mirror of https://lore.kernel.org/lkml/
 help / color / mirror / Atom feed
* Linux 6.1.103
@ 2024-08-03  7:05 Greg Kroah-Hartman
  2024-08-03  7:05 ` Greg Kroah-Hartman
  0 siblings, 1 reply; 2+ messages in thread
From: Greg Kroah-Hartman @ 2024-08-03  7:05 UTC (permalink / raw)
  To: linux-kernel, akpm, torvalds, stable; +Cc: lwn, jslaby, Greg Kroah-Hartman

I'm announcing the release of the 6.1.103 kernel.

All users of the 6.1 kernel series must upgrade.

The updated 6.1.y git tree can be found at:
	git://git.kernel.org/pub/scm/linux/kernel/git/stable/linux-stable.git linux-6.1.y
and can be browsed at the normal kernel.org git web browser:
	https://git.kernel.org/?p=linux/kernel/git/stable/linux-stable.git;a=summary

thanks,

greg k-h

------------

 Documentation/devicetree/bindings/thermal/thermal-zones.yaml      |    5 
 Makefile                                                          |    2 
 arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi                       |   23 
 arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi                     |   14 
 arch/arm/mach-pxa/spitz.c                                         |   30 
 arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi                       |    4 
 arch/arm64/boot/dts/amlogic/meson-gxl.dtsi                        |    4 
 arch/arm64/boot/dts/amlogic/meson-sm1.dtsi                        |    4 
 arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts          |    4 
 arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts                      |    4 
 arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi            |   25 
 arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi                    |    2 
 arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi               |    1 
 arch/arm64/boot/dts/qcom/msm8996.dtsi                             |    2 
 arch/arm64/boot/dts/qcom/msm8998.dtsi                             |    1 
 arch/arm64/boot/dts/qcom/sdm845.dtsi                              |    2 
 arch/arm64/boot/dts/qcom/sm6350.dtsi                              |    4 
 arch/arm64/boot/dts/qcom/sm8250.dtsi                              |   22 
 arch/arm64/boot/dts/qcom/sm8450.dtsi                              |    2 
 arch/arm64/boot/dts/renesas/r8a779a0.dtsi                         |   14 
 arch/arm64/boot/dts/renesas/r8a779f0.dtsi                         |   14 
 arch/arm64/boot/dts/renesas/r8a779g0.dtsi                         |   82 +
 arch/arm64/boot/dts/renesas/r9a07g043u.dtsi                       |   11 
 arch/arm64/boot/dts/renesas/r9a07g044.dtsi                        |   11 
 arch/arm64/boot/dts/renesas/r9a07g044c1.dtsi                      |    7 
 arch/arm64/boot/dts/renesas/r9a07g044l1.dtsi                      |    7 
 arch/arm64/boot/dts/renesas/r9a07g054.dtsi                        |   11 
 arch/arm64/boot/dts/renesas/r9a07g054l1.dtsi                      |    7 
 arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts                 |   71 
 arch/arm64/boot/dts/rockchip/rk3328.dtsi                          |    4 
 arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts                  |    2 
 arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts                   |    4 
 arch/arm64/boot/dts/rockchip/rk356x.dtsi                          |    1 
 arch/m68k/amiga/config.c                                          |    9 
 arch/m68k/atari/ataints.c                                         |    6 
 arch/m68k/include/asm/cmpxchg.h                                   |    2 
 arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi                |   21 
 arch/mips/include/asm/mach-loongson64/boot_param.h                |    2 
 arch/mips/include/asm/mips-cm.h                                   |    4 
 arch/mips/kernel/smp-cps.c                                        |    5 
 arch/mips/loongson64/env.c                                        |    8 
 arch/mips/loongson64/reset.c                                      |   38 
 arch/mips/loongson64/smp.c                                        |   23 
 arch/mips/sgi-ip30/ip30-console.c                                 |    1 
 arch/parisc/Kconfig                                               |    1 
 arch/powerpc/configs/85xx-hw.config                               |    2 
 arch/powerpc/include/asm/kexec.h                                  |    4 
 arch/powerpc/include/asm/plpks.h                                  |  163 ++
 arch/powerpc/kernel/prom.c                                        |   12 
 arch/powerpc/kexec/core_64.c                                      |  112 +
 arch/powerpc/kexec/file_load_64.c                                 |   87 -
 arch/powerpc/kvm/powerpc.c                                        |    4 
 arch/powerpc/platforms/pseries/plpks.c                            |  171 ++
 arch/powerpc/platforms/pseries/plpks.h                            |   96 -
 arch/powerpc/xmon/ppc-dis.c                                       |   33 
 arch/s390/kernel/uv.c                                             |   58 
 arch/s390/pci/pci_irq.c                                           |  110 -
 arch/sparc/include/asm/oplib_64.h                                 |    1 
 arch/sparc/prom/init_64.c                                         |    3 
 arch/sparc/prom/p1275.c                                           |    2 
 arch/um/drivers/ubd_kern.c                                        |   50 
 arch/um/kernel/time.c                                             |    4 
 arch/um/os-Linux/signal.c                                         |  118 +
 arch/x86/events/core.c                                            |    3 
 arch/x86/events/intel/cstate.c                                    |    7 
 arch/x86/events/intel/pt.c                                        |    4 
 arch/x86/events/intel/pt.h                                        |    4 
 arch/x86/events/intel/uncore_snbep.c                              |    6 
 arch/x86/include/asm/kvm_host.h                                   |    2 
 arch/x86/kernel/devicetree.c                                      |    2 
 arch/x86/kvm/vmx/nested.c                                         |    2 
 arch/x86/kvm/vmx/vmx.c                                            |   11 
 arch/x86/kvm/vmx/vmx.h                                            |    1 
 arch/x86/kvm/x86.c                                                |    4 
 arch/x86/pci/intel_mid_pci.c                                      |    4 
 arch/x86/pci/xen.c                                                |    4 
 arch/x86/platform/intel/iosf_mbi.c                                |    4 
 arch/x86/xen/p2m.c                                                |    4 
 block/bio-integrity.c                                             |   21 
 drivers/android/binder.c                                          |    4 
 drivers/ata/libata-scsi.c                                         |    7 
 drivers/auxdisplay/ht16k33.c                                      |    1 
 drivers/base/devres.c                                             |   11 
 drivers/block/rbd.c                                               |   35 
 drivers/bluetooth/btusb.c                                         |    4 
 drivers/char/hw_random/amd-rng.c                                  |    4 
 drivers/char/tpm/eventlog/common.c                                |    2 
 drivers/clk/clk-en7523.c                                          |    9 
 drivers/clk/davinci/da8xx-cfgchip.c                               |    4 
 drivers/clk/qcom/camcc-sc7280.c                                   |    5 
 drivers/clk/qcom/clk-branch.h                                     |   26 
 drivers/clk/qcom/clk-rcg2.c                                       |   32 
 drivers/clk/qcom/gcc-sc7280.c                                     |    3 
 drivers/clk/qcom/gpucc-sm8350.c                                   |    5 
 drivers/cpufreq/ti-cpufreq.c                                      |    2 
 drivers/crypto/qat/qat_common/adf_cfg.c                           |    6 
 drivers/dma/ti/k3-udma.c                                          |    4 
 drivers/edac/Makefile                                             |   10 
 drivers/edac/skx_common.c                                         |   21 
 drivers/edac/skx_common.h                                         |    4 
 drivers/firmware/efi/libstub/x86-stub.c                           |   25 
 drivers/firmware/turris-mox-rwtm.c                                |   23 
 drivers/gpu/drm/amd/amdgpu/amdgpu_device.c                        |    2 
 drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c                           |    1 
 drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c                            |   12 
 drivers/gpu/drm/amd/display/dc/core/dc_surface.c                  |    3 
 drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c                    |    4 
 drivers/gpu/drm/display/drm_dp_mst_topology.c                     |    4 
 drivers/gpu/drm/etnaviv/etnaviv_gem.c                             |    6 
 drivers/gpu/drm/etnaviv/etnaviv_sched.c                           |    9 
 drivers/gpu/drm/gma500/cdv_intel_lvds.c                           |    3 
 drivers/gpu/drm/gma500/psb_intel_lvds.c                           |    3 
 drivers/gpu/drm/i915/display/intel_dp.c                           |    2 
 drivers/gpu/drm/i915/gt/intel_execlists_submission.c              |    6 
 drivers/gpu/drm/mediatek/mtk_drm_drv.c                            |    2 
 drivers/gpu/drm/mediatek/mtk_drm_plane.c                          |    2 
 drivers/gpu/drm/meson/meson_drv.c                                 |   37 
 drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c                       |    3 
 drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c               |    3 
 drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h                        |    3 
 drivers/gpu/drm/msm/dsi/dsi_host.c                                |    3 
 drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c                    |    8 
 drivers/gpu/drm/panfrost/panfrost_drv.c                           |    1 
 drivers/gpu/drm/qxl/qxl_display.c                                 |    3 
 drivers/gpu/drm/rockchip/rockchip_drm_vop2.c                      |    2 
 drivers/hwmon/adt7475.c                                           |    2 
 drivers/hwmon/max6697.c                                           |    5 
 drivers/hwtracing/coresight/coresight-platform.c                  |    4 
 drivers/iio/frequency/adrf6780.c                                  |    1 
 drivers/infiniband/core/cache.c                                   |   14 
 drivers/infiniband/core/device.c                                  |    6 
 drivers/infiniband/core/iwcm.c                                    |   11 
 drivers/infiniband/hw/bnxt_re/ib_verbs.c                          |    8 
 drivers/infiniband/hw/bnxt_re/qplib_fp.h                          |    6 
 drivers/infiniband/hw/hns/hns_roce_device.h                       |    6 
 drivers/infiniband/hw/hns/hns_roce_hw_v2.c                        |   40 
 drivers/infiniband/hw/hns/hns_roce_mr.c                           |    5 
 drivers/infiniband/hw/hns/hns_roce_qp.c                           |    4 
 drivers/infiniband/hw/hns/hns_roce_srq.c                          |    2 
 drivers/infiniband/hw/mlx4/alias_GUID.c                           |    2 
 drivers/infiniband/hw/mlx4/mad.c                                  |    2 
 drivers/infiniband/hw/mlx5/mlx5_ib.h                              |   13 
 drivers/infiniband/hw/mlx5/odp.c                                  |    6 
 drivers/infiniband/sw/rxe/rxe_req.c                               |    7 
 drivers/input/keyboard/qt1050.c                                   |    7 
 drivers/input/mouse/elan_i2c_core.c                               |    2 
 drivers/interconnect/qcom/qcm2290.c                               |    2 
 drivers/iommu/intel/iommu.c                                       |   22 
 drivers/iommu/sprd-iommu.c                                        |    2 
 drivers/irqchip/irq-imx-irqsteer.c                                |   24 
 drivers/isdn/hardware/mISDN/hfcmulti.c                            |    7 
 drivers/leds/flash/leds-mt6360.c                                  |    5 
 drivers/leds/led-class.c                                          |    1 
 drivers/leds/led-triggers.c                                       |    2 
 drivers/leds/leds-ss4200.c                                        |    7 
 drivers/macintosh/therm_windtunnel.c                              |    2 
 drivers/md/dm-verity-target.c                                     |   16 
 drivers/md/md.c                                                   |   26 
 drivers/media/i2c/imx412.c                                        |    9 
 drivers/media/pci/ivtv/ivtv-udma.c                                |    8 
 drivers/media/pci/ivtv/ivtv-yuv.c                                 |    6 
 drivers/media/pci/ivtv/ivtvfb.c                                   |    6 
 drivers/media/pci/saa7134/saa7134-dvb.c                           |    8 
 drivers/media/platform/qcom/venus/vdec.c                          |    3 
 drivers/media/platform/renesas/rcar-vin/rcar-csi2.c               |    5 
 drivers/media/platform/renesas/rcar-vin/rcar-dma.c                |   16 
 drivers/media/platform/renesas/vsp1/vsp1_histo.c                  |   20 
 drivers/media/platform/renesas/vsp1/vsp1_pipe.h                   |    2 
 drivers/media/platform/renesas/vsp1/vsp1_rpf.c                    |    8 
 drivers/media/rc/imon.c                                           |    5 
 drivers/media/rc/lirc_dev.c                                       |    4 
 drivers/media/usb/dvb-usb/dvb-usb-init.c                          |   35 
 drivers/media/usb/uvc/uvc_ctrl.c                                  |    9 
 drivers/media/usb/uvc/uvc_video.c                                 |   10 
 drivers/media/v4l2-core/v4l2-async.c                              |    3 
 drivers/memory/Kconfig                                            |    2 
 drivers/mfd/Makefile                                              |    6 
 drivers/mfd/omap-usb-tll.c                                        |    3 
 drivers/mfd/rsmu_core.c                                           |    2 
 drivers/mtd/nand/raw/Kconfig                                      |    3 
 drivers/mtd/tests/Makefile                                        |   34 
 drivers/mtd/tests/mtd_test.c                                      |    9 
 drivers/mtd/ubi/eba.c                                             |    3 
 drivers/net/bonding/bond_main.c                                   |    7 
 drivers/net/dsa/b53/b53_common.c                                  |    3 
 drivers/net/dsa/mv88e6xxx/chip.c                                  |    3 
 drivers/net/ethernet/brocade/bna/bna_types.h                      |    2 
 drivers/net/ethernet/brocade/bna/bnad.c                           |   11 
 drivers/net/ethernet/freescale/fec_main.c                         |   52 
 drivers/net/ethernet/google/gve/gve_tx_dqo.c                      |   22 
 drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c                 |    2 
 drivers/net/ethernet/intel/ice/ice_fdir.h                         |    3 
 drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c                |   16 
 drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h                |    1 
 drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c          |   18 
 drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c   |    2 
 drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c            |   13 
 drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h           |    9 
 drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c                 |    2 
 drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c               |    2 
 drivers/net/ethernet/stmicro/stmmac/hwif.h                        |    2 
 drivers/net/ethernet/stmicro/stmmac/stmmac_main.c                 |    4 
 drivers/net/netconsole.c                                          |    2 
 drivers/net/wireless/ath/ath11k/dp_rx.c                           |    3 
 drivers/net/wireless/ath/ath11k/dp_rx.h                           |    3 
 drivers/net/wireless/ath/ath11k/mac.c                             |   15 
 drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c    |   18 
 drivers/net/wireless/marvell/mwifiex/cfg80211.c                   |    2 
 drivers/net/wireless/realtek/rtw89/debug.c                        |    2 
 drivers/net/wireless/virt_wifi.c                                  |   20 
 drivers/nvme/host/pci.c                                           |    5 
 drivers/nvme/target/auth.c                                        |   14 
 drivers/opp/ti-opp-supply.c                                       |    6 
 drivers/parport/procfs.c                                          |   24 
 drivers/pci/controller/dwc/pci-keystone.c                         |  156 +-
 drivers/pci/controller/dwc/pcie-designware-ep.c                   |   13 
 drivers/pci/controller/dwc/pcie-dw-rockchip.c                     |    2 
 drivers/pci/controller/dwc/pcie-qcom-ep.c                         |    6 
 drivers/pci/controller/pci-hyperv.c                               |    4 
 drivers/pci/controller/pci-loongson.c                             |   13 
 drivers/pci/controller/pcie-rcar-host.c                           |    6 
 drivers/pci/controller/pcie-rockchip.c                            |    2 
 drivers/pci/endpoint/functions/pci-epf-vntb.c                     |   19 
 drivers/pci/pci.c                                                 |    6 
 drivers/pci/setup-bus.c                                           |    6 
 drivers/phy/cadence/phy-cadence-torrent.c                         |    3 
 drivers/pinctrl/core.c                                            |   12 
 drivers/pinctrl/freescale/pinctrl-mxs.c                           |    4 
 drivers/pinctrl/pinctrl-rockchip.c                                |   17 
 drivers/pinctrl/pinctrl-single.c                                  |    7 
 drivers/pinctrl/renesas/pfc-r8a779g0.c                            |  712 ++++------
 drivers/pinctrl/ti/pinctrl-ti-iodelay.c                           |   14 
 drivers/platform/chrome/cros_ec_debugfs.c                         |    1 
 drivers/platform/mips/cpu_hwmon.c                                 |    3 
 drivers/pwm/pwm-atmel-tcb.c                                       |   66 
 drivers/pwm/pwm-stm32.c                                           |    5 
 drivers/remoteproc/imx_rproc.c                                    |   10 
 drivers/remoteproc/stm32_rproc.c                                  |    2 
 drivers/rtc/interface.c                                           |    9 
 drivers/rtc/rtc-cmos.c                                            |   10 
 drivers/rtc/rtc-isl1208.c                                         |   11 
 drivers/s390/block/dasd_devmap.c                                  |   10 
 drivers/scsi/qla2xxx/qla_bsg.c                                    |   98 -
 drivers/scsi/qla2xxx/qla_def.h                                    |    3 
 drivers/scsi/qla2xxx/qla_gs.c                                     |   35 
 drivers/scsi/qla2xxx/qla_init.c                                   |   87 -
 drivers/scsi/qla2xxx/qla_inline.h                                 |    8 
 drivers/scsi/qla2xxx/qla_mid.c                                    |    2 
 drivers/scsi/qla2xxx/qla_nvme.c                                   |    5 
 drivers/scsi/qla2xxx/qla_os.c                                     |    7 
 drivers/scsi/qla2xxx/qla_sup.c                                    |  108 +
 drivers/soc/qcom/pdr_interface.c                                  |    8 
 drivers/soc/qcom/rpmh-rsc.c                                       |    7 
 drivers/soc/qcom/rpmh.c                                           |    1 
 drivers/soc/xilinx/xlnx_event_manager.c                           |   15 
 drivers/soc/xilinx/zynqmp_power.c                                 |    4 
 drivers/spi/atmel-quadspi.c                                       |   11 
 drivers/spi/spi-microchip-core.c                                  |  188 +-
 drivers/spi/spidev.c                                              |   11 
 drivers/vhost/vsock.c                                             |    4 
 drivers/watchdog/rzg2l_wdt.c                                      |   22 
 fs/ceph/super.c                                                   |    3 
 fs/ext2/balloc.c                                                  |   11 
 fs/ext4/extents_status.c                                          |    2 
 fs/ext4/fast_commit.c                                             |    6 
 fs/ext4/namei.c                                                   |   73 -
 fs/ext4/xattr.c                                                   |    6 
 fs/f2fs/checkpoint.c                                              |   10 
 fs/f2fs/file.c                                                    |    2 
 fs/f2fs/inline.c                                                  |    6 
 fs/f2fs/inode.c                                                   |    3 
 fs/f2fs/segment.h                                                 |    3 
 fs/fuse/inode.c                                                   |   24 
 fs/hfs/inode.c                                                    |    3 
 fs/hfsplus/bfind.c                                                |   15 
 fs/hfsplus/extents.c                                              |    9 
 fs/hfsplus/hfsplus_fs.h                                           |   21 
 fs/jbd2/commit.c                                                  |    2 
 fs/jbd2/journal.c                                                 |    5 
 fs/jfs/jfs_imap.c                                                 |    5 
 fs/kernfs/dir.c                                                   |  112 -
 fs/kernfs/file.c                                                  |   18 
 fs/kernfs/inode.c                                                 |    8 
 fs/kernfs/kernfs-internal.h                                       |    2 
 fs/kernfs/mount.c                                                 |   10 
 fs/kernfs/symlink.c                                               |    2 
 fs/nfs/nfs4client.c                                               |    6 
 fs/nfs/nfs4proc.c                                                 |    2 
 fs/nilfs2/btnode.c                                                |   25 
 fs/nilfs2/btree.c                                                 |    4 
 fs/nilfs2/segment.c                                               |    2 
 fs/ntfs3/attrib.c                                                 |   17 
 fs/ntfs3/bitmap.c                                                 |    2 
 fs/ntfs3/dir.c                                                    |    3 
 fs/ntfs3/file.c                                                   |    5 
 fs/ntfs3/frecord.c                                                |    2 
 fs/ntfs3/fslog.c                                                  |    5 
 fs/ntfs3/fsntfs.c                                                 |    2 
 fs/ntfs3/index.c                                                  |    4 
 fs/ntfs3/inode.c                                                  |    3 
 fs/ntfs3/ntfs.h                                                   |   13 
 fs/ntfs3/ntfs_fs.h                                                |    2 
 fs/proc/task_mmu.c                                                |    2 
 fs/smb/client/cifsfs.c                                            |    8 
 fs/smb/client/connect.c                                           |   24 
 fs/super.c                                                        |   11 
 fs/udf/balloc.c                                                   |   15 
 fs/udf/super.c                                                    |    3 
 include/asm-generic/vmlinux.lds.h                                 |    2 
 include/drm/drm_mipi_dsi.h                                        |   21 
 include/linux/bpf_verifier.h                                      |    2 
 include/linux/hugetlb.h                                           |    1 
 include/linux/jbd2.h                                              |    5 
 include/linux/jump_label.h                                        |   21 
 include/linux/mlx5/qp.h                                           |    9 
 include/linux/objagg.h                                            |    1 
 include/linux/pci.h                                               |    2 
 include/linux/perf_event.h                                        |    1 
 include/linux/sbitmap.h                                           |    5 
 include/linux/task_work.h                                         |    3 
 include/linux/virtio_net.h                                        |   11 
 include/net/ip_fib.h                                              |    1 
 include/net/tcp.h                                                 |    1 
 include/trace/events/rpcgss.h                                     |    2 
 include/uapi/linux/netfilter/nf_tables.h                          |    2 
 include/uapi/linux/zorro_ids.h                                    |    3 
 io_uring/io-wq.c                                                  |   10 
 io_uring/io_uring.c                                               |    5 
 io_uring/timeout.c                                                |    2 
 kernel/bpf/btf.c                                                  |   10 
 kernel/bpf/dispatcher.c                                           |    5 
 kernel/cgroup/cgroup-v1.c                                         |    2 
 kernel/cgroup/cgroup.c                                            |    4 
 kernel/cgroup/cpuset.c                                            |   15 
 kernel/debug/kdb/kdb_io.c                                         |    6 
 kernel/dma/mapping.c                                              |    2 
 kernel/events/core.c                                              |   79 -
 kernel/events/internal.h                                          |    2 
 kernel/events/ring_buffer.c                                       |    4 
 kernel/irq/manage.c                                               |    2 
 kernel/jump_label.c                                               |  101 -
 kernel/locking/rwsem.c                                            |    6 
 kernel/rcu/tasks.h                                                |   10 
 kernel/sched/core.c                                               |   37 
 kernel/sched/fair.c                                               |    9 
 kernel/sched/sched.h                                              |    2 
 kernel/signal.c                                                   |    8 
 kernel/task_work.c                                                |   34 
 kernel/time/tick-broadcast.c                                      |   23 
 kernel/trace/pid_list.c                                           |    4 
 kernel/watchdog_hld.c                                             |   11 
 lib/decompress_bunzip2.c                                          |    3 
 lib/kobject_uevent.c                                              |   17 
 lib/objagg.c                                                      |   18 
 lib/sbitmap.c                                                     |   83 -
 mm/hugetlb.c                                                      |    2 
 mm/mempolicy.c                                                    |   18 
 mm/mmap_lock.c                                                    |  175 --
 mm/vmscan.c                                                       |    1 
 net/bridge/br_forward.c                                           |    4 
 net/core/filter.c                                                 |   15 
 net/core/flow_dissector.c                                         |    2 
 net/core/xdp.c                                                    |    4 
 net/ipv4/esp4.c                                                   |    3 
 net/ipv4/fib_semantics.c                                          |   13 
 net/ipv4/fib_trie.c                                               |    1 
 net/ipv4/nexthop.c                                                |    7 
 net/ipv4/route.c                                                  |   18 
 net/ipv4/tcp.c                                                    |   13 
 net/ipv4/tcp_input.c                                              |   34 
 net/ipv4/tcp_ipv4.c                                               |   19 
 net/ipv4/tcp_output.c                                             |    2 
 net/ipv4/tcp_timer.c                                              |   10 
 net/ipv6/addrconf.c                                               |    3 
 net/ipv6/esp6.c                                                   |    3 
 net/ipv6/tcp_ipv6.c                                               |   19 
 net/mac80211/cfg.c                                                |   23 
 net/mac80211/ieee80211_i.h                                        |    2 
 net/mac80211/rate.c                                               |    2 
 net/mac80211/sta_info.h                                           |    6 
 net/mac80211/vht.c                                                |   37 
 net/netfilter/ipvs/ip_vs_proto_sctp.c                             |    4 
 net/netfilter/nf_conntrack_netlink.c                              |    3 
 net/netfilter/nft_set_pipapo.c                                    |   22 
 net/netfilter/nft_set_pipapo.h                                    |   27 
 net/netfilter/nft_set_pipapo_avx2.c                               |   81 -
 net/packet/af_packet.c                                            |   86 +
 net/smc/smc_core.c                                                |    5 
 net/sunrpc/auth_gss/gss_krb5_keys.c                               |    2 
 net/sunrpc/clnt.c                                                 |    3 
 net/sunrpc/xprtrdma/frwr_ops.c                                    |    3 
 net/sunrpc/xprtrdma/verbs.c                                       |   16 
 net/tipc/udp_media.c                                              |    5 
 net/unix/af_unix.c                                                |   41 
 net/unix/unix_bpf.c                                               |    3 
 net/wireless/util.c                                               |    8 
 scripts/Makefile.lib                                              |    6 
 scripts/gcc-x86_32-has-stack-protector.sh                         |    2 
 scripts/gcc-x86_64-has-stack-protector.sh                         |    2 
 security/apparmor/lsm.c                                           |    7 
 security/apparmor/policy.c                                        |    2 
 security/apparmor/policy_unpack.c                                 |    1 
 security/keys/keyctl.c                                            |    2 
 security/landlock/cred.c                                          |   11 
 sound/soc/amd/acp-es8336.c                                        |    4 
 sound/soc/amd/yc/acp6x-mach.c                                     |    7 
 sound/soc/codecs/max98088.c                                       |   10 
 sound/soc/intel/common/soc-intel-quirks.h                         |    2 
 sound/soc/qcom/lpass-cpu.c                                        |    4 
 sound/soc/sof/imx/imx8m.c                                         |    2 
 sound/usb/mixer.c                                                 |    7 
 sound/usb/quirks.c                                                |    4 
 tools/bpf/bpftool/common.c                                        |    2 
 tools/bpf/bpftool/prog.c                                          |    4 
 tools/bpf/resolve_btfids/main.c                                   |    2 
 tools/lib/bpf/btf_dump.c                                          |    8 
 tools/lib/bpf/linker.c                                            |   11 
 tools/memory-model/lock.cat                                       |   20 
 tools/perf/arch/x86/util/intel-pt.c                               |   15 
 tools/perf/tests/shell/test_arm_callgraph_fp.sh                   |   64 
 tools/perf/tests/workloads/leafloop.c                             |   20 
 tools/perf/util/sort.c                                            |    2 
 tools/testing/selftests/bpf/prog_tests/sk_lookup.c                |    2 
 tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c          |    2 
 tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c   |    4 
 tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c     |    4 
 tools/testing/selftests/bpf/test_sockmap.c                        |    9 
 tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh |   55 
 tools/testing/selftests/landlock/base_test.c                      |   74 +
 tools/testing/selftests/landlock/config                           |    5 
 tools/testing/selftests/net/fib_tests.sh                          |   24 
 tools/testing/selftests/net/forwarding/devlink_lib.sh             |    2 
 tools/testing/selftests/sigaltstack/current_stack_pointer.h       |    2 
 433 files changed, 4242 insertions(+), 2567 deletions(-)

Abhinav Kumar (1):
      drm/msm/dpu: drop validity checks for clear_pending_flush() ctl op

Adrian Hunter (7):
      perf/x86/intel/pt: Fix pt_topa_entry_for_page() address calculation
      perf: Fix perf_aux_size() for greater-than 32-bit size
      perf: Prevent passing zero nr_pages to rb_alloc_aux()
      perf: Fix default aux_watermark calculation
      perf intel-pt: Fix aux_watermark calculation for 64-bit size
      perf intel-pt: Fix exclude_guest setting
      perf/x86/intel/pt: Fix a topa_entry base address calculation

Ahmed Zaki (1):
      ice: Add a per-VF limit on number of FDIR filters

Al Viro (2):
      powerpc: fix a file leak in kvm_vcpu_ioctl_enable_cap()
      lirc: rc_dev_get_from_fd(): fix file leak

Alan Maguire (2):
      bpf: annotate BTF show functions with __printf
      bpf: Eliminate remaining "make W=1" warnings in kernel/bpf/btf.o

Alan Stern (1):
      tools/memory-model: Fix bug in lock.cat

Aleksandr Burakov (1):
      saa7134: Unchecked i2c_transfer function result fixed

Aleksandr Mishin (6):
      wifi: rtw89: Fix array index mistake in rtw89_sta_info_get_iter()
      PCI: keystone: Fix NULL pointer dereference in case of DT error in ks_pcie_setup_rc_app_regs()
      ASoC: qcom: Adjust issues in case of DT error in asoc_qcom_lpass_cpu_platform_probe()
      ASoC: amd: Adjust error handling in case of absent codec device
      remoteproc: imx_rproc: Skip over memory region when node value is NULL
      remoteproc: imx_rproc: Fix refcount mistake in imx_rproc_addr_init

Alex Deucher (1):
      drm/amdgpu/sdma5.2: Update wptr registers as well as doorbell

Alexey Kodanev (1):
      bna: adjust 'name' buf size of bna_tcb and bna_ccb structures

Amit Cohen (1):
      selftests: forwarding: devlink_lib: Wait for udev events after reloading

Andreas Larsson (1):
      sparc64: Fix incorrect function signature and add prototype for prom_cif_init

Andrei Lalaev (1):
      Input: qt1050 - handle CHIP_ID reading error

Andrew Donnellan (1):
      powerpc/pseries: Fix alignment of PLPKS structures and buffers

Andrii Nakryiko (1):
      libbpf: Fix no-args func prototype BTF dumping syntax

Andy Yan (1):
      drm/rockchip: vop2: Fix the port mux of VP2

Antoniu Miclaus (1):
      iio: frequency: adrf6780: rm clk provider include

Ard Biesheuvel (2):
      x86/efistub: Avoid returning EFI_SUCCESS on error
      x86/efistub: Revert to heap allocated boot_params for PE entrypoint

Arnd Bergmann (4):
      EDAC, i10nm: make skx_common.o a separate module
      mfd: rsmu: Split core code into separate module
      mtd: make mtd_test.c a separate module
      kdb: address -Wformat-security warnings

Artem Chernyshev (1):
      iommu: sprd: Avoid NULL deref in sprd_iommu_hw_en

Bailey Forrest (1):
      gve: Fix an edge case for TSO skb validity check

Baochen Qiang (3):
      wifi: ath11k: fix wrong handling of CCMP256 and GCMP ciphers
      wifi: cfg80211: fix typo in cfg80211_calculate_bitrate_he()
      wifi: cfg80211: handle 2x996 RU allocation in cfg80211_calculate_bitrate_he()

Baokun Li (2):
      ext4: check dot and dotdot of dx_root before making dir indexed
      ext4: make sure the first directory block is not a hole

Bart Van Assche (2):
      RDMA/iwcm: Fix a use-after-free related to destroying CM IDs
      nvme-pci: Fix the instructions for disabling power management

Bastien Curutchet (1):
      clk: davinci: da8xx-cfgchip: Initialize clk_init_data before use

Benjamin Coddington (1):
      SUNRPC: Fixup gss_status tracepoint error output

Breno Leitao (1):
      net: netconsole: Disable target before netpoll cleanup

Bryan O'Donoghue (1):
      media: i2c: Fix imx412 exposure control

Carlos Llamas (1):
      binder: fix hang of unregistered readers

Carlos López (1):
      s390/dasd: fix error checks in dasd_copy_pair_store()

Chao Yu (6):
      hfsplus: fix to avoid false alarm of circular locking
      hfs: fix to initialize fields of hfs_inode_info after hfs_alloc_inode()
      f2fs: fix to force buffered IO on inline_data inode
      f2fs: fix to don't dirty inode for readonly filesystem
      f2fs: fix return value of f2fs_convert_inline_inode()
      f2fs: fix to update user block counts in block_operations()

Chen Ni (4):
      spi: atmel-quadspi: Add missing check for clk_prepare
      x86/xen: Convert comma to semicolon
      drm/qxl: Add check for drm_cvt_mode
      ASoC: max98088: Check for clk_prepare_enable() error

Chen Ridong (1):
      cgroup/cpuset: Prevent UAF in proc_cpuset_show()

Chen-Yu Tsai (2):
      arm64: dts: mediatek: mt8183-kukui: Drop bogus output-enable property
      arm64: dts: mediatek: mt8183-kukui-jacuzzi: Add ports node for anx7625

Chengchang Tang (4):
      RDMA/hns: Fix missing pagesize and alignment check in FRMR
      RDMA/hns: Fix shift-out-bounds when max_inline_data is 0
      RDMA/hns: Fix undifined behavior caused by invalid max_sge
      RDMA/hns: Fix insufficient extend DB for VFs.

Chengen Du (1):
      af_packet: Handle outgoing VLAN packets without hardware offloading

ChiYuan Huang (1):
      media: v4l: async: Fix NULL pointer dereference in adding ancillary links

Chiara Meiohas (1):
      RDMA/mlx5: Set mkeys for dmabuf at PAGE_SIZE

Christoph Hellwig (3):
      ubd: refactor the interrupt handler
      ubd: untagle discard vs write zeroes not support handling
      block: initialize integrity buffer to zero before writing it to media

Christophe Leroy (1):
      vmlinux.lds.h: catch .bss..L* sections into BSS")

Chuck Lever (1):
      xprtrdma: Fix rpcrdma_reqs_reset()

Claudiu Beznea (2):
      watchdog: rzg2l_wdt: Use pm_runtime_resume_and_get()
      watchdog: rzg2l_wdt: Check return status of pm_runtime_put()

Conor Dooley (1):
      spi: spidev: add correct compatible for Rohm BH2228FV

Cristian Ciocaltea (3):
      arm64: dts: rockchip: Drop invalid mic-in-differential on rk3568-rock-3a
      arm64: dts: rockchip: Fix mic-in-differential usage on rk3568-evb1-v10
      arm64: dts: rockchip: Add missing power-domains for rk356x vop_mmu

Csókás Bence (1):
      net: fec: Refactor: #define magic constants

Csókás, Bence (2):
      net: fec: Fix FEC_ECR_EN1588 being cleared on link-down
      rtc: interface: Add RTC offset to alarm after fix-up

Dan Carpenter (3):
      PCI: endpoint: Clean up error handling in vpci_scan_bus()
      PCI: endpoint: Fix error handling in epf_ntb_epc_cleanup()
      mISDN: Fix a use after free in hfcmulti_tx()

Daniel Baluta (1):
      ASoC: SOF: imx8m: Fix DSP control regmap retrieval

Daniel Schaefer (1):
      media: uvcvideo: Override default flags

David Hildenbrand (2):
      s390/uv: Don't call folio_wait_writeback() without a folio reference
      fs/proc/task_mmu: indicate PM_FILE for PMD-mapped file THP

Denis Arefev (1):
      net: missing check virtio

Dikshita Agarwal (2):
      media: venus: flush all buffers in output plane streamoff
      media: venus: fix use after free in vdec_close

Dmitry Baryshkov (9):
      arm64: dts: qcom: sdm845: add power-domain to UFS PHY
      arm64: dts: qcom: sm6350: add power-domain to UFS PHY
      arm64: dts: qcom: sm8250: switch UFS QMP PHY to new style of bindings
      arm64: dts: qcom: sm8250: add power-domain to UFS PHY
      arm64: dts: qcom: sm8450: add power-domain to UFS PHY
      arm64: dts: qcom: msm8996-xiaomi-common: drop excton from the USB PHY
      arm64: dts: qcom: msm8996: specify UFS core_clk frequencies
      soc: qcom: pdr: protect locator_addr with the main mutex
      soc: qcom: pdr: fix parsing of domains lists

Dmitry Safonov (1):
      jump_label: Prevent key->enabled int overflow

Dmitry Torokhov (2):
      ARM: spitz: fix GPIO assignment for backlight
      Input: elan_i2c - do not leave interrupt disabled on suspend failure

Dmitry Yashin (1):
      pinctrl: rockchip: update rk3308 iomux routes

Dominique Martinet (1):
      MIPS: Octeron: remove source file executable bit

Donglin Peng (1):
      libbpf: Checking the btf_type kind when fixing variable offsets

Douglas Anderson (4):
      drm/mipi-dsi: Fix theoretical int overflow in mipi_dsi_dcs_write_seq()
      drm/panel: boe-tv101wum-nl6: If prepare fails, disable GPIO before regulators
      drm/panel: boe-tv101wum-nl6: Check for errors on the NOP in prepare()
      kdb: Use the passed prompt in kdb_position_cursor()

Dragan Simic (1):
      drm/panfrost: Mark simple_ondemand governor as softdep

Eero Tamminen (1):
      m68k: atari: Fix TT bootup freeze / unexpected (SCU) interrupt messages

Elliot Ayrey (1):
      net: bridge: mst: Check vlan state for egress decision

En-Wei Wu (1):
      wifi: virt_wifi: avoid reporting connection success with wrong SSID

Eric Biggers (1):
      dm-verity: fix dm_is_verity_target() when dm-verity is builtin

Eric Dumazet (5):
      tcp: annotate lockless accesses to sk->sk_err_soft
      tcp: annotate lockless access to sk->sk_err
      tcp: add tcp_done_with_error() helper
      tcp: fix race in tcp_write_err()
      tcp: fix races in tcp_v[46]_err()

Eric Sandeen (1):
      fuse: verify {g,u}id mount options correctly

Esben Haabendal (2):
      powerpc/configs: Update defconfig with now user-visible CONFIG_FSL_IFC
      memory: fsl_ifc: Make FSL_IFC config visible and selectable

Fedor Pchelkin (2):
      apparmor: use kvfree_sensitive to free data->data
      ubi: eba: properly rollback inside self_check_eba

Florian Westphal (3):
      netfilter: nft_set_pipapo: constify lookup fn args where possible
      netfilter: nf_set_pipapo: fix initial map fill
      netfilter: nft_set_pipapo_avx2: disable softinterrupts

Frank Li (1):
      PCI: dwc: Fix index 0 incorrectly being interpreted as a free ATU slot

Fred Li (1):
      bpf: Fix a segment issue when downgrading gso_size

Frederic Weisbecker (5):
      rcu/tasks: Fix stale task snaphot for Tasks Trace
      task_work: s/task_work_cancel()/task_work_cancel_func()/
      task_work: Introduce task_work_cancel() again
      perf: Fix event leak upon exit
      perf: Fix event leak upon exec and file release

Friedrich Vock (1):
      drm/amdgpu: Check if NBIO funcs are NULL in amdgpu_device_baco_exit

Gaosheng Cui (2):
      nvmet-auth: fix nvmet_auth hash error handling
      gss_krb5: Fix the error handling path for crypto_sync_skcipher_setkey

Geert Uytterhoeven (16):
      arm64: dts: renesas: r8a779g0: Add L3 cache controller
      arm64: dts: renesas: r8a779g0: Add secondary CA76 CPU cores
      arm64: dts: renesas: r8a779a0: Add missing hypervisor virtual timer IRQ
      arm64: dts: renesas: r8a779f0: Add missing hypervisor virtual timer IRQ
      arm64: dts: renesas: r8a779g0: Add missing hypervisor virtual timer IRQ
      arm64: dts: renesas: r9a07g043u: Add missing hypervisor virtual timer IRQ
      arm64: dts: renesas: r9a07g044: Add missing hypervisor virtual timer IRQ
      arm64: dts: renesas: r9a07g054: Add missing hypervisor virtual timer IRQ
      pinctrl: renesas: r8a779g0: Fix CANFD5 suffix
      pinctrl: renesas: r8a779g0: Fix FXR_TXEN[AB] suffixes
      pinctrl: renesas: r8a779g0: Fix (H)SCIF1 suffixes
      pinctrl: renesas: r8a779g0: Fix (H)SCIF3 suffixes
      pinctrl: renesas: r8a779g0: Fix IRQ suffixes
      pinctrl: renesas: r8a779g0: FIX PWM suffixes
      pinctrl: renesas: r8a779g0: Fix TCLK suffixes
      pinctrl: renesas: r8a779g0: Fix TPU suffixes

Geliang Tang (4):
      selftests/bpf: Fix prog numbers in test_sockmap
      selftests/bpf: Check length of recv in test_sockmap
      selftests/bpf: Close fd in error path in drop_on_reuseport
      selftests/bpf: Close obj in error path in xdp_adjust_tail

Gerd Bayer (2):
      s390/pci: Refactor arch_setup_msi_irqs()
      s390/pci: Allow allocation of more than 1 MSI interrupt

Greg Kroah-Hartman (1):
      Linux 6.1.103

Gregory CLEMENT (1):
      MIPS: SMP-CPS: Fix address for GCR_ACCESS register for CM3 and later

Guangguan Wang (1):
      net/smc: set rmb's SG_MAX_SINGLE_ALLOC limitation only when CONFIG_ARCH_NO_SG_CHAIN is defined

Guenter Roeck (2):
      hwmon: (max6697) Fix underflow when writing limit attributes
      hwmon: (max6697) Fix swapped temp{1,8} critical alarms

Gwenael Treuveur (1):
      remoteproc: stm32_rproc: Fix mailbox interrupts queuing

Hagar Hemdan (1):
      net: esp: cleanup esp_output_tail_tcp() in case of unsupported ESPINTCP

Hans de Goede (1):
      leds: trigger: Unregister sysfs attributes before calling deactivate()

Hilda Wu (1):
      Bluetooth: btusb: Add RTL8852BE device 0489:e125 to device tables

Honggang LI (1):
      RDMA/rxe: Don't set BTH_ACK_MASK for UC or UD QPs

Hou Tao (1):
      bpf, events: Use prog to emit ksymbol event for main program

Hsiao Chien Sung (2):
      drm/mediatek: Add missing plane settings when async update
      drm/mediatek: Add OVL compatible name for MT8195

Huacai Chen (2):
      PCI: loongson: Enable MSI in LS7A Root Complex
      fs/ntfs3: Update log->page_{mask,bits} if log->page_size changed

Ido Schimmel (6):
      lib: objagg: Fix general protection fault
      mlxsw: spectrum_acl_erp: Fix object nesting warning
      mlxsw: spectrum_acl: Fix ACL scale regression and firmware errors
      ipv4: Fix incorrect TOS in route get reply
      ipv4: Fix incorrect TOS in fibmatch route get reply
      ipv4: Fix incorrect source address in Record Route option

Igor Pylypiv (1):
      ata: libata-scsi: Honor the D_SENSE bit for CK_COND=1 and no error

Ilpo Järvinen (7):
      x86/of: Return consistent error type from x86_of_pci_irq_enable()
      x86/pci/intel_mid_pci: Fix PCIBIOS_* return code handling
      x86/pci/xen: Fix PCIBIOS_* return code handling
      x86/platform/iosf_mbi: Convert PCIBIOS_* return codes to errnos
      PCI: Fix resource double counting on remove & rescan
      leds: ss4200: Convert PCIBIOS_* return codes to errnos
      hwrng: amd - Convert PCIBIOS_* return codes to errnos

Ilya Dryomov (3):
      rbd: don't assume rbd_is_lock_owner() for exclusive mappings
      rbd: rename RBD_LOCK_STATE_RELEASING and releasing_wait
      rbd: don't assume RBD_LOCK_STATE_LOCKED for exclusive mappings

Imre Deak (1):
      drm/i915/dp: Reset intel_dp->link_trained before retraining the link

Ira Weiny (1):
      PCI: Introduce cleanup helpers for device reference counts and locks

Ismael Luceno (1):
      ipvs: Avoid unnecessary calls to skb_is_gso_sctp

Ivan Babrou (1):
      bpftool: Un-const bpf_func_info to fix it for llvm 17 and newer

Jack Wang (1):
      bnxt_re: Fix imm_data endianness

Jacopo Mondi (3):
      media: rcar-vin: Fix YUYV8_1X16 handling for CSI-2
      media: rcar-csi2: Disable runtime_pm in probe error
      media: rcar-csi2: Cleanup subdevice in remove()

James Clark (3):
      perf tests: Fix test_arm_callgraph_fp variable expansion
      perf test: Make test_arm_callgraph_fp.sh more robust
      coresight: Fix ref leak when of_coresight_parse_endpoint() fails

Jan Kara (4):
      ext4: avoid writing unitialized memory to disk in EA inodes
      ext2: Verify bitmap and itable block numbers before using them
      udf: Avoid using corrupted block bitmap buffer
      jbd2: make jbd2_journal_get_max_txn_bufs() internal

Jann Horn (1):
      landlock: Don't lose track of restrictions on cred_transfer

Javier Carrasco (2):
      mfd: omap-usb-tll: Use struct_size to allocate tll
      leds: mt6360: Fix memory leak in mt6360_init_isnk_properties()

Javier Martinez Canillas (1):
      drm/mipi-dsi: Fix mipi_dsi_dcs_write_seq() macro definition format

Jay Buddhabhatti (2):
      soc: xilinx: rename cpu_number1 to dummy_cpu_number
      drivers: soc: xilinx: check return status of get_api_version()

Jeongjun Park (1):
      jfs: Fix array-index-out-of-bounds in diFree

Jerome Brunet (2):
      arm64: dts: amlogic: sm1: fix spdif compatibles
      arm64: dts: amlogic: gx: correct hdmi clocks

Jiaxun Yang (8):
      platform: mips: cpu_hwmon: Disable driver on unsupported hardware
      MIPS: dts: loongson: Add ISA node
      MIPS: ip30: ip30-console: Add missing include
      MIPS: dts: loongson: Fix GMAC phy node
      MIPS: Loongson64: env: Hook up Loongsson-2K
      MIPS: Loongson64: Remove memory node for builtin-dtb
      MIPS: Loongson64: reset: Prioritise firmware service
      MIPS: Loongson64: Test register availability before use

Jinyoung Choi (1):
      block: cleanup bio_integrity_prep

Jiri Olsa (1):
      bpf: Synchronize dispatcher update with bpf_dispatcher_xdp_func

Joe Hattori (1):
      char: tpm: Fix possible memory leak in tpm_bios_measurements_open()

Johannes Berg (6):
      wifi: virt_wifi: don't use strlen() in const context
      wifi: mac80211: track capability/opmode NSS separately
      wifi: mac80211: check basic rates validity
      um: time-travel: fix time-travel-start option
      um: time-travel: fix signal blocking race/hang
      net: bonding: correctly annotate RCU in bond_should_notify_peers()

John David Anglin (1):
      parisc: Fix warning at drivers/pci/msi/msi.h:121

John Stultz (1):
      locking/rwsem: Add __always_inline annotation to __down_write_common() and inlined callers

Jon Pan-Doh (1):
      iommu/vt-d: Fix identity map bounds in si_domain_init()

Jonas Karlman (5):
      arm64: dts: rockchip: Add sdmmc related properties on rk3308-rock-pi-s
      arm64: dts: rockchip: Add pinctrl for UART0 to rk3308-rock-pi-s
      arm64: dts: rockchip: Add mdio and ethernet-phy nodes to rk3308-rock-pi-s
      arm64: dts: rockchip: Update WIFi/BT related nodes on rk3308-rock-pi-s
      arm64: dts: rockchip: Increase VOP clk rate on RK3328

Jonathan Marek (1):
      drm/msm/dsi: set VIDEO_COMPRESSION_MODE_CTRL_WC

Joy Chakraborty (2):
      rtc: cmos: Fix return value of nvmem callbacks
      rtc: isl1208: Fix return value of nvmem callbacks

Junxian Huang (2):
      RDMA/hns: Check atomic wr length
      RDMA/hns: Fix unmatch exception handling when init eq table fails

Kan Liang (1):
      perf/x86/intel/uncore: Fix the bits of the CHA extended umask for SPR

Kees Cook (1):
      kernfs: Convert kernfs_path_from_node_locked() from strlcpy() to strscpy()

Kemeng Shi (2):
      sbitmap: remove unnecessary calculation of alloc_hint in __sbitmap_get_shallow
      sbitmap: rewrite sbitmap_find_bit_in_index to reduce repeat code

Konrad Dybcio (2):
      clk: qcom: branch: Add helper functions for setting retain bits
      interconnect: qcom: qcm2290: Fix mas_snoc_bimc RPM master ID

Konstantin Komarov (10):
      fs/ntfs3: Use ALIGN kernel macro
      fs/ntfs3: Merge synonym COMPRESSION_UNIT and NTFS_LZNT_CUNIT
      fs/ntfs3: Fix transform resident to nonresident for compressed files
      fs/ntfs3: Missed NI_FLAG_UPDATE_PARENT setting
      fs/ntfs3: Fix getting file type
      fs/ntfs3: Add missing .dirty_folio in address_space_operations
      fs/ntfs3: Replace inode_trylock with inode_lock
      fs/ntfs3: Fix field-spanning write in INDEX_HDR
      fs/ntfs3: Missed error return
      fs/ntfs3: Keep runs for $MFT::$ATTR_DATA and $MFT::$ATTR_BITMAP

Krzysztof Kozlowski (2):
      dt-bindings: thermal: correct thermal zone node name limit
      spi: spidev: order compatibles alphabetically

Lad Prabhakar (1):
      arm64: dts: renesas: Drop specifying the GIC_CPU_MASK_SIMPLE() for GICv3 systems

Lance Richardson (1):
      dma: fix call order in dmam_free_coherent

Laurent Pinchart (2):
      media: renesas: vsp1: Fix _irqsave and _irq mix
      media: renesas: vsp1: Store RPF partition configuration per RPF instance

Leon Romanovsky (5):
      RDMA/cache: Release GID table even if leak is detected
      RDMA/mlx4: Fix truncated output warning in mad.c
      RDMA/mlx4: Fix truncated output warning in alias_GUID.c
      RDMA/device: Return error earlier if port in not valid
      nvme-pci: add missing condition check for existence of mapped data

Li Nan (1):
      md: fix deadlock between mddev_suspend and flush bio

Lijo Lazar (1):
      drm/amd/pm: Fix aldebaran pcie speed reporting

Liwei Song (1):
      tools/resolve_btfids: Fix comparison of distinct pointer types warning in resolve_btfids

Lorenzo Bianconi (1):
      clk: en7523: fix rate divider for slic and spi clocks

Luca Ceresoli (1):
      Revert "leds: led-core: Fix refcount leak in of_led_get()"

Luca Weiss (1):
      arm64: dts: qcom: sm6350: Add missing qcom,non-secure-domain property

Lucas Stach (2):
      drm/etnaviv: fix DMA direction handling for cached RW buffers
      drm/etnaviv: don't block scheduler when GPU is still active

Luis Henriques (SUSE) (2):
      ext4: fix infinite loop when replaying fast_commit
      ext4: don't track ranges in fast_commit if inode has inlined data

Lukas Wunner (1):
      PCI/DPC: Fix use-after-free on concurrent DPC and hot-removal

Ma Ke (3):
      drm/gma500: fix null pointer dereference in cdv_intel_lvds_get_modes
      drm/gma500: fix null pointer dereference in psb_intel_lvds_get_modes
      phy: cadence-torrent: Check return value on register read

Manish Rangankar (1):
      scsi: qla2xxx: During vport delete send async logout explicitly

Manivannan Sadhasivam (2):
      PCI: qcom-ep: Disable resources unconditionally during PERST# assert
      PCI: rockchip: Use GPIOD_OUT_LOW flag while requesting ep_gpio

Marc Gonzalez (1):
      arm64: dts: qcom: msm8998: enable adreno_smmu by default

Marco Cavenati (1):
      perf/x86/intel/pt: Fix topa_entry base length

Marek Behún (3):
      firmware: turris-mox-rwtm: Do not complete if there are no waiters
      firmware: turris-mox-rwtm: Fix checking return value of wait_for_completion_timeout()
      firmware: turris-mox-rwtm: Initialize completion before mailbox

Marek Vasut (1):
      PCI: rcar: Demote WARN() to dev_warn_ratelimited() in rcar_pcie_wakeup()

Markus Elfring (1):
      auxdisplay: ht16k33: Drop reference after LED registration

Martin Willi (2):
      net: dsa: mv88e6xxx: Limit chip-wide frame size config to CPU ports
      net: dsa: b53: Limit chip-wide jumbo frame config to CPU ports

Masahiro Yamada (1):
      kbuild: avoid build error when single DTB is turned into composite DTB

Matthew Wilcox (Oracle) (2):
      s390/mm: Convert make_page_secure to use a folio
      s390/mm: Convert gmap_make_secure to use a folio

Miaohe Lin (1):
      mm/hugetlb: fix possible recursive locking detected warning

Michael Ellerman (2):
      powerpc/xmon: Fix disassembly CPU feature checks
      selftests/sigaltstack: Fix ppc64 GCC build

Michael S. Tsirkin (1):
      vhost/vsock: always initialize seqpacket_allow

Michael Walle (5):
      ARM: dts: imx6qdl-kontron-samx6i: fix phy-mode
      ARM: dts: imx6qdl-kontron-samx6i: fix PHY reset
      ARM: dts: imx6qdl-kontron-samx6i: fix board reset
      ARM: dts: imx6qdl-kontron-samx6i: fix SPI0 chip selects
      ARM: dts: imx6qdl-kontron-samx6i: fix PCIe reset polarity

Michal Luczaj (1):
      af_unix: Disable MSG_OOB handling for sockets in sockmap/sockhash

Mickaël Salaün (1):
      selftests/landlock: Add cred_transfer test

Mikhail Kobuk (1):
      media: pci: ivtv: Add check for DMA map result

Naga Sureshkumar Relli (1):
      spi: microchip-core: fix the issues in the isr

Namhyung Kim (2):
      perf test: Replace arm callgraph fp test workload with leafloop
      perf report: Fix condition in sort__sym_cmp()

Nathan Chancellor (1):
      kbuild: Fix '-S -c' in x86 stack protector scripts

Nathan Lynch (1):
      powerpc/prom: Add CPU info to hardware description string later

Nayna Jain (1):
      powerpc/pseries: Expose PLPKS config values, support additional fields

NeilBrown (1):
      SUNRPC: avoid soft lockup when transmitting UDP to reachable server.

Nick Bowler (1):
      macintosh/therm_windtunnel: fix module unload.

Nicolas Dichtel (2):
      ipv4: fix source address selection with route leak
      ipv6: take care of scope when choosing the src addr

Niklas Cassel (1):
      PCI: dw-rockchip: Fix initial PERST# GPIO value

Nilesh Javali (1):
      scsi: qla2xxx: validate nvme_local_port correctly

Nitesh Shetty (1):
      block: refactor to use helper

Nitin Gote (1):
      drm/i915/gt: Do not consider preemption during execlists_dequeue for gen8

Nivas Varadharajan Mugunthakumar (1):
      crypto: qat - extend scope of lock in adf_cfg_add_key_value_param()

Olga Kornievskaia (1):
      NFSv4.1 another fix for EXCHGID4_FLAG_USE_PNFS_DS for DS server

Or Har-Toov (1):
      RDMA/mlx5: Use sq timestamp as QP timestamp when RoCE is disabled

Pablo Neira Ayuso (3):
      netfilter: nf_tables: rise cap on SELinux secmark context
      netfilter: ctnetlink: use helper function to calculate expect ID
      net: flow_dissector: use DEBUG_NET_WARN_ON_ONCE

Paolo Pisati (1):
      m68k: amiga: Turn off Warp1260 interrupts during boot

Pavel Begunkov (4):
      kernel: rerun task_work while freezing in get_signal()
      io_uring: tighten task exit cancellations
      io_uring/io-wq: limit retrying worker initialisation
      io_uring: fix io_match_task must_hold

Peng Fan (1):
      pinctrl: freescale: mxs: Fix refcount of child

Petr Machata (1):
      net: nexthop: Initialize all fields in dumped nexthops

Pierre Gondois (1):
      sched/fair: Use all little CPUs for CPU-bound workloads

Pierre-Louis Bossart (1):
      ASoC: Intel: use soc_intel_is_byt_cr() only when IOSF_MBI is reachable

Prajna Rajendra Kumar (1):
      spi: spi-microchip-core: Fix the number of chip selects supported

Primoz Fiser (2):
      cpufreq: ti-cpufreq: Handle deferred probe with dev_err_probe()
      OPP: ti: Fix ti_opp_supply_probe wrong return values

Quinn Tran (3):
      scsi: qla2xxx: Unable to act on RSCN for port online
      scsi: qla2xxx: Use QP lock to search for bsg
      scsi: qla2xxx: Fix flash read failure

Rafael Beims (1):
      wifi: mwifiex: Fix interface type change

Rafał Miłecki (1):
      arm64: dts: mediatek: mt7622: fix "emmc" pinctrl mux

Rameshkumar Sundaram (1):
      wifi: mac80211: Allow NSS change only up to capability

Randy Dunlap (1):
      kernfs: fix all kernel-doc warnings and multiple typos

Ricardo Ribalda (2):
      media: imon: Fix race getting ictx->lock
      media: uvcvideo: Fix integer overflow calculating timestamp

Ross Lagerwall (1):
      decompress_bunzip2: fix rare decompression failure

Russell Currey (3):
      powerpc/pseries: Move plpks.h to include directory
      powerpc/pseries: Add helper to get PLPKS password length
      powerpc/pseries: Avoid hcall in plpks_is_available() on non-pseries

Ryusuke Konishi (2):
      nilfs2: avoid undefined behavior in nilfs_cnt32_ge macro
      nilfs2: handle inconsistent state in nilfs_btnode_create_block()

Samasth Norway Ananda (1):
      wifi: brcmsmac: LCN PHY code is used for BCM4313 2G-only device

Saurav Kashyap (1):
      scsi: qla2xxx: Return ENOBUFS if sg_cnt is more than one for ELS cmds

Sean Christopherson (2):
      KVM: VMX: Split out the non-virtualization part of vmx_interrupt_blocked()
      KVM: nVMX: Request immediate exit iff pending nested event needs injection

Seth Forshee (DigitalOcean) (1):
      fs: don't allow non-init s_user_ns for filesystems without FS_USERNS_MOUNT

Sheng Yong (1):
      f2fs: fix start segno of large section

Shenwei Wang (1):
      irqchip/imx-irqsteer: Handle runtime power management correctly

Shigeru Yoshida (1):
      tipc: Return non-zero value from tipc_udp_addr2str() on error

Shreyas Deodhar (3):
      scsi: qla2xxx: Fix optrom version displayed in FDMI
      scsi: qla2xxx: Fix for possible memory corruption
      scsi: qla2xxx: Complete command early within lock

Siddharth Vadapalli (2):
      PCI: keystone: Relocate ks_pcie_set/clear_dbi_mode()
      PCI: keystone: Don't enable BAR 0 for AM654x

Simon Horman (1):
      net: stmmac: Correct byte order of perfect_match

Sourabh Jain (2):
      powerpc/kexec: make the update_cpus_node() function public
      powerpc/kexec_file: fix cpus node update to FDT

Spoorthy S (1):
      perf tests arm_callgraph_fp: Address shellcheck warnings about signal names and adding double quotes for expression

Stephen Boyd (2):
      soc: qcom: rpmh-rsc: Ensure irqs aren't disabled by rpmh_rsc_send_data() callers
      clk: qcom: Park shared RCGs upon registration

Steve French (3):
      cifs: fix potential null pointer use in destroy_workqueue in init_cifs error path
      cifs: fix reconnect with SMB1 UNIX Extensions
      cifs: mount with "unix" mount option for SMB1 incorrectly handled

Steve Wilkins (2):
      spi: microchip-core: only disable SPI controller when register value change requires it
      spi: microchip-core: fix init function not setting the master and motorola modes

Sung Joon Kim (1):
      drm/amd/display: Check for NULL pointer

Taehee Yoo (1):
      xdp: fix invalid wait context of page_pool_destroy()

Takashi Iwai (2):
      ALSA: usb-audio: Move HD Webcam quirk to the right place
      ASoC: amd: yc: Support mic on Lenovo Thinkpad E16 Gen 2

Taniya Das (3):
      clk: qcom: gcc-sc7280: Update force mem core bit for UFS ICE clock
      clk: qcom: camcc-sc7280: Add parent dependency to all camera GDSCs
      clk: qcom: gpucc-sm8350: Park RCG's clk source at XO during disable

Tao Chen (1):
      bpftool: Mount bpffs when pinmaps path not under the bpffs

Tejun Heo (1):
      sched/fair: set_load_weight() must also call reweight_task() for SCHED_IDLE tasks

Tengda Wu (1):
      bpf: Fix null pointer dereference in resolve_prog_type() for BPF_PROG_TYPE_EXT

Tetsuo Handa (1):
      mm: mmap_lock: replace get_memcg_path_buf() with on-stack buffer

Thomas Gleixner (3):
      perf/x86: Serialize set_attr_rdpmc()
      jump_label: Fix concurrency issues in static_key_slow_dec()
      watchdog/perf: properly initialize the turbo mode timestamp and rearm counter

Thorsten Blum (1):
      m68k: cmpxchg: Fix return value for default case in __arch_xchg()

Tim Van Patten (1):
      drm/amdgpu: Remove GC HW IP 9.3.0 from noretry=1

Tvrtko Ursulin (1):
      mm/numa_balancing: teach mpol_to_str about the balancing mode

Tzung-Bi Shih (1):
      platform/chrome: cros_ec_debugfs: fix wrong EC message version

Uros Bizjak (1):
      jump_label: Use atomic_try_cmpxchg() in static_key_slow_inc_cpuslocked()

Uwe Kleine-König (6):
      pwm: stm32: Always do lazy disabling
      pwm: atmel-tcb: Put per-channel data into driver data
      pwm: atmel-tcb: Unroll atmel_tcb_pwm_set_polarity() into only caller
      pwm: atmel-tcb: Don't track polarity in driver data
      pwm: atmel-tcb: Fix race condition and convert to guards
      pinctrl: ti: ti-iodelay: Drop if block with always false condition

Vignesh Raghavendra (1):
      dmaengine: ti: k3-udma: Fix BCHAN count with UHC and HC channels

Vincent Tremblay (1):
      spidev: Add Silicon Labs EM3581 device compatible

WangYuli (1):
      Bluetooth: btusb: Add Realtek RTL8852BE support ID 0x13d3:0x3591

Wayne Lin (1):
      drm/dp_mst: Fix all mstb marked as not probed after suspend/resume

Wayne Tung (1):
      hwmon: (adt7475) Fix default duty on fan is disabled

Wei Liu (1):
      PCI: hv: Return zero, not garbage, when reading PCI_INTERRUPT_PIN

Xiao Liang (1):
      apparmor: Fix null pointer deref when receiving skb during sock creation

Yanfei Xu (1):
      iommu/vt-d: Fix to convert mm pfn to dma pfn

Yang Yang (1):
      sbitmap: fix io hung due to race on sbitmap_word::cleared

Yang Yingliang (4):
      pinctrl: core: fix possible memory leak when pinctrl_enable() fails
      pinctrl: single: fix possible memory leak when pinctrl_enable() fails
      pinctrl: ti: ti-iodelay: fix possible memory leak when pinctrl_enable() fails
      spi: microchip-core: switch to use modern name

Yao Zi (1):
      drm/meson: fix canvas release in bind function

Yu Liao (1):
      tick/broadcast: Make takeover of broadcast hrtimer reliable

Yu Zhao (1):
      mm/mglru: fix div-by-zero in vmpressure_calc_level()

Zhang Rui (1):
      perf/x86/intel/cstate: Fix Alderlake/Raptorlake/Meteorlake

Zheng Yejian (1):
      media: dvb-usb: Fix unexpected infinite loop in dvb_usb_read_remote_control()

Zijun Hu (3):
      kobject_uevent: Fix OOB access within zap_modalias_env()
      devres: Fix devm_krealloc() wasting memory
      devres: Fix memory leakage caused by driver API devm_free_percpu()

ethanwu (1):
      ceph: fix incorrect kmalloc size of pagevec mempool

levi.yun (1):
      trace/pid_list: Change gfp flags in pid_list_fill_irq()

linke li (1):
      sbitmap: use READ_ONCE to access map->word

tuhaowen (1):
      dev/parport: fix the array out-of-bounds risk

wangdicheng (2):
      ALSA: usb-audio: Fix microphone sound on HD webcam.
      ALSA: usb-audio: Add a quirk for Sonix HD USB Camera


^ permalink raw reply	[flat|nested] 2+ messages in thread

* Re: Linux 6.1.103
  2024-08-03  7:05 Linux 6.1.103 Greg Kroah-Hartman
@ 2024-08-03  7:05 ` Greg Kroah-Hartman
  0 siblings, 0 replies; 2+ messages in thread
From: Greg Kroah-Hartman @ 2024-08-03  7:05 UTC (permalink / raw)
  To: linux-kernel, akpm, torvalds, stable; +Cc: lwn, jslaby, Greg Kroah-Hartman

diff --git a/Documentation/devicetree/bindings/thermal/thermal-zones.yaml b/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
index 8d2c6d74b605..bc9ccdfd3a27 100644
--- a/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
+++ b/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
@@ -49,7 +49,10 @@ properties:
       to take when the temperature crosses those thresholds.
 
 patternProperties:
-  "^[a-zA-Z][a-zA-Z0-9\\-]{1,12}-thermal$":
+  # Node name is limited in size due to Linux kernel requirements - 19
+  # characters in total (see THERMAL_NAME_LENGTH, including terminating NUL
+  # byte):
+  "^[a-zA-Z][a-zA-Z0-9\\-]{1,10}-thermal$":
     type: object
     description:
       Each thermal zone node contains information about how frequently it
diff --git a/Makefile b/Makefile
index 00ec5357bc78..97149e46565a 100644
--- a/Makefile
+++ b/Makefile
@@ -1,7 +1,7 @@
 # SPDX-License-Identifier: GPL-2.0
 VERSION = 6
 PATCHLEVEL = 1
-SUBLEVEL = 102
+SUBLEVEL = 103
 EXTRAVERSION =
 NAME = Curry Ramen
 
diff --git a/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi b/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi
index 4d6a0c3e8455..ff062f4fd726 100644
--- a/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi
+++ b/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi
@@ -5,31 +5,8 @@
 
 #include "imx6q.dtsi"
 #include "imx6qdl-kontron-samx6i.dtsi"
-#include <dt-bindings/gpio/gpio.h>
 
 / {
 	model = "Kontron SMARC sAMX6i Quad/Dual";
 	compatible = "kontron,imx6q-samx6i", "fsl,imx6q";
 };
-
-/* Quad/Dual SoMs have 3 chip-select signals */
-&ecspi4 {
-	cs-gpios = <&gpio3 24 GPIO_ACTIVE_LOW>,
-		   <&gpio3 29 GPIO_ACTIVE_LOW>,
-		   <&gpio3 25 GPIO_ACTIVE_LOW>;
-};
-
-&pinctrl_ecspi4 {
-	fsl,pins = <
-		MX6QDL_PAD_EIM_D21__ECSPI4_SCLK 0x100b1
-		MX6QDL_PAD_EIM_D28__ECSPI4_MOSI 0x100b1
-		MX6QDL_PAD_EIM_D22__ECSPI4_MISO 0x100b1
-
-		/* SPI4_IMX_CS2# - connected to internal flash */
-		MX6QDL_PAD_EIM_D24__GPIO3_IO24 0x1b0b0
-		/* SPI4_IMX_CS0# - connected to SMARC SPI0_CS0# */
-		MX6QDL_PAD_EIM_D29__GPIO3_IO29 0x1b0b0
-		/* SPI4_CS3# - connected to  SMARC SPI0_CS1# */
-		MX6QDL_PAD_EIM_D25__GPIO3_IO25 0x1b0b0
-	>;
-};
diff --git a/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi b/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi
index 85aeebc9485d..668d33d1ff0c 100644
--- a/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi
+++ b/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi
@@ -244,7 +244,8 @@ &ecspi4 {
 	pinctrl-names = "default";
 	pinctrl-0 = <&pinctrl_ecspi4>;
 	cs-gpios = <&gpio3 24 GPIO_ACTIVE_LOW>,
-		   <&gpio3 29 GPIO_ACTIVE_LOW>;
+		   <&gpio3 29 GPIO_ACTIVE_LOW>,
+		   <&gpio3 25 GPIO_ACTIVE_LOW>;
 	status = "okay";
 
 	/* default boot source: workaround #1 for errata ERR006282 */
@@ -259,7 +260,7 @@ smarc_flash: flash@0 {
 &fec {
 	pinctrl-names = "default";
 	pinctrl-0 = <&pinctrl_enet>;
-	phy-mode = "rgmii";
+	phy-connection-type = "rgmii-id";
 	phy-handle = <&ethphy>;
 
 	mdio {
@@ -269,7 +270,7 @@ mdio {
 		ethphy: ethernet-phy@1 {
 			compatible = "ethernet-phy-ieee802.3-c22";
 			reg = <1>;
-			reset-gpios = <&gpio1 25 GPIO_ACTIVE_LOW>;
+			reset-gpios = <&gpio2 1 GPIO_ACTIVE_LOW>;
 			reset-assert-us = <1000>;
 		};
 	};
@@ -464,6 +465,8 @@ MX6QDL_PAD_EIM_D22__ECSPI4_MISO 0x100b1
 			MX6QDL_PAD_EIM_D24__GPIO3_IO24 0x1b0b0
 			/* SPI_IMX_CS0# - connected to SMARC SPI0_CS0# */
 			MX6QDL_PAD_EIM_D29__GPIO3_IO29 0x1b0b0
+			/* SPI4_CS3# - connected to SMARC SPI0_CS1# */
+			MX6QDL_PAD_EIM_D25__GPIO3_IO25 0x1b0b0
 		>;
 	};
 
@@ -516,7 +519,7 @@ MX6QDL_PAD_RGMII_RX_CTL__RGMII_RX_CTL 0x1b0b0
 			MX6QDL_PAD_ENET_MDIO__ENET_MDIO       0x1b0b0
 			MX6QDL_PAD_ENET_MDC__ENET_MDC         0x1b0b0
 			MX6QDL_PAD_ENET_REF_CLK__ENET_TX_CLK  0x1b0b0
-			MX6QDL_PAD_ENET_CRS_DV__GPIO1_IO25    0x1b0b0 /* RST_GBE0_PHY# */
+			MX6QDL_PAD_NANDF_D1__GPIO2_IO01       0x1b0b0 /* RST_GBE0_PHY# */
 		>;
 	};
 
@@ -729,7 +732,7 @@ &pcie {
 	pinctrl-names = "default";
 	pinctrl-0 = <&pinctrl_pcie>;
 	wake-up-gpio = <&gpio6 18 GPIO_ACTIVE_HIGH>;
-	reset-gpio = <&gpio3 13 GPIO_ACTIVE_HIGH>;
+	reset-gpio = <&gpio3 13 GPIO_ACTIVE_LOW>;
 };
 
 /* LCD_BKLT_PWM */
@@ -817,5 +820,6 @@ &wdog1 {
 	/* CPLD is feeded by watchdog (hardwired) */
 	pinctrl-names = "default";
 	pinctrl-0 = <&pinctrl_wdog1>;
+	fsl,ext-reset-output;
 	status = "okay";
 };
diff --git a/arch/arm/mach-pxa/spitz.c b/arch/arm/mach-pxa/spitz.c
index 937f56bbaf6c..effd28294da0 100644
--- a/arch/arm/mach-pxa/spitz.c
+++ b/arch/arm/mach-pxa/spitz.c
@@ -512,10 +512,8 @@ static struct ads7846_platform_data spitz_ads7846_info = {
 static struct gpiod_lookup_table spitz_lcdcon_gpio_table = {
 	.dev_id = "spi2.1",
 	.table = {
-		GPIO_LOOKUP("gpio-pxa", SPITZ_GPIO_BACKLIGHT_CONT,
-			    "BL_CONT", GPIO_ACTIVE_LOW),
-		GPIO_LOOKUP("gpio-pxa", SPITZ_GPIO_BACKLIGHT_ON,
-			    "BL_ON", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.1", 6, "BL_CONT", GPIO_ACTIVE_LOW),
+		GPIO_LOOKUP("sharp-scoop.1", 7, "BL_ON", GPIO_ACTIVE_HIGH),
 		{ },
 	},
 };
@@ -523,10 +521,8 @@ static struct gpiod_lookup_table spitz_lcdcon_gpio_table = {
 static struct gpiod_lookup_table akita_lcdcon_gpio_table = {
 	.dev_id = "spi2.1",
 	.table = {
-		GPIO_LOOKUP("gpio-pxa", AKITA_GPIO_BACKLIGHT_CONT,
-			    "BL_CONT", GPIO_ACTIVE_LOW),
-		GPIO_LOOKUP("gpio-pxa", AKITA_GPIO_BACKLIGHT_ON,
-			    "BL_ON", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("i2c-max7310", 3, "BL_ON", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("i2c-max7310", 4, "BL_CONT", GPIO_ACTIVE_LOW),
 		{ },
 	},
 };
@@ -953,12 +949,9 @@ static inline void spitz_i2c_init(void) {}
 static struct gpiod_lookup_table spitz_audio_gpio_table = {
 	.dev_id = "spitz-audio",
 	.table = {
-		GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_L - SPITZ_SCP_GPIO_BASE,
-			    "mute-l", GPIO_ACTIVE_HIGH),
-		GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_R - SPITZ_SCP_GPIO_BASE,
-			    "mute-r", GPIO_ACTIVE_HIGH),
-		GPIO_LOOKUP("sharp-scoop.1", SPITZ_GPIO_MIC_BIAS - SPITZ_SCP2_GPIO_BASE,
-			    "mic", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.0", 3, "mute-l", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.0", 4, "mute-r", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.1", 8, "mic", GPIO_ACTIVE_HIGH),
 		{ },
 	},
 };
@@ -966,12 +959,9 @@ static struct gpiod_lookup_table spitz_audio_gpio_table = {
 static struct gpiod_lookup_table akita_audio_gpio_table = {
 	.dev_id = "spitz-audio",
 	.table = {
-		GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_L - SPITZ_SCP_GPIO_BASE,
-			    "mute-l", GPIO_ACTIVE_HIGH),
-		GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_R - SPITZ_SCP_GPIO_BASE,
-			    "mute-r", GPIO_ACTIVE_HIGH),
-		GPIO_LOOKUP("i2c-max7310", AKITA_GPIO_MIC_BIAS - AKITA_IOEXP_GPIO_BASE,
-			    "mic", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.0", 3, "mute-l", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.0", 4, "mute-r", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("i2c-max7310", 2, "mic", GPIO_ACTIVE_HIGH),
 		{ },
 	},
 };
diff --git a/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi b/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
index 7c029f552a23..256c46771db7 100644
--- a/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
@@ -311,8 +311,8 @@ &hdmi_tx {
 		 <&reset RESET_HDMI_SYSTEM_RESET>,
 		 <&reset RESET_HDMI_TX>;
 	reset-names = "hdmitx_apb", "hdmitx", "hdmitx_phy";
-	clocks = <&clkc CLKID_HDMI_PCLK>,
-		 <&clkc CLKID_CLK81>,
+	clocks = <&clkc CLKID_HDMI>,
+		 <&clkc CLKID_HDMI_PCLK>,
 		 <&clkc CLKID_GCLK_VENCI_INT0>;
 	clock-names = "isfr", "iahb", "venci";
 };
diff --git a/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi b/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
index 350022935052..a689bd14ece9 100644
--- a/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
@@ -323,8 +323,8 @@ &hdmi_tx {
 		 <&reset RESET_HDMI_SYSTEM_RESET>,
 		 <&reset RESET_HDMI_TX>;
 	reset-names = "hdmitx_apb", "hdmitx", "hdmitx_phy";
-	clocks = <&clkc CLKID_HDMI_PCLK>,
-		 <&clkc CLKID_CLK81>,
+	clocks = <&clkc CLKID_HDMI>,
+		 <&clkc CLKID_HDMI_PCLK>,
 		 <&clkc CLKID_GCLK_VENCI_INT0>;
 	clock-names = "isfr", "iahb", "venci";
 };
diff --git a/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi b/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
index 80737731af3f..8bc4ef9d8a61 100644
--- a/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
@@ -337,7 +337,7 @@ tdmin_lb: audio-controller@3c0 {
 		};
 
 		spdifin: audio-controller@400 {
-			compatible = "amlogic,g12a-spdifin",
+			compatible = "amlogic,sm1-spdifin",
 				     "amlogic,axg-spdifin";
 			reg = <0x0 0x400 0x0 0x30>;
 			#sound-dai-cells = <0>;
@@ -351,7 +351,7 @@ spdifin: audio-controller@400 {
 		};
 
 		spdifout_a: audio-controller@480 {
-			compatible = "amlogic,g12a-spdifout",
+			compatible = "amlogic,sm1-spdifout",
 				     "amlogic,axg-spdifout";
 			reg = <0x0 0x480 0x0 0x50>;
 			#sound-dai-cells = <0>;
diff --git a/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts b/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
index b1ddc491d293..9c9431455f85 100644
--- a/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
+++ b/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
@@ -286,8 +286,8 @@ asm_sel {
 	/* eMMC is shared pin with parallel NAND */
 	emmc_pins_default: emmc-pins-default {
 		mux {
-			function = "emmc", "emmc_rst";
-			groups = "emmc";
+			function = "emmc";
+			groups = "emmc", "emmc_rst";
 		};
 
 		/* "NDL0","NDL1","NDL2","NDL3","NDL4","NDL5","NDL6","NDL7",
diff --git a/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts b/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
index 527dcb279ba5..f4bb9c6521c6 100644
--- a/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
+++ b/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
@@ -244,8 +244,8 @@ &pio {
 	/* eMMC is shared pin with parallel NAND */
 	emmc_pins_default: emmc-pins-default {
 		mux {
-			function = "emmc", "emmc_rst";
-			groups = "emmc";
+			function = "emmc";
+			groups = "emmc", "emmc_rst";
 		};
 
 		/* "NDL0","NDL1","NDL2","NDL3","NDL4","NDL5","NDL6","NDL7",
diff --git a/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi b/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
index 3d95625f1b0b..d7fc924a9d0e 100644
--- a/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
@@ -168,21 +168,24 @@ anx_bridge: anx7625@58 {
 		vdd18-supply = <&pp1800_mipibrdg>;
 		vdd33-supply = <&vddio_mipibrdg>;
 
-		#address-cells = <1>;
-		#size-cells = <0>;
-		port@0 {
-			reg = <0>;
+		ports {
+			#address-cells = <1>;
+			#size-cells = <0>;
 
-			anx7625_in: endpoint {
-				remote-endpoint = <&dsi_out>;
+			port@0 {
+				reg = <0>;
+
+				anx7625_in: endpoint {
+					remote-endpoint = <&dsi_out>;
+				};
 			};
-		};
 
-		port@1 {
-			reg = <1>;
+			port@1 {
+				reg = <1>;
 
-			anx7625_out: endpoint {
-				remote-endpoint = <&panel_in>;
+				anx7625_out: endpoint {
+					remote-endpoint = <&panel_in>;
+				};
 			};
 		};
 	};
diff --git a/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi b/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
index 1db97d94658b..03ccdbb1c5ed 100644
--- a/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
@@ -767,7 +767,6 @@ pins-tx {
 		};
 		pins-rts {
 			pinmux = <PINMUX_GPIO47__FUNC_URTS1>;
-			output-enable;
 		};
 		pins-cts {
 			pinmux = <PINMUX_GPIO46__FUNC_UCTS1>;
@@ -786,7 +785,6 @@ pins-tx {
 		};
 		pins-rts {
 			pinmux = <PINMUX_GPIO47__FUNC_URTS1>;
-			output-enable;
 		};
 		pins-cts {
 			pinmux = <PINMUX_GPIO46__FUNC_UCTS1>;
diff --git a/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi b/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
index 77819186086a..de320bebe412 100644
--- a/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
@@ -368,7 +368,6 @@ &usb3_dwc3 {
 
 &hsusb_phy1 {
 	status = "okay";
-	extcon = <&typec>;
 
 	vdda-pll-supply = <&vreg_l12a_1p8>;
 	vdda-phy-dpdm-supply = <&vreg_l24a_3p075>;
diff --git a/arch/arm64/boot/dts/qcom/msm8996.dtsi b/arch/arm64/boot/dts/qcom/msm8996.dtsi
index 986a5b5c05e4..3b9a4bf89701 100644
--- a/arch/arm64/boot/dts/qcom/msm8996.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8996.dtsi
@@ -2016,7 +2016,7 @@ ufshc: ufshc@624000 {
 				<&gcc GCC_UFS_RX_SYMBOL_0_CLK>;
 			freq-table-hz =
 				<100000000 200000000>,
-				<0 0>,
+				<100000000 200000000>,
 				<0 0>,
 				<0 0>,
 				<0 0>,
diff --git a/arch/arm64/boot/dts/qcom/msm8998.dtsi b/arch/arm64/boot/dts/qcom/msm8998.dtsi
index 7a41250539ff..3d4941dc31d7 100644
--- a/arch/arm64/boot/dts/qcom/msm8998.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8998.dtsi
@@ -1457,7 +1457,6 @@ adreno_smmu: iommu@5040000 {
 			 * SoC VDDMX RPM Power Domain in the Adreno driver.
 			 */
 			power-domains = <&gpucc GPU_GX_GDSC>;
-			status = "disabled";
 		};
 
 		gpucc: clock-controller@5065000 {
diff --git a/arch/arm64/boot/dts/qcom/sdm845.dtsi b/arch/arm64/boot/dts/qcom/sdm845.dtsi
index 95c515da9f2e..71644b9b8866 100644
--- a/arch/arm64/boot/dts/qcom/sdm845.dtsi
+++ b/arch/arm64/boot/dts/qcom/sdm845.dtsi
@@ -2537,6 +2537,8 @@ ufs_mem_phy: phy@1d87000 {
 			clocks = <&gcc GCC_UFS_MEM_CLKREF_CLK>,
 				 <&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
 
+			power-domains = <&gcc UFS_PHY_GDSC>;
+
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
 			status = "disabled";
diff --git a/arch/arm64/boot/dts/qcom/sm6350.dtsi b/arch/arm64/boot/dts/qcom/sm6350.dtsi
index 9da373090593..ba078099b805 100644
--- a/arch/arm64/boot/dts/qcom/sm6350.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm6350.dtsi
@@ -830,6 +830,8 @@ ufs_mem_phy: phy@1d87000 {
 			clocks = <&gcc GCC_UFS_MEM_CLKREF_CLK>,
 				 <&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
 
+			power-domains = <&gcc UFS_PHY_GDSC>;
+
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
 
@@ -893,6 +895,7 @@ fastrpc {
 					compatible = "qcom,fastrpc";
 					qcom,glink-channels = "fastrpcglink-apps-dsp";
 					label = "adsp";
+					qcom,non-secure-domain;
 					#address-cells = <1>;
 					#size-cells = <0>;
 
@@ -1000,6 +1003,7 @@ fastrpc {
 					compatible = "qcom,fastrpc";
 					qcom,glink-channels = "fastrpcglink-apps-dsp";
 					label = "cdsp";
+					qcom,non-secure-domain;
 					#address-cells = <1>;
 					#size-cells = <0>;
 
diff --git a/arch/arm64/boot/dts/qcom/sm8250.dtsi b/arch/arm64/boot/dts/qcom/sm8250.dtsi
index 3d02adbc0b62..6a2852584405 100644
--- a/arch/arm64/boot/dts/qcom/sm8250.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm8250.dtsi
@@ -2125,7 +2125,7 @@ ufs_mem_hc: ufshc@1d84000 {
 				     "jedec,ufs-2.0";
 			reg = <0 0x01d84000 0 0x3000>;
 			interrupts = <GIC_SPI 265 IRQ_TYPE_LEVEL_HIGH>;
-			phys = <&ufs_mem_phy_lanes>;
+			phys = <&ufs_mem_phy>;
 			phy-names = "ufsphy";
 			lanes-per-direction = <2>;
 			#reset-cells = <1>;
@@ -2169,10 +2169,8 @@ ufs_mem_hc: ufshc@1d84000 {
 
 		ufs_mem_phy: phy@1d87000 {
 			compatible = "qcom,sm8250-qmp-ufs-phy";
-			reg = <0 0x01d87000 0 0x1c0>;
-			#address-cells = <2>;
-			#size-cells = <2>;
-			ranges;
+			reg = <0 0x01d87000 0 0x1000>;
+
 			clock-names = "ref",
 				      "ref_aux";
 			clocks = <&rpmhcc RPMH_CXO_CLK>,
@@ -2180,16 +2178,12 @@ ufs_mem_phy: phy@1d87000 {
 
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
-			status = "disabled";
 
-			ufs_mem_phy_lanes: phy@1d87400 {
-				reg = <0 0x01d87400 0 0x16c>,
-				      <0 0x01d87600 0 0x200>,
-				      <0 0x01d87c00 0 0x200>,
-				      <0 0x01d87800 0 0x16c>,
-				      <0 0x01d87a00 0 0x200>;
-				#phy-cells = <0>;
-			};
+			power-domains = <&gcc UFS_PHY_GDSC>;
+
+			#phy-cells = <0>;
+
+			status = "disabled";
 		};
 
 		ipa_virt: interconnect@1e00000 {
diff --git a/arch/arm64/boot/dts/qcom/sm8450.dtsi b/arch/arm64/boot/dts/qcom/sm8450.dtsi
index 128542582b3d..aa0977af9411 100644
--- a/arch/arm64/boot/dts/qcom/sm8450.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm8450.dtsi
@@ -3153,6 +3153,8 @@ ufs_mem_phy: phy@1d87000 {
 				 <&gcc GCC_UFS_PHY_PHY_AUX_CLK>,
 				 <&gcc GCC_UFS_0_CLKREF_EN>;
 
+			power-domains = <&gcc UFS_PHY_GDSC>;
+
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
 			status = "disabled";
diff --git a/arch/arm64/boot/dts/renesas/r8a779a0.dtsi b/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
index b677ef6705d9..158c99b1a7b7 100644
--- a/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
@@ -2209,8 +2209,7 @@ gic: interrupt-controller@f1000000 {
 			interrupt-controller;
 			reg = <0x0 0xf1000000 0 0x20000>,
 			      <0x0 0xf1060000 0 0x110000>;
-			interrupts = <GIC_PPI 9
-				      (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_HIGH)>;
+			interrupts = <GIC_PPI 9 IRQ_TYPE_LEVEL_HIGH>;
 		};
 
 		fcpvd0: fcp@fea10000 {
@@ -2857,9 +2856,12 @@ sensor5_crit: sensor5-crit {
 
 	timer {
 		compatible = "arm,armv8-timer";
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
+		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
diff --git a/arch/arm64/boot/dts/renesas/r8a779f0.dtsi b/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
index 4092c0016035..140c4672ff5b 100644
--- a/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
@@ -935,8 +935,7 @@ gic: interrupt-controller@f1000000 {
 			interrupt-controller;
 			reg = <0x0 0xf1000000 0 0x20000>,
 			      <0x0 0xf1060000 0 0x110000>;
-			interrupts = <GIC_PPI 9
-				      (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_HIGH)>;
+			interrupts = <GIC_PPI 9 IRQ_TYPE_LEVEL_HIGH>;
 		};
 
 		prr: chipid@fff00044 {
@@ -991,10 +990,13 @@ sensor3_crit: sensor3-crit {
 
 	timer {
 		compatible = "arm,armv8-timer";
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_LOW)>;
+		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 
 	ufs30_clk: ufs30-clk {
diff --git a/arch/arm64/boot/dts/renesas/r8a779g0.dtsi b/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
index 868d1a3cbdf6..3de3ea0073c3 100644
--- a/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
@@ -18,12 +18,80 @@ cpus {
 		#address-cells = <1>;
 		#size-cells = <0>;
 
+		cpu-map {
+			cluster0 {
+				core0 {
+					cpu = <&a76_0>;
+				};
+				core1 {
+					cpu = <&a76_1>;
+				};
+			};
+
+			cluster1 {
+				core0 {
+					cpu = <&a76_2>;
+				};
+				core1 {
+					cpu = <&a76_3>;
+				};
+			};
+		};
+
 		a76_0: cpu@0 {
 			compatible = "arm,cortex-a76";
 			reg = <0>;
 			device_type = "cpu";
 			power-domains = <&sysc R8A779G0_PD_A1E0D0C0>;
+			next-level-cache = <&L3_CA76_0>;
+			enable-method = "psci";
+		};
+
+		a76_1: cpu@100 {
+			compatible = "arm,cortex-a76";
+			reg = <0x100>;
+			device_type = "cpu";
+			power-domains = <&sysc R8A779G0_PD_A1E0D0C1>;
+			next-level-cache = <&L3_CA76_0>;
+			enable-method = "psci";
+		};
+
+		a76_2: cpu@10000 {
+			compatible = "arm,cortex-a76";
+			reg = <0x10000>;
+			device_type = "cpu";
+			power-domains = <&sysc R8A779G0_PD_A1E0D1C0>;
+			next-level-cache = <&L3_CA76_1>;
+			enable-method = "psci";
 		};
+
+		a76_3: cpu@10100 {
+			compatible = "arm,cortex-a76";
+			reg = <0x10100>;
+			device_type = "cpu";
+			power-domains = <&sysc R8A779G0_PD_A1E0D1C1>;
+			next-level-cache = <&L3_CA76_1>;
+			enable-method = "psci";
+		};
+
+		L3_CA76_0: cache-controller-0 {
+			compatible = "cache";
+			power-domains = <&sysc R8A779G0_PD_A2E0D0>;
+			cache-unified;
+			cache-level = <3>;
+		};
+
+		L3_CA76_1: cache-controller-1 {
+			compatible = "cache";
+			power-domains = <&sysc R8A779G0_PD_A2E0D1>;
+			cache-unified;
+			cache-level = <3>;
+		};
+	};
+
+	psci {
+		compatible = "arm,psci-1.0", "arm,psci-0.2";
+		method = "smc";
 	};
 
 	extal_clk: extal {
@@ -482,8 +550,7 @@ gic: interrupt-controller@f1000000 {
 			interrupt-controller;
 			reg = <0x0 0xf1000000 0 0x20000>,
 			      <0x0 0xf1060000 0 0x110000>;
-			interrupts = <GIC_PPI 9
-				      (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_HIGH)>;
+			interrupts = <GIC_PPI 9 IRQ_TYPE_LEVEL_HIGH>;
 		};
 
 		prr: chipid@fff00044 {
@@ -494,9 +561,12 @@ prr: chipid@fff00044 {
 
 	timer {
 		compatible = "arm,armv8-timer";
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
+		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
diff --git a/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi b/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
index 011d4c88f4ed..2e7db48462e1 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
@@ -41,10 +41,13 @@ psci {
 
 	timer {
 		compatible = "arm,armv8-timer";
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
+		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
 
diff --git a/arch/arm64/boot/dts/renesas/r9a07g044.dtsi b/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
index d26488b5a82d..4703fbc9a8e0 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
@@ -1091,9 +1091,12 @@ target: trip-point {
 
 	timer {
 		compatible = "arm,armv8-timer";
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>;
+		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
diff --git a/arch/arm64/boot/dts/renesas/r9a07g044c1.dtsi b/arch/arm64/boot/dts/renesas/r9a07g044c1.dtsi
index 1d57df706939..56a979e82c4f 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g044c1.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g044c1.dtsi
@@ -15,13 +15,6 @@ cpus {
 		/delete-node/ cpu-map;
 		/delete-node/ cpu@100;
 	};
-
-	timer {
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
-	};
 };
 
 &soc {
diff --git a/arch/arm64/boot/dts/renesas/r9a07g044l1.dtsi b/arch/arm64/boot/dts/renesas/r9a07g044l1.dtsi
index 9d89d4590358..9cf27ca9f1d2 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g044l1.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g044l1.dtsi
@@ -15,11 +15,4 @@ cpus {
 		/delete-node/ cpu-map;
 		/delete-node/ cpu@100;
 	};
-
-	timer {
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
-	};
 };
diff --git a/arch/arm64/boot/dts/renesas/r9a07g054.dtsi b/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
index b3d37ca942ee..60a20a3ca12e 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
@@ -1097,9 +1097,12 @@ target: trip-point {
 
 	timer {
 		compatible = "arm,armv8-timer";
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>;
+		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
diff --git a/arch/arm64/boot/dts/renesas/r9a07g054l1.dtsi b/arch/arm64/boot/dts/renesas/r9a07g054l1.dtsi
index c448cc6634c1..d85a6ac0f024 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g054l1.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g054l1.dtsi
@@ -15,11 +15,4 @@ cpus {
 		/delete-node/ cpu-map;
 		/delete-node/ cpu@100;
 	};
-
-	timer {
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
-	};
 };
diff --git a/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts b/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
index edc8d2e3980d..bc9e98fe0f01 100644
--- a/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
@@ -17,6 +17,7 @@ aliases {
 		ethernet0 = &gmac;
 		mmc0 = &emmc;
 		mmc1 = &sdmmc;
+		mmc2 = &sdio;
 	};
 
 	chosen {
@@ -145,11 +146,25 @@ &emmc {
 
 &gmac {
 	clock_in_out = "output";
+	phy-handle = <&rtl8201f>;
 	phy-supply = <&vcc_io>;
-	snps,reset-gpio = <&gpio0 RK_PA7 GPIO_ACTIVE_LOW>;
-	snps,reset-active-low;
-	snps,reset-delays-us = <0 50000 50000>;
 	status = "okay";
+
+	mdio {
+		compatible = "snps,dwmac-mdio";
+		#address-cells = <1>;
+		#size-cells = <0>;
+
+		rtl8201f: ethernet-phy@1 {
+			compatible = "ethernet-phy-ieee802.3-c22";
+			reg = <1>;
+			pinctrl-names = "default";
+			pinctrl-0 = <&mac_rst>;
+			reset-assert-us = <20000>;
+			reset-deassert-us = <50000>;
+			reset-gpios = <&gpio0 RK_PA7 GPIO_ACTIVE_LOW>;
+		};
+	};
 };
 
 &i2c1 {
@@ -160,6 +175,26 @@ &pinctrl {
 	pinctrl-names = "default";
 	pinctrl-0 = <&rtc_32k>;
 
+	bluetooth {
+		bt_reg_on: bt-reg-on {
+			rockchip,pins = <4 RK_PB3 RK_FUNC_GPIO &pcfg_pull_none>;
+		};
+
+		bt_wake_host: bt-wake-host {
+			rockchip,pins = <4 RK_PB4 RK_FUNC_GPIO &pcfg_pull_down>;
+		};
+
+		host_wake_bt: host-wake-bt {
+			rockchip,pins = <4 RK_PB2 RK_FUNC_GPIO &pcfg_pull_none>;
+		};
+	};
+
+	gmac {
+		mac_rst: mac-rst {
+			rockchip,pins = <0 RK_PA7 RK_FUNC_GPIO &pcfg_pull_none>;
+		};
+	};
+
 	leds {
 		green_led: green-led {
 			rockchip,pins = <0 RK_PA6 RK_FUNC_GPIO &pcfg_pull_none>;
@@ -203,15 +238,31 @@ &sdio {
 	cap-sd-highspeed;
 	cap-sdio-irq;
 	keep-power-in-suspend;
-	max-frequency = <1000000>;
+	max-frequency = <100000000>;
 	mmc-pwrseq = <&sdio_pwrseq>;
+	no-mmc;
+	no-sd;
 	non-removable;
-	sd-uhs-sdr104;
+	sd-uhs-sdr50;
+	vmmc-supply = <&vcc_io>;
+	vqmmc-supply = <&vcc_1v8>;
 	status = "okay";
+
+	rtl8723ds: wifi@1 {
+		reg = <1>;
+		interrupt-parent = <&gpio0>;
+		interrupts = <RK_PA0 IRQ_TYPE_LEVEL_HIGH>;
+		interrupt-names = "host-wake";
+		pinctrl-names = "default";
+		pinctrl-0 = <&wifi_host_wake>;
+	};
 };
 
 &sdmmc {
+	cap-mmc-highspeed;
 	cap-sd-highspeed;
+	disable-wp;
+	vmmc-supply = <&vcc_io>;
 	status = "okay";
 };
 
@@ -230,16 +281,22 @@ u2phy_otg: otg-port {
 };
 
 &uart0 {
+	pinctrl-names = "default";
+	pinctrl-0 = <&uart0_xfer>;
 	status = "okay";
 };
 
 &uart4 {
+	uart-has-rtscts;
 	status = "okay";
 
 	bluetooth {
-		compatible = "realtek,rtl8723bs-bt";
-		device-wake-gpios = <&gpio4 RK_PB3 GPIO_ACTIVE_HIGH>;
+		compatible = "realtek,rtl8723ds-bt";
+		device-wake-gpios = <&gpio4 RK_PB2 GPIO_ACTIVE_HIGH>;
+		enable-gpios = <&gpio4 RK_PB3 GPIO_ACTIVE_HIGH>;
 		host-wake-gpios = <&gpio4 RK_PB4 GPIO_ACTIVE_HIGH>;
+		pinctrl-names = "default";
+		pinctrl-0 = <&bt_reg_on &bt_wake_host &host_wake_bt>;
 	};
 };
 
diff --git a/arch/arm64/boot/dts/rockchip/rk3328.dtsi b/arch/arm64/boot/dts/rockchip/rk3328.dtsi
index d42846efff2f..5adb2fbc2aaf 100644
--- a/arch/arm64/boot/dts/rockchip/rk3328.dtsi
+++ b/arch/arm64/boot/dts/rockchip/rk3328.dtsi
@@ -820,8 +820,8 @@ cru: clock-controller@ff440000 {
 			<0>, <24000000>,
 			<24000000>, <24000000>,
 			<15000000>, <15000000>,
-			<100000000>, <100000000>,
-			<100000000>, <100000000>,
+			<300000000>, <100000000>,
+			<400000000>, <100000000>,
 			<50000000>, <100000000>,
 			<100000000>, <100000000>,
 			<50000000>, <50000000>,
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts b/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
index 674792567fa6..4fc8354e069a 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
@@ -478,7 +478,7 @@ regulator-state-mem {
 		};
 
 		codec {
-			mic-in-differential;
+			rockchip,mic-in-differential;
 		};
 	};
 };
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts b/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
index bab46db2b18c..478620c78259 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
@@ -481,10 +481,6 @@ regulator-state-mem {
 				};
 			};
 		};
-
-		codec {
-			mic-in-differential;
-		};
 	};
 };
 
diff --git a/arch/arm64/boot/dts/rockchip/rk356x.dtsi b/arch/arm64/boot/dts/rockchip/rk356x.dtsi
index 99ad6fc51b58..e5c88f000725 100644
--- a/arch/arm64/boot/dts/rockchip/rk356x.dtsi
+++ b/arch/arm64/boot/dts/rockchip/rk356x.dtsi
@@ -737,6 +737,7 @@ vop_mmu: iommu@fe043e00 {
 		clocks = <&cru ACLK_VOP>, <&cru HCLK_VOP>;
 		clock-names = "aclk", "iface";
 		#iommu-cells = <0>;
+		power-domains = <&power RK3568_PD_VO>;
 		status = "disabled";
 	};
 
diff --git a/arch/m68k/amiga/config.c b/arch/m68k/amiga/config.c
index 3137b45750df..b7cb28f5ee29 100644
--- a/arch/m68k/amiga/config.c
+++ b/arch/m68k/amiga/config.c
@@ -180,6 +180,15 @@ int __init amiga_parse_bootinfo(const struct bi_record *record)
 			dev->slotsize = be16_to_cpu(cd->cd_SlotSize);
 			dev->boardaddr = be32_to_cpu(cd->cd_BoardAddr);
 			dev->boardsize = be32_to_cpu(cd->cd_BoardSize);
+
+			/* CS-LAB Warp 1260 workaround */
+			if (be16_to_cpu(dev->rom.er_Manufacturer) == ZORRO_MANUF(ZORRO_PROD_CSLAB_WARP_1260) &&
+			    dev->rom.er_Product == ZORRO_PROD(ZORRO_PROD_CSLAB_WARP_1260)) {
+
+				/* turn off all interrupts */
+				pr_info("Warp 1260 card detected: applying interrupt storm workaround\n");
+				*(uint32_t *)(dev->boardaddr + 0x1000) = 0xfff;
+			}
 		} else
 			pr_warn("amiga_parse_bootinfo: too many AutoConfig devices\n");
 #endif /* CONFIG_ZORRO */
diff --git a/arch/m68k/atari/ataints.c b/arch/m68k/atari/ataints.c
index 56f02ea2c248..715d1e0d973e 100644
--- a/arch/m68k/atari/ataints.c
+++ b/arch/m68k/atari/ataints.c
@@ -302,11 +302,7 @@ void __init atari_init_IRQ(void)
 
 	if (ATARIHW_PRESENT(SCU)) {
 		/* init the SCU if present */
-		tt_scu.sys_mask = 0x10;		/* enable VBL (for the cursor) and
-									 * disable HSYNC interrupts (who
-									 * needs them?)  MFP and SCC are
-									 * enabled in VME mask
-									 */
+		tt_scu.sys_mask = 0x0;		/* disable all interrupts */
 		tt_scu.vme_mask = 0x60;		/* enable MFP and SCC ints */
 	} else {
 		/* If no SCU and no Hades, the HSYNC interrupt needs to be
diff --git a/arch/m68k/include/asm/cmpxchg.h b/arch/m68k/include/asm/cmpxchg.h
index 6cf464cdab06..694a44a5c3b0 100644
--- a/arch/m68k/include/asm/cmpxchg.h
+++ b/arch/m68k/include/asm/cmpxchg.h
@@ -32,7 +32,7 @@ static inline unsigned long __xchg(unsigned long x, volatile void * ptr, int siz
 		x = tmp;
 		break;
 	default:
-		tmp = __invalid_xchg_size(x, ptr, size);
+		x = __invalid_xchg_size(x, ptr, size);
 		break;
 	}
 
diff --git a/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi b/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
index c16b521308cb..9089d1e4f3fe 100644
--- a/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
+++ b/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
@@ -23,14 +23,6 @@ cpu0: cpu@0 {
 		};
 	};
 
-	memory@200000 {
-		compatible = "memory";
-		device_type = "memory";
-		reg = <0x00000000 0x00200000 0x00000000 0x0ee00000>, /* 238 MB at 2 MB */
-			<0x00000000 0x20000000 0x00000000 0x1f000000>, /* 496 MB at 512 MB */
-			<0x00000001 0x10000000 0x00000001 0xb0000000>; /* 6912 MB at 4352MB */
-	};
-
 	cpu_clk: cpu_clk {
 		#clock-cells = <0>;
 		compatible = "fixed-clock";
@@ -52,6 +44,13 @@ package0: bus@10000000 {
 			0 0x40000000 0 0x40000000 0 0x40000000
 			0xfe 0x00000000 0xfe 0x00000000 0 0x40000000>;
 
+		isa@18000000 {
+			compatible = "isa";
+			#size-cells = <1>;
+			#address-cells = <2>;
+			ranges = <1 0x0 0x0 0x18000000 0x4000>;
+		};
+
 		pm: reset-controller@1fe07000 {
 			compatible = "loongson,ls2k-pm";
 			reg = <0 0x1fe07000 0 0x422>;
@@ -130,7 +129,8 @@ gmac@3,0 {
 					     <13 IRQ_TYPE_LEVEL_LOW>;
 				interrupt-names = "macirq", "eth_lpi";
 				interrupt-parent = <&liointc0>;
-				phy-mode = "rgmii";
+				phy-mode = "rgmii-id";
+				phy-handle = <&phy1>;
 				mdio {
 					#address-cells = <1>;
 					#size-cells = <0>;
@@ -153,7 +153,8 @@ gmac@3,1 {
 					     <15 IRQ_TYPE_LEVEL_LOW>;
 				interrupt-names = "macirq", "eth_lpi";
 				interrupt-parent = <&liointc0>;
-				phy-mode = "rgmii";
+				phy-mode = "rgmii-id";
+				phy-handle = <&phy1>;
 				mdio {
 					#address-cells = <1>;
 					#size-cells = <0>;
diff --git a/arch/mips/include/asm/mach-loongson64/boot_param.h b/arch/mips/include/asm/mach-loongson64/boot_param.h
index e007edd6b60a..9218b3ae3383 100644
--- a/arch/mips/include/asm/mach-loongson64/boot_param.h
+++ b/arch/mips/include/asm/mach-loongson64/boot_param.h
@@ -42,12 +42,14 @@ enum loongson_cpu_type {
 	Legacy_1B = 0x5,
 	Legacy_2G = 0x6,
 	Legacy_2H = 0x7,
+	Legacy_2K = 0x8,
 	Loongson_1A = 0x100,
 	Loongson_1B = 0x101,
 	Loongson_2E = 0x200,
 	Loongson_2F = 0x201,
 	Loongson_2G = 0x202,
 	Loongson_2H = 0x203,
+	Loongson_2K = 0x204,
 	Loongson_3A = 0x300,
 	Loongson_3B = 0x301
 };
diff --git a/arch/mips/include/asm/mips-cm.h b/arch/mips/include/asm/mips-cm.h
index 23c67c0871b1..696b40beb774 100644
--- a/arch/mips/include/asm/mips-cm.h
+++ b/arch/mips/include/asm/mips-cm.h
@@ -228,6 +228,10 @@ GCR_ACCESSOR_RO(32, 0x0d0, gic_status)
 GCR_ACCESSOR_RO(32, 0x0f0, cpc_status)
 #define CM_GCR_CPC_STATUS_EX			BIT(0)
 
+/* GCR_ACCESS - Controls core/IOCU access to GCRs */
+GCR_ACCESSOR_RW(32, 0x120, access_cm3)
+#define CM_GCR_ACCESS_ACCESSEN			GENMASK(7, 0)
+
 /* GCR_L2_CONFIG - Indicates L2 cache configuration when Config5.L2C=1 */
 GCR_ACCESSOR_RW(32, 0x130, l2_config)
 #define CM_GCR_L2_CONFIG_BYPASS			BIT(20)
diff --git a/arch/mips/kernel/smp-cps.c b/arch/mips/kernel/smp-cps.c
index bcd6a944b839..739997e6fd65 100644
--- a/arch/mips/kernel/smp-cps.c
+++ b/arch/mips/kernel/smp-cps.c
@@ -230,7 +230,10 @@ static void boot_core(unsigned int core, unsigned int vpe_id)
 	write_gcr_co_reset_ext_base(CM_GCR_Cx_RESET_EXT_BASE_UEB);
 
 	/* Ensure the core can access the GCRs */
-	set_gcr_access(1 << core);
+	if (mips_cm_revision() < CM_REV_CM3)
+		set_gcr_access(1 << core);
+	else
+		set_gcr_access_cm3(1 << core);
 
 	if (mips_cpc_present()) {
 		/* Reset the core */
diff --git a/arch/mips/loongson64/env.c b/arch/mips/loongson64/env.c
index ef3750a6ffac..09ff05269861 100644
--- a/arch/mips/loongson64/env.c
+++ b/arch/mips/loongson64/env.c
@@ -88,6 +88,12 @@ void __init prom_lefi_init_env(void)
 	cpu_clock_freq = ecpu->cpu_clock_freq;
 	loongson_sysconf.cputype = ecpu->cputype;
 	switch (ecpu->cputype) {
+	case Legacy_2K:
+	case Loongson_2K:
+		smp_group[0] = 0x900000001fe11000;
+		loongson_sysconf.cores_per_node = 2;
+		loongson_sysconf.cores_per_package = 2;
+		break;
 	case Legacy_3A:
 	case Loongson_3A:
 		loongson_sysconf.cores_per_node = 4;
@@ -221,6 +227,8 @@ void __init prom_lefi_init_env(void)
 		default:
 			break;
 		}
+	} else if ((read_c0_prid() & PRID_IMP_MASK) == PRID_IMP_LOONGSON_64R) {
+		loongson_fdt_blob = __dtb_loongson64_2core_2k1000_begin;
 	} else if ((read_c0_prid() & PRID_IMP_MASK) == PRID_IMP_LOONGSON_64G) {
 		if (loongson_sysconf.bridgetype == LS7A)
 			loongson_fdt_blob = __dtb_loongson64g_4core_ls7a_begin;
diff --git a/arch/mips/loongson64/reset.c b/arch/mips/loongson64/reset.c
index e420800043b0..2a8e4cd72605 100644
--- a/arch/mips/loongson64/reset.c
+++ b/arch/mips/loongson64/reset.c
@@ -11,6 +11,7 @@
 #include <linux/init.h>
 #include <linux/kexec.h>
 #include <linux/pm.h>
+#include <linux/reboot.h>
 #include <linux/slab.h>
 
 #include <asm/bootinfo.h>
@@ -21,36 +22,21 @@
 #include <loongson.h>
 #include <boot_param.h>
 
-static void loongson_restart(char *command)
+static int firmware_restart(struct sys_off_data *unusedd)
 {
 
 	void (*fw_restart)(void) = (void *)loongson_sysconf.restart_addr;
 
 	fw_restart();
-	while (1) {
-		if (cpu_wait)
-			cpu_wait();
-	}
+	return NOTIFY_DONE;
 }
 
-static void loongson_poweroff(void)
+static int firmware_poweroff(struct sys_off_data *unused)
 {
 	void (*fw_poweroff)(void) = (void *)loongson_sysconf.poweroff_addr;
 
 	fw_poweroff();
-	while (1) {
-		if (cpu_wait)
-			cpu_wait();
-	}
-}
-
-static void loongson_halt(void)
-{
-	pr_notice("\n\n** You can safely turn off the power now **\n\n");
-	while (1) {
-		if (cpu_wait)
-			cpu_wait();
-	}
+	return NOTIFY_DONE;
 }
 
 #ifdef CONFIG_KEXEC
@@ -154,9 +140,17 @@ static void loongson_crash_shutdown(struct pt_regs *regs)
 
 static int __init mips_reboot_setup(void)
 {
-	_machine_restart = loongson_restart;
-	_machine_halt = loongson_halt;
-	pm_power_off = loongson_poweroff;
+	if (loongson_sysconf.restart_addr) {
+		register_sys_off_handler(SYS_OFF_MODE_RESTART,
+				 SYS_OFF_PRIO_FIRMWARE,
+				 firmware_restart, NULL);
+	}
+
+	if (loongson_sysconf.poweroff_addr) {
+		register_sys_off_handler(SYS_OFF_MODE_POWER_OFF,
+				 SYS_OFF_PRIO_FIRMWARE,
+				 firmware_poweroff, NULL);
+	}
 
 #ifdef CONFIG_KEXEC
 	kexec_argv = kmalloc(KEXEC_ARGV_SIZE, GFP_KERNEL);
diff --git a/arch/mips/loongson64/smp.c b/arch/mips/loongson64/smp.c
index 660e1de4412a..52dc95995783 100644
--- a/arch/mips/loongson64/smp.c
+++ b/arch/mips/loongson64/smp.c
@@ -479,12 +479,25 @@ static void loongson3_smp_finish(void)
 static void __init loongson3_smp_setup(void)
 {
 	int i = 0, num = 0; /* i: physical id, num: logical id */
+	int max_cpus = 0;
 
 	init_cpu_possible(cpu_none_mask);
 
+	for (i = 0; i < ARRAY_SIZE(smp_group); i++) {
+		if (!smp_group[i])
+			break;
+		max_cpus += loongson_sysconf.cores_per_node;
+	}
+
+	if (max_cpus < loongson_sysconf.nr_cpus) {
+		pr_err("SMP Groups are less than the number of CPUs\n");
+		loongson_sysconf.nr_cpus = max_cpus ? max_cpus : 1;
+	}
+
 	/* For unified kernel, NR_CPUS is the maximum possible value,
 	 * loongson_sysconf.nr_cpus is the really present value
 	 */
+	i = 0;
 	while (i < loongson_sysconf.nr_cpus) {
 		if (loongson_sysconf.reserved_cpus_mask & (1<<i)) {
 			/* Reserved physical CPU cores */
@@ -505,14 +518,14 @@ static void __init loongson3_smp_setup(void)
 		__cpu_logical_map[num] = -1;
 		num++;
 	}
-
 	csr_ipi_probe();
 	ipi_set0_regs_init();
 	ipi_clear0_regs_init();
 	ipi_status0_regs_init();
 	ipi_en0_regs_init();
 	ipi_mailbox_buf_init();
-	ipi_write_enable(0);
+	if (smp_group[0])
+		ipi_write_enable(0);
 
 	cpu_set_core(&cpu_data[0],
 		     cpu_logical_map(0) % loongson_sysconf.cores_per_package);
@@ -829,6 +842,9 @@ static int loongson3_disable_clock(unsigned int cpu)
 	uint64_t core_id = cpu_core(&cpu_data[cpu]);
 	uint64_t package_id = cpu_data[cpu].package;
 
+	if (!loongson_chipcfg[package_id] || !loongson_freqctrl[package_id])
+		return 0;
+
 	if ((read_c0_prid() & PRID_REV_MASK) == PRID_REV_LOONGSON3A_R1) {
 		LOONGSON_CHIPCFG(package_id) &= ~(1 << (12 + core_id));
 	} else {
@@ -843,6 +859,9 @@ static int loongson3_enable_clock(unsigned int cpu)
 	uint64_t core_id = cpu_core(&cpu_data[cpu]);
 	uint64_t package_id = cpu_data[cpu].package;
 
+	if (!loongson_chipcfg[package_id] || !loongson_freqctrl[package_id])
+		return 0;
+
 	if ((read_c0_prid() & PRID_REV_MASK) == PRID_REV_LOONGSON3A_R1) {
 		LOONGSON_CHIPCFG(package_id) |= 1 << (12 + core_id);
 	} else {
diff --git a/arch/mips/pci/pcie-octeon.c b/arch/mips/pci/pcie-octeon.c
old mode 100755
new mode 100644
diff --git a/arch/mips/sgi-ip30/ip30-console.c b/arch/mips/sgi-ip30/ip30-console.c
index b91f8c4fdc78..a087b7ebe129 100644
--- a/arch/mips/sgi-ip30/ip30-console.c
+++ b/arch/mips/sgi-ip30/ip30-console.c
@@ -1,6 +1,7 @@
 // SPDX-License-Identifier: GPL-2.0
 
 #include <linux/io.h>
+#include <linux/processor.h>
 
 #include <asm/sn/ioc3.h>
 
diff --git a/arch/parisc/Kconfig b/arch/parisc/Kconfig
index 5762633ea95e..3341d4a42199 100644
--- a/arch/parisc/Kconfig
+++ b/arch/parisc/Kconfig
@@ -75,6 +75,7 @@ config PARISC
 	select HAVE_SOFTIRQ_ON_OWN_STACK if IRQSTACKS
 	select TRACE_IRQFLAGS_SUPPORT
 	select HAVE_FUNCTION_DESCRIPTORS if 64BIT
+	select PCI_MSI_ARCH_FALLBACKS if PCI_MSI
 
 	help
 	  The PA-RISC microprocessor is designed by Hewlett-Packard and used
diff --git a/arch/powerpc/configs/85xx-hw.config b/arch/powerpc/configs/85xx-hw.config
index 524db76f47b7..8aff83217397 100644
--- a/arch/powerpc/configs/85xx-hw.config
+++ b/arch/powerpc/configs/85xx-hw.config
@@ -24,6 +24,7 @@ CONFIG_FS_ENET=y
 CONFIG_FSL_CORENET_CF=y
 CONFIG_FSL_DMA=y
 CONFIG_FSL_HV_MANAGER=y
+CONFIG_FSL_IFC=y
 CONFIG_FSL_PQ_MDIO=y
 CONFIG_FSL_RIO=y
 CONFIG_FSL_XGMAC_MDIO=y
@@ -58,6 +59,7 @@ CONFIG_INPUT_FF_MEMLESS=m
 CONFIG_MARVELL_PHY=y
 CONFIG_MDIO_BUS_MUX_GPIO=y
 CONFIG_MDIO_BUS_MUX_MMIOREG=y
+CONFIG_MEMORY=y
 CONFIG_MMC_SDHCI_OF_ESDHC=y
 CONFIG_MMC_SDHCI_PLTFM=y
 CONFIG_MMC_SDHCI=y
diff --git a/arch/powerpc/include/asm/kexec.h b/arch/powerpc/include/asm/kexec.h
index a1ddba01e7d1..f2db1b443920 100644
--- a/arch/powerpc/include/asm/kexec.h
+++ b/arch/powerpc/include/asm/kexec.h
@@ -181,6 +181,10 @@ static inline void crash_send_ipi(void (*crash_ipi_callback)(struct pt_regs *))
 
 #endif /* CONFIG_KEXEC_CORE */
 
+#if defined(CONFIG_KEXEC_FILE) || defined(CONFIG_CRASH_DUMP)
+int update_cpus_node(void *fdt);
+#endif
+
 #ifdef CONFIG_PPC_BOOK3S_64
 #include <asm/book3s/64/kexec.h>
 #endif
diff --git a/arch/powerpc/include/asm/plpks.h b/arch/powerpc/include/asm/plpks.h
new file mode 100644
index 000000000000..9e2219b0202d
--- /dev/null
+++ b/arch/powerpc/include/asm/plpks.h
@@ -0,0 +1,163 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+/*
+ * Copyright (C) 2022 IBM Corporation
+ * Author: Nayna Jain <nayna@linux.ibm.com>
+ *
+ * Platform keystore for pseries LPAR(PLPKS).
+ */
+
+#ifndef _ASM_POWERPC_PLPKS_H
+#define _ASM_POWERPC_PLPKS_H
+
+#ifdef CONFIG_PSERIES_PLPKS
+
+#include <linux/types.h>
+#include <linux/list.h>
+
+// Object policy flags from supported_policies
+#define PLPKS_OSSECBOOTAUDIT	PPC_BIT32(1) // OS secure boot must be audit/enforce
+#define PLPKS_OSSECBOOTENFORCE	PPC_BIT32(2) // OS secure boot must be enforce
+#define PLPKS_PWSET		PPC_BIT32(3) // No access without password set
+#define PLPKS_WORLDREADABLE	PPC_BIT32(4) // Readable without authentication
+#define PLPKS_IMMUTABLE		PPC_BIT32(5) // Once written, object cannot be removed
+#define PLPKS_TRANSIENT		PPC_BIT32(6) // Object does not persist through reboot
+#define PLPKS_SIGNEDUPDATE	PPC_BIT32(7) // Object can only be modified by signed updates
+#define PLPKS_HVPROVISIONED	PPC_BIT32(28) // Hypervisor has provisioned this object
+
+// Signature algorithm flags from signed_update_algorithms
+#define PLPKS_ALG_RSA2048	PPC_BIT(0)
+#define PLPKS_ALG_RSA4096	PPC_BIT(1)
+
+// Object label OS metadata flags
+#define PLPKS_VAR_LINUX		0x02
+#define PLPKS_VAR_COMMON	0x04
+
+// Flags for which consumer owns an object is owned by
+#define PLPKS_FW_OWNER			0x1
+#define PLPKS_BOOTLOADER_OWNER		0x2
+#define PLPKS_OS_OWNER			0x3
+
+// Flags for label metadata fields
+#define PLPKS_LABEL_VERSION		0
+#define PLPKS_MAX_LABEL_ATTR_SIZE	16
+#define PLPKS_MAX_NAME_SIZE		239
+#define PLPKS_MAX_DATA_SIZE		4000
+
+// Timeouts for PLPKS operations
+#define PLPKS_MAX_TIMEOUT		(5 * USEC_PER_SEC)
+#define PLPKS_FLUSH_SLEEP		10000 // usec
+
+struct plpks_var {
+	char *component;
+	u8 *name;
+	u8 *data;
+	u32 policy;
+	u16 namelen;
+	u16 datalen;
+	u8 os;
+};
+
+struct plpks_var_name {
+	u8  *name;
+	u16 namelen;
+};
+
+struct plpks_var_name_list {
+	u32 varcount;
+	struct plpks_var_name varlist[];
+};
+
+/**
+ * Writes the specified var and its data to PKS.
+ * Any caller of PKS driver should present a valid component type for
+ * their variable.
+ */
+int plpks_write_var(struct plpks_var var);
+
+/**
+ * Removes the specified var and its data from PKS.
+ */
+int plpks_remove_var(char *component, u8 varos,
+		     struct plpks_var_name vname);
+
+/**
+ * Returns the data for the specified os variable.
+ */
+int plpks_read_os_var(struct plpks_var *var);
+
+/**
+ * Returns the data for the specified firmware variable.
+ */
+int plpks_read_fw_var(struct plpks_var *var);
+
+/**
+ * Returns the data for the specified bootloader variable.
+ */
+int plpks_read_bootloader_var(struct plpks_var *var);
+
+/**
+ * Returns if PKS is available on this LPAR.
+ */
+bool plpks_is_available(void);
+
+/**
+ * Returns version of the Platform KeyStore.
+ */
+u8 plpks_get_version(void);
+
+/**
+ * Returns hypervisor storage overhead per object, not including the size of
+ * the object or label. Only valid for config version >= 2
+ */
+u16 plpks_get_objoverhead(void);
+
+/**
+ * Returns maximum password size. Must be >= 32 bytes
+ */
+u16 plpks_get_maxpwsize(void);
+
+/**
+ * Returns maximum object size supported by Platform KeyStore.
+ */
+u16 plpks_get_maxobjectsize(void);
+
+/**
+ * Returns maximum object label size supported by Platform KeyStore.
+ */
+u16 plpks_get_maxobjectlabelsize(void);
+
+/**
+ * Returns total size of the configured Platform KeyStore.
+ */
+u32 plpks_get_totalsize(void);
+
+/**
+ * Returns used space from the total size of the Platform KeyStore.
+ */
+u32 plpks_get_usedspace(void);
+
+/**
+ * Returns bitmask of policies supported by the hypervisor.
+ */
+u32 plpks_get_supportedpolicies(void);
+
+/**
+ * Returns maximum byte size of a single object supported by the hypervisor.
+ * Only valid for config version >= 3
+ */
+u32 plpks_get_maxlargeobjectsize(void);
+
+/**
+ * Returns bitmask of signature algorithms supported for signed updates.
+ * Only valid for config version >= 3
+ */
+u64 plpks_get_signedupdatealgorithms(void);
+
+/**
+ * Returns the length of the PLPKS password in bytes.
+ */
+u16 plpks_get_passwordlen(void);
+
+#endif // CONFIG_PSERIES_PLPKS
+
+#endif // _ASM_POWERPC_PLPKS_H
diff --git a/arch/powerpc/kernel/prom.c b/arch/powerpc/kernel/prom.c
index 9531ab90feb8..e5b90d67cd53 100644
--- a/arch/powerpc/kernel/prom.c
+++ b/arch/powerpc/kernel/prom.c
@@ -324,6 +324,7 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
 					  void *data)
 {
 	const char *type = of_get_flat_dt_prop(node, "device_type", NULL);
+	const __be32 *cpu_version = NULL;
 	const __be32 *prop;
 	const __be32 *intserv;
 	int i, nthreads;
@@ -404,7 +405,7 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
 		prop = of_get_flat_dt_prop(node, "cpu-version", NULL);
 		if (prop && (be32_to_cpup(prop) & 0xff000000) == 0x0f000000) {
 			identify_cpu(0, be32_to_cpup(prop));
-			seq_buf_printf(&ppc_hw_desc, "0x%04x ", be32_to_cpup(prop));
+			cpu_version = prop;
 		}
 
 		check_cpu_feature_properties(node);
@@ -415,6 +416,12 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
 	}
 
 	identical_pvr_fixup(node);
+
+	// We can now add the CPU name & PVR to the hardware description
+	seq_buf_printf(&ppc_hw_desc, "%s 0x%04lx ", cur_cpu_spec->cpu_name, mfspr(SPRN_PVR));
+	if (cpu_version)
+		seq_buf_printf(&ppc_hw_desc, "0x%04x ", be32_to_cpup(cpu_version));
+
 	init_mmu_slb_size(node);
 
 #ifdef CONFIG_PPC64
@@ -852,9 +859,6 @@ void __init early_init_devtree(void *params)
 
 	dt_cpu_ftrs_scan();
 
-	// We can now add the CPU name & PVR to the hardware description
-	seq_buf_printf(&ppc_hw_desc, "%s 0x%04lx ", cur_cpu_spec->cpu_name, mfspr(SPRN_PVR));
-
 	/* Retrieve CPU related informations from the flat tree
 	 * (altivec support, boot CPU ID, ...)
 	 */
diff --git a/arch/powerpc/kexec/core_64.c b/arch/powerpc/kexec/core_64.c
index e465e4487737..653b3c8c6a53 100644
--- a/arch/powerpc/kexec/core_64.c
+++ b/arch/powerpc/kexec/core_64.c
@@ -17,6 +17,7 @@
 #include <linux/cpu.h>
 #include <linux/hardirq.h>
 #include <linux/of.h>
+#include <linux/libfdt.h>
 
 #include <asm/page.h>
 #include <asm/current.h>
@@ -31,6 +32,7 @@
 #include <asm/hw_breakpoint.h>
 #include <asm/svm.h>
 #include <asm/ultravisor.h>
+#include <asm/crashdump-ppc64.h>
 
 int machine_kexec_prepare(struct kimage *image)
 {
@@ -431,3 +433,113 @@ static int __init export_htab_values(void)
 }
 late_initcall(export_htab_values);
 #endif /* CONFIG_PPC_64S_HASH_MMU */
+
+#if defined(CONFIG_KEXEC_FILE) || defined(CONFIG_CRASH_DUMP)
+/**
+ * add_node_props - Reads node properties from device node structure and add
+ *                  them to fdt.
+ * @fdt:            Flattened device tree of the kernel
+ * @node_offset:    offset of the node to add a property at
+ * @dn:             device node pointer
+ *
+ * Returns 0 on success, negative errno on error.
+ */
+static int add_node_props(void *fdt, int node_offset, const struct device_node *dn)
+{
+	int ret = 0;
+	struct property *pp;
+
+	if (!dn)
+		return -EINVAL;
+
+	for_each_property_of_node(dn, pp) {
+		ret = fdt_setprop(fdt, node_offset, pp->name, pp->value, pp->length);
+		if (ret < 0) {
+			pr_err("Unable to add %s property: %s\n", pp->name, fdt_strerror(ret));
+			return ret;
+		}
+	}
+	return ret;
+}
+
+/**
+ * update_cpus_node - Update cpus node of flattened device tree using of_root
+ *                    device node.
+ * @fdt:              Flattened device tree of the kernel.
+ *
+ * Returns 0 on success, negative errno on error.
+ *
+ * Note: expecting no subnodes under /cpus/<node> with device_type == "cpu".
+ * If this changes, update this function to include them.
+ */
+int update_cpus_node(void *fdt)
+{
+	int prev_node_offset;
+	const char *device_type;
+	const struct fdt_property *prop;
+	struct device_node *cpus_node, *dn;
+	int cpus_offset, cpus_subnode_offset, ret = 0;
+
+	cpus_offset = fdt_path_offset(fdt, "/cpus");
+	if (cpus_offset < 0 && cpus_offset != -FDT_ERR_NOTFOUND) {
+		pr_err("Malformed device tree: error reading /cpus node: %s\n",
+		       fdt_strerror(cpus_offset));
+		return cpus_offset;
+	}
+
+	prev_node_offset = cpus_offset;
+	/* Delete sub-nodes of /cpus node with device_type == "cpu" */
+	for (cpus_subnode_offset = fdt_first_subnode(fdt, cpus_offset); cpus_subnode_offset >= 0;) {
+		/* Ignore nodes that do not have a device_type property or device_type != "cpu" */
+		prop = fdt_get_property(fdt, cpus_subnode_offset, "device_type", NULL);
+		if (!prop || strcmp(prop->data, "cpu")) {
+			prev_node_offset = cpus_subnode_offset;
+			goto next_node;
+		}
+
+		ret = fdt_del_node(fdt, cpus_subnode_offset);
+		if (ret < 0) {
+			pr_err("Failed to delete a cpus sub-node: %s\n", fdt_strerror(ret));
+			return ret;
+		}
+next_node:
+		if (prev_node_offset == cpus_offset)
+			cpus_subnode_offset = fdt_first_subnode(fdt, cpus_offset);
+		else
+			cpus_subnode_offset = fdt_next_subnode(fdt, prev_node_offset);
+	}
+
+	cpus_node = of_find_node_by_path("/cpus");
+	/* Fail here to avoid kexec/kdump kernel boot hung */
+	if (!cpus_node) {
+		pr_err("No /cpus node found\n");
+		return -EINVAL;
+	}
+
+	/* Add all /cpus sub-nodes of device_type == "cpu" to FDT */
+	for_each_child_of_node(cpus_node, dn) {
+		/* Ignore device nodes that do not have a device_type property
+		 * or device_type != "cpu".
+		 */
+		device_type = of_get_property(dn, "device_type", NULL);
+		if (!device_type || strcmp(device_type, "cpu"))
+			continue;
+
+		cpus_subnode_offset = fdt_add_subnode(fdt, cpus_offset, dn->full_name);
+		if (cpus_subnode_offset < 0) {
+			pr_err("Unable to add %s subnode: %s\n", dn->full_name,
+			       fdt_strerror(cpus_subnode_offset));
+			ret = cpus_subnode_offset;
+			goto out;
+		}
+
+		ret = add_node_props(fdt, cpus_subnode_offset, dn);
+		if (ret < 0)
+			goto out;
+	}
+out:
+	of_node_put(cpus_node);
+	of_node_put(dn);
+	return ret;
+}
+#endif /* CONFIG_KEXEC_FILE || CONFIG_CRASH_DUMP */
diff --git a/arch/powerpc/kexec/file_load_64.c b/arch/powerpc/kexec/file_load_64.c
index 349a781cea0b..180c1dfe4aa7 100644
--- a/arch/powerpc/kexec/file_load_64.c
+++ b/arch/powerpc/kexec/file_load_64.c
@@ -952,93 +952,6 @@ unsigned int kexec_extra_fdt_size_ppc64(struct kimage *image)
 	return (unsigned int)(usm_entries * sizeof(u64));
 }
 
-/**
- * add_node_props - Reads node properties from device node structure and add
- *                  them to fdt.
- * @fdt:            Flattened device tree of the kernel
- * @node_offset:    offset of the node to add a property at
- * @dn:             device node pointer
- *
- * Returns 0 on success, negative errno on error.
- */
-static int add_node_props(void *fdt, int node_offset, const struct device_node *dn)
-{
-	int ret = 0;
-	struct property *pp;
-
-	if (!dn)
-		return -EINVAL;
-
-	for_each_property_of_node(dn, pp) {
-		ret = fdt_setprop(fdt, node_offset, pp->name, pp->value, pp->length);
-		if (ret < 0) {
-			pr_err("Unable to add %s property: %s\n", pp->name, fdt_strerror(ret));
-			return ret;
-		}
-	}
-	return ret;
-}
-
-/**
- * update_cpus_node - Update cpus node of flattened device tree using of_root
- *                    device node.
- * @fdt:              Flattened device tree of the kernel.
- *
- * Returns 0 on success, negative errno on error.
- */
-static int update_cpus_node(void *fdt)
-{
-	struct device_node *cpus_node, *dn;
-	int cpus_offset, cpus_subnode_offset, ret = 0;
-
-	cpus_offset = fdt_path_offset(fdt, "/cpus");
-	if (cpus_offset < 0 && cpus_offset != -FDT_ERR_NOTFOUND) {
-		pr_err("Malformed device tree: error reading /cpus node: %s\n",
-		       fdt_strerror(cpus_offset));
-		return cpus_offset;
-	}
-
-	if (cpus_offset > 0) {
-		ret = fdt_del_node(fdt, cpus_offset);
-		if (ret < 0) {
-			pr_err("Error deleting /cpus node: %s\n", fdt_strerror(ret));
-			return -EINVAL;
-		}
-	}
-
-	/* Add cpus node to fdt */
-	cpus_offset = fdt_add_subnode(fdt, fdt_path_offset(fdt, "/"), "cpus");
-	if (cpus_offset < 0) {
-		pr_err("Error creating /cpus node: %s\n", fdt_strerror(cpus_offset));
-		return -EINVAL;
-	}
-
-	/* Add cpus node properties */
-	cpus_node = of_find_node_by_path("/cpus");
-	ret = add_node_props(fdt, cpus_offset, cpus_node);
-	of_node_put(cpus_node);
-	if (ret < 0)
-		return ret;
-
-	/* Loop through all subnodes of cpus and add them to fdt */
-	for_each_node_by_type(dn, "cpu") {
-		cpus_subnode_offset = fdt_add_subnode(fdt, cpus_offset, dn->full_name);
-		if (cpus_subnode_offset < 0) {
-			pr_err("Unable to add %s subnode: %s\n", dn->full_name,
-			       fdt_strerror(cpus_subnode_offset));
-			ret = cpus_subnode_offset;
-			goto out;
-		}
-
-		ret = add_node_props(fdt, cpus_subnode_offset, dn);
-		if (ret < 0)
-			goto out;
-	}
-out:
-	of_node_put(dn);
-	return ret;
-}
-
 static int copy_property(void *fdt, int node_offset, const struct device_node *dn,
 			 const char *propname)
 {
diff --git a/arch/powerpc/kvm/powerpc.c b/arch/powerpc/kvm/powerpc.c
index b850b0efa201..98ac5d39ad9c 100644
--- a/arch/powerpc/kvm/powerpc.c
+++ b/arch/powerpc/kvm/powerpc.c
@@ -1998,8 +1998,10 @@ static int kvm_vcpu_ioctl_enable_cap(struct kvm_vcpu *vcpu,
 			break;
 
 		r = -ENXIO;
-		if (!xive_enabled())
+		if (!xive_enabled()) {
+			fdput(f);
 			break;
+		}
 
 		r = -EPERM;
 		dev = kvm_device_from_filp(f.file);
diff --git a/arch/powerpc/platforms/pseries/plpks.c b/arch/powerpc/platforms/pseries/plpks.c
index 25f95440a773..d1eb6f0433fe 100644
--- a/arch/powerpc/platforms/pseries/plpks.c
+++ b/arch/powerpc/platforms/pseries/plpks.c
@@ -18,15 +18,23 @@
 #include <linux/types.h>
 #include <asm/hvcall.h>
 #include <asm/machdep.h>
-
-#include "plpks.h"
+#include <asm/plpks.h>
+#include <asm/firmware.h>
 
 static u8 *ospassword;
 static u16 ospasswordlength;
 
 // Retrieved with H_PKS_GET_CONFIG
+static u8 version;
+static u16 objoverhead;
 static u16 maxpwsize;
 static u16 maxobjsize;
+static s16 maxobjlabelsize;
+static u32 totalsize;
+static u32 usedspace;
+static u32 supportedpolicies;
+static u32 maxlargeobjectsize;
+static u64 signedupdatealgorithms;
 
 struct plpks_auth {
 	u8 version;
@@ -113,7 +121,8 @@ static int plpks_gen_password(void)
 	u8 *password, consumer = PLPKS_OS_OWNER;
 	int rc;
 
-	password = kzalloc(maxpwsize, GFP_KERNEL);
+	// The password must not cross a page boundary, so we align to the next power of 2
+	password = kzalloc(roundup_pow_of_two(maxpwsize), GFP_KERNEL);
 	if (!password)
 		return -ENOMEM;
 
@@ -149,7 +158,9 @@ static struct plpks_auth *construct_auth(u8 consumer)
 	if (consumer > PLPKS_OS_OWNER)
 		return ERR_PTR(-EINVAL);
 
-	auth = kzalloc(struct_size(auth, password, maxpwsize), GFP_KERNEL);
+	// The auth structure must not cross a page boundary and must be
+	// 16 byte aligned. We align to the next largest power of 2
+	auth = kzalloc(roundup_pow_of_two(struct_size(auth, password, maxpwsize)), GFP_KERNEL);
 	if (!auth)
 		return ERR_PTR(-ENOMEM);
 
@@ -183,7 +194,8 @@ static struct label *construct_label(char *component, u8 varos, u8 *name,
 	if (component && slen > sizeof(label->attr.prefix))
 		return ERR_PTR(-EINVAL);
 
-	label = kzalloc(sizeof(*label), GFP_KERNEL);
+	// The label structure must not cross a page boundary, so we align to the next power of 2
+	label = kzalloc(roundup_pow_of_two(sizeof(*label)), GFP_KERNEL);
 	if (!label)
 		return ERR_PTR(-ENOMEM);
 
@@ -203,32 +215,157 @@ static struct label *construct_label(char *component, u8 varos, u8 *name,
 static int _plpks_get_config(void)
 {
 	unsigned long retbuf[PLPAR_HCALL_BUFSIZE] = { 0 };
-	struct {
+	struct config {
 		u8 version;
 		u8 flags;
-		__be32 rsvd0;
+		__be16 rsvd0;
+		__be16 objoverhead;
 		__be16 maxpwsize;
 		__be16 maxobjlabelsize;
 		__be16 maxobjsize;
 		__be32 totalsize;
 		__be32 usedspace;
 		__be32 supportedpolicies;
-		__be64 rsvd1;
-	} __packed config;
+		__be32 maxlargeobjectsize;
+		__be64 signedupdatealgorithms;
+		u8 rsvd1[476];
+	} __packed * config;
 	size_t size;
-	int rc;
+	int rc = 0;
+
+	size = sizeof(*config);
+
+	// Config struct must not cross a page boundary. So long as the struct
+	// size is a power of 2, this should be fine as alignment is guaranteed
+	config = kzalloc(size, GFP_KERNEL);
+	if (!config) {
+		rc = -ENOMEM;
+		goto err;
+	}
+
+	rc = plpar_hcall(H_PKS_GET_CONFIG, retbuf, virt_to_phys(config), size);
+
+	if (rc != H_SUCCESS) {
+		rc = pseries_status_to_err(rc);
+		goto err;
+	}
+
+	version = config->version;
+	objoverhead = be16_to_cpu(config->objoverhead);
+	maxpwsize = be16_to_cpu(config->maxpwsize);
+	maxobjsize = be16_to_cpu(config->maxobjsize);
+	maxobjlabelsize = be16_to_cpu(config->maxobjlabelsize);
+	totalsize = be32_to_cpu(config->totalsize);
+	usedspace = be32_to_cpu(config->usedspace);
+	supportedpolicies = be32_to_cpu(config->supportedpolicies);
+	maxlargeobjectsize = be32_to_cpu(config->maxlargeobjectsize);
+	signedupdatealgorithms = be64_to_cpu(config->signedupdatealgorithms);
+
+	// Validate that the numbers we get back match the requirements of the spec
+	if (maxpwsize < 32) {
+		pr_err("Invalid Max Password Size received from hypervisor (%d < 32)\n", maxpwsize);
+		rc = -EIO;
+		goto err;
+	}
+
+	if (maxobjlabelsize < 255) {
+		pr_err("Invalid Max Object Label Size received from hypervisor (%d < 255)\n",
+		       maxobjlabelsize);
+		rc = -EIO;
+		goto err;
+	}
+
+	if (totalsize < 4096) {
+		pr_err("Invalid Total Size received from hypervisor (%d < 4096)\n", totalsize);
+		rc = -EIO;
+		goto err;
+	}
+
+	if (version >= 3 && maxlargeobjectsize >= 65536 && maxobjsize != 0xFFFF) {
+		pr_err("Invalid Max Object Size (0x%x != 0xFFFF)\n", maxobjsize);
+		rc = -EIO;
+		goto err;
+	}
+
+err:
+	kfree(config);
+	return rc;
+}
+
+u8 plpks_get_version(void)
+{
+	return version;
+}
+
+u16 plpks_get_objoverhead(void)
+{
+	return objoverhead;
+}
+
+u16 plpks_get_maxpwsize(void)
+{
+	return maxpwsize;
+}
+
+u16 plpks_get_maxobjectsize(void)
+{
+	return maxobjsize;
+}
+
+u16 plpks_get_maxobjectlabelsize(void)
+{
+	return maxobjlabelsize;
+}
+
+u32 plpks_get_totalsize(void)
+{
+	return totalsize;
+}
+
+u32 plpks_get_usedspace(void)
+{
+	// Unlike other config values, usedspace regularly changes as objects
+	// are updated, so we need to refresh.
+	int rc = _plpks_get_config();
+	if (rc) {
+		pr_err("Couldn't get config, rc: %d\n", rc);
+		return 0;
+	}
+	return usedspace;
+}
 
-	size = sizeof(config);
+u32 plpks_get_supportedpolicies(void)
+{
+	return supportedpolicies;
+}
 
-	rc = plpar_hcall(H_PKS_GET_CONFIG, retbuf, virt_to_phys(&config), size);
+u32 plpks_get_maxlargeobjectsize(void)
+{
+	return maxlargeobjectsize;
+}
 
-	if (rc != H_SUCCESS)
-		return pseries_status_to_err(rc);
+u64 plpks_get_signedupdatealgorithms(void)
+{
+	return signedupdatealgorithms;
+}
 
-	maxpwsize = be16_to_cpu(config.maxpwsize);
-	maxobjsize = be16_to_cpu(config.maxobjsize);
+u16 plpks_get_passwordlen(void)
+{
+	return ospasswordlength;
+}
+
+bool plpks_is_available(void)
+{
+	int rc;
+
+	if (!firmware_has_feature(FW_FEATURE_LPAR))
+		return false;
+
+	rc = _plpks_get_config();
+	if (rc)
+		return false;
 
-	return 0;
+	return true;
 }
 
 static int plpks_confirm_object_flushed(struct label *label,
diff --git a/arch/powerpc/platforms/pseries/plpks.h b/arch/powerpc/platforms/pseries/plpks.h
deleted file mode 100644
index 07278a990c2d..000000000000
--- a/arch/powerpc/platforms/pseries/plpks.h
+++ /dev/null
@@ -1,96 +0,0 @@
-/* SPDX-License-Identifier: GPL-2.0 */
-/*
- * Copyright (C) 2022 IBM Corporation
- * Author: Nayna Jain <nayna@linux.ibm.com>
- *
- * Platform keystore for pseries LPAR(PLPKS).
- */
-
-#ifndef _PSERIES_PLPKS_H
-#define _PSERIES_PLPKS_H
-
-#include <linux/types.h>
-#include <linux/list.h>
-
-// Object policy flags from supported_policies
-#define PLPKS_OSSECBOOTAUDIT	PPC_BIT32(1) // OS secure boot must be audit/enforce
-#define PLPKS_OSSECBOOTENFORCE	PPC_BIT32(2) // OS secure boot must be enforce
-#define PLPKS_PWSET		PPC_BIT32(3) // No access without password set
-#define PLPKS_WORLDREADABLE	PPC_BIT32(4) // Readable without authentication
-#define PLPKS_IMMUTABLE		PPC_BIT32(5) // Once written, object cannot be removed
-#define PLPKS_TRANSIENT		PPC_BIT32(6) // Object does not persist through reboot
-#define PLPKS_SIGNEDUPDATE	PPC_BIT32(7) // Object can only be modified by signed updates
-#define PLPKS_HVPROVISIONED	PPC_BIT32(28) // Hypervisor has provisioned this object
-
-// Signature algorithm flags from signed_update_algorithms
-#define PLPKS_ALG_RSA2048	PPC_BIT(0)
-#define PLPKS_ALG_RSA4096	PPC_BIT(1)
-
-// Object label OS metadata flags
-#define PLPKS_VAR_LINUX		0x02
-#define PLPKS_VAR_COMMON	0x04
-
-// Flags for which consumer owns an object is owned by
-#define PLPKS_FW_OWNER			0x1
-#define PLPKS_BOOTLOADER_OWNER		0x2
-#define PLPKS_OS_OWNER			0x3
-
-// Flags for label metadata fields
-#define PLPKS_LABEL_VERSION		0
-#define PLPKS_MAX_LABEL_ATTR_SIZE	16
-#define PLPKS_MAX_NAME_SIZE		239
-#define PLPKS_MAX_DATA_SIZE		4000
-
-// Timeouts for PLPKS operations
-#define PLPKS_MAX_TIMEOUT		(5 * USEC_PER_SEC)
-#define PLPKS_FLUSH_SLEEP		10000 // usec
-
-struct plpks_var {
-	char *component;
-	u8 *name;
-	u8 *data;
-	u32 policy;
-	u16 namelen;
-	u16 datalen;
-	u8 os;
-};
-
-struct plpks_var_name {
-	u8  *name;
-	u16 namelen;
-};
-
-struct plpks_var_name_list {
-	u32 varcount;
-	struct plpks_var_name varlist[];
-};
-
-/**
- * Writes the specified var and its data to PKS.
- * Any caller of PKS driver should present a valid component type for
- * their variable.
- */
-int plpks_write_var(struct plpks_var var);
-
-/**
- * Removes the specified var and its data from PKS.
- */
-int plpks_remove_var(char *component, u8 varos,
-		     struct plpks_var_name vname);
-
-/**
- * Returns the data for the specified os variable.
- */
-int plpks_read_os_var(struct plpks_var *var);
-
-/**
- * Returns the data for the specified firmware variable.
- */
-int plpks_read_fw_var(struct plpks_var *var);
-
-/**
- * Returns the data for the specified bootloader variable.
- */
-int plpks_read_bootloader_var(struct plpks_var *var);
-
-#endif
diff --git a/arch/powerpc/xmon/ppc-dis.c b/arch/powerpc/xmon/ppc-dis.c
index 75fa98221d48..af105e1bc3fc 100644
--- a/arch/powerpc/xmon/ppc-dis.c
+++ b/arch/powerpc/xmon/ppc-dis.c
@@ -122,32 +122,21 @@ int print_insn_powerpc (unsigned long insn, unsigned long memaddr)
   bool insn_is_short;
   ppc_cpu_t dialect;
 
-  dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON
-            | PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_ALTIVEC;
+  dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON;
 
-  if (cpu_has_feature(CPU_FTRS_POWER5))
-    dialect |= PPC_OPCODE_POWER5;
+  if (IS_ENABLED(CONFIG_PPC64))
+    dialect |= PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_CELL |
+	PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 | PPC_OPCODE_POWER8 |
+	PPC_OPCODE_POWER9;
 
-  if (cpu_has_feature(CPU_FTRS_CELL))
-    dialect |= (PPC_OPCODE_CELL | PPC_OPCODE_ALTIVEC);
+  if (cpu_has_feature(CPU_FTR_TM))
+    dialect |= PPC_OPCODE_HTM;
 
-  if (cpu_has_feature(CPU_FTRS_POWER6))
-    dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_ALTIVEC);
+  if (cpu_has_feature(CPU_FTR_ALTIVEC))
+    dialect |= PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2;
 
-  if (cpu_has_feature(CPU_FTRS_POWER7))
-    dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
-                | PPC_OPCODE_ALTIVEC | PPC_OPCODE_VSX);
-
-  if (cpu_has_feature(CPU_FTRS_POWER8))
-    dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
-		| PPC_OPCODE_POWER8 | PPC_OPCODE_HTM
-		| PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2 | PPC_OPCODE_VSX);
-
-  if (cpu_has_feature(CPU_FTRS_POWER9))
-    dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
-		| PPC_OPCODE_POWER8 | PPC_OPCODE_POWER9 | PPC_OPCODE_HTM
-		| PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2
-		| PPC_OPCODE_VSX | PPC_OPCODE_VSX3);
+  if (cpu_has_feature(CPU_FTR_VSX))
+    dialect |= PPC_OPCODE_VSX | PPC_OPCODE_VSX3;
 
   /* Get the major opcode of the insn.  */
   opcode = NULL;
diff --git a/arch/s390/kernel/uv.c b/arch/s390/kernel/uv.c
index 5caa0ed2b594..1ae7a0403804 100644
--- a/arch/s390/kernel/uv.c
+++ b/arch/s390/kernel/uv.c
@@ -172,36 +172,36 @@ int uv_convert_owned_from_secure(unsigned long paddr)
 }
 
 /*
- * Calculate the expected ref_count for a page that would otherwise have no
+ * Calculate the expected ref_count for a folio that would otherwise have no
  * further pins. This was cribbed from similar functions in other places in
  * the kernel, but with some slight modifications. We know that a secure
- * page can not be a huge page for example.
+ * folio can not be a large folio, for example.
  */
-static int expected_page_refs(struct page *page)
+static int expected_folio_refs(struct folio *folio)
 {
 	int res;
 
-	res = page_mapcount(page);
-	if (PageSwapCache(page)) {
+	res = folio_mapcount(folio);
+	if (folio_test_swapcache(folio)) {
 		res++;
-	} else if (page_mapping(page)) {
+	} else if (folio_mapping(folio)) {
 		res++;
-		if (page_has_private(page))
+		if (folio->private)
 			res++;
 	}
 	return res;
 }
 
-static int make_page_secure(struct page *page, struct uv_cb_header *uvcb)
+static int make_folio_secure(struct folio *folio, struct uv_cb_header *uvcb)
 {
 	int expected, cc = 0;
 
-	if (PageWriteback(page))
+	if (folio_test_writeback(folio))
 		return -EAGAIN;
-	expected = expected_page_refs(page);
-	if (!page_ref_freeze(page, expected))
+	expected = expected_folio_refs(folio);
+	if (!folio_ref_freeze(folio, expected))
 		return -EBUSY;
-	set_bit(PG_arch_1, &page->flags);
+	set_bit(PG_arch_1, &folio->flags);
 	/*
 	 * If the UVC does not succeed or fail immediately, we don't want to
 	 * loop for long, or we might get stall notifications.
@@ -211,9 +211,9 @@ static int make_page_secure(struct page *page, struct uv_cb_header *uvcb)
 	 * -EAGAIN and we let the callers deal with it.
 	 */
 	cc = __uv_call(0, (u64)uvcb);
-	page_ref_unfreeze(page, expected);
+	folio_ref_unfreeze(folio, expected);
 	/*
-	 * Return -ENXIO if the page was not mapped, -EINVAL for other errors.
+	 * Return -ENXIO if the folio was not mapped, -EINVAL for other errors.
 	 * If busy or partially completed, return -EAGAIN.
 	 */
 	if (cc == UVC_CC_OK)
@@ -261,7 +261,7 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
 	bool local_drain = false;
 	spinlock_t *ptelock;
 	unsigned long uaddr;
-	struct page *page;
+	struct folio *folio;
 	pte_t *ptep;
 	int rc;
 
@@ -288,15 +288,26 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
 	rc = -ENXIO;
 	ptep = get_locked_pte(gmap->mm, uaddr, &ptelock);
 	if (pte_present(*ptep) && !(pte_val(*ptep) & _PAGE_INVALID) && pte_write(*ptep)) {
-		page = pte_page(*ptep);
+		folio = page_folio(pte_page(*ptep));
+		rc = -EINVAL;
+		if (folio_test_large(folio))
+			goto unlock;
 		rc = -EAGAIN;
-		if (trylock_page(page)) {
+		if (folio_trylock(folio)) {
 			if (should_export_before_import(uvcb, gmap->mm))
-				uv_convert_from_secure(page_to_phys(page));
-			rc = make_page_secure(page, uvcb);
-			unlock_page(page);
+				uv_convert_from_secure(PFN_PHYS(folio_pfn(folio)));
+			rc = make_folio_secure(folio, uvcb);
+			folio_unlock(folio);
 		}
+
+		/*
+		 * Once we drop the PTL, the folio may get unmapped and
+		 * freed immediately. We need a temporary reference.
+		 */
+		if (rc == -EAGAIN)
+			folio_get(folio);
 	}
+unlock:
 	pte_unmap_unlock(ptep, ptelock);
 out:
 	mmap_read_unlock(gmap->mm);
@@ -306,10 +317,11 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
 		 * If we are here because the UVC returned busy or partial
 		 * completion, this is just a useless check, but it is safe.
 		 */
-		wait_on_page_writeback(page);
+		folio_wait_writeback(folio);
+		folio_put(folio);
 	} else if (rc == -EBUSY) {
 		/*
-		 * If we have tried a local drain and the page refcount
+		 * If we have tried a local drain and the folio refcount
 		 * still does not match our expected safe value, try with a
 		 * system wide drain. This is needed if the pagevecs holding
 		 * the page are on a different CPU.
@@ -320,7 +332,7 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
 			return -EAGAIN;
 		}
 		/*
-		 * We are here if the page refcount does not match the
+		 * We are here if the folio refcount does not match the
 		 * expected safe value. The main culprits are usually
 		 * pagevecs. With lru_add_drain() we drain the pagevecs
 		 * on the local CPU so that hopefully the refcount will
diff --git a/arch/s390/pci/pci_irq.c b/arch/s390/pci/pci_irq.c
index 04c19ab93a32..393bcc2c3dc2 100644
--- a/arch/s390/pci/pci_irq.c
+++ b/arch/s390/pci/pci_irq.c
@@ -268,33 +268,20 @@ static void zpci_floating_irq_handler(struct airq_struct *airq,
 	}
 }
 
-int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
+static int __alloc_airq(struct zpci_dev *zdev, int msi_vecs,
+			unsigned long *bit)
 {
-	struct zpci_dev *zdev = to_zpci(pdev);
-	unsigned int hwirq, msi_vecs, cpu;
-	unsigned long bit;
-	struct msi_desc *msi;
-	struct msi_msg msg;
-	int cpu_addr;
-	int rc, irq;
-
-	zdev->aisb = -1UL;
-	zdev->msi_first_bit = -1U;
-	if (type == PCI_CAP_ID_MSI && nvec > 1)
-		return 1;
-	msi_vecs = min_t(unsigned int, nvec, zdev->max_msi);
-
 	if (irq_delivery == DIRECTED) {
 		/* Allocate cpu vector bits */
-		bit = airq_iv_alloc(zpci_ibv[0], msi_vecs);
-		if (bit == -1UL)
+		*bit = airq_iv_alloc(zpci_ibv[0], msi_vecs);
+		if (*bit == -1UL)
 			return -EIO;
 	} else {
 		/* Allocate adapter summary indicator bit */
-		bit = airq_iv_alloc_bit(zpci_sbv);
-		if (bit == -1UL)
+		*bit = airq_iv_alloc_bit(zpci_sbv);
+		if (*bit == -1UL)
 			return -EIO;
-		zdev->aisb = bit;
+		zdev->aisb = *bit;
 
 		/* Create adapter interrupt vector */
 		zdev->aibv = airq_iv_create(msi_vecs, AIRQ_IV_DATA | AIRQ_IV_BITLOCK, NULL);
@@ -302,27 +289,66 @@ int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
 			return -ENOMEM;
 
 		/* Wire up shortcut pointer */
-		zpci_ibv[bit] = zdev->aibv;
+		zpci_ibv[*bit] = zdev->aibv;
 		/* Each function has its own interrupt vector */
-		bit = 0;
+		*bit = 0;
 	}
+	return 0;
+}
 
-	/* Request MSI interrupts */
+int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
+{
+	unsigned int hwirq, msi_vecs, irqs_per_msi, i, cpu;
+	struct zpci_dev *zdev = to_zpci(pdev);
+	struct msi_desc *msi;
+	struct msi_msg msg;
+	unsigned long bit;
+	int cpu_addr;
+	int rc, irq;
+
+	zdev->aisb = -1UL;
+	zdev->msi_first_bit = -1U;
+
+	msi_vecs = min_t(unsigned int, nvec, zdev->max_msi);
+	if (msi_vecs < nvec) {
+		pr_info("%s requested %d irqs, allocate system limit of %d",
+			pci_name(pdev), nvec, zdev->max_msi);
+	}
+
+	rc = __alloc_airq(zdev, msi_vecs, &bit);
+	if (rc < 0)
+		return rc;
+
+	/*
+	 * Request MSI interrupts:
+	 * When using MSI, nvec_used interrupt sources and their irq
+	 * descriptors are controlled through one msi descriptor.
+	 * Thus the outer loop over msi descriptors shall run only once,
+	 * while two inner loops iterate over the interrupt vectors.
+	 * When using MSI-X, each interrupt vector/irq descriptor
+	 * is bound to exactly one msi descriptor (nvec_used is one).
+	 * So the inner loops are executed once, while the outer iterates
+	 * over the MSI-X descriptors.
+	 */
 	hwirq = bit;
 	msi_for_each_desc(msi, &pdev->dev, MSI_DESC_NOTASSOCIATED) {
-		rc = -EIO;
 		if (hwirq - bit >= msi_vecs)
 			break;
-		irq = __irq_alloc_descs(-1, 0, 1, 0, THIS_MODULE,
-				(irq_delivery == DIRECTED) ?
-				msi->affinity : NULL);
+		irqs_per_msi = min_t(unsigned int, msi_vecs, msi->nvec_used);
+		irq = __irq_alloc_descs(-1, 0, irqs_per_msi, 0, THIS_MODULE,
+					(irq_delivery == DIRECTED) ?
+					msi->affinity : NULL);
 		if (irq < 0)
 			return -ENOMEM;
-		rc = irq_set_msi_desc(irq, msi);
-		if (rc)
-			return rc;
-		irq_set_chip_and_handler(irq, &zpci_irq_chip,
-					 handle_percpu_irq);
+
+		for (i = 0; i < irqs_per_msi; i++) {
+			rc = irq_set_msi_desc_off(irq, i, msi);
+			if (rc)
+				return rc;
+			irq_set_chip_and_handler(irq + i, &zpci_irq_chip,
+						 handle_percpu_irq);
+		}
+
 		msg.data = hwirq - bit;
 		if (irq_delivery == DIRECTED) {
 			if (msi->affinity)
@@ -335,31 +361,35 @@ int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
 			msg.address_lo |= (cpu_addr << 8);
 
 			for_each_possible_cpu(cpu) {
-				airq_iv_set_data(zpci_ibv[cpu], hwirq, irq);
+				for (i = 0; i < irqs_per_msi; i++)
+					airq_iv_set_data(zpci_ibv[cpu],
+							 hwirq + i, irq + i);
 			}
 		} else {
 			msg.address_lo = zdev->msi_addr & 0xffffffff;
-			airq_iv_set_data(zdev->aibv, hwirq, irq);
+			for (i = 0; i < irqs_per_msi; i++)
+				airq_iv_set_data(zdev->aibv, hwirq + i, irq + i);
 		}
 		msg.address_hi = zdev->msi_addr >> 32;
 		pci_write_msi_msg(irq, &msg);
-		hwirq++;
+		hwirq += irqs_per_msi;
 	}
 
 	zdev->msi_first_bit = bit;
-	zdev->msi_nr_irqs = msi_vecs;
+	zdev->msi_nr_irqs = hwirq - bit;
 
 	rc = zpci_set_irq(zdev);
 	if (rc)
 		return rc;
 
-	return (msi_vecs == nvec) ? 0 : msi_vecs;
+	return (zdev->msi_nr_irqs == nvec) ? 0 : zdev->msi_nr_irqs;
 }
 
 void arch_teardown_msi_irqs(struct pci_dev *pdev)
 {
 	struct zpci_dev *zdev = to_zpci(pdev);
 	struct msi_desc *msi;
+	unsigned int i;
 	int rc;
 
 	/* Disable interrupts */
@@ -369,8 +399,10 @@ void arch_teardown_msi_irqs(struct pci_dev *pdev)
 
 	/* Release MSI interrupts */
 	msi_for_each_desc(msi, &pdev->dev, MSI_DESC_ASSOCIATED) {
-		irq_set_msi_desc(msi->irq, NULL);
-		irq_free_desc(msi->irq);
+		for (i = 0; i < msi->nvec_used; i++) {
+			irq_set_msi_desc(msi->irq + i, NULL);
+			irq_free_desc(msi->irq + i);
+		}
 		msi->msg.address_lo = 0;
 		msi->msg.address_hi = 0;
 		msi->msg.data = 0;
diff --git a/arch/sparc/include/asm/oplib_64.h b/arch/sparc/include/asm/oplib_64.h
index a67abebd4359..1b86d02a8455 100644
--- a/arch/sparc/include/asm/oplib_64.h
+++ b/arch/sparc/include/asm/oplib_64.h
@@ -247,6 +247,7 @@ void prom_sun4v_guest_soft_state(void);
 int prom_ihandle2path(int handle, char *buffer, int bufsize);
 
 /* Client interface level routines. */
+void prom_cif_init(void *cif_handler);
 void p1275_cmd_direct(unsigned long *);
 
 #endif /* !(__SPARC64_OPLIB_H) */
diff --git a/arch/sparc/prom/init_64.c b/arch/sparc/prom/init_64.c
index 103aa9104318..f7b8a1a865b8 100644
--- a/arch/sparc/prom/init_64.c
+++ b/arch/sparc/prom/init_64.c
@@ -26,9 +26,6 @@ phandle prom_chosen_node;
  * routines in the prom library.
  * It gets passed the pointer to the PROM vector.
  */
-
-extern void prom_cif_init(void *);
-
 void __init prom_init(void *cif_handler)
 {
 	phandle node;
diff --git a/arch/sparc/prom/p1275.c b/arch/sparc/prom/p1275.c
index 889aa602f8d8..51c3f984bbf7 100644
--- a/arch/sparc/prom/p1275.c
+++ b/arch/sparc/prom/p1275.c
@@ -49,7 +49,7 @@ void p1275_cmd_direct(unsigned long *args)
 	local_irq_restore(flags);
 }
 
-void prom_cif_init(void *cif_handler, void *cif_stack)
+void prom_cif_init(void *cif_handler)
 {
 	p1275buf.prom_cif_handler = (void (*)(long *))cif_handler;
 }
diff --git a/arch/um/drivers/ubd_kern.c b/arch/um/drivers/ubd_kern.c
index 13a22a461305..1203f5078cb5 100644
--- a/arch/um/drivers/ubd_kern.c
+++ b/arch/um/drivers/ubd_kern.c
@@ -456,43 +456,31 @@ static int bulk_req_safe_read(
 	return n;
 }
 
-/* Called without dev->lock held, and only in interrupt context. */
-static void ubd_handler(void)
+static void ubd_end_request(struct io_thread_req *io_req)
 {
-	int n;
-	int count;
-
-	while(1){
-		n = bulk_req_safe_read(
-			thread_fd,
-			irq_req_buffer,
-			&irq_remainder,
-			&irq_remainder_size,
-			UBD_REQ_BUFFER_SIZE
-		);
-		if (n < 0) {
-			if(n == -EAGAIN)
-				break;
-			printk(KERN_ERR "spurious interrupt in ubd_handler, "
-			       "err = %d\n", -n);
-			return;
-		}
-		for (count = 0; count < n/sizeof(struct io_thread_req *); count++) {
-			struct io_thread_req *io_req = (*irq_req_buffer)[count];
-
-			if ((io_req->error == BLK_STS_NOTSUPP) && (req_op(io_req->req) == REQ_OP_DISCARD)) {
-				blk_queue_max_discard_sectors(io_req->req->q, 0);
-				blk_queue_max_write_zeroes_sectors(io_req->req->q, 0);
-			}
-			blk_mq_end_request(io_req->req, io_req->error);
-			kfree(io_req);
-		}
+	if (io_req->error == BLK_STS_NOTSUPP) {
+		if (req_op(io_req->req) == REQ_OP_DISCARD)
+			blk_queue_max_discard_sectors(io_req->req->q, 0);
+		else if (req_op(io_req->req) == REQ_OP_WRITE_ZEROES)
+			blk_queue_max_write_zeroes_sectors(io_req->req->q, 0);
 	}
+	blk_mq_end_request(io_req->req, io_req->error);
+	kfree(io_req);
 }
 
 static irqreturn_t ubd_intr(int irq, void *dev)
 {
-	ubd_handler();
+	int len, i;
+
+	while ((len = bulk_req_safe_read(thread_fd, irq_req_buffer,
+			&irq_remainder, &irq_remainder_size,
+			UBD_REQ_BUFFER_SIZE)) >= 0) {
+		for (i = 0; i < len / sizeof(struct io_thread_req *); i++)
+			ubd_end_request((*irq_req_buffer)[i]);
+	}
+
+	if (len < 0 && len != -EAGAIN)
+		pr_err("spurious interrupt in %s, err = %d\n", __func__, len);
 	return IRQ_HANDLED;
 }
 
diff --git a/arch/um/kernel/time.c b/arch/um/kernel/time.c
index 3e270da6b6f6..c8c4ef94c753 100644
--- a/arch/um/kernel/time.c
+++ b/arch/um/kernel/time.c
@@ -874,9 +874,9 @@ int setup_time_travel_start(char *str)
 	return 1;
 }
 
-__setup("time-travel-start", setup_time_travel_start);
+__setup("time-travel-start=", setup_time_travel_start);
 __uml_help(setup_time_travel_start,
-"time-travel-start=<seconds>\n"
+"time-travel-start=<nanoseconds>\n"
 "Configure the UML instance's wall clock to start at this value rather than\n"
 "the host's wall clock at the time of UML boot.\n");
 #endif
diff --git a/arch/um/os-Linux/signal.c b/arch/um/os-Linux/signal.c
index 24a403a70a02..850d21e6473e 100644
--- a/arch/um/os-Linux/signal.c
+++ b/arch/um/os-Linux/signal.c
@@ -8,6 +8,7 @@
 
 #include <stdlib.h>
 #include <stdarg.h>
+#include <stdbool.h>
 #include <errno.h>
 #include <signal.h>
 #include <string.h>
@@ -65,9 +66,7 @@ static void sig_handler_common(int sig, struct siginfo *si, mcontext_t *mc)
 
 int signals_enabled;
 #ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
-static int signals_blocked;
-#else
-#define signals_blocked 0
+static int signals_blocked, signals_blocked_pending;
 #endif
 static unsigned int signals_pending;
 static unsigned int signals_active = 0;
@@ -76,14 +75,27 @@ void sig_handler(int sig, struct siginfo *si, mcontext_t *mc)
 {
 	int enabled = signals_enabled;
 
-	if ((signals_blocked || !enabled) && (sig == SIGIO)) {
+#ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
+	if ((signals_blocked ||
+	     __atomic_load_n(&signals_blocked_pending, __ATOMIC_SEQ_CST)) &&
+	    (sig == SIGIO)) {
+		/* increment so unblock will do another round */
+		__atomic_add_fetch(&signals_blocked_pending, 1,
+				   __ATOMIC_SEQ_CST);
+		return;
+	}
+#endif
+
+	if (!enabled && (sig == SIGIO)) {
 		/*
 		 * In TT_MODE_EXTERNAL, need to still call time-travel
-		 * handlers unless signals are also blocked for the
-		 * external time message processing. This will mark
-		 * signals_pending by itself (only if necessary.)
+		 * handlers. This will mark signals_pending by itself
+		 * (only if necessary.)
+		 * Note we won't get here if signals are hard-blocked
+		 * (which is handled above), in that case the hard-
+		 * unblock will handle things.
 		 */
-		if (!signals_blocked && time_travel_mode == TT_MODE_EXTERNAL)
+		if (time_travel_mode == TT_MODE_EXTERNAL)
 			sigio_run_timetravel_handlers();
 		else
 			signals_pending |= SIGIO_MASK;
@@ -380,33 +392,99 @@ int um_set_signals_trace(int enable)
 #ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
 void mark_sigio_pending(void)
 {
+	/*
+	 * It would seem that this should be atomic so
+	 * it isn't a read-modify-write with a signal
+	 * that could happen in the middle, losing the
+	 * value set by the signal.
+	 *
+	 * However, this function is only called when in
+	 * time-travel=ext simulation mode, in which case
+	 * the only signal ever pending is SIGIO, which
+	 * is blocked while this can be called, and the
+	 * timer signal (SIGALRM) cannot happen.
+	 */
 	signals_pending |= SIGIO_MASK;
 }
 
 void block_signals_hard(void)
 {
-	if (signals_blocked)
-		return;
-	signals_blocked = 1;
+	signals_blocked++;
 	barrier();
 }
 
 void unblock_signals_hard(void)
 {
+	static bool unblocking;
+
 	if (!signals_blocked)
+		panic("unblocking signals while not blocked");
+
+	if (--signals_blocked)
 		return;
-	/* Must be set to 0 before we check the pending bits etc. */
-	signals_blocked = 0;
+	/*
+	 * Must be set to 0 before we check pending so the
+	 * SIGIO handler will run as normal unless we're still
+	 * going to process signals_blocked_pending.
+	 */
 	barrier();
 
-	if (signals_pending && signals_enabled) {
-		/* this is a bit inefficient, but that's not really important */
-		block_signals();
-		unblock_signals();
-	} else if (signals_pending & SIGIO_MASK) {
-		/* we need to run time-travel handlers even if not enabled */
-		sigio_run_timetravel_handlers();
+	/*
+	 * Note that block_signals_hard()/unblock_signals_hard() can be called
+	 * within the unblock_signals()/sigio_run_timetravel_handlers() below.
+	 * This would still be prone to race conditions since it's actually a
+	 * call _within_ e.g. vu_req_read_message(), where we observed this
+	 * issue, which loops. Thus, if the inner call handles the recorded
+	 * pending signals, we can get out of the inner call with the real
+	 * signal hander no longer blocked, and still have a race. Thus don't
+	 * handle unblocking in the inner call, if it happens, but only in
+	 * the outermost call - 'unblocking' serves as an ownership for the
+	 * signals_blocked_pending decrement.
+	 */
+	if (unblocking)
+		return;
+	unblocking = true;
+
+	while (__atomic_load_n(&signals_blocked_pending, __ATOMIC_SEQ_CST)) {
+		if (signals_enabled) {
+			/* signals are enabled so we can touch this */
+			signals_pending |= SIGIO_MASK;
+			/*
+			 * this is a bit inefficient, but that's
+			 * not really important
+			 */
+			block_signals();
+			unblock_signals();
+		} else {
+			/*
+			 * we need to run time-travel handlers even
+			 * if not enabled
+			 */
+			sigio_run_timetravel_handlers();
+		}
+
+		/*
+		 * The decrement of signals_blocked_pending must be atomic so
+		 * that the signal handler will either happen before or after
+		 * the decrement, not during a read-modify-write:
+		 *  - If it happens before, it can increment it and we'll
+		 *    decrement it and do another round in the loop.
+		 *  - If it happens after it'll see 0 for both signals_blocked
+		 *    and signals_blocked_pending and thus run the handler as
+		 *    usual (subject to signals_enabled, but that's unrelated.)
+		 *
+		 * Note that a call to unblock_signals_hard() within the calls
+		 * to unblock_signals() or sigio_run_timetravel_handlers() above
+		 * will do nothing due to the 'unblocking' state, so this cannot
+		 * underflow as the only one decrementing will be the outermost
+		 * one.
+		 */
+		if (__atomic_sub_fetch(&signals_blocked_pending, 1,
+				       __ATOMIC_SEQ_CST) < 0)
+			panic("signals_blocked_pending underflow");
 	}
+
+	unblocking = false;
 }
 #endif
 
diff --git a/arch/x86/events/core.c b/arch/x86/events/core.c
index 1394312b732a..2b2c9fd74ef9 100644
--- a/arch/x86/events/core.c
+++ b/arch/x86/events/core.c
@@ -2573,6 +2573,7 @@ static ssize_t set_attr_rdpmc(struct device *cdev,
 			      struct device_attribute *attr,
 			      const char *buf, size_t count)
 {
+	static DEFINE_MUTEX(rdpmc_mutex);
 	unsigned long val;
 	ssize_t ret;
 
@@ -2586,6 +2587,8 @@ static ssize_t set_attr_rdpmc(struct device *cdev,
 	if (x86_pmu.attr_rdpmc_broken)
 		return -ENOTSUPP;
 
+	guard(mutex)(&rdpmc_mutex);
+
 	if (val != x86_pmu.attr_rdpmc) {
 		/*
 		 * Changing into or out of never available or always available,
diff --git a/arch/x86/events/intel/cstate.c b/arch/x86/events/intel/cstate.c
index 551741e79e03..8175bff77efa 100644
--- a/arch/x86/events/intel/cstate.c
+++ b/arch/x86/events/intel/cstate.c
@@ -80,7 +80,7 @@
  *	MSR_PKG_C7_RESIDENCY:  Package C7 Residency Counter.
  *			       perf code: 0x03
  *			       Available model: NHM,WSM,SNB,IVB,HSW,BDW,SKL,CNL,
- *						KBL,CML,ICL,TGL,RKL,ADL,RPL,MTL
+ *						KBL,CML,ICL,TGL,RKL
  *			       Scope: Package (physical package)
  *	MSR_PKG_C8_RESIDENCY:  Package C8 Residency Counter.
  *			       perf code: 0x04
@@ -89,8 +89,7 @@
  *			       Scope: Package (physical package)
  *	MSR_PKG_C9_RESIDENCY:  Package C9 Residency Counter.
  *			       perf code: 0x05
- *			       Available model: HSW ULT,KBL,CNL,CML,ICL,TGL,RKL,
- *						ADL,RPL,MTL
+ *			       Available model: HSW ULT,KBL,CNL,CML,ICL,TGL,RKL
  *			       Scope: Package (physical package)
  *	MSR_PKG_C10_RESIDENCY: Package C10 Residency Counter.
  *			       perf code: 0x06
@@ -584,9 +583,7 @@ static const struct cstate_model adl_cstates __initconst = {
 	.pkg_events		= BIT(PERF_CSTATE_PKG_C2_RES) |
 				  BIT(PERF_CSTATE_PKG_C3_RES) |
 				  BIT(PERF_CSTATE_PKG_C6_RES) |
-				  BIT(PERF_CSTATE_PKG_C7_RES) |
 				  BIT(PERF_CSTATE_PKG_C8_RES) |
-				  BIT(PERF_CSTATE_PKG_C9_RES) |
 				  BIT(PERF_CSTATE_PKG_C10_RES),
 };
 
diff --git a/arch/x86/events/intel/pt.c b/arch/x86/events/intel/pt.c
index 42a55794004a..cc5c6a326496 100644
--- a/arch/x86/events/intel/pt.c
+++ b/arch/x86/events/intel/pt.c
@@ -877,7 +877,7 @@ static void pt_update_head(struct pt *pt)
  */
 static void *pt_buffer_region(struct pt_buffer *buf)
 {
-	return phys_to_virt(TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT);
+	return phys_to_virt((phys_addr_t)TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT);
 }
 
 /**
@@ -989,7 +989,7 @@ pt_topa_entry_for_page(struct pt_buffer *buf, unsigned int pg)
 	 * order allocations, there shouldn't be many of these.
 	 */
 	list_for_each_entry(topa, &buf->tables, list) {
-		if (topa->offset + topa->size > pg << PAGE_SHIFT)
+		if (topa->offset + topa->size > (unsigned long)pg << PAGE_SHIFT)
 			goto found;
 	}
 
diff --git a/arch/x86/events/intel/pt.h b/arch/x86/events/intel/pt.h
index 96906a62aacd..f5e46c04c145 100644
--- a/arch/x86/events/intel/pt.h
+++ b/arch/x86/events/intel/pt.h
@@ -33,8 +33,8 @@ struct topa_entry {
 	u64	rsvd2	: 1;
 	u64	size	: 4;
 	u64	rsvd3	: 2;
-	u64	base	: 36;
-	u64	rsvd4	: 16;
+	u64	base	: 40;
+	u64	rsvd4	: 12;
 };
 
 /* TSC to Core Crystal Clock Ratio */
diff --git a/arch/x86/events/intel/uncore_snbep.c b/arch/x86/events/intel/uncore_snbep.c
index 9b5859812f4f..d081eb89ba12 100644
--- a/arch/x86/events/intel/uncore_snbep.c
+++ b/arch/x86/events/intel/uncore_snbep.c
@@ -459,6 +459,7 @@
 #define SPR_RAW_EVENT_MASK_EXT			0xffffff
 
 /* SPR CHA */
+#define SPR_CHA_EVENT_MASK_EXT			0xffffffff
 #define SPR_CHA_PMON_CTL_TID_EN			(1 << 16)
 #define SPR_CHA_PMON_EVENT_MASK			(SNBEP_PMON_RAW_EVENT_MASK | \
 						 SPR_CHA_PMON_CTL_TID_EN)
@@ -475,6 +476,7 @@ DEFINE_UNCORE_FORMAT_ATTR(umask_ext, umask, "config:8-15,32-43,45-55");
 DEFINE_UNCORE_FORMAT_ATTR(umask_ext2, umask, "config:8-15,32-57");
 DEFINE_UNCORE_FORMAT_ATTR(umask_ext3, umask, "config:8-15,32-39");
 DEFINE_UNCORE_FORMAT_ATTR(umask_ext4, umask, "config:8-15,32-55");
+DEFINE_UNCORE_FORMAT_ATTR(umask_ext5, umask, "config:8-15,32-63");
 DEFINE_UNCORE_FORMAT_ATTR(qor, qor, "config:16");
 DEFINE_UNCORE_FORMAT_ATTR(edge, edge, "config:18");
 DEFINE_UNCORE_FORMAT_ATTR(tid_en, tid_en, "config:19");
@@ -5648,7 +5650,7 @@ static struct intel_uncore_ops spr_uncore_chabox_ops = {
 
 static struct attribute *spr_uncore_cha_formats_attr[] = {
 	&format_attr_event.attr,
-	&format_attr_umask_ext4.attr,
+	&format_attr_umask_ext5.attr,
 	&format_attr_tid_en2.attr,
 	&format_attr_edge.attr,
 	&format_attr_inv.attr,
@@ -5684,7 +5686,7 @@ ATTRIBUTE_GROUPS(uncore_alias);
 static struct intel_uncore_type spr_uncore_chabox = {
 	.name			= "cha",
 	.event_mask		= SPR_CHA_PMON_EVENT_MASK,
-	.event_mask_ext		= SPR_RAW_EVENT_MASK_EXT,
+	.event_mask_ext		= SPR_CHA_EVENT_MASK_EXT,
 	.num_shared_regs	= 1,
 	.constraints		= skx_uncore_chabox_constraints,
 	.ops			= &spr_uncore_chabox_ops,
diff --git a/arch/x86/include/asm/kvm_host.h b/arch/x86/include/asm/kvm_host.h
index 887a171488ea..9de3db4a32f8 100644
--- a/arch/x86/include/asm/kvm_host.h
+++ b/arch/x86/include/asm/kvm_host.h
@@ -1651,7 +1651,7 @@ struct kvm_x86_nested_ops {
 	bool (*is_exception_vmexit)(struct kvm_vcpu *vcpu, u8 vector,
 				    u32 error_code);
 	int (*check_events)(struct kvm_vcpu *vcpu);
-	bool (*has_events)(struct kvm_vcpu *vcpu);
+	bool (*has_events)(struct kvm_vcpu *vcpu, bool for_injection);
 	void (*triple_fault)(struct kvm_vcpu *vcpu);
 	int (*get_state)(struct kvm_vcpu *vcpu,
 			 struct kvm_nested_state __user *user_kvm_nested_state,
diff --git a/arch/x86/kernel/devicetree.c b/arch/x86/kernel/devicetree.c
index 5cd51f25f446..c77297fa2dad 100644
--- a/arch/x86/kernel/devicetree.c
+++ b/arch/x86/kernel/devicetree.c
@@ -87,7 +87,7 @@ static int x86_of_pci_irq_enable(struct pci_dev *dev)
 
 	ret = pci_read_config_byte(dev, PCI_INTERRUPT_PIN, &pin);
 	if (ret)
-		return ret;
+		return pcibios_err_to_errno(ret);
 	if (!pin)
 		return 0;
 
diff --git a/arch/x86/kvm/vmx/nested.c b/arch/x86/kvm/vmx/nested.c
index 9d683b6067c7..2283f485a81f 100644
--- a/arch/x86/kvm/vmx/nested.c
+++ b/arch/x86/kvm/vmx/nested.c
@@ -3934,7 +3934,7 @@ static bool nested_vmx_preemption_timer_pending(struct kvm_vcpu *vcpu)
 	       to_vmx(vcpu)->nested.preemption_timer_expired;
 }
 
-static bool vmx_has_nested_events(struct kvm_vcpu *vcpu)
+static bool vmx_has_nested_events(struct kvm_vcpu *vcpu, bool for_injection)
 {
 	return nested_vmx_preemption_timer_pending(vcpu) ||
 	       to_vmx(vcpu)->nested.mtf_pending;
diff --git a/arch/x86/kvm/vmx/vmx.c b/arch/x86/kvm/vmx/vmx.c
index 10aff2c9a4e4..87abf4eebf8a 100644
--- a/arch/x86/kvm/vmx/vmx.c
+++ b/arch/x86/kvm/vmx/vmx.c
@@ -4980,14 +4980,19 @@ static int vmx_nmi_allowed(struct kvm_vcpu *vcpu, bool for_injection)
 	return !vmx_nmi_blocked(vcpu);
 }
 
+bool __vmx_interrupt_blocked(struct kvm_vcpu *vcpu)
+{
+	return !(vmx_get_rflags(vcpu) & X86_EFLAGS_IF) ||
+	       (vmcs_read32(GUEST_INTERRUPTIBILITY_INFO) &
+		(GUEST_INTR_STATE_STI | GUEST_INTR_STATE_MOV_SS));
+}
+
 bool vmx_interrupt_blocked(struct kvm_vcpu *vcpu)
 {
 	if (is_guest_mode(vcpu) && nested_exit_on_intr(vcpu))
 		return false;
 
-	return !(vmx_get_rflags(vcpu) & X86_EFLAGS_IF) ||
-	       (vmcs_read32(GUEST_INTERRUPTIBILITY_INFO) &
-		(GUEST_INTR_STATE_STI | GUEST_INTR_STATE_MOV_SS));
+	return __vmx_interrupt_blocked(vcpu);
 }
 
 static int vmx_interrupt_allowed(struct kvm_vcpu *vcpu, bool for_injection)
diff --git a/arch/x86/kvm/vmx/vmx.h b/arch/x86/kvm/vmx/vmx.h
index e2b04f4c0fef..9e0bb98b116d 100644
--- a/arch/x86/kvm/vmx/vmx.h
+++ b/arch/x86/kvm/vmx/vmx.h
@@ -413,6 +413,7 @@ u64 construct_eptp(struct kvm_vcpu *vcpu, hpa_t root_hpa, int root_level);
 bool vmx_guest_inject_ac(struct kvm_vcpu *vcpu);
 void vmx_update_exception_bitmap(struct kvm_vcpu *vcpu);
 bool vmx_nmi_blocked(struct kvm_vcpu *vcpu);
+bool __vmx_interrupt_blocked(struct kvm_vcpu *vcpu);
 bool vmx_interrupt_blocked(struct kvm_vcpu *vcpu);
 bool vmx_get_nmi_mask(struct kvm_vcpu *vcpu);
 void vmx_set_nmi_mask(struct kvm_vcpu *vcpu, bool masked);
diff --git a/arch/x86/kvm/x86.c b/arch/x86/kvm/x86.c
index 53d83b37db8c..658a88483d8b 100644
--- a/arch/x86/kvm/x86.c
+++ b/arch/x86/kvm/x86.c
@@ -10131,7 +10131,7 @@ static int kvm_check_and_inject_events(struct kvm_vcpu *vcpu,
 
 	if (is_guest_mode(vcpu) &&
 	    kvm_x86_ops.nested_ops->has_events &&
-	    kvm_x86_ops.nested_ops->has_events(vcpu))
+	    kvm_x86_ops.nested_ops->has_events(vcpu, true))
 		*req_immediate_exit = true;
 
 	/*
@@ -13013,7 +13013,7 @@ static inline bool kvm_vcpu_has_events(struct kvm_vcpu *vcpu)
 
 	if (is_guest_mode(vcpu) &&
 	    kvm_x86_ops.nested_ops->has_events &&
-	    kvm_x86_ops.nested_ops->has_events(vcpu))
+	    kvm_x86_ops.nested_ops->has_events(vcpu, false))
 		return true;
 
 	if (kvm_xen_has_pending_events(vcpu))
diff --git a/arch/x86/pci/intel_mid_pci.c b/arch/x86/pci/intel_mid_pci.c
index 8edd62206604..722a33be08a1 100644
--- a/arch/x86/pci/intel_mid_pci.c
+++ b/arch/x86/pci/intel_mid_pci.c
@@ -233,9 +233,9 @@ static int intel_mid_pci_irq_enable(struct pci_dev *dev)
 		return 0;
 
 	ret = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi);
-	if (ret < 0) {
+	if (ret) {
 		dev_warn(&dev->dev, "Failed to read interrupt line: %d\n", ret);
-		return ret;
+		return pcibios_err_to_errno(ret);
 	}
 
 	id = x86_match_cpu(intel_mid_cpu_ids);
diff --git a/arch/x86/pci/xen.c b/arch/x86/pci/xen.c
index 5a4ecf0c2ac4..b4621cc95e1f 100644
--- a/arch/x86/pci/xen.c
+++ b/arch/x86/pci/xen.c
@@ -38,10 +38,10 @@ static int xen_pcifront_enable_irq(struct pci_dev *dev)
 	u8 gsi;
 
 	rc = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi);
-	if (rc < 0) {
+	if (rc) {
 		dev_warn(&dev->dev, "Xen PCI: failed to read interrupt line: %d\n",
 			 rc);
-		return rc;
+		return pcibios_err_to_errno(rc);
 	}
 	/* In PV DomU the Xen PCI backend puts the PIRQ in the interrupt line.*/
 	pirq = gsi;
diff --git a/arch/x86/platform/intel/iosf_mbi.c b/arch/x86/platform/intel/iosf_mbi.c
index fdd49d70b437..c81cea208c2c 100644
--- a/arch/x86/platform/intel/iosf_mbi.c
+++ b/arch/x86/platform/intel/iosf_mbi.c
@@ -62,7 +62,7 @@ static int iosf_mbi_pci_read_mdr(u32 mcrx, u32 mcr, u32 *mdr)
 
 fail_read:
 	dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result);
-	return result;
+	return pcibios_err_to_errno(result);
 }
 
 static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr)
@@ -91,7 +91,7 @@ static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr)
 
 fail_write:
 	dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result);
-	return result;
+	return pcibios_err_to_errno(result);
 }
 
 int iosf_mbi_read(u8 port, u8 opcode, u32 offset, u32 *mdr)
diff --git a/arch/x86/xen/p2m.c b/arch/x86/xen/p2m.c
index 58db86f7b384..a02cc5433889 100644
--- a/arch/x86/xen/p2m.c
+++ b/arch/x86/xen/p2m.c
@@ -736,7 +736,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops,
 		 * immediate unmapping.
 		 */
 		map_ops[i].status = GNTST_general_error;
-		unmap[0].host_addr = map_ops[i].host_addr,
+		unmap[0].host_addr = map_ops[i].host_addr;
 		unmap[0].handle = map_ops[i].handle;
 		map_ops[i].handle = INVALID_GRANT_HANDLE;
 		if (map_ops[i].flags & GNTMAP_device_map)
@@ -746,7 +746,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops,
 
 		if (kmap_ops) {
 			kmap_ops[i].status = GNTST_general_error;
-			unmap[1].host_addr = kmap_ops[i].host_addr,
+			unmap[1].host_addr = kmap_ops[i].host_addr;
 			unmap[1].handle = kmap_ops[i].handle;
 			kmap_ops[i].handle = INVALID_GRANT_HANDLE;
 			if (kmap_ops[i].flags & GNTMAP_device_map)
diff --git a/block/bio-integrity.c b/block/bio-integrity.c
index 4533eb491661..adbc00449a9c 100644
--- a/block/bio-integrity.c
+++ b/block/bio-integrity.c
@@ -199,8 +199,7 @@ bool bio_integrity_prep(struct bio *bio)
 	unsigned long start, end;
 	unsigned int len, nr_pages;
 	unsigned int bytes, offset, i;
-	unsigned int intervals;
-	blk_status_t status;
+	gfp_t gfp = GFP_NOIO;
 
 	if (!bi)
 		return true;
@@ -223,13 +222,19 @@ bool bio_integrity_prep(struct bio *bio)
 		if (!bi->profile->generate_fn ||
 		    !(bi->flags & BLK_INTEGRITY_GENERATE))
 			return true;
+
+		/*
+		 * Zero the memory allocated to not leak uninitialized kernel
+		 * memory to disk.  For PI this only affects the app tag, but
+		 * for non-integrity metadata it affects the entire metadata
+		 * buffer.
+		 */
+		gfp |= __GFP_ZERO;
 	}
-	intervals = bio_integrity_intervals(bi, bio_sectors(bio));
 
 	/* Allocate kernel buffer for protection data */
-	len = intervals * bi->tuple_size;
-	buf = kmalloc(len, GFP_NOIO);
-	status = BLK_STS_RESOURCE;
+	len = bio_integrity_bytes(bi, bio_sectors(bio));
+	buf = kmalloc(len, gfp);
 	if (unlikely(buf == NULL)) {
 		printk(KERN_ERR "could not allocate integrity buffer\n");
 		goto err_end_io;
@@ -244,7 +249,6 @@ bool bio_integrity_prep(struct bio *bio)
 	if (IS_ERR(bip)) {
 		printk(KERN_ERR "could not allocate data integrity bioset\n");
 		kfree(buf);
-		status = BLK_STS_RESOURCE;
 		goto err_end_io;
 	}
 
@@ -272,7 +276,6 @@ bool bio_integrity_prep(struct bio *bio)
 
 		if (ret == 0) {
 			printk(KERN_ERR "could not attach integrity payload\n");
-			status = BLK_STS_RESOURCE;
 			goto err_end_io;
 		}
 
@@ -294,7 +297,7 @@ bool bio_integrity_prep(struct bio *bio)
 	return true;
 
 err_end_io:
-	bio->bi_status = status;
+	bio->bi_status = BLK_STS_RESOURCE;
 	bio_endio(bio);
 	return false;
 
diff --git a/drivers/android/binder.c b/drivers/android/binder.c
index 46111f8c12e6..e0ef648df265 100644
--- a/drivers/android/binder.c
+++ b/drivers/android/binder.c
@@ -569,9 +569,7 @@ static bool binder_has_work(struct binder_thread *thread, bool do_proc_work)
 static bool binder_available_for_proc_work_ilocked(struct binder_thread *thread)
 {
 	return !thread->transaction_stack &&
-		binder_worklist_empty_ilocked(&thread->todo) &&
-		(thread->looper & (BINDER_LOOPER_STATE_ENTERED |
-				   BINDER_LOOPER_STATE_REGISTERED));
+		binder_worklist_empty_ilocked(&thread->todo);
 }
 
 static void binder_wakeup_poll_threads_ilocked(struct binder_proc *proc,
diff --git a/drivers/ata/libata-scsi.c b/drivers/ata/libata-scsi.c
index 65fde5717928..c8970453b4d9 100644
--- a/drivers/ata/libata-scsi.c
+++ b/drivers/ata/libata-scsi.c
@@ -900,11 +900,8 @@ static void ata_gen_passthru_sense(struct ata_queued_cmd *qc)
 				   &sense_key, &asc, &ascq, verbose);
 		ata_scsi_set_sense(qc->dev, cmd, sense_key, asc, ascq);
 	} else {
-		/*
-		 * ATA PASS-THROUGH INFORMATION AVAILABLE
-		 * Always in descriptor format sense.
-		 */
-		scsi_build_sense(cmd, 1, RECOVERED_ERROR, 0, 0x1D);
+		/* ATA PASS-THROUGH INFORMATION AVAILABLE */
+		ata_scsi_set_sense(qc->dev, cmd, RECOVERED_ERROR, 0, 0x1D);
 	}
 
 	if ((cmd->sense_buffer[0] & 0x7f) >= 0x72) {
diff --git a/drivers/auxdisplay/ht16k33.c b/drivers/auxdisplay/ht16k33.c
index 02425991c159..57b4efff344e 100644
--- a/drivers/auxdisplay/ht16k33.c
+++ b/drivers/auxdisplay/ht16k33.c
@@ -507,6 +507,7 @@ static int ht16k33_led_probe(struct device *dev, struct led_classdev *led,
 	led->max_brightness = MAX_BRIGHTNESS;
 
 	err = devm_led_classdev_register_ext(dev, led, &init_data);
+	fwnode_handle_put(init_data.fwnode);
 	if (err)
 		dev_err(dev, "Failed to register LED\n");
 
diff --git a/drivers/base/devres.c b/drivers/base/devres.c
index 4ab2b50ee38f..f9add2ecdc55 100644
--- a/drivers/base/devres.c
+++ b/drivers/base/devres.c
@@ -892,9 +892,12 @@ void *devm_krealloc(struct device *dev, void *ptr, size_t new_size, gfp_t gfp)
 	/*
 	 * Otherwise: allocate new, larger chunk. We need to allocate before
 	 * taking the lock as most probably the caller uses GFP_KERNEL.
+	 * alloc_dr() will call check_dr_size() to reserve extra memory
+	 * for struct devres automatically, so size @new_size user request
+	 * is delivered to it directly as devm_kmalloc() does.
 	 */
 	new_dr = alloc_dr(devm_kmalloc_release,
-			  total_new_size, gfp, dev_to_node(dev));
+			  new_size, gfp, dev_to_node(dev));
 	if (!new_dr)
 		return NULL;
 
@@ -1218,7 +1221,11 @@ EXPORT_SYMBOL_GPL(__devm_alloc_percpu);
  */
 void devm_free_percpu(struct device *dev, void __percpu *pdata)
 {
-	WARN_ON(devres_destroy(dev, devm_percpu_release, devm_percpu_match,
+	/*
+	 * Use devres_release() to prevent memory leakage as
+	 * devm_free_pages() does.
+	 */
+	WARN_ON(devres_release(dev, devm_percpu_release, devm_percpu_match,
 			       (__force void *)pdata));
 }
 EXPORT_SYMBOL_GPL(devm_free_percpu);
diff --git a/drivers/block/rbd.c b/drivers/block/rbd.c
index f58ca9ce3503..4f8efc829a59 100644
--- a/drivers/block/rbd.c
+++ b/drivers/block/rbd.c
@@ -362,7 +362,7 @@ enum rbd_watch_state {
 enum rbd_lock_state {
 	RBD_LOCK_STATE_UNLOCKED,
 	RBD_LOCK_STATE_LOCKED,
-	RBD_LOCK_STATE_RELEASING,
+	RBD_LOCK_STATE_QUIESCING,
 };
 
 /* WatchNotify::ClientId */
@@ -422,7 +422,7 @@ struct rbd_device {
 	struct list_head	running_list;
 	struct completion	acquire_wait;
 	int			acquire_err;
-	struct completion	releasing_wait;
+	struct completion	quiescing_wait;
 
 	spinlock_t		object_map_lock;
 	u8			*object_map;
@@ -525,7 +525,7 @@ static bool __rbd_is_lock_owner(struct rbd_device *rbd_dev)
 	lockdep_assert_held(&rbd_dev->lock_rwsem);
 
 	return rbd_dev->lock_state == RBD_LOCK_STATE_LOCKED ||
-	       rbd_dev->lock_state == RBD_LOCK_STATE_RELEASING;
+	       rbd_dev->lock_state == RBD_LOCK_STATE_QUIESCING;
 }
 
 static bool rbd_is_lock_owner(struct rbd_device *rbd_dev)
@@ -3458,13 +3458,14 @@ static void rbd_lock_del_request(struct rbd_img_request *img_req)
 	lockdep_assert_held(&rbd_dev->lock_rwsem);
 	spin_lock(&rbd_dev->lock_lists_lock);
 	if (!list_empty(&img_req->lock_item)) {
+		rbd_assert(!list_empty(&rbd_dev->running_list));
 		list_del_init(&img_req->lock_item);
-		need_wakeup = (rbd_dev->lock_state == RBD_LOCK_STATE_RELEASING &&
+		need_wakeup = (rbd_dev->lock_state == RBD_LOCK_STATE_QUIESCING &&
 			       list_empty(&rbd_dev->running_list));
 	}
 	spin_unlock(&rbd_dev->lock_lists_lock);
 	if (need_wakeup)
-		complete(&rbd_dev->releasing_wait);
+		complete(&rbd_dev->quiescing_wait);
 }
 
 static int rbd_img_exclusive_lock(struct rbd_img_request *img_req)
@@ -3477,11 +3478,6 @@ static int rbd_img_exclusive_lock(struct rbd_img_request *img_req)
 	if (rbd_lock_add_request(img_req))
 		return 1;
 
-	if (rbd_dev->opts->exclusive) {
-		WARN_ON(1); /* lock got released? */
-		return -EROFS;
-	}
-
 	/*
 	 * Note the use of mod_delayed_work() in rbd_acquire_lock()
 	 * and cancel_delayed_work() in wake_lock_waiters().
@@ -4182,16 +4178,16 @@ static bool rbd_quiesce_lock(struct rbd_device *rbd_dev)
 	/*
 	 * Ensure that all in-flight IO is flushed.
 	 */
-	rbd_dev->lock_state = RBD_LOCK_STATE_RELEASING;
-	rbd_assert(!completion_done(&rbd_dev->releasing_wait));
+	rbd_dev->lock_state = RBD_LOCK_STATE_QUIESCING;
+	rbd_assert(!completion_done(&rbd_dev->quiescing_wait));
 	if (list_empty(&rbd_dev->running_list))
 		return true;
 
 	up_write(&rbd_dev->lock_rwsem);
-	wait_for_completion(&rbd_dev->releasing_wait);
+	wait_for_completion(&rbd_dev->quiescing_wait);
 
 	down_write(&rbd_dev->lock_rwsem);
-	if (rbd_dev->lock_state != RBD_LOCK_STATE_RELEASING)
+	if (rbd_dev->lock_state != RBD_LOCK_STATE_QUIESCING)
 		return false;
 
 	rbd_assert(list_empty(&rbd_dev->running_list));
@@ -4602,6 +4598,10 @@ static void rbd_reacquire_lock(struct rbd_device *rbd_dev)
 			rbd_warn(rbd_dev, "failed to update lock cookie: %d",
 				 ret);
 
+		if (rbd_dev->opts->exclusive)
+			rbd_warn(rbd_dev,
+			     "temporarily releasing lock on exclusive mapping");
+
 		/*
 		 * Lock cookie cannot be updated on older OSDs, so do
 		 * a manual release and queue an acquire.
@@ -5383,7 +5383,7 @@ static struct rbd_device *__rbd_dev_create(struct rbd_spec *spec)
 	INIT_LIST_HEAD(&rbd_dev->acquiring_list);
 	INIT_LIST_HEAD(&rbd_dev->running_list);
 	init_completion(&rbd_dev->acquire_wait);
-	init_completion(&rbd_dev->releasing_wait);
+	init_completion(&rbd_dev->quiescing_wait);
 
 	spin_lock_init(&rbd_dev->object_map_lock);
 
@@ -6589,11 +6589,6 @@ static int rbd_add_acquire_lock(struct rbd_device *rbd_dev)
 	if (ret)
 		return ret;
 
-	/*
-	 * The lock may have been released by now, unless automatic lock
-	 * transitions are disabled.
-	 */
-	rbd_assert(!rbd_dev->opts->exclusive || rbd_is_lock_owner(rbd_dev));
 	return 0;
 }
 
diff --git a/drivers/bluetooth/btusb.c b/drivers/bluetooth/btusb.c
index 6a772b955d69..2d8c405a27a6 100644
--- a/drivers/bluetooth/btusb.c
+++ b/drivers/bluetooth/btusb.c
@@ -545,6 +545,10 @@ static const struct usb_device_id blacklist_table[] = {
 						     BTUSB_WIDEBAND_SPEECH },
 	{ USB_DEVICE(0x13d3, 0x3571), .driver_info = BTUSB_REALTEK |
 						     BTUSB_WIDEBAND_SPEECH },
+	{ USB_DEVICE(0x13d3, 0x3591), .driver_info = BTUSB_REALTEK |
+						     BTUSB_WIDEBAND_SPEECH },
+	{ USB_DEVICE(0x0489, 0xe125), .driver_info = BTUSB_REALTEK |
+						     BTUSB_WIDEBAND_SPEECH },
 
 	/* Realtek Bluetooth devices */
 	{ USB_VENDOR_AND_INTERFACE_INFO(0x0bda, 0xe0, 0x01, 0x01),
diff --git a/drivers/char/hw_random/amd-rng.c b/drivers/char/hw_random/amd-rng.c
index 0555e3838bce..5229da114377 100644
--- a/drivers/char/hw_random/amd-rng.c
+++ b/drivers/char/hw_random/amd-rng.c
@@ -142,8 +142,10 @@ static int __init amd_rng_mod_init(void)
 
 found:
 	err = pci_read_config_dword(pdev, 0x58, &pmbase);
-	if (err)
+	if (err) {
+		err = pcibios_err_to_errno(err);
 		goto put_dev;
+	}
 
 	pmbase &= 0x0000FF00;
 	if (pmbase == 0) {
diff --git a/drivers/char/tpm/eventlog/common.c b/drivers/char/tpm/eventlog/common.c
index 8512ec76d526..4a6186f9f889 100644
--- a/drivers/char/tpm/eventlog/common.c
+++ b/drivers/char/tpm/eventlog/common.c
@@ -47,6 +47,8 @@ static int tpm_bios_measurements_open(struct inode *inode,
 	if (!err) {
 		seq = file->private_data;
 		seq->private = chip;
+	} else {
+		put_device(&chip->dev);
 	}
 
 	return err;
diff --git a/drivers/clk/clk-en7523.c b/drivers/clk/clk-en7523.c
index 29f0126cbd05..d22fae24a3da 100644
--- a/drivers/clk/clk-en7523.c
+++ b/drivers/clk/clk-en7523.c
@@ -41,6 +41,7 @@ struct en_clk_desc {
 	u8 div_shift;
 	u16 div_val0;
 	u8 div_step;
+	u8 div_offset;
 };
 
 struct en_clk_gate {
@@ -68,6 +69,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
 		.div_bits = 3,
 		.div_shift = 0,
 		.div_step = 1,
+		.div_offset = 1,
 	}, {
 		.id = EN7523_CLK_EMI,
 		.name = "emi",
@@ -81,6 +83,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
 		.div_bits = 3,
 		.div_shift = 0,
 		.div_step = 1,
+		.div_offset = 1,
 	}, {
 		.id = EN7523_CLK_BUS,
 		.name = "bus",
@@ -94,6 +97,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
 		.div_bits = 3,
 		.div_shift = 0,
 		.div_step = 1,
+		.div_offset = 1,
 	}, {
 		.id = EN7523_CLK_SLIC,
 		.name = "slic",
@@ -134,13 +138,14 @@ static const struct en_clk_desc en7523_base_clks[] = {
 		.div_bits = 3,
 		.div_shift = 0,
 		.div_step = 1,
+		.div_offset = 1,
 	}, {
 		.id = EN7523_CLK_CRYPTO,
 		.name = "crypto",
 
 		.base_reg = REG_CRYPTO_CLKSRC,
 		.base_bits = 1,
-		.base_shift = 8,
+		.base_shift = 0,
 		.base_values = emi_base,
 		.n_base_values = ARRAY_SIZE(emi_base),
 	}
@@ -185,7 +190,7 @@ static u32 en7523_get_div(void __iomem *base, int i)
 	if (!val && desc->div_val0)
 		return desc->div_val0;
 
-	return (val + 1) * desc->div_step;
+	return (val + desc->div_offset) * desc->div_step;
 }
 
 static int en7523_pci_is_enabled(struct clk_hw *hw)
diff --git a/drivers/clk/davinci/da8xx-cfgchip.c b/drivers/clk/davinci/da8xx-cfgchip.c
index 4103d605e804..6faa4372ed65 100644
--- a/drivers/clk/davinci/da8xx-cfgchip.c
+++ b/drivers/clk/davinci/da8xx-cfgchip.c
@@ -505,7 +505,7 @@ da8xx_cfgchip_register_usb0_clk48(struct device *dev,
 	const char * const parent_names[] = { "usb_refclkin", "pll0_auxclk" };
 	struct clk *fck_clk;
 	struct da8xx_usb0_clk48 *usb0;
-	struct clk_init_data init;
+	struct clk_init_data init = {};
 	int ret;
 
 	fck_clk = devm_clk_get(dev, "fck");
@@ -579,7 +579,7 @@ da8xx_cfgchip_register_usb1_clk48(struct device *dev,
 {
 	const char * const parent_names[] = { "usb0_clk48", "usb_refclkin" };
 	struct da8xx_usb1_clk48 *usb1;
-	struct clk_init_data init;
+	struct clk_init_data init = {};
 	int ret;
 
 	usb1 = devm_kzalloc(dev, sizeof(*usb1), GFP_KERNEL);
diff --git a/drivers/clk/qcom/camcc-sc7280.c b/drivers/clk/qcom/camcc-sc7280.c
index ec163ea769f5..932096a972bc 100644
--- a/drivers/clk/qcom/camcc-sc7280.c
+++ b/drivers/clk/qcom/camcc-sc7280.c
@@ -2260,6 +2260,7 @@ static struct gdsc cam_cc_bps_gdsc = {
 		.name = "cam_cc_bps_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = HW_CTRL | RETAIN_FF_ENABLE,
 };
 
@@ -2269,6 +2270,7 @@ static struct gdsc cam_cc_ife_0_gdsc = {
 		.name = "cam_cc_ife_0_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = RETAIN_FF_ENABLE,
 };
 
@@ -2278,6 +2280,7 @@ static struct gdsc cam_cc_ife_1_gdsc = {
 		.name = "cam_cc_ife_1_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = RETAIN_FF_ENABLE,
 };
 
@@ -2287,6 +2290,7 @@ static struct gdsc cam_cc_ife_2_gdsc = {
 		.name = "cam_cc_ife_2_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = RETAIN_FF_ENABLE,
 };
 
@@ -2296,6 +2300,7 @@ static struct gdsc cam_cc_ipe_0_gdsc = {
 		.name = "cam_cc_ipe_0_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = HW_CTRL | RETAIN_FF_ENABLE,
 };
 
diff --git a/drivers/clk/qcom/clk-branch.h b/drivers/clk/qcom/clk-branch.h
index 17a58119165e..55b3a2c3afed 100644
--- a/drivers/clk/qcom/clk-branch.h
+++ b/drivers/clk/qcom/clk-branch.h
@@ -37,6 +37,32 @@ struct clk_branch {
 	struct clk_regmap clkr;
 };
 
+/* Branch clock common bits for HLOS-owned clocks */
+#define CBCR_FORCE_MEM_CORE_ON		BIT(14)
+#define CBCR_FORCE_MEM_PERIPH_ON	BIT(13)
+#define CBCR_FORCE_MEM_PERIPH_OFF	BIT(12)
+
+static inline void qcom_branch_set_force_mem_core(struct regmap *regmap,
+						  struct clk_branch clk, bool on)
+{
+	regmap_update_bits(regmap, clk.halt_reg, CBCR_FORCE_MEM_CORE_ON,
+			   on ? CBCR_FORCE_MEM_CORE_ON : 0);
+}
+
+static inline void qcom_branch_set_force_periph_on(struct regmap *regmap,
+						   struct clk_branch clk, bool on)
+{
+	regmap_update_bits(regmap, clk.halt_reg, CBCR_FORCE_MEM_PERIPH_ON,
+			   on ? CBCR_FORCE_MEM_PERIPH_ON : 0);
+}
+
+static inline void qcom_branch_set_force_periph_off(struct regmap *regmap,
+						    struct clk_branch clk, bool on)
+{
+	regmap_update_bits(regmap, clk.halt_reg, CBCR_FORCE_MEM_PERIPH_OFF,
+			   on ? CBCR_FORCE_MEM_PERIPH_OFF : 0);
+}
+
 extern const struct clk_ops clk_branch_ops;
 extern const struct clk_ops clk_branch2_ops;
 extern const struct clk_ops clk_branch_simple_ops;
diff --git a/drivers/clk/qcom/clk-rcg2.c b/drivers/clk/qcom/clk-rcg2.c
index dc797bd137ca..e46bb60dcda4 100644
--- a/drivers/clk/qcom/clk-rcg2.c
+++ b/drivers/clk/qcom/clk-rcg2.c
@@ -1136,7 +1136,39 @@ clk_rcg2_shared_recalc_rate(struct clk_hw *hw, unsigned long parent_rate)
 	return clk_rcg2_recalc_rate(hw, parent_rate);
 }
 
+static int clk_rcg2_shared_init(struct clk_hw *hw)
+{
+	/*
+	 * This does a few things:
+	 *
+	 *  1. Sets rcg->parked_cfg to reflect the value at probe so that the
+	 *     proper parent is reported from clk_rcg2_shared_get_parent().
+	 *
+	 *  2. Clears the force enable bit of the RCG because we rely on child
+	 *     clks (branches) to turn the RCG on/off with a hardware feedback
+	 *     mechanism and only set the force enable bit in the RCG when we
+	 *     want to make sure the clk stays on for parent switches or
+	 *     parking.
+	 *
+	 *  3. Parks shared RCGs on the safe source at registration because we
+	 *     can't be certain that the parent clk will stay on during boot,
+	 *     especially if the parent is shared. If this RCG is enabled at
+	 *     boot, and the parent is turned off, the RCG will get stuck on. A
+	 *     GDSC can wedge if is turned on and the RCG is stuck on because
+	 *     the GDSC's controller will hang waiting for the clk status to
+	 *     toggle on when it never does.
+	 *
+	 * The safest option here is to "park" the RCG at init so that the clk
+	 * can never get stuck on or off. This ensures the GDSC can't get
+	 * wedged.
+	 */
+	clk_rcg2_shared_disable(hw);
+
+	return 0;
+}
+
 const struct clk_ops clk_rcg2_shared_ops = {
+	.init = clk_rcg2_shared_init,
 	.enable = clk_rcg2_shared_enable,
 	.disable = clk_rcg2_shared_disable,
 	.get_parent = clk_rcg2_shared_get_parent,
diff --git a/drivers/clk/qcom/gcc-sc7280.c b/drivers/clk/qcom/gcc-sc7280.c
index 46d41ebce2b0..2067e39840cb 100644
--- a/drivers/clk/qcom/gcc-sc7280.c
+++ b/drivers/clk/qcom/gcc-sc7280.c
@@ -3469,6 +3469,9 @@ static int gcc_sc7280_probe(struct platform_device *pdev)
 	regmap_update_bits(regmap, 0x71004, BIT(0), BIT(0));
 	regmap_update_bits(regmap, 0x7100C, BIT(13), BIT(13));
 
+	/* FORCE_MEM_CORE_ON for ufs phy ice core clocks */
+	qcom_branch_set_force_mem_core(regmap, gcc_ufs_phy_ice_core_clk, true);
+
 	ret = qcom_cc_register_rcg_dfs(regmap, gcc_dfs_clocks,
 			ARRAY_SIZE(gcc_dfs_clocks));
 	if (ret)
diff --git a/drivers/clk/qcom/gpucc-sm8350.c b/drivers/clk/qcom/gpucc-sm8350.c
index 5367ce654ac9..cc9fcbc88465 100644
--- a/drivers/clk/qcom/gpucc-sm8350.c
+++ b/drivers/clk/qcom/gpucc-sm8350.c
@@ -2,6 +2,7 @@
 /*
  * Copyright (c) 2019-2020, The Linux Foundation. All rights reserved.
  * Copyright (c) 2022, Linaro Limited
+ * Copyright (c) 2024, Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include <linux/clk.h>
@@ -147,7 +148,7 @@ static struct clk_rcg2 gpu_cc_gmu_clk_src = {
 		.parent_data = gpu_cc_parent_data_0,
 		.num_parents = ARRAY_SIZE(gpu_cc_parent_data_0),
 		.flags = CLK_SET_RATE_PARENT,
-		.ops = &clk_rcg2_ops,
+		.ops = &clk_rcg2_shared_ops,
 	},
 };
 
@@ -169,7 +170,7 @@ static struct clk_rcg2 gpu_cc_hub_clk_src = {
 		.parent_data = gpu_cc_parent_data_1,
 		.num_parents = ARRAY_SIZE(gpu_cc_parent_data_1),
 		.flags = CLK_SET_RATE_PARENT,
-		.ops = &clk_rcg2_ops,
+		.ops = &clk_rcg2_shared_ops,
 	},
 };
 
diff --git a/drivers/cpufreq/ti-cpufreq.c b/drivers/cpufreq/ti-cpufreq.c
index 61ef653bcf56..15e2ef830350 100644
--- a/drivers/cpufreq/ti-cpufreq.c
+++ b/drivers/cpufreq/ti-cpufreq.c
@@ -381,7 +381,7 @@ static int ti_cpufreq_probe(struct platform_device *pdev)
 
 	ret = dev_pm_opp_set_config(opp_data->cpu_dev, &config);
 	if (ret < 0) {
-		dev_err(opp_data->cpu_dev, "Failed to set OPP config\n");
+		dev_err_probe(opp_data->cpu_dev, ret, "Failed to set OPP config\n");
 		goto fail_put_node;
 	}
 
diff --git a/drivers/crypto/qat/qat_common/adf_cfg.c b/drivers/crypto/qat/qat_common/adf_cfg.c
index 1931e5b37f2b..368d14d81503 100644
--- a/drivers/crypto/qat/qat_common/adf_cfg.c
+++ b/drivers/crypto/qat/qat_common/adf_cfg.c
@@ -276,17 +276,19 @@ int adf_cfg_add_key_value_param(struct adf_accel_dev *accel_dev,
 	 * 3. if the key exists with the same value, then return without doing
 	 *    anything (the newly created key_val is freed).
 	 */
+	down_write(&cfg->lock);
 	if (!adf_cfg_key_val_get(accel_dev, section_name, key, temp_val)) {
 		if (strncmp(temp_val, key_val->val, sizeof(temp_val))) {
 			adf_cfg_keyval_remove(key, section);
 		} else {
 			kfree(key_val);
-			return 0;
+			goto out;
 		}
 	}
 
-	down_write(&cfg->lock);
 	adf_cfg_keyval_add(key_val, section);
+
+out:
 	up_write(&cfg->lock);
 	return 0;
 }
diff --git a/drivers/dma/ti/k3-udma.c b/drivers/dma/ti/k3-udma.c
index 82e7acfda6ed..e323e1a5f20f 100644
--- a/drivers/dma/ti/k3-udma.c
+++ b/drivers/dma/ti/k3-udma.c
@@ -4423,7 +4423,9 @@ static int udma_get_mmrs(struct platform_device *pdev, struct udma_dev *ud)
 		ud->rchan_cnt = UDMA_CAP2_RCHAN_CNT(cap2);
 		break;
 	case DMA_TYPE_BCDMA:
-		ud->bchan_cnt = BCDMA_CAP2_BCHAN_CNT(cap2);
+		ud->bchan_cnt = BCDMA_CAP2_BCHAN_CNT(cap2) +
+				BCDMA_CAP3_HBCHAN_CNT(cap3) +
+				BCDMA_CAP3_UBCHAN_CNT(cap3);
 		ud->tchan_cnt = BCDMA_CAP2_TCHAN_CNT(cap2);
 		ud->rchan_cnt = BCDMA_CAP2_RCHAN_CNT(cap2);
 		ud->rflow_cnt = ud->rchan_cnt;
diff --git a/drivers/edac/Makefile b/drivers/edac/Makefile
index 2d1641a27a28..a98e1981df15 100644
--- a/drivers/edac/Makefile
+++ b/drivers/edac/Makefile
@@ -54,11 +54,13 @@ obj-$(CONFIG_EDAC_MPC85XX)		+= mpc85xx_edac_mod.o
 layerscape_edac_mod-y			:= fsl_ddr_edac.o layerscape_edac.o
 obj-$(CONFIG_EDAC_LAYERSCAPE)		+= layerscape_edac_mod.o
 
-skx_edac-y				:= skx_common.o skx_base.o
-obj-$(CONFIG_EDAC_SKX)			+= skx_edac.o
+skx_edac_common-y			:= skx_common.o
 
-i10nm_edac-y				:= skx_common.o i10nm_base.o
-obj-$(CONFIG_EDAC_I10NM)		+= i10nm_edac.o
+skx_edac-y				:= skx_base.o
+obj-$(CONFIG_EDAC_SKX)			+= skx_edac.o skx_edac_common.o
+
+i10nm_edac-y				:= i10nm_base.o
+obj-$(CONFIG_EDAC_I10NM)		+= i10nm_edac.o skx_edac_common.o
 
 obj-$(CONFIG_EDAC_CELL)			+= cell_edac.o
 obj-$(CONFIG_EDAC_PPC4XX)		+= ppc4xx_edac.o
diff --git a/drivers/edac/skx_common.c b/drivers/edac/skx_common.c
index f0f8e98f6efb..e218909f9f9e 100644
--- a/drivers/edac/skx_common.c
+++ b/drivers/edac/skx_common.c
@@ -48,7 +48,7 @@ static u64 skx_tolm, skx_tohm;
 static LIST_HEAD(dev_edac_list);
 static bool skx_mem_cfg_2lm;
 
-int __init skx_adxl_get(void)
+int skx_adxl_get(void)
 {
 	const char * const *names;
 	int i, j;
@@ -110,12 +110,14 @@ int __init skx_adxl_get(void)
 
 	return -ENODEV;
 }
+EXPORT_SYMBOL_GPL(skx_adxl_get);
 
-void __exit skx_adxl_put(void)
+void skx_adxl_put(void)
 {
 	kfree(adxl_values);
 	kfree(adxl_msg);
 }
+EXPORT_SYMBOL_GPL(skx_adxl_put);
 
 static bool skx_adxl_decode(struct decoded_addr *res, bool error_in_1st_level_mem)
 {
@@ -187,12 +189,14 @@ void skx_set_mem_cfg(bool mem_cfg_2lm)
 {
 	skx_mem_cfg_2lm = mem_cfg_2lm;
 }
+EXPORT_SYMBOL_GPL(skx_set_mem_cfg);
 
 void skx_set_decode(skx_decode_f decode, skx_show_retry_log_f show_retry_log)
 {
 	driver_decode = decode;
 	skx_show_retry_rd_err_log = show_retry_log;
 }
+EXPORT_SYMBOL_GPL(skx_set_decode);
 
 int skx_get_src_id(struct skx_dev *d, int off, u8 *id)
 {
@@ -206,6 +210,7 @@ int skx_get_src_id(struct skx_dev *d, int off, u8 *id)
 	*id = GET_BITFIELD(reg, 12, 14);
 	return 0;
 }
+EXPORT_SYMBOL_GPL(skx_get_src_id);
 
 int skx_get_node_id(struct skx_dev *d, u8 *id)
 {
@@ -219,6 +224,7 @@ int skx_get_node_id(struct skx_dev *d, u8 *id)
 	*id = GET_BITFIELD(reg, 0, 2);
 	return 0;
 }
+EXPORT_SYMBOL_GPL(skx_get_node_id);
 
 static int get_width(u32 mtr)
 {
@@ -284,6 +290,7 @@ int skx_get_all_bus_mappings(struct res_config *cfg, struct list_head **list)
 		*list = &dev_edac_list;
 	return ndev;
 }
+EXPORT_SYMBOL_GPL(skx_get_all_bus_mappings);
 
 int skx_get_hi_lo(unsigned int did, int off[], u64 *tolm, u64 *tohm)
 {
@@ -323,6 +330,7 @@ int skx_get_hi_lo(unsigned int did, int off[], u64 *tolm, u64 *tohm)
 	pci_dev_put(pdev);
 	return -ENODEV;
 }
+EXPORT_SYMBOL_GPL(skx_get_hi_lo);
 
 static int skx_get_dimm_attr(u32 reg, int lobit, int hibit, int add,
 			     int minval, int maxval, const char *name)
@@ -394,6 +402,7 @@ int skx_get_dimm_info(u32 mtr, u32 mcmtr, u32 amap, struct dimm_info *dimm,
 
 	return 1;
 }
+EXPORT_SYMBOL_GPL(skx_get_dimm_info);
 
 int skx_get_nvdimm_info(struct dimm_info *dimm, struct skx_imc *imc,
 			int chan, int dimmno, const char *mod_str)
@@ -442,6 +451,7 @@ int skx_get_nvdimm_info(struct dimm_info *dimm, struct skx_imc *imc,
 
 	return (size == 0 || size == ~0ull) ? 0 : 1;
 }
+EXPORT_SYMBOL_GPL(skx_get_nvdimm_info);
 
 int skx_register_mci(struct skx_imc *imc, struct pci_dev *pdev,
 		     const char *ctl_name, const char *mod_str,
@@ -512,6 +522,7 @@ int skx_register_mci(struct skx_imc *imc, struct pci_dev *pdev,
 	imc->mci = NULL;
 	return rc;
 }
+EXPORT_SYMBOL_GPL(skx_register_mci);
 
 static void skx_unregister_mci(struct skx_imc *imc)
 {
@@ -694,6 +705,7 @@ int skx_mce_check_error(struct notifier_block *nb, unsigned long val,
 	mce->kflags |= MCE_HANDLED_EDAC;
 	return NOTIFY_DONE;
 }
+EXPORT_SYMBOL_GPL(skx_mce_check_error);
 
 void skx_remove(void)
 {
@@ -731,3 +743,8 @@ void skx_remove(void)
 		kfree(d);
 	}
 }
+EXPORT_SYMBOL_GPL(skx_remove);
+
+MODULE_LICENSE("GPL v2");
+MODULE_AUTHOR("Tony Luck");
+MODULE_DESCRIPTION("MC Driver for Intel server processors");
diff --git a/drivers/edac/skx_common.h b/drivers/edac/skx_common.h
index 0cbadd3d2cd3..c0c174c101d2 100644
--- a/drivers/edac/skx_common.h
+++ b/drivers/edac/skx_common.h
@@ -178,8 +178,8 @@ typedef int (*get_dimm_config_f)(struct mem_ctl_info *mci,
 typedef bool (*skx_decode_f)(struct decoded_addr *res);
 typedef void (*skx_show_retry_log_f)(struct decoded_addr *res, char *msg, int len, bool scrub_err);
 
-int __init skx_adxl_get(void);
-void __exit skx_adxl_put(void);
+int skx_adxl_get(void);
+void skx_adxl_put(void);
 void skx_set_decode(skx_decode_f decode, skx_show_retry_log_f show_retry_log);
 void skx_set_mem_cfg(bool mem_cfg_2lm);
 
diff --git a/drivers/firmware/efi/libstub/x86-stub.c b/drivers/firmware/efi/libstub/x86-stub.c
index f7eb389aeec0..b8246fc7f412 100644
--- a/drivers/firmware/efi/libstub/x86-stub.c
+++ b/drivers/firmware/efi/libstub/x86-stub.c
@@ -435,11 +435,12 @@ void __noreturn efi_stub_entry(efi_handle_t handle,
 efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
 				   efi_system_table_t *sys_table_arg)
 {
-	static struct boot_params boot_params __page_aligned_bss;
-	struct setup_header *hdr = &boot_params.hdr;
 	efi_guid_t proto = LOADED_IMAGE_PROTOCOL_GUID;
+	struct boot_params *boot_params;
+	struct setup_header *hdr;
 	int options_size = 0;
 	efi_status_t status;
+	unsigned long alloc;
 	char *cmdline_ptr;
 
 	if (efi_is_native())
@@ -457,6 +458,13 @@ efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
 		efi_exit(handle, status);
 	}
 
+	status = efi_allocate_pages(PARAM_SIZE, &alloc, ULONG_MAX);
+	if (status != EFI_SUCCESS)
+		efi_exit(handle, status);
+
+	boot_params = memset((void *)alloc, 0x0, PARAM_SIZE);
+	hdr	    = &boot_params->hdr;
+
 	/* Assign the setup_header fields that the kernel actually cares about */
 	hdr->root_flags	= 1;
 	hdr->vid_mode	= 0xffff;
@@ -466,17 +474,16 @@ efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
 
 	/* Convert unicode cmdline to ascii */
 	cmdline_ptr = efi_convert_cmdline(image, &options_size);
-	if (!cmdline_ptr)
-		goto fail;
+	if (!cmdline_ptr) {
+		efi_free(PARAM_SIZE, alloc);
+		efi_exit(handle, EFI_OUT_OF_RESOURCES);
+	}
 
 	efi_set_u64_split((unsigned long)cmdline_ptr, &hdr->cmd_line_ptr,
-			  &boot_params.ext_cmd_line_ptr);
+			  &boot_params->ext_cmd_line_ptr);
 
-	efi_stub_entry(handle, sys_table_arg, &boot_params);
+	efi_stub_entry(handle, sys_table_arg, boot_params);
 	/* not reached */
-
-fail:
-	efi_exit(handle, status);
 }
 
 static void add_e820ext(struct boot_params *params,
diff --git a/drivers/firmware/turris-mox-rwtm.c b/drivers/firmware/turris-mox-rwtm.c
index c2d34dc8ba46..c3d49fcc5330 100644
--- a/drivers/firmware/turris-mox-rwtm.c
+++ b/drivers/firmware/turris-mox-rwtm.c
@@ -2,7 +2,7 @@
 /*
  * Turris Mox rWTM firmware driver
  *
- * Copyright (C) 2019 Marek Behún <kabel@kernel.org>
+ * Copyright (C) 2019, 2024 Marek Behún <kabel@kernel.org>
  */
 
 #include <linux/armada-37xx-rwtm-mailbox.h>
@@ -174,6 +174,9 @@ static void mox_rwtm_rx_callback(struct mbox_client *cl, void *data)
 	struct mox_rwtm *rwtm = dev_get_drvdata(cl->dev);
 	struct armada_37xx_rwtm_rx_msg *msg = data;
 
+	if (completion_done(&rwtm->cmd_done))
+		return;
+
 	rwtm->reply = *msg;
 	complete(&rwtm->cmd_done);
 }
@@ -199,9 +202,8 @@ static int mox_get_board_info(struct mox_rwtm *rwtm)
 	if (ret < 0)
 		return ret;
 
-	ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
-	if (ret < 0)
-		return ret;
+	if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+		return -ETIMEDOUT;
 
 	ret = mox_get_status(MBOX_CMD_BOARD_INFO, reply->retval);
 	if (ret == -ENODATA) {
@@ -235,9 +237,8 @@ static int mox_get_board_info(struct mox_rwtm *rwtm)
 	if (ret < 0)
 		return ret;
 
-	ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
-	if (ret < 0)
-		return ret;
+	if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+		return -ETIMEDOUT;
 
 	ret = mox_get_status(MBOX_CMD_ECDSA_PUB_KEY, reply->retval);
 	if (ret == -ENODATA) {
@@ -274,9 +275,8 @@ static int check_get_random_support(struct mox_rwtm *rwtm)
 	if (ret < 0)
 		return ret;
 
-	ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
-	if (ret < 0)
-		return ret;
+	if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+		return -ETIMEDOUT;
 
 	return mox_get_status(MBOX_CMD_GET_RANDOM, rwtm->reply.retval);
 }
@@ -499,6 +499,7 @@ static int turris_mox_rwtm_probe(struct platform_device *pdev)
 	platform_set_drvdata(pdev, rwtm);
 
 	mutex_init(&rwtm->busy);
+	init_completion(&rwtm->cmd_done);
 
 	rwtm->mbox_client.dev = dev;
 	rwtm->mbox_client.rx_callback = mox_rwtm_rx_callback;
@@ -512,8 +513,6 @@ static int turris_mox_rwtm_probe(struct platform_device *pdev)
 		goto remove_files;
 	}
 
-	init_completion(&rwtm->cmd_done);
-
 	ret = mox_get_board_info(rwtm);
 	if (ret < 0)
 		dev_warn(dev, "Cannot read board information: %i\n", ret);
diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
index 157441dd0704..d4faa489bd5f 100644
--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
+++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
@@ -5815,7 +5815,7 @@ int amdgpu_device_baco_exit(struct drm_device *dev)
 	    adev->nbio.funcs->enable_doorbell_interrupt)
 		adev->nbio.funcs->enable_doorbell_interrupt(adev, true);
 
-	if (amdgpu_passthrough(adev) &&
+	if (amdgpu_passthrough(adev) && adev->nbio.funcs &&
 	    adev->nbio.funcs->clear_doorbell_interrupt)
 		adev->nbio.funcs->clear_doorbell_interrupt(adev);
 
diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
index ea0fb079f942..fd98d2508a22 100644
--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
+++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
@@ -583,7 +583,6 @@ void amdgpu_gmc_noretry_set(struct amdgpu_device *adev)
 	struct amdgpu_gmc *gmc = &adev->gmc;
 	uint32_t gc_ver = adev->ip_versions[GC_HWIP][0];
 	bool noretry_default = (gc_ver == IP_VERSION(9, 0, 1) ||
-				gc_ver == IP_VERSION(9, 3, 0) ||
 				gc_ver == IP_VERSION(9, 4, 0) ||
 				gc_ver == IP_VERSION(9, 4, 1) ||
 				gc_ver == IP_VERSION(9, 4, 2) ||
diff --git a/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c b/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
index c7af36370b0d..38f57455bc74 100644
--- a/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
+++ b/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
@@ -241,6 +241,14 @@ static void sdma_v5_2_ring_set_wptr(struct amdgpu_ring *ring)
 		DRM_DEBUG("calling WDOORBELL64(0x%08x, 0x%016llx)\n",
 				ring->doorbell_index, ring->wptr << 2);
 		WDOORBELL64(ring->doorbell_index, ring->wptr << 2);
+		/* SDMA seems to miss doorbells sometimes when powergating kicks in.
+		 * Updating the wptr directly will wake it. This is only safe because
+		 * we disallow gfxoff in begin_use() and then allow it again in end_use().
+		 */
+		WREG32(sdma_v5_2_get_reg_offset(adev, ring->me, mmSDMA0_GFX_RB_WPTR),
+		       lower_32_bits(ring->wptr << 2));
+		WREG32(sdma_v5_2_get_reg_offset(adev, ring->me, mmSDMA0_GFX_RB_WPTR_HI),
+		       upper_32_bits(ring->wptr << 2));
 	} else {
 		DRM_DEBUG("Not using doorbell -- "
 				"mmSDMA%i_GFX_RB_WPTR == 0x%08x "
@@ -1705,6 +1713,10 @@ static void sdma_v5_2_ring_begin_use(struct amdgpu_ring *ring)
 	 * but it shouldn't hurt for other parts since
 	 * this GFXOFF will be disallowed anyway when SDMA is
 	 * active, this just makes it explicit.
+	 * sdma_v5_2_ring_set_wptr() takes advantage of this
+	 * to update the wptr because sometimes SDMA seems to miss
+	 * doorbells when entering PG.  If you remove this, update
+	 * sdma_v5_2_ring_set_wptr() as well!
 	 */
 	amdgpu_gfx_off_ctrl(adev, false);
 }
diff --git a/drivers/gpu/drm/amd/display/dc/core/dc_surface.c b/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
index a80e45300783..f4f3ca7aad60 100644
--- a/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
+++ b/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
@@ -154,7 +154,8 @@ const struct dc_plane_status *dc_plane_get_status(
 		if (pipe_ctx->plane_state != plane_state)
 			continue;
 
-		pipe_ctx->plane_state->status.is_flip_pending = false;
+		if (pipe_ctx->plane_state)
+			pipe_ctx->plane_state->status.is_flip_pending = false;
 
 		break;
 	}
diff --git a/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c b/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
index f3257cf4b06f..3aab1caed2ac 100644
--- a/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
+++ b/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
@@ -79,8 +79,8 @@ MODULE_FIRMWARE("amdgpu/smu_13_0_10.bin");
 #define PCIE_LC_LINK_WIDTH_CNTL__LC_LINK_WIDTH_RD_MASK 0x00000070L
 #define PCIE_LC_LINK_WIDTH_CNTL__LC_LINK_WIDTH_RD__SHIFT 0x4
 #define smnPCIE_LC_SPEED_CNTL			0x11140290
-#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE_MASK 0xC000
-#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE__SHIFT 0xE
+#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE_MASK 0xE0
+#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE__SHIFT 0x5
 
 static const int link_width[] = {0, 1, 2, 4, 8, 12, 16};
 static const int link_speed[] = {25, 50, 80, 160};
diff --git a/drivers/gpu/drm/display/drm_dp_mst_topology.c b/drivers/gpu/drm/display/drm_dp_mst_topology.c
index 72b2b171e533..805f8455b8d6 100644
--- a/drivers/gpu/drm/display/drm_dp_mst_topology.c
+++ b/drivers/gpu/drm/display/drm_dp_mst_topology.c
@@ -2923,7 +2923,7 @@ static int drm_dp_send_link_address(struct drm_dp_mst_topology_mgr *mgr,
 
 	/* FIXME: Actually do some real error handling here */
 	ret = drm_dp_mst_wait_tx_reply(mstb, txmsg);
-	if (ret <= 0) {
+	if (ret < 0) {
 		drm_err(mgr->dev, "Sending link address failed with %d\n", ret);
 		goto out;
 	}
@@ -2975,7 +2975,7 @@ static int drm_dp_send_link_address(struct drm_dp_mst_topology_mgr *mgr,
 	mutex_unlock(&mgr->lock);
 
 out:
-	if (ret <= 0)
+	if (ret < 0)
 		mstb->link_address_sent = false;
 	kfree(txmsg);
 	return ret < 0 ? ret : changed;
diff --git a/drivers/gpu/drm/etnaviv/etnaviv_gem.c b/drivers/gpu/drm/etnaviv/etnaviv_gem.c
index 5cf13e52f7c9..23d5058eca8d 100644
--- a/drivers/gpu/drm/etnaviv/etnaviv_gem.c
+++ b/drivers/gpu/drm/etnaviv/etnaviv_gem.c
@@ -355,9 +355,11 @@ static void *etnaviv_gem_vmap_impl(struct etnaviv_gem_object *obj)
 
 static inline enum dma_data_direction etnaviv_op_to_dma_dir(u32 op)
 {
-	if (op & ETNA_PREP_READ)
+	op &= ETNA_PREP_READ | ETNA_PREP_WRITE;
+
+	if (op == ETNA_PREP_READ)
 		return DMA_FROM_DEVICE;
-	else if (op & ETNA_PREP_WRITE)
+	else if (op == ETNA_PREP_WRITE)
 		return DMA_TO_DEVICE;
 	else
 		return DMA_BIDIRECTIONAL;
diff --git a/drivers/gpu/drm/etnaviv/etnaviv_sched.c b/drivers/gpu/drm/etnaviv/etnaviv_sched.c
index 72e2553fbc98..5d506767b8f2 100644
--- a/drivers/gpu/drm/etnaviv/etnaviv_sched.c
+++ b/drivers/gpu/drm/etnaviv/etnaviv_sched.c
@@ -38,9 +38,6 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
 	u32 dma_addr;
 	int change;
 
-	/* block scheduler */
-	drm_sched_stop(&gpu->sched, sched_job);
-
 	/*
 	 * If the GPU managed to complete this jobs fence, the timout is
 	 * spurious. Bail out.
@@ -62,6 +59,9 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
 		goto out_no_timeout;
 	}
 
+	/* block scheduler */
+	drm_sched_stop(&gpu->sched, sched_job);
+
 	if(sched_job)
 		drm_sched_increase_karma(sched_job);
 
@@ -75,8 +75,7 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
 	return DRM_GPU_SCHED_STAT_NOMINAL;
 
 out_no_timeout:
-	/* restart scheduler after GPU is usable again */
-	drm_sched_start(&gpu->sched, true);
+	list_add(&sched_job->list, &sched_job->sched->pending_list);
 	return DRM_GPU_SCHED_STAT_NOMINAL;
 }
 
diff --git a/drivers/gpu/drm/gma500/cdv_intel_lvds.c b/drivers/gpu/drm/gma500/cdv_intel_lvds.c
index be6efcaaa3b3..c9ad16960e82 100644
--- a/drivers/gpu/drm/gma500/cdv_intel_lvds.c
+++ b/drivers/gpu/drm/gma500/cdv_intel_lvds.c
@@ -309,6 +309,9 @@ static int cdv_intel_lvds_get_modes(struct drm_connector *connector)
 	if (mode_dev->panel_fixed_mode != NULL) {
 		struct drm_display_mode *mode =
 		    drm_mode_duplicate(dev, mode_dev->panel_fixed_mode);
+		if (!mode)
+			return 0;
+
 		drm_mode_probed_add(connector, mode);
 		return 1;
 	}
diff --git a/drivers/gpu/drm/gma500/psb_intel_lvds.c b/drivers/gpu/drm/gma500/psb_intel_lvds.c
index 7ee6c8ce103b..9842de0dad3a 100644
--- a/drivers/gpu/drm/gma500/psb_intel_lvds.c
+++ b/drivers/gpu/drm/gma500/psb_intel_lvds.c
@@ -502,6 +502,9 @@ static int psb_intel_lvds_get_modes(struct drm_connector *connector)
 	if (mode_dev->panel_fixed_mode != NULL) {
 		struct drm_display_mode *mode =
 		    drm_mode_duplicate(dev, mode_dev->panel_fixed_mode);
+		if (!mode)
+			return 0;
+
 		drm_mode_probed_add(connector, mode);
 		return 1;
 	}
diff --git a/drivers/gpu/drm/i915/display/intel_dp.c b/drivers/gpu/drm/i915/display/intel_dp.c
index a27563bfd909..3f65d890b8a9 100644
--- a/drivers/gpu/drm/i915/display/intel_dp.c
+++ b/drivers/gpu/drm/i915/display/intel_dp.c
@@ -4089,6 +4089,8 @@ int intel_dp_retrain_link(struct intel_encoder *encoder,
 		    !intel_dp_mst_is_master_trans(crtc_state))
 			continue;
 
+		intel_dp->link_trained = false;
+
 		intel_dp_check_frl_training(intel_dp);
 		intel_dp_pcon_dsc_configure(intel_dp, crtc_state);
 		intel_dp_start_link_train(intel_dp, crtc_state);
diff --git a/drivers/gpu/drm/i915/gt/intel_execlists_submission.c b/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
index eae138b9f2df..321dbecba0f3 100644
--- a/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
+++ b/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
@@ -3313,11 +3313,7 @@ static void remove_from_engine(struct i915_request *rq)
 
 static bool can_preempt(struct intel_engine_cs *engine)
 {
-	if (GRAPHICS_VER(engine->i915) > 8)
-		return true;
-
-	/* GPGPU on bdw requires extra w/a; not implemented */
-	return engine->class != RENDER_CLASS;
+	return GRAPHICS_VER(engine->i915) > 8;
 }
 
 static void kick_execlists(const struct i915_request *rq, int prio)
diff --git a/drivers/gpu/drm/mediatek/mtk_drm_drv.c b/drivers/gpu/drm/mediatek/mtk_drm_drv.c
index 25639fbfd374..905275df0980 100644
--- a/drivers/gpu/drm/mediatek/mtk_drm_drv.c
+++ b/drivers/gpu/drm/mediatek/mtk_drm_drv.c
@@ -598,6 +598,8 @@ static const struct of_device_id mtk_ddp_comp_dt_ids[] = {
 	  .data = (void *)MTK_DISP_OVL },
 	{ .compatible = "mediatek,mt8192-disp-ovl",
 	  .data = (void *)MTK_DISP_OVL },
+	{ .compatible = "mediatek,mt8195-disp-ovl",
+	  .data = (void *)MTK_DISP_OVL },
 	{ .compatible = "mediatek,mt8183-disp-ovl-2l",
 	  .data = (void *)MTK_DISP_OVL_2L },
 	{ .compatible = "mediatek,mt8192-disp-ovl-2l",
diff --git a/drivers/gpu/drm/mediatek/mtk_drm_plane.c b/drivers/gpu/drm/mediatek/mtk_drm_plane.c
index c4a0203d17e3..30d361671aa9 100644
--- a/drivers/gpu/drm/mediatek/mtk_drm_plane.c
+++ b/drivers/gpu/drm/mediatek/mtk_drm_plane.c
@@ -157,6 +157,8 @@ static void mtk_plane_atomic_async_update(struct drm_plane *plane,
 	plane->state->src_y = new_state->src_y;
 	plane->state->src_h = new_state->src_h;
 	plane->state->src_w = new_state->src_w;
+	plane->state->dst.x1 = new_state->dst.x1;
+	plane->state->dst.y1 = new_state->dst.y1;
 
 	mtk_plane_update_new_state(new_state, new_plane_state);
 	swap(plane->state->fb, new_state->fb);
diff --git a/drivers/gpu/drm/meson/meson_drv.c b/drivers/gpu/drm/meson/meson_drv.c
index fbac39aa38cc..f0df41cf39a3 100644
--- a/drivers/gpu/drm/meson/meson_drv.c
+++ b/drivers/gpu/drm/meson/meson_drv.c
@@ -249,29 +249,20 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
 	if (ret)
 		goto free_drm;
 	ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_0);
-	if (ret) {
-		meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
-		goto free_drm;
-	}
+	if (ret)
+		goto free_canvas_osd1;
 	ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_1);
-	if (ret) {
-		meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
-		meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
-		goto free_drm;
-	}
+	if (ret)
+		goto free_canvas_vd1_0;
 	ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_2);
-	if (ret) {
-		meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
-		meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
-		meson_canvas_free(priv->canvas, priv->canvas_id_vd1_1);
-		goto free_drm;
-	}
+	if (ret)
+		goto free_canvas_vd1_1;
 
 	priv->vsync_irq = platform_get_irq(pdev, 0);
 
 	ret = drm_vblank_init(drm, 1);
 	if (ret)
-		goto free_drm;
+		goto free_canvas_vd1_2;
 
 	/* Assign limits per soc revision/package */
 	for (i = 0 ; i < ARRAY_SIZE(meson_drm_soc_attrs) ; ++i) {
@@ -287,11 +278,11 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
 	 */
 	ret = drm_aperture_remove_framebuffers(&meson_driver);
 	if (ret)
-		goto free_drm;
+		goto free_canvas_vd1_2;
 
 	ret = drmm_mode_config_init(drm);
 	if (ret)
-		goto free_drm;
+		goto free_canvas_vd1_2;
 	drm->mode_config.max_width = 3840;
 	drm->mode_config.max_height = 2160;
 	drm->mode_config.funcs = &meson_mode_config_funcs;
@@ -306,7 +297,7 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
 	if (priv->afbcd.ops) {
 		ret = priv->afbcd.ops->init(priv);
 		if (ret)
-			goto free_drm;
+			goto free_canvas_vd1_2;
 	}
 
 	/* Encoder Initialization */
@@ -364,6 +355,14 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
 exit_afbcd:
 	if (priv->afbcd.ops)
 		priv->afbcd.ops->exit(priv);
+free_canvas_vd1_2:
+	meson_canvas_free(priv->canvas, priv->canvas_id_vd1_2);
+free_canvas_vd1_1:
+	meson_canvas_free(priv->canvas, priv->canvas_id_vd1_1);
+free_canvas_vd1_0:
+	meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
+free_canvas_osd1:
+	meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
 free_drm:
 	drm_dev_put(drm);
 
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
index 3632f0768aa9..1bf41a82cd0f 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
@@ -1653,8 +1653,7 @@ void dpu_encoder_trigger_kickoff_pending(struct drm_encoder *drm_enc)
 		phys = dpu_enc->phys_encs[i];
 
 		ctl = phys->hw_ctl;
-		if (ctl->ops.clear_pending_flush)
-			ctl->ops.clear_pending_flush(ctl);
+		ctl->ops.clear_pending_flush(ctl);
 
 		/* update only for command mode primary ctl */
 		if ((phys == dpu_enc->cur_master) &&
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
index 42c7e378d504..05a09d86e183 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
@@ -548,8 +548,7 @@ static void dpu_encoder_phys_wb_disable(struct dpu_encoder_phys *phys_enc)
 	}
 
 	/* reset h/w before final flush */
-	if (phys_enc->hw_ctl->ops.clear_pending_flush)
-		phys_enc->hw_ctl->ops.clear_pending_flush(phys_enc->hw_ctl);
+	phys_enc->hw_ctl->ops.clear_pending_flush(phys_enc->hw_ctl);
 
 	/*
 	 * New CTL reset sequence from 5.0 MDP onwards.
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h b/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
index 96c012ec8467..ec5265771cdf 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
@@ -81,7 +81,8 @@ struct dpu_hw_ctl_ops {
 
 	/**
 	 * Clear the value of the cached pending_flush_mask
-	 * No effect on hardware
+	 * No effect on hardware.
+	 * Required to be implemented.
 	 * @ctx       : ctl path ctx pointer
 	 */
 	void (*clear_pending_flush)(struct dpu_hw_ctl *ctx);
diff --git a/drivers/gpu/drm/msm/dsi/dsi_host.c b/drivers/gpu/drm/msm/dsi/dsi_host.c
index cd9ca3690161..034ad810fd65 100644
--- a/drivers/gpu/drm/msm/dsi/dsi_host.c
+++ b/drivers/gpu/drm/msm/dsi/dsi_host.c
@@ -848,6 +848,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
 	u32 slice_per_intf, total_bytes_per_intf;
 	u32 pkt_per_line;
 	u32 eol_byte_num;
+	u32 bytes_per_pkt;
 
 	/* first calculate dsc parameters and then program
 	 * compress mode registers
@@ -855,6 +856,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
 	slice_per_intf = DIV_ROUND_UP(hdisplay, dsc->slice_width);
 
 	total_bytes_per_intf = dsc->slice_chunk_size * slice_per_intf;
+	bytes_per_pkt = dsc->slice_chunk_size; /* * slice_per_pkt; */
 
 	eol_byte_num = total_bytes_per_intf % 3;
 
@@ -892,6 +894,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
 		dsi_write(msm_host, REG_DSI_COMMAND_COMPRESSION_MODE_CTRL, reg_ctrl);
 		dsi_write(msm_host, REG_DSI_COMMAND_COMPRESSION_MODE_CTRL2, reg_ctrl2);
 	} else {
+		reg |= DSI_VIDEO_COMPRESSION_MODE_CTRL_WC(bytes_per_pkt);
 		dsi_write(msm_host, REG_DSI_VIDEO_COMPRESSION_MODE_CTRL, reg);
 	}
 }
diff --git a/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c b/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
index 1c008bd9102f..820d8d29b62b 100644
--- a/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
+++ b/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
@@ -1271,7 +1271,11 @@ static int boe_panel_prepare(struct drm_panel *panel)
 	usleep_range(10000, 11000);
 
 	if (boe->desc->lp11_before_reset) {
-		mipi_dsi_dcs_nop(boe->dsi);
+		ret = mipi_dsi_dcs_nop(boe->dsi);
+		if (ret < 0) {
+			dev_err(&boe->dsi->dev, "Failed to send NOP: %d\n", ret);
+			goto poweroff;
+		}
 		usleep_range(1000, 2000);
 	}
 	gpiod_set_value(boe->enable_gpio, 1);
@@ -1292,13 +1296,13 @@ static int boe_panel_prepare(struct drm_panel *panel)
 	return 0;
 
 poweroff:
+	gpiod_set_value(boe->enable_gpio, 0);
 	regulator_disable(boe->avee);
 poweroffavdd:
 	regulator_disable(boe->avdd);
 poweroff1v8:
 	usleep_range(5000, 7000);
 	regulator_disable(boe->pp1800);
-	gpiod_set_value(boe->enable_gpio, 0);
 
 	return ret;
 }
diff --git a/drivers/gpu/drm/panfrost/panfrost_drv.c b/drivers/gpu/drm/panfrost/panfrost_drv.c
index 919e6cc04982..3c0aa8b5e1ae 100644
--- a/drivers/gpu/drm/panfrost/panfrost_drv.c
+++ b/drivers/gpu/drm/panfrost/panfrost_drv.c
@@ -704,3 +704,4 @@ module_platform_driver(panfrost_driver);
 MODULE_AUTHOR("Panfrost Project Developers");
 MODULE_DESCRIPTION("Panfrost DRM Driver");
 MODULE_LICENSE("GPL v2");
+MODULE_SOFTDEP("pre: governor_simpleondemand");
diff --git a/drivers/gpu/drm/qxl/qxl_display.c b/drivers/gpu/drm/qxl/qxl_display.c
index f91a86225d5e..462a4d2ac0b9 100644
--- a/drivers/gpu/drm/qxl/qxl_display.c
+++ b/drivers/gpu/drm/qxl/qxl_display.c
@@ -236,6 +236,9 @@ static int qxl_add_mode(struct drm_connector *connector,
 		return 0;
 
 	mode = drm_cvt_mode(dev, width, height, 60, false, false, false);
+	if (!mode)
+		return 0;
+
 	if (preferred)
 		mode->type |= DRM_MODE_TYPE_PREFERRED;
 	mode->hdisplay = width;
diff --git a/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c b/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
index a72642bb9cc6..80b8c8334284 100644
--- a/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
+++ b/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
@@ -1923,7 +1923,7 @@ static void vop2_setup_layer_mixer(struct vop2_video_port *vp)
 		port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT2_MUX,
 			(vp2->nlayers + vp1->nlayers + vp0->nlayers - 1));
 	else
-		port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT1_MUX, 8);
+		port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT2_MUX, 8);
 
 	layer_sel = vop2_readl(vop2, RK3568_OVL_LAYER_SEL);
 
diff --git a/drivers/hwmon/adt7475.c b/drivers/hwmon/adt7475.c
index 6a6ebcc896b1..3ac674427675 100644
--- a/drivers/hwmon/adt7475.c
+++ b/drivers/hwmon/adt7475.c
@@ -1863,7 +1863,7 @@ static void adt7475_read_pwm(struct i2c_client *client, int index)
 		data->pwm[CONTROL][index] &= ~0xE0;
 		data->pwm[CONTROL][index] |= (7 << 5);
 
-		i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index),
+		i2c_smbus_write_byte_data(client, PWM_REG(index),
 					  data->pwm[INPUT][index]);
 
 		i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index),
diff --git a/drivers/hwmon/max6697.c b/drivers/hwmon/max6697.c
index 2895cea54193..266baae94e3e 100644
--- a/drivers/hwmon/max6697.c
+++ b/drivers/hwmon/max6697.c
@@ -312,6 +312,7 @@ static ssize_t temp_store(struct device *dev,
 		return ret;
 
 	mutex_lock(&data->update_lock);
+	temp = clamp_val(temp, -1000000, 1000000);	/* prevent underflow */
 	temp = DIV_ROUND_CLOSEST(temp, 1000) + data->temp_offset;
 	temp = clamp_val(temp, 0, data->type == max6581 ? 255 : 127);
 	data->temp[nr][index] = temp;
@@ -429,14 +430,14 @@ static SENSOR_DEVICE_ATTR_RO(temp6_max_alarm, alarm, 20);
 static SENSOR_DEVICE_ATTR_RO(temp7_max_alarm, alarm, 21);
 static SENSOR_DEVICE_ATTR_RO(temp8_max_alarm, alarm, 23);
 
-static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 14);
+static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 15);
 static SENSOR_DEVICE_ATTR_RO(temp2_crit_alarm, alarm, 8);
 static SENSOR_DEVICE_ATTR_RO(temp3_crit_alarm, alarm, 9);
 static SENSOR_DEVICE_ATTR_RO(temp4_crit_alarm, alarm, 10);
 static SENSOR_DEVICE_ATTR_RO(temp5_crit_alarm, alarm, 11);
 static SENSOR_DEVICE_ATTR_RO(temp6_crit_alarm, alarm, 12);
 static SENSOR_DEVICE_ATTR_RO(temp7_crit_alarm, alarm, 13);
-static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 15);
+static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 14);
 
 static SENSOR_DEVICE_ATTR_RO(temp2_fault, alarm, 1);
 static SENSOR_DEVICE_ATTR_RO(temp3_fault, alarm, 2);
diff --git a/drivers/hwtracing/coresight/coresight-platform.c b/drivers/hwtracing/coresight/coresight-platform.c
index 475899714104..3f82ae07a18e 100644
--- a/drivers/hwtracing/coresight/coresight-platform.c
+++ b/drivers/hwtracing/coresight/coresight-platform.c
@@ -323,8 +323,10 @@ static int of_get_coresight_platform_data(struct device *dev,
 			continue;
 
 		ret = of_coresight_parse_endpoint(dev, ep, pdata);
-		if (ret)
+		if (ret) {
+			of_node_put(ep);
 			return ret;
+		}
 	}
 
 	return 0;
diff --git a/drivers/iio/frequency/adrf6780.c b/drivers/iio/frequency/adrf6780.c
index b4defb82f37e..3f46032c9275 100644
--- a/drivers/iio/frequency/adrf6780.c
+++ b/drivers/iio/frequency/adrf6780.c
@@ -9,7 +9,6 @@
 #include <linux/bits.h>
 #include <linux/clk.h>
 #include <linux/clkdev.h>
-#include <linux/clk-provider.h>
 #include <linux/delay.h>
 #include <linux/device.h>
 #include <linux/iio/iio.h>
diff --git a/drivers/infiniband/core/cache.c b/drivers/infiniband/core/cache.c
index 4084d05a4510..c319664ca74b 100644
--- a/drivers/infiniband/core/cache.c
+++ b/drivers/infiniband/core/cache.c
@@ -794,7 +794,6 @@ static struct ib_gid_table *alloc_gid_table(int sz)
 static void release_gid_table(struct ib_device *device,
 			      struct ib_gid_table *table)
 {
-	bool leak = false;
 	int i;
 
 	if (!table)
@@ -803,15 +802,12 @@ static void release_gid_table(struct ib_device *device,
 	for (i = 0; i < table->sz; i++) {
 		if (is_gid_entry_free(table->data_vec[i]))
 			continue;
-		if (kref_read(&table->data_vec[i]->kref) > 1) {
-			dev_err(&device->dev,
-				"GID entry ref leak for index %d ref=%u\n", i,
-				kref_read(&table->data_vec[i]->kref));
-			leak = true;
-		}
+
+		WARN_ONCE(true,
+			  "GID entry ref leak for dev %s index %d ref=%u\n",
+			  dev_name(&device->dev), i,
+			  kref_read(&table->data_vec[i]->kref));
 	}
-	if (leak)
-		return;
 
 	mutex_destroy(&table->lock);
 	kfree(table->data_vec);
diff --git a/drivers/infiniband/core/device.c b/drivers/infiniband/core/device.c
index 453188db39d8..291ded20934c 100644
--- a/drivers/infiniband/core/device.c
+++ b/drivers/infiniband/core/device.c
@@ -2146,6 +2146,9 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev,
 	unsigned long flags;
 	int ret;
 
+	if (!rdma_is_port_valid(ib_dev, port))
+		return -EINVAL;
+
 	/*
 	 * Drivers wish to call this before ib_register_driver, so we have to
 	 * setup the port data early.
@@ -2154,9 +2157,6 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev,
 	if (ret)
 		return ret;
 
-	if (!rdma_is_port_valid(ib_dev, port))
-		return -EINVAL;
-
 	pdata = &ib_dev->port_data[port];
 	spin_lock_irqsave(&pdata->netdev_lock, flags);
 	old_ndev = rcu_dereference_protected(
diff --git a/drivers/infiniband/core/iwcm.c b/drivers/infiniband/core/iwcm.c
index 2b47073c61a6..2d09d1be38f1 100644
--- a/drivers/infiniband/core/iwcm.c
+++ b/drivers/infiniband/core/iwcm.c
@@ -369,8 +369,10 @@ EXPORT_SYMBOL(iw_cm_disconnect);
  *
  * Clean up all resources associated with the connection and release
  * the initial reference taken by iw_create_cm_id.
+ *
+ * Returns true if and only if the last cm_id_priv reference has been dropped.
  */
-static void destroy_cm_id(struct iw_cm_id *cm_id)
+static bool destroy_cm_id(struct iw_cm_id *cm_id)
 {
 	struct iwcm_id_private *cm_id_priv;
 	struct ib_qp *qp;
@@ -440,7 +442,7 @@ static void destroy_cm_id(struct iw_cm_id *cm_id)
 		iwpm_remove_mapping(&cm_id->local_addr, RDMA_NL_IWCM);
 	}
 
-	(void)iwcm_deref_id(cm_id_priv);
+	return iwcm_deref_id(cm_id_priv);
 }
 
 /*
@@ -451,7 +453,8 @@ static void destroy_cm_id(struct iw_cm_id *cm_id)
  */
 void iw_destroy_cm_id(struct iw_cm_id *cm_id)
 {
-	destroy_cm_id(cm_id);
+	if (!destroy_cm_id(cm_id))
+		flush_workqueue(iwcm_wq);
 }
 EXPORT_SYMBOL(iw_destroy_cm_id);
 
@@ -1035,7 +1038,7 @@ static void cm_work_handler(struct work_struct *_work)
 		if (!test_bit(IWCM_F_DROP_EVENTS, &cm_id_priv->flags)) {
 			ret = process_event(cm_id_priv, &levent);
 			if (ret)
-				destroy_cm_id(&cm_id_priv->id);
+				WARN_ON_ONCE(destroy_cm_id(&cm_id_priv->id));
 		} else
 			pr_debug("dropping event %d\n", levent.event);
 		if (iwcm_deref_id(cm_id_priv))
diff --git a/drivers/infiniband/hw/bnxt_re/ib_verbs.c b/drivers/infiniband/hw/bnxt_re/ib_verbs.c
index 6ed0568747ea..4c34cb1cb786 100644
--- a/drivers/infiniband/hw/bnxt_re/ib_verbs.c
+++ b/drivers/infiniband/hw/bnxt_re/ib_verbs.c
@@ -2359,7 +2359,7 @@ static int bnxt_re_build_send_wqe(struct bnxt_re_qp *qp,
 		break;
 	case IB_WR_SEND_WITH_IMM:
 		wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_IMM;
-		wqe->send.imm_data = wr->ex.imm_data;
+		wqe->send.imm_data = be32_to_cpu(wr->ex.imm_data);
 		break;
 	case IB_WR_SEND_WITH_INV:
 		wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_INV;
@@ -2389,7 +2389,7 @@ static int bnxt_re_build_rdma_wqe(const struct ib_send_wr *wr,
 		break;
 	case IB_WR_RDMA_WRITE_WITH_IMM:
 		wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_WRITE_WITH_IMM;
-		wqe->rdma.imm_data = wr->ex.imm_data;
+		wqe->rdma.imm_data = be32_to_cpu(wr->ex.imm_data);
 		break;
 	case IB_WR_RDMA_READ:
 		wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_READ;
@@ -3340,7 +3340,7 @@ static void bnxt_re_process_res_shadow_qp_wc(struct bnxt_re_qp *gsi_sqp,
 	wc->byte_len = orig_cqe->length;
 	wc->qp = &gsi_qp->ib_qp;
 
-	wc->ex.imm_data = orig_cqe->immdata;
+	wc->ex.imm_data = cpu_to_be32(le32_to_cpu(orig_cqe->immdata));
 	wc->src_qp = orig_cqe->src_qp;
 	memcpy(wc->smac, orig_cqe->smac, ETH_ALEN);
 	if (bnxt_re_is_vlan_pkt(orig_cqe, &vlan_id, &sl)) {
@@ -3476,7 +3476,7 @@ int bnxt_re_poll_cq(struct ib_cq *ib_cq, int num_entries, struct ib_wc *wc)
 				 (unsigned long)(cqe->qp_handle),
 				 struct bnxt_re_qp, qplib_qp);
 			wc->qp = &qp->ib_qp;
-			wc->ex.imm_data = cqe->immdata;
+			wc->ex.imm_data = cpu_to_be32(le32_to_cpu(cqe->immdata));
 			wc->src_qp = cqe->src_qp;
 			memcpy(wc->smac, cqe->smac, ETH_ALEN);
 			wc->port_num = 1;
diff --git a/drivers/infiniband/hw/bnxt_re/qplib_fp.h b/drivers/infiniband/hw/bnxt_re/qplib_fp.h
index 49d89c080827..4f1a845f9be6 100644
--- a/drivers/infiniband/hw/bnxt_re/qplib_fp.h
+++ b/drivers/infiniband/hw/bnxt_re/qplib_fp.h
@@ -164,7 +164,7 @@ struct bnxt_qplib_swqe {
 		/* Send, with imm, inval key */
 		struct {
 			union {
-				__be32	imm_data;
+				u32	imm_data;
 				u32	inv_key;
 			};
 			u32		q_key;
@@ -182,7 +182,7 @@ struct bnxt_qplib_swqe {
 		/* RDMA write, with imm, read */
 		struct {
 			union {
-				__be32	imm_data;
+				u32	imm_data;
 				u32	inv_key;
 			};
 			u64		remote_va;
@@ -374,7 +374,7 @@ struct bnxt_qplib_cqe {
 	u16				cfa_meta;
 	u64				wr_id;
 	union {
-		__be32			immdata;
+		__le32			immdata;
 		u32			invrkey;
 	};
 	u64				qp_handle;
diff --git a/drivers/infiniband/hw/hns/hns_roce_device.h b/drivers/infiniband/hw/hns/hns_roce_device.h
index 8748b65c87ea..a2bdfa026c56 100644
--- a/drivers/infiniband/hw/hns/hns_roce_device.h
+++ b/drivers/infiniband/hw/hns/hns_roce_device.h
@@ -82,6 +82,7 @@
 #define MR_TYPE_DMA				0x03
 
 #define HNS_ROCE_FRMR_MAX_PA			512
+#define HNS_ROCE_FRMR_ALIGN_SIZE		128
 
 #define PKEY_ID					0xffff
 #define NODE_DESC_SIZE				64
@@ -90,6 +91,8 @@
 /* Configure to HW for PAGE_SIZE larger than 4KB */
 #define PG_SHIFT_OFFSET				(PAGE_SHIFT - 12)
 
+#define ATOMIC_WR_LEN				8
+
 #define HNS_ROCE_IDX_QUE_ENTRY_SZ		4
 #define SRQ_DB_REG				0x230
 
@@ -180,6 +183,9 @@ enum {
 #define HNS_HW_PAGE_SHIFT			12
 #define HNS_HW_PAGE_SIZE			(1 << HNS_HW_PAGE_SHIFT)
 
+#define HNS_HW_MAX_PAGE_SHIFT			27
+#define HNS_HW_MAX_PAGE_SIZE			(1 << HNS_HW_MAX_PAGE_SHIFT)
+
 struct hns_roce_uar {
 	u64		pfn;
 	unsigned long	index;
diff --git a/drivers/infiniband/hw/hns/hns_roce_hw_v2.c b/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
index c931cce50d50..c4521ab66ee4 100644
--- a/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
+++ b/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
@@ -602,11 +602,16 @@ static inline int set_rc_wqe(struct hns_roce_qp *qp,
 		     (wr->send_flags & IB_SEND_SIGNALED) ? 1 : 0);
 
 	if (wr->opcode == IB_WR_ATOMIC_CMP_AND_SWP ||
-	    wr->opcode == IB_WR_ATOMIC_FETCH_AND_ADD)
+	    wr->opcode == IB_WR_ATOMIC_FETCH_AND_ADD) {
+		if (msg_len != ATOMIC_WR_LEN)
+			return -EINVAL;
 		set_atomic_seg(wr, rc_sq_wqe, valid_num_sge);
-	else if (wr->opcode != IB_WR_REG_MR)
+	} else if (wr->opcode != IB_WR_REG_MR) {
 		ret = set_rwqe_data_seg(&qp->ibqp, wr, rc_sq_wqe,
 					&curr_idx, valid_num_sge);
+		if (ret)
+			return ret;
+	}
 
 	/*
 	 * The pipeline can sequentially post all valid WQEs into WQ buffer,
@@ -2569,14 +2574,16 @@ static int set_llm_cfg_to_hw(struct hns_roce_dev *hr_dev,
 static struct hns_roce_link_table *
 alloc_link_table_buf(struct hns_roce_dev *hr_dev)
 {
+	u16 total_sl = hr_dev->caps.sl_num * hr_dev->func_num;
 	struct hns_roce_v2_priv *priv = hr_dev->priv;
 	struct hns_roce_link_table *link_tbl;
 	u32 pg_shift, size, min_size;
 
 	link_tbl = &priv->ext_llm;
 	pg_shift = hr_dev->caps.llm_buf_pg_sz + PAGE_SHIFT;
-	size = hr_dev->caps.num_qps * HNS_ROCE_V2_EXT_LLM_ENTRY_SZ;
-	min_size = HNS_ROCE_EXT_LLM_MIN_PAGES(hr_dev->caps.sl_num) << pg_shift;
+	size = hr_dev->caps.num_qps * hr_dev->func_num *
+	       HNS_ROCE_V2_EXT_LLM_ENTRY_SZ;
+	min_size = HNS_ROCE_EXT_LLM_MIN_PAGES(total_sl) << pg_shift;
 
 	/* Alloc data table */
 	size = max(size, min_size);
@@ -6413,9 +6420,16 @@ static void hns_roce_v2_int_mask_enable(struct hns_roce_dev *hr_dev,
 	roce_write(hr_dev, ROCEE_VF_ABN_INT_CFG_REG, enable_flag);
 }
 
-static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev, u32 eqn)
+static void free_eq_buf(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
+{
+	hns_roce_mtr_destroy(hr_dev, &eq->mtr);
+}
+
+static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev,
+				    struct hns_roce_eq *eq)
 {
 	struct device *dev = hr_dev->dev;
+	int eqn = eq->eqn;
 	int ret;
 	u8 cmd;
 
@@ -6426,12 +6440,9 @@ static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev, u32 eqn)
 
 	ret = hns_roce_destroy_hw_ctx(hr_dev, cmd, eqn & HNS_ROCE_V2_EQN_M);
 	if (ret)
-		dev_err(dev, "[mailbox cmd] destroy eqc(%u) failed.\n", eqn);
-}
+		dev_err(dev, "[mailbox cmd] destroy eqc(%d) failed.\n", eqn);
 
-static void free_eq_buf(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
-{
-	hns_roce_mtr_destroy(hr_dev, &eq->mtr);
+	free_eq_buf(hr_dev, eq);
 }
 
 static void init_eq_config(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
@@ -6737,7 +6748,7 @@ static int hns_roce_v2_init_eq_table(struct hns_roce_dev *hr_dev)
 
 err_create_eq_fail:
 	for (i -= 1; i >= 0; i--)
-		free_eq_buf(hr_dev, &eq_table->eq[i]);
+		hns_roce_v2_destroy_eqc(hr_dev, &eq_table->eq[i]);
 	kfree(eq_table->eq);
 
 	return ret;
@@ -6757,11 +6768,8 @@ static void hns_roce_v2_cleanup_eq_table(struct hns_roce_dev *hr_dev)
 	__hns_roce_free_irq(hr_dev);
 	destroy_workqueue(hr_dev->irq_workq);
 
-	for (i = 0; i < eq_num; i++) {
-		hns_roce_v2_destroy_eqc(hr_dev, i);
-
-		free_eq_buf(hr_dev, &eq_table->eq[i]);
-	}
+	for (i = 0; i < eq_num; i++)
+		hns_roce_v2_destroy_eqc(hr_dev, &eq_table->eq[i]);
 
 	kfree(eq_table->eq);
 }
diff --git a/drivers/infiniband/hw/hns/hns_roce_mr.c b/drivers/infiniband/hw/hns/hns_roce_mr.c
index 190e62da98e4..980261969b0c 100644
--- a/drivers/infiniband/hw/hns/hns_roce_mr.c
+++ b/drivers/infiniband/hw/hns/hns_roce_mr.c
@@ -423,6 +423,11 @@ int hns_roce_map_mr_sg(struct ib_mr *ibmr, struct scatterlist *sg, int sg_nents,
 	struct hns_roce_mtr *mtr = &mr->pbl_mtr;
 	int ret, sg_num = 0;
 
+	if (!IS_ALIGNED(*sg_offset, HNS_ROCE_FRMR_ALIGN_SIZE) ||
+	    ibmr->page_size < HNS_HW_PAGE_SIZE ||
+	    ibmr->page_size > HNS_HW_MAX_PAGE_SIZE)
+		return sg_num;
+
 	mr->npages = 0;
 	mr->page_list = kvcalloc(mr->pbl_mtr.hem_cfg.buf_pg_count,
 				 sizeof(dma_addr_t), GFP_KERNEL);
diff --git a/drivers/infiniband/hw/hns/hns_roce_qp.c b/drivers/infiniband/hw/hns/hns_roce_qp.c
index 7b79e6b3f3ba..c97b5dba1772 100644
--- a/drivers/infiniband/hw/hns/hns_roce_qp.c
+++ b/drivers/infiniband/hw/hns/hns_roce_qp.c
@@ -538,13 +538,15 @@ static unsigned int get_sge_num_from_max_inl_data(bool is_ud_or_gsi,
 {
 	unsigned int inline_sge;
 
-	inline_sge = roundup_pow_of_two(max_inline_data) / HNS_ROCE_SGE_SIZE;
+	if (!max_inline_data)
+		return 0;
 
 	/*
 	 * if max_inline_data less than
 	 * HNS_ROCE_SGE_IN_WQE * HNS_ROCE_SGE_SIZE,
 	 * In addition to ud's mode, no need to extend sge.
 	 */
+	inline_sge = roundup_pow_of_two(max_inline_data) / HNS_ROCE_SGE_SIZE;
 	if (!is_ud_or_gsi && inline_sge <= HNS_ROCE_SGE_IN_WQE)
 		inline_sge = 0;
 
diff --git a/drivers/infiniband/hw/hns/hns_roce_srq.c b/drivers/infiniband/hw/hns/hns_roce_srq.c
index 6a4923c21cbc..727f92650071 100644
--- a/drivers/infiniband/hw/hns/hns_roce_srq.c
+++ b/drivers/infiniband/hw/hns/hns_roce_srq.c
@@ -296,7 +296,7 @@ static int set_srq_basic_param(struct hns_roce_srq *srq,
 
 	max_sge = proc_srq_sge(hr_dev, srq, !!udata);
 	if (attr->max_wr > hr_dev->caps.max_srq_wrs ||
-	    attr->max_sge > max_sge) {
+	    attr->max_sge > max_sge || !attr->max_sge) {
 		ibdev_err(&hr_dev->ib_dev,
 			  "invalid SRQ attr, depth = %u, sge = %u.\n",
 			  attr->max_wr, attr->max_sge);
diff --git a/drivers/infiniband/hw/mlx4/alias_GUID.c b/drivers/infiniband/hw/mlx4/alias_GUID.c
index 111fa88a3be4..9a439569ffcf 100644
--- a/drivers/infiniband/hw/mlx4/alias_GUID.c
+++ b/drivers/infiniband/hw/mlx4/alias_GUID.c
@@ -829,7 +829,7 @@ void mlx4_ib_destroy_alias_guid_service(struct mlx4_ib_dev *dev)
 
 int mlx4_ib_init_alias_guid_service(struct mlx4_ib_dev *dev)
 {
-	char alias_wq_name[15];
+	char alias_wq_name[22];
 	int ret = 0;
 	int i, j;
 	union ib_gid gid;
diff --git a/drivers/infiniband/hw/mlx4/mad.c b/drivers/infiniband/hw/mlx4/mad.c
index a37cfac5e23f..dc9cf45d2d32 100644
--- a/drivers/infiniband/hw/mlx4/mad.c
+++ b/drivers/infiniband/hw/mlx4/mad.c
@@ -2158,7 +2158,7 @@ static int mlx4_ib_alloc_demux_ctx(struct mlx4_ib_dev *dev,
 				       struct mlx4_ib_demux_ctx *ctx,
 				       int port)
 {
-	char name[12];
+	char name[21];
 	int ret = 0;
 	int i;
 
diff --git a/drivers/infiniband/hw/mlx5/mlx5_ib.h b/drivers/infiniband/hw/mlx5/mlx5_ib.h
index 8d94e6834e01..0ef347e91ffe 100644
--- a/drivers/infiniband/hw/mlx5/mlx5_ib.h
+++ b/drivers/infiniband/hw/mlx5/mlx5_ib.h
@@ -109,6 +109,19 @@ unsigned long __mlx5_umem_find_best_quantized_pgoff(
 		__mlx5_bit_sz(typ, page_offset_fld), 0, scale,                 \
 		page_offset_quantized)
 
+static inline unsigned long
+mlx5_umem_dmabuf_find_best_pgsz(struct ib_umem_dmabuf *umem_dmabuf)
+{
+	/*
+	 * mkeys used for dmabuf are fixed at PAGE_SIZE because we must be able
+	 * to hold any sgl after a move operation. Ideally the mkc page size
+	 * could be changed at runtime to be optimal, but right now the driver
+	 * cannot do that.
+	 */
+	return ib_umem_find_best_pgsz(&umem_dmabuf->umem, PAGE_SIZE,
+				      umem_dmabuf->umem.iova);
+}
+
 enum {
 	MLX5_IB_MMAP_OFFSET_START = 9,
 	MLX5_IB_MMAP_OFFSET_END = 255,
diff --git a/drivers/infiniband/hw/mlx5/odp.c b/drivers/infiniband/hw/mlx5/odp.c
index bc97958818bb..af73c5ebe6ac 100644
--- a/drivers/infiniband/hw/mlx5/odp.c
+++ b/drivers/infiniband/hw/mlx5/odp.c
@@ -706,10 +706,8 @@ static int pagefault_dmabuf_mr(struct mlx5_ib_mr *mr, size_t bcnt,
 		return err;
 	}
 
-	page_size = mlx5_umem_find_best_pgsz(&umem_dmabuf->umem, mkc,
-					     log_page_size, 0,
-					     umem_dmabuf->umem.iova);
-	if (unlikely(page_size < PAGE_SIZE)) {
+	page_size = mlx5_umem_dmabuf_find_best_pgsz(umem_dmabuf);
+	if (!page_size) {
 		ib_umem_dmabuf_unmap_pages(umem_dmabuf);
 		err = -EINVAL;
 	} else {
diff --git a/drivers/infiniband/sw/rxe/rxe_req.c b/drivers/infiniband/sw/rxe/rxe_req.c
index 2ace1007a419..35768fdbd5b7 100644
--- a/drivers/infiniband/sw/rxe/rxe_req.c
+++ b/drivers/infiniband/sw/rxe/rxe_req.c
@@ -390,7 +390,7 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp,
 	int			paylen;
 	int			solicited;
 	u32			qp_num;
-	int			ack_req;
+	int			ack_req = 0;
 
 	/* length from start of bth to end of icrc */
 	paylen = rxe_opcode[opcode].length + payload + pad + RXE_ICRC_SIZE;
@@ -411,8 +411,9 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp,
 	qp_num = (pkt->mask & RXE_DETH_MASK) ? ibwr->wr.ud.remote_qpn :
 					 qp->attr.dest_qp_num;
 
-	ack_req = ((pkt->mask & RXE_END_MASK) ||
-		(qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK));
+	if (qp_type(qp) != IB_QPT_UD && qp_type(qp) != IB_QPT_UC)
+		ack_req = ((pkt->mask & RXE_END_MASK) ||
+			   (qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK));
 	if (ack_req)
 		qp->req.noack_pkts = 0;
 
diff --git a/drivers/input/keyboard/qt1050.c b/drivers/input/keyboard/qt1050.c
index 403060d05c3b..7193a4198e21 100644
--- a/drivers/input/keyboard/qt1050.c
+++ b/drivers/input/keyboard/qt1050.c
@@ -226,7 +226,12 @@ static bool qt1050_identify(struct qt1050_priv *ts)
 	int err;
 
 	/* Read Chip ID */
-	regmap_read(ts->regmap, QT1050_CHIP_ID, &val);
+	err = regmap_read(ts->regmap, QT1050_CHIP_ID, &val);
+	if (err) {
+		dev_err(&ts->client->dev, "Failed to read chip ID: %d\n", err);
+		return false;
+	}
+
 	if (val != QT1050_CHIP_ID_VER) {
 		dev_err(&ts->client->dev, "ID %d not supported\n", val);
 		return false;
diff --git a/drivers/input/mouse/elan_i2c_core.c b/drivers/input/mouse/elan_i2c_core.c
index d4eb59b55bf1..5fa0d6ef627b 100644
--- a/drivers/input/mouse/elan_i2c_core.c
+++ b/drivers/input/mouse/elan_i2c_core.c
@@ -1372,6 +1372,8 @@ static int __maybe_unused elan_suspend(struct device *dev)
 	}
 
 err:
+	if (ret)
+		enable_irq(client->irq);
 	mutex_unlock(&data->sysfs_mutex);
 	return ret;
 }
diff --git a/drivers/interconnect/qcom/qcm2290.c b/drivers/interconnect/qcom/qcm2290.c
index ca7ad37ea677..d75bb918e1bb 100644
--- a/drivers/interconnect/qcom/qcm2290.c
+++ b/drivers/interconnect/qcom/qcm2290.c
@@ -166,7 +166,7 @@ static struct qcom_icc_node mas_snoc_bimc = {
 	.qos.ap_owned = true,
 	.qos.qos_port = 6,
 	.qos.qos_mode = NOC_QOS_MODE_BYPASS,
-	.mas_rpm_id = 164,
+	.mas_rpm_id = 3,
 	.slv_rpm_id = -1,
 	.num_links = ARRAY_SIZE(mas_snoc_bimc_links),
 	.links = mas_snoc_bimc_links,
diff --git a/drivers/iommu/intel/iommu.c b/drivers/iommu/intel/iommu.c
index e111b35a7aff..7b9502c30fe9 100644
--- a/drivers/iommu/intel/iommu.c
+++ b/drivers/iommu/intel/iommu.c
@@ -113,13 +113,17 @@ static inline unsigned long lvl_to_nr_pages(unsigned int lvl)
 
 /* VT-d pages must always be _smaller_ than MM pages. Otherwise things
    are never going to work. */
-static inline unsigned long mm_to_dma_pfn(unsigned long mm_pfn)
+static inline unsigned long mm_to_dma_pfn_start(unsigned long mm_pfn)
 {
 	return mm_pfn << (PAGE_SHIFT - VTD_PAGE_SHIFT);
 }
+static inline unsigned long mm_to_dma_pfn_end(unsigned long mm_pfn)
+{
+	return ((mm_pfn + 1) << (PAGE_SHIFT - VTD_PAGE_SHIFT)) - 1;
+}
 static inline unsigned long page_to_dma_pfn(struct page *pg)
 {
-	return mm_to_dma_pfn(page_to_pfn(pg));
+	return mm_to_dma_pfn_start(page_to_pfn(pg));
 }
 static inline unsigned long virt_to_dma_pfn(void *p)
 {
@@ -2439,8 +2443,8 @@ static int __init si_domain_init(int hw)
 
 		for_each_mem_pfn_range(i, nid, &start_pfn, &end_pfn, NULL) {
 			ret = iommu_domain_identity_map(si_domain,
-					mm_to_dma_pfn(start_pfn),
-					mm_to_dma_pfn(end_pfn));
+					mm_to_dma_pfn_start(start_pfn),
+					mm_to_dma_pfn_end(end_pfn-1));
 			if (ret)
 				return ret;
 		}
@@ -2461,8 +2465,8 @@ static int __init si_domain_init(int hw)
 				continue;
 
 			ret = iommu_domain_identity_map(si_domain,
-					mm_to_dma_pfn(start >> PAGE_SHIFT),
-					mm_to_dma_pfn(end >> PAGE_SHIFT));
+					mm_to_dma_pfn_start(start >> PAGE_SHIFT),
+					mm_to_dma_pfn_end(end >> PAGE_SHIFT));
 			if (ret)
 				return ret;
 		}
@@ -3698,8 +3702,8 @@ static int intel_iommu_memory_notifier(struct notifier_block *nb,
 				       unsigned long val, void *v)
 {
 	struct memory_notify *mhp = v;
-	unsigned long start_vpfn = mm_to_dma_pfn(mhp->start_pfn);
-	unsigned long last_vpfn = mm_to_dma_pfn(mhp->start_pfn +
+	unsigned long start_vpfn = mm_to_dma_pfn_start(mhp->start_pfn);
+	unsigned long last_vpfn = mm_to_dma_pfn_end(mhp->start_pfn +
 			mhp->nr_pages - 1);
 
 	switch (val) {
@@ -4401,7 +4405,7 @@ static void intel_iommu_tlb_sync(struct iommu_domain *domain,
 	unsigned long i;
 
 	nrpages = aligned_nrpages(gather->start, size);
-	start_pfn = mm_to_dma_pfn(iova_pfn);
+	start_pfn = mm_to_dma_pfn_start(iova_pfn);
 
 	xa_for_each(&dmar_domain->iommu_array, i, info)
 		iommu_flush_iotlb_psi(info->iommu, dmar_domain,
diff --git a/drivers/iommu/sprd-iommu.c b/drivers/iommu/sprd-iommu.c
index e4358393fe37..71d22daaec2e 100644
--- a/drivers/iommu/sprd-iommu.c
+++ b/drivers/iommu/sprd-iommu.c
@@ -234,8 +234,8 @@ static void sprd_iommu_cleanup(struct sprd_iommu_domain *dom)
 
 	pgt_size = sprd_iommu_pgt_size(&dom->domain);
 	dma_free_coherent(dom->sdev->dev, pgt_size, dom->pgt_va, dom->pgt_pa);
-	dom->sdev = NULL;
 	sprd_iommu_hw_en(dom->sdev, false);
+	dom->sdev = NULL;
 }
 
 static void sprd_iommu_domain_free(struct iommu_domain *domain)
diff --git a/drivers/irqchip/irq-imx-irqsteer.c b/drivers/irqchip/irq-imx-irqsteer.c
index 96230a04ec23..44ce85c27f57 100644
--- a/drivers/irqchip/irq-imx-irqsteer.c
+++ b/drivers/irqchip/irq-imx-irqsteer.c
@@ -35,6 +35,7 @@ struct irqsteer_data {
 	int			channel;
 	struct irq_domain	*domain;
 	u32			*saved_reg;
+	struct device		*dev;
 };
 
 static int imx_irqsteer_get_reg_index(struct irqsteer_data *data,
@@ -71,10 +72,26 @@ static void imx_irqsteer_irq_mask(struct irq_data *d)
 	raw_spin_unlock_irqrestore(&data->lock, flags);
 }
 
+static void imx_irqsteer_irq_bus_lock(struct irq_data *d)
+{
+	struct irqsteer_data *data = d->chip_data;
+
+	pm_runtime_get_sync(data->dev);
+}
+
+static void imx_irqsteer_irq_bus_sync_unlock(struct irq_data *d)
+{
+	struct irqsteer_data *data = d->chip_data;
+
+	pm_runtime_put_autosuspend(data->dev);
+}
+
 static const struct irq_chip imx_irqsteer_irq_chip = {
-	.name		= "irqsteer",
-	.irq_mask	= imx_irqsteer_irq_mask,
-	.irq_unmask	= imx_irqsteer_irq_unmask,
+	.name			= "irqsteer",
+	.irq_mask		= imx_irqsteer_irq_mask,
+	.irq_unmask		= imx_irqsteer_irq_unmask,
+	.irq_bus_lock		= imx_irqsteer_irq_bus_lock,
+	.irq_bus_sync_unlock	= imx_irqsteer_irq_bus_sync_unlock,
 };
 
 static int imx_irqsteer_irq_map(struct irq_domain *h, unsigned int irq,
@@ -149,6 +166,7 @@ static int imx_irqsteer_probe(struct platform_device *pdev)
 	if (!data)
 		return -ENOMEM;
 
+	data->dev = &pdev->dev;
 	data->regs = devm_platform_ioremap_resource(pdev, 0);
 	if (IS_ERR(data->regs)) {
 		dev_err(&pdev->dev, "failed to initialize reg\n");
diff --git a/drivers/isdn/hardware/mISDN/hfcmulti.c b/drivers/isdn/hardware/mISDN/hfcmulti.c
index e840609c50eb..2063afffd085 100644
--- a/drivers/isdn/hardware/mISDN/hfcmulti.c
+++ b/drivers/isdn/hardware/mISDN/hfcmulti.c
@@ -1931,7 +1931,7 @@ hfcmulti_dtmf(struct hfc_multi *hc)
 static void
 hfcmulti_tx(struct hfc_multi *hc, int ch)
 {
-	int i, ii, temp, len = 0;
+	int i, ii, temp, tmp_len, len = 0;
 	int Zspace, z1, z2; /* must be int for calculation */
 	int Fspace, f1, f2;
 	u_char *d;
@@ -2152,14 +2152,15 @@ hfcmulti_tx(struct hfc_multi *hc, int ch)
 		HFC_wait_nodebug(hc);
 	}
 
+	tmp_len = (*sp)->len;
 	dev_kfree_skb(*sp);
 	/* check for next frame */
 	if (bch && get_next_bframe(bch)) {
-		len = (*sp)->len;
+		len = tmp_len;
 		goto next_frame;
 	}
 	if (dch && get_next_dframe(dch)) {
-		len = (*sp)->len;
+		len = tmp_len;
 		goto next_frame;
 	}
 
diff --git a/drivers/leds/flash/leds-mt6360.c b/drivers/leds/flash/leds-mt6360.c
index e1066a52d2d2..2fab335a6425 100644
--- a/drivers/leds/flash/leds-mt6360.c
+++ b/drivers/leds/flash/leds-mt6360.c
@@ -637,14 +637,17 @@ static int mt6360_init_isnk_properties(struct mt6360_led *led,
 
 			ret = fwnode_property_read_u32(child, "reg", &reg);
 			if (ret || reg > MT6360_LED_ISNK3 ||
-			    priv->leds_active & BIT(reg))
+			    priv->leds_active & BIT(reg)) {
+				fwnode_handle_put(child);
 				return -EINVAL;
+			}
 
 			ret = fwnode_property_read_u32(child, "color", &color);
 			if (ret) {
 				dev_err(priv->dev,
 					"led %d, no color specified\n",
 					led->led_no);
+				fwnode_handle_put(child);
 				return ret;
 			}
 
diff --git a/drivers/leds/led-class.c b/drivers/leds/led-class.c
index aa39b2a48fdf..7391d2cf1370 100644
--- a/drivers/leds/led-class.c
+++ b/drivers/leds/led-class.c
@@ -235,7 +235,6 @@ struct led_classdev *of_led_get(struct device_node *np, int index)
 
 	led_dev = class_find_device_by_of_node(leds_class, led_node);
 	of_node_put(led_node);
-	put_device(led_dev);
 
 	if (!led_dev)
 		return ERR_PTR(-EPROBE_DEFER);
diff --git a/drivers/leds/led-triggers.c b/drivers/leds/led-triggers.c
index 072491d3e17b..024b73f84ce0 100644
--- a/drivers/leds/led-triggers.c
+++ b/drivers/leds/led-triggers.c
@@ -179,9 +179,9 @@ int led_trigger_set(struct led_classdev *led_cdev, struct led_trigger *trig)
 
 		cancel_work_sync(&led_cdev->set_brightness_work);
 		led_stop_software_blink(led_cdev);
+		device_remove_groups(led_cdev->dev, led_cdev->trigger->groups);
 		if (led_cdev->trigger->deactivate)
 			led_cdev->trigger->deactivate(led_cdev);
-		device_remove_groups(led_cdev->dev, led_cdev->trigger->groups);
 		led_cdev->trigger = NULL;
 		led_cdev->trigger_data = NULL;
 		led_cdev->activated = false;
diff --git a/drivers/leds/leds-ss4200.c b/drivers/leds/leds-ss4200.c
index fcaa34706b6c..2ef9fc7371bd 100644
--- a/drivers/leds/leds-ss4200.c
+++ b/drivers/leds/leds-ss4200.c
@@ -356,8 +356,10 @@ static int ich7_lpc_probe(struct pci_dev *dev,
 
 	nas_gpio_pci_dev = dev;
 	status = pci_read_config_dword(dev, PMBASE, &g_pm_io_base);
-	if (status)
+	if (status) {
+		status = pcibios_err_to_errno(status);
 		goto out;
+	}
 	g_pm_io_base &= 0x00000ff80;
 
 	status = pci_read_config_dword(dev, GPIO_CTRL, &gc);
@@ -369,8 +371,9 @@ static int ich7_lpc_probe(struct pci_dev *dev,
 	}
 
 	status = pci_read_config_dword(dev, GPIO_BASE, &nas_gpio_io_base);
-	if (0 > status) {
+	if (status) {
 		dev_info(&dev->dev, "Unable to read GPIOBASE.\n");
+		status = pcibios_err_to_errno(status);
 		goto out;
 	}
 	dev_dbg(&dev->dev, ": GPIOBASE = 0x%08x\n", nas_gpio_io_base);
diff --git a/drivers/macintosh/therm_windtunnel.c b/drivers/macintosh/therm_windtunnel.c
index b8228ca40454..ab9b381c8ff1 100644
--- a/drivers/macintosh/therm_windtunnel.c
+++ b/drivers/macintosh/therm_windtunnel.c
@@ -548,7 +548,7 @@ g4fan_exit( void )
 	platform_driver_unregister( &therm_of_driver );
 
 	if( x.of_dev )
-		of_device_unregister( x.of_dev );
+		of_platform_device_destroy(&x.of_dev->dev, NULL);
 }
 
 module_init(g4fan_init);
diff --git a/drivers/md/dm-verity-target.c b/drivers/md/dm-verity-target.c
index 6a707b41dc86..52585e2c61aa 100644
--- a/drivers/md/dm-verity-target.c
+++ b/drivers/md/dm-verity-target.c
@@ -1496,14 +1496,6 @@ static int verity_ctr(struct dm_target *ti, unsigned int argc, char **argv)
 	return r;
 }
 
-/*
- * Check whether a DM target is a verity target.
- */
-bool dm_is_verity_target(struct dm_target *ti)
-{
-	return ti->type->module == THIS_MODULE;
-}
-
 /*
  * Get the verity mode (error behavior) of a verity target.
  *
@@ -1575,6 +1567,14 @@ static void __exit dm_verity_exit(void)
 module_init(dm_verity_init);
 module_exit(dm_verity_exit);
 
+/*
+ * Check whether a DM target is a verity target.
+ */
+bool dm_is_verity_target(struct dm_target *ti)
+{
+	return ti->type == &verity_target;
+}
+
 MODULE_AUTHOR("Mikulas Patocka <mpatocka@redhat.com>");
 MODULE_AUTHOR("Mandeep Baines <msb@chromium.org>");
 MODULE_AUTHOR("Will Drewry <wad@chromium.org>");
diff --git a/drivers/md/md.c b/drivers/md/md.c
index 506c998c0ca5..7dc1c42acccc 100644
--- a/drivers/md/md.c
+++ b/drivers/md/md.c
@@ -527,13 +527,9 @@ static void md_end_flush(struct bio *bio)
 
 	rdev_dec_pending(rdev, mddev);
 
-	if (atomic_dec_and_test(&mddev->flush_pending)) {
-		/* The pair is percpu_ref_get() from md_flush_request() */
-		percpu_ref_put(&mddev->active_io);
-
+	if (atomic_dec_and_test(&mddev->flush_pending))
 		/* The pre-request flush has finished */
 		queue_work(md_wq, &mddev->flush_work);
-	}
 }
 
 static void md_submit_flush_data(struct work_struct *ws);
@@ -564,12 +560,8 @@ static void submit_flushes(struct work_struct *ws)
 			rcu_read_lock();
 		}
 	rcu_read_unlock();
-	if (atomic_dec_and_test(&mddev->flush_pending)) {
-		/* The pair is percpu_ref_get() from md_flush_request() */
-		percpu_ref_put(&mddev->active_io);
-
+	if (atomic_dec_and_test(&mddev->flush_pending))
 		queue_work(md_wq, &mddev->flush_work);
-	}
 }
 
 static void md_submit_flush_data(struct work_struct *ws)
@@ -594,8 +586,20 @@ static void md_submit_flush_data(struct work_struct *ws)
 		bio_endio(bio);
 	} else {
 		bio->bi_opf &= ~REQ_PREFLUSH;
-		md_handle_request(mddev, bio);
+
+		/*
+		 * make_requst() will never return error here, it only
+		 * returns error in raid5_make_request() by dm-raid.
+		 * Since dm always splits data and flush operation into
+		 * two separate io, io size of flush submitted by dm
+		 * always is 0, make_request() will not be called here.
+		 */
+		if (WARN_ON_ONCE(!mddev->pers->make_request(mddev, bio)))
+			bio_io_error(bio);;
 	}
+
+	/* The pair is percpu_ref_get() from md_flush_request() */
+	percpu_ref_put(&mddev->active_io);
 }
 
 /*
diff --git a/drivers/media/i2c/imx412.c b/drivers/media/i2c/imx412.c
index 7f6d29e0e7c4..77fa6253ba3e 100644
--- a/drivers/media/i2c/imx412.c
+++ b/drivers/media/i2c/imx412.c
@@ -544,14 +544,13 @@ static int imx412_update_controls(struct imx412 *imx412,
  */
 static int imx412_update_exp_gain(struct imx412 *imx412, u32 exposure, u32 gain)
 {
-	u32 lpfr, shutter;
+	u32 lpfr;
 	int ret;
 
 	lpfr = imx412->vblank + imx412->cur_mode->height;
-	shutter = lpfr - exposure;
 
-	dev_dbg(imx412->dev, "Set exp %u, analog gain %u, shutter %u, lpfr %u",
-		exposure, gain, shutter, lpfr);
+	dev_dbg(imx412->dev, "Set exp %u, analog gain %u, lpfr %u",
+		exposure, gain, lpfr);
 
 	ret = imx412_write_reg(imx412, IMX412_REG_HOLD, 1, 1);
 	if (ret)
@@ -561,7 +560,7 @@ static int imx412_update_exp_gain(struct imx412 *imx412, u32 exposure, u32 gain)
 	if (ret)
 		goto error_release_group_hold;
 
-	ret = imx412_write_reg(imx412, IMX412_REG_EXPOSURE_CIT, 2, shutter);
+	ret = imx412_write_reg(imx412, IMX412_REG_EXPOSURE_CIT, 2, exposure);
 	if (ret)
 		goto error_release_group_hold;
 
diff --git a/drivers/media/pci/ivtv/ivtv-udma.c b/drivers/media/pci/ivtv/ivtv-udma.c
index 210be8290f24..fd76f88975ae 100644
--- a/drivers/media/pci/ivtv/ivtv-udma.c
+++ b/drivers/media/pci/ivtv/ivtv-udma.c
@@ -131,6 +131,8 @@ int ivtv_udma_setup(struct ivtv *itv, unsigned long ivtv_dest_addr,
 
 	/* Fill SG List with new values */
 	if (ivtv_udma_fill_sg_list(dma, &user_dma, 0) < 0) {
+		IVTV_DEBUG_WARN("%s: could not allocate bounce buffers for highmem userspace buffers\n",
+				__func__);
 		unpin_user_pages(dma->map, dma->page_count);
 		dma->page_count = 0;
 		return -ENOMEM;
@@ -139,6 +141,12 @@ int ivtv_udma_setup(struct ivtv *itv, unsigned long ivtv_dest_addr,
 	/* Map SG List */
 	dma->SG_length = dma_map_sg(&itv->pdev->dev, dma->SGlist,
 				    dma->page_count, DMA_TO_DEVICE);
+	if (!dma->SG_length) {
+		IVTV_DEBUG_WARN("%s: DMA map error, SG_length is 0\n", __func__);
+		unpin_user_pages(dma->map, dma->page_count);
+		dma->page_count = 0;
+		return -EINVAL;
+	}
 
 	/* Fill SG Array with new values */
 	ivtv_udma_fill_sg_array (dma, ivtv_dest_addr, 0, -1);
diff --git a/drivers/media/pci/ivtv/ivtv-yuv.c b/drivers/media/pci/ivtv/ivtv-yuv.c
index 4ba10c34a16a..bd0b80331602 100644
--- a/drivers/media/pci/ivtv/ivtv-yuv.c
+++ b/drivers/media/pci/ivtv/ivtv-yuv.c
@@ -115,6 +115,12 @@ static int ivtv_yuv_prep_user_dma(struct ivtv *itv, struct ivtv_user_dma *dma,
 	}
 	dma->SG_length = dma_map_sg(&itv->pdev->dev, dma->SGlist,
 				    dma->page_count, DMA_TO_DEVICE);
+	if (!dma->SG_length) {
+		IVTV_DEBUG_WARN("%s: DMA map error, SG_length is 0\n", __func__);
+		unpin_user_pages(dma->map, dma->page_count);
+		dma->page_count = 0;
+		return -EINVAL;
+	}
 
 	/* Fill SG Array with new values */
 	ivtv_udma_fill_sg_array(dma, y_buffer_offset, uv_buffer_offset, y_size);
diff --git a/drivers/media/pci/ivtv/ivtvfb.c b/drivers/media/pci/ivtv/ivtvfb.c
index 00ac94d4ab19..a642becdc0d7 100644
--- a/drivers/media/pci/ivtv/ivtvfb.c
+++ b/drivers/media/pci/ivtv/ivtvfb.c
@@ -281,10 +281,10 @@ static int ivtvfb_prep_dec_dma_to_device(struct ivtv *itv,
 	/* Map User DMA */
 	if (ivtv_udma_setup(itv, ivtv_dest_addr, userbuf, size_in_bytes) <= 0) {
 		mutex_unlock(&itv->udma.lock);
-		IVTVFB_WARN("ivtvfb_prep_dec_dma_to_device, Error with pin_user_pages: %d bytes, %d pages returned\n",
-			       size_in_bytes, itv->udma.page_count);
+		IVTVFB_WARN("%s, Error in ivtv_udma_setup: %d bytes, %d pages returned\n",
+			       __func__, size_in_bytes, itv->udma.page_count);
 
-		/* pin_user_pages must have failed completely */
+		/* pin_user_pages or DMA must have failed completely */
 		return -EIO;
 	}
 
diff --git a/drivers/media/pci/saa7134/saa7134-dvb.c b/drivers/media/pci/saa7134/saa7134-dvb.c
index 9c6cfef03331..a66df6adfaad 100644
--- a/drivers/media/pci/saa7134/saa7134-dvb.c
+++ b/drivers/media/pci/saa7134/saa7134-dvb.c
@@ -466,7 +466,9 @@ static int philips_europa_tuner_sleep(struct dvb_frontend *fe)
 	/* switch the board to analog mode */
 	if (fe->ops.i2c_gate_ctrl)
 		fe->ops.i2c_gate_ctrl(fe, 1);
-	i2c_transfer(&dev->i2c_adap, &analog_msg, 1);
+	if (i2c_transfer(&dev->i2c_adap, &analog_msg, 1) != 1)
+		return -EIO;
+
 	return 0;
 }
 
@@ -1018,7 +1020,9 @@ static int md8800_set_voltage2(struct dvb_frontend *fe,
 	else
 		wbuf[1] = rbuf & 0xef;
 	msg[0].len = 2;
-	i2c_transfer(&dev->i2c_adap, msg, 1);
+	if (i2c_transfer(&dev->i2c_adap, msg, 1) != 1)
+		return -EIO;
+
 	return 0;
 }
 
diff --git a/drivers/media/platform/qcom/venus/vdec.c b/drivers/media/platform/qcom/venus/vdec.c
index 1a52c2ea2da5..7ea976efc024 100644
--- a/drivers/media/platform/qcom/venus/vdec.c
+++ b/drivers/media/platform/qcom/venus/vdec.c
@@ -1221,7 +1221,7 @@ static int vdec_stop_output(struct venus_inst *inst)
 		break;
 	case VENUS_DEC_STATE_INIT:
 	case VENUS_DEC_STATE_CAPTURE_SETUP:
-		ret = hfi_session_flush(inst, HFI_FLUSH_INPUT, true);
+		ret = hfi_session_flush(inst, HFI_FLUSH_ALL, true);
 		break;
 	default:
 		break;
@@ -1705,6 +1705,7 @@ static int vdec_close(struct file *file)
 
 	vdec_pm_get(inst);
 
+	cancel_work_sync(&inst->delayed_process_work);
 	v4l2_m2m_ctx_release(inst->m2m_ctx);
 	v4l2_m2m_release(inst->m2m_dev);
 	vdec_ctrl_deinit(inst);
diff --git a/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c b/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
index 174aa6176f54..3b6657d4877a 100644
--- a/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
+++ b/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
@@ -1559,12 +1559,14 @@ static int rcsi2_probe(struct platform_device *pdev)
 
 	ret = v4l2_async_register_subdev(&priv->subdev);
 	if (ret < 0)
-		goto error_async;
+		goto error_pm_runtime;
 
 	dev_info(priv->dev, "%d lanes found\n", priv->lanes);
 
 	return 0;
 
+error_pm_runtime:
+	pm_runtime_disable(&pdev->dev);
 error_async:
 	v4l2_async_nf_unregister(&priv->notifier);
 	v4l2_async_nf_cleanup(&priv->notifier);
@@ -1581,6 +1583,7 @@ static int rcsi2_remove(struct platform_device *pdev)
 	v4l2_async_nf_unregister(&priv->notifier);
 	v4l2_async_nf_cleanup(&priv->notifier);
 	v4l2_async_unregister_subdev(&priv->subdev);
+	v4l2_subdev_cleanup(&priv->subdev);
 
 	pm_runtime_disable(&pdev->dev);
 
diff --git a/drivers/media/platform/renesas/rcar-vin/rcar-dma.c b/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
index ef5adffae197..8bfb020b2f26 100644
--- a/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
+++ b/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
@@ -665,12 +665,22 @@ static int rvin_setup(struct rvin_dev *vin)
 	 */
 	switch (vin->mbus_code) {
 	case MEDIA_BUS_FMT_YUYV8_1X16:
-		/* BT.601/BT.1358 16bit YCbCr422 */
-		vnmc |= VNMC_INF_YUV16;
+		if (vin->is_csi)
+			/* YCbCr422 8-bit */
+			vnmc |= VNMC_INF_YUV8_BT601;
+		else
+			/* BT.601/BT.1358 16bit YCbCr422 */
+			vnmc |= VNMC_INF_YUV16;
 		input_is_yuv = true;
 		break;
 	case MEDIA_BUS_FMT_UYVY8_1X16:
-		vnmc |= VNMC_INF_YUV16 | VNMC_YCAL;
+		if (vin->is_csi)
+			/* YCbCr422 8-bit */
+			vnmc |= VNMC_INF_YUV8_BT601;
+		else
+			/* BT.601/BT.1358 16bit YCbCr422 */
+			vnmc |= VNMC_INF_YUV16;
+		vnmc |= VNMC_YCAL;
 		input_is_yuv = true;
 		break;
 	case MEDIA_BUS_FMT_UYVY8_2X8:
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_histo.c b/drivers/media/platform/renesas/vsp1/vsp1_histo.c
index f22449dd654c..c0f1002f4ecf 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_histo.c
+++ b/drivers/media/platform/renesas/vsp1/vsp1_histo.c
@@ -36,9 +36,8 @@ struct vsp1_histogram_buffer *
 vsp1_histogram_buffer_get(struct vsp1_histogram *histo)
 {
 	struct vsp1_histogram_buffer *buf = NULL;
-	unsigned long flags;
 
-	spin_lock_irqsave(&histo->irqlock, flags);
+	spin_lock(&histo->irqlock);
 
 	if (list_empty(&histo->irqqueue))
 		goto done;
@@ -49,7 +48,7 @@ vsp1_histogram_buffer_get(struct vsp1_histogram *histo)
 	histo->readout = true;
 
 done:
-	spin_unlock_irqrestore(&histo->irqlock, flags);
+	spin_unlock(&histo->irqlock);
 	return buf;
 }
 
@@ -58,7 +57,6 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo,
 				    size_t size)
 {
 	struct vsp1_pipeline *pipe = histo->entity.pipe;
-	unsigned long flags;
 
 	/*
 	 * The pipeline pointer is guaranteed to be valid as this function is
@@ -70,10 +68,10 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo,
 	vb2_set_plane_payload(&buf->buf.vb2_buf, 0, size);
 	vb2_buffer_done(&buf->buf.vb2_buf, VB2_BUF_STATE_DONE);
 
-	spin_lock_irqsave(&histo->irqlock, flags);
+	spin_lock(&histo->irqlock);
 	histo->readout = false;
 	wake_up(&histo->wait_queue);
-	spin_unlock_irqrestore(&histo->irqlock, flags);
+	spin_unlock(&histo->irqlock);
 }
 
 /* -----------------------------------------------------------------------------
@@ -124,11 +122,10 @@ static void histo_buffer_queue(struct vb2_buffer *vb)
 	struct vb2_v4l2_buffer *vbuf = to_vb2_v4l2_buffer(vb);
 	struct vsp1_histogram *histo = vb2_get_drv_priv(vb->vb2_queue);
 	struct vsp1_histogram_buffer *buf = to_vsp1_histogram_buffer(vbuf);
-	unsigned long flags;
 
-	spin_lock_irqsave(&histo->irqlock, flags);
+	spin_lock_irq(&histo->irqlock);
 	list_add_tail(&buf->queue, &histo->irqqueue);
-	spin_unlock_irqrestore(&histo->irqlock, flags);
+	spin_unlock_irq(&histo->irqlock);
 }
 
 static int histo_start_streaming(struct vb2_queue *vq, unsigned int count)
@@ -140,9 +137,8 @@ static void histo_stop_streaming(struct vb2_queue *vq)
 {
 	struct vsp1_histogram *histo = vb2_get_drv_priv(vq);
 	struct vsp1_histogram_buffer *buffer;
-	unsigned long flags;
 
-	spin_lock_irqsave(&histo->irqlock, flags);
+	spin_lock_irq(&histo->irqlock);
 
 	/* Remove all buffers from the IRQ queue. */
 	list_for_each_entry(buffer, &histo->irqqueue, queue)
@@ -152,7 +148,7 @@ static void histo_stop_streaming(struct vb2_queue *vq)
 	/* Wait for the buffer being read out (if any) to complete. */
 	wait_event_lock_irq(histo->wait_queue, !histo->readout, histo->irqlock);
 
-	spin_unlock_irqrestore(&histo->irqlock, flags);
+	spin_unlock_irq(&histo->irqlock);
 }
 
 static const struct vb2_ops histo_video_queue_qops = {
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_pipe.h b/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
index ae646c9ef337..15daf35bda21 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
+++ b/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
@@ -73,7 +73,7 @@ struct vsp1_partition_window {
  * @wpf: The WPF partition window configuration
  */
 struct vsp1_partition {
-	struct vsp1_partition_window rpf;
+	struct vsp1_partition_window rpf[VSP1_MAX_RPF];
 	struct vsp1_partition_window uds_sink;
 	struct vsp1_partition_window uds_source;
 	struct vsp1_partition_window sru;
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_rpf.c b/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
index 75083cb234fe..996a3058d5b7 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
+++ b/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
@@ -271,8 +271,8 @@ static void rpf_configure_partition(struct vsp1_entity *entity,
 	 * 'width' need to be adjusted.
 	 */
 	if (pipe->partitions > 1) {
-		crop.width = pipe->partition->rpf.width;
-		crop.left += pipe->partition->rpf.left;
+		crop.width = pipe->partition->rpf[rpf->entity.index].width;
+		crop.left += pipe->partition->rpf[rpf->entity.index].left;
 	}
 
 	if (pipe->interlaced) {
@@ -327,7 +327,9 @@ static void rpf_partition(struct vsp1_entity *entity,
 			  unsigned int partition_idx,
 			  struct vsp1_partition_window *window)
 {
-	partition->rpf = *window;
+	struct vsp1_rwpf *rpf = to_rwpf(&entity->subdev);
+
+	partition->rpf[rpf->entity.index] = *window;
 }
 
 static const struct vsp1_entity_operations rpf_entity_ops = {
diff --git a/drivers/media/rc/imon.c b/drivers/media/rc/imon.c
index 5719dda6e0f0..e5590a708f1c 100644
--- a/drivers/media/rc/imon.c
+++ b/drivers/media/rc/imon.c
@@ -1148,10 +1148,7 @@ static int imon_ir_change_protocol(struct rc_dev *rc, u64 *rc_proto)
 
 	memcpy(ictx->usb_tx_buf, &ir_proto_packet, sizeof(ir_proto_packet));
 
-	if (!mutex_is_locked(&ictx->lock)) {
-		unlock = true;
-		mutex_lock(&ictx->lock);
-	}
+	unlock = mutex_trylock(&ictx->lock);
 
 	retval = send_packet(ictx);
 	if (retval)
diff --git a/drivers/media/rc/lirc_dev.c b/drivers/media/rc/lirc_dev.c
index adb8c794a2d7..d9a9017b96ea 100644
--- a/drivers/media/rc/lirc_dev.c
+++ b/drivers/media/rc/lirc_dev.c
@@ -828,8 +828,10 @@ struct rc_dev *rc_dev_get_from_fd(int fd, bool write)
 		return ERR_PTR(-EINVAL);
 	}
 
-	if (write && !(f.file->f_mode & FMODE_WRITE))
+	if (write && !(f.file->f_mode & FMODE_WRITE)) {
+		fdput(f);
 		return ERR_PTR(-EPERM);
+	}
 
 	fh = f.file->private_data;
 	dev = fh->rc;
diff --git a/drivers/media/usb/dvb-usb/dvb-usb-init.c b/drivers/media/usb/dvb-usb/dvb-usb-init.c
index 58eea8ab5477..6cf6d08cc4ec 100644
--- a/drivers/media/usb/dvb-usb/dvb-usb-init.c
+++ b/drivers/media/usb/dvb-usb/dvb-usb-init.c
@@ -23,11 +23,40 @@ static int dvb_usb_force_pid_filter_usage;
 module_param_named(force_pid_filter_usage, dvb_usb_force_pid_filter_usage, int, 0444);
 MODULE_PARM_DESC(force_pid_filter_usage, "force all dvb-usb-devices to use a PID filter, if any (default: 0).");
 
+static int dvb_usb_check_bulk_endpoint(struct dvb_usb_device *d, u8 endpoint)
+{
+	if (endpoint) {
+		int ret;
+
+		ret = usb_pipe_type_check(d->udev, usb_sndbulkpipe(d->udev, endpoint));
+		if (ret)
+			return ret;
+		ret = usb_pipe_type_check(d->udev, usb_rcvbulkpipe(d->udev, endpoint));
+		if (ret)
+			return ret;
+	}
+	return 0;
+}
+
+static void dvb_usb_clear_halt(struct dvb_usb_device *d, u8 endpoint)
+{
+	if (endpoint) {
+		usb_clear_halt(d->udev, usb_sndbulkpipe(d->udev, endpoint));
+		usb_clear_halt(d->udev, usb_rcvbulkpipe(d->udev, endpoint));
+	}
+}
+
 static int dvb_usb_adapter_init(struct dvb_usb_device *d, short *adapter_nrs)
 {
 	struct dvb_usb_adapter *adap;
 	int ret, n, o;
 
+	ret = dvb_usb_check_bulk_endpoint(d, d->props.generic_bulk_ctrl_endpoint);
+	if (ret)
+		return ret;
+	ret = dvb_usb_check_bulk_endpoint(d, d->props.generic_bulk_ctrl_endpoint_response);
+	if (ret)
+		return ret;
 	for (n = 0; n < d->props.num_adapters; n++) {
 		adap = &d->adapter[n];
 		adap->dev = d;
@@ -103,10 +132,8 @@ static int dvb_usb_adapter_init(struct dvb_usb_device *d, short *adapter_nrs)
 	 * when reloading the driver w/o replugging the device
 	 * sometimes a timeout occurs, this helps
 	 */
-	if (d->props.generic_bulk_ctrl_endpoint != 0) {
-		usb_clear_halt(d->udev, usb_sndbulkpipe(d->udev, d->props.generic_bulk_ctrl_endpoint));
-		usb_clear_halt(d->udev, usb_rcvbulkpipe(d->udev, d->props.generic_bulk_ctrl_endpoint));
-	}
+	dvb_usb_clear_halt(d, d->props.generic_bulk_ctrl_endpoint);
+	dvb_usb_clear_halt(d, d->props.generic_bulk_ctrl_endpoint_response);
 
 	return 0;
 
diff --git a/drivers/media/usb/uvc/uvc_ctrl.c b/drivers/media/usb/uvc/uvc_ctrl.c
index 6d7535efc09d..dffc9d03235c 100644
--- a/drivers/media/usb/uvc/uvc_ctrl.c
+++ b/drivers/media/usb/uvc/uvc_ctrl.c
@@ -1959,7 +1959,13 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev,
 	else
 		ret = uvc_query_ctrl(dev, UVC_GET_INFO, ctrl->entity->id,
 				     dev->intfnum, info->selector, data, 1);
-	if (!ret)
+
+	if (!ret) {
+		info->flags &= ~(UVC_CTRL_FLAG_GET_CUR |
+				 UVC_CTRL_FLAG_SET_CUR |
+				 UVC_CTRL_FLAG_AUTO_UPDATE |
+				 UVC_CTRL_FLAG_ASYNCHRONOUS);
+
 		info->flags |= (data[0] & UVC_CONTROL_CAP_GET ?
 				UVC_CTRL_FLAG_GET_CUR : 0)
 			    |  (data[0] & UVC_CONTROL_CAP_SET ?
@@ -1968,6 +1974,7 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev,
 				UVC_CTRL_FLAG_AUTO_UPDATE : 0)
 			    |  (data[0] & UVC_CONTROL_CAP_ASYNCHRONOUS ?
 				UVC_CTRL_FLAG_ASYNCHRONOUS : 0);
+	}
 
 	kfree(data);
 	return ret;
diff --git a/drivers/media/usb/uvc/uvc_video.c b/drivers/media/usb/uvc/uvc_video.c
index 0d3a3b697b2d..a5ad3ff8bdbb 100644
--- a/drivers/media/usb/uvc/uvc_video.c
+++ b/drivers/media/usb/uvc/uvc_video.c
@@ -705,11 +705,11 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
 	unsigned long flags;
 	u64 timestamp;
 	u32 delta_stc;
-	u32 y1, y2;
+	u32 y1;
 	u32 x1, x2;
 	u32 mean;
 	u32 sof;
-	u64 y;
+	u64 y, y2;
 
 	if (!uvc_hw_timestamps_param)
 		return;
@@ -749,7 +749,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
 	sof = y;
 
 	uvc_dbg(stream->dev, CLOCK,
-		"%s: PTS %u y %llu.%06llu SOF %u.%06llu (x1 %u x2 %u y1 %u y2 %u SOF offset %u)\n",
+		"%s: PTS %u y %llu.%06llu SOF %u.%06llu (x1 %u x2 %u y1 %u y2 %llu SOF offset %u)\n",
 		stream->dev->name, buf->pts,
 		y >> 16, div_u64((y & 0xffff) * 1000000, 65536),
 		sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536),
@@ -764,7 +764,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
 		goto done;
 
 	y1 = NSEC_PER_SEC;
-	y2 = (u32)ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1;
+	y2 = ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1;
 
 	/*
 	 * Interpolated and host SOF timestamps can wrap around at slightly
@@ -785,7 +785,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
 	timestamp = ktime_to_ns(first->host_time) + y - y1;
 
 	uvc_dbg(stream->dev, CLOCK,
-		"%s: SOF %u.%06llu y %llu ts %llu buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %u)\n",
+		"%s: SOF %u.%06llu y %llu ts %llu buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %llu)\n",
 		stream->dev->name,
 		sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536),
 		y, timestamp, vbuf->vb2_buf.timestamp,
diff --git a/drivers/media/v4l2-core/v4l2-async.c b/drivers/media/v4l2-core/v4l2-async.c
index 008a2a3e312e..7471dbd14040 100644
--- a/drivers/media/v4l2-core/v4l2-async.c
+++ b/drivers/media/v4l2-core/v4l2-async.c
@@ -302,6 +302,9 @@ static int v4l2_async_create_ancillary_links(struct v4l2_async_notifier *n,
 	    sd->entity.function != MEDIA_ENT_F_FLASH)
 		return 0;
 
+	if (!n->sd)
+		return 0;
+
 	link = media_create_ancillary_link(&n->sd->entity, &sd->entity);
 
 #endif
diff --git a/drivers/memory/Kconfig b/drivers/memory/Kconfig
index fac290e48e0b..15a9e66f031d 100644
--- a/drivers/memory/Kconfig
+++ b/drivers/memory/Kconfig
@@ -178,7 +178,7 @@ config FSL_CORENET_CF
 	  represents a coherency violation.
 
 config FSL_IFC
-	bool "Freescale IFC driver" if COMPILE_TEST
+	bool "Freescale IFC driver"
 	depends on FSL_SOC || ARCH_LAYERSCAPE || SOC_LS1021A || COMPILE_TEST
 	depends on HAS_IOMEM
 
diff --git a/drivers/mfd/Makefile b/drivers/mfd/Makefile
index 7ed3ef4a698c..e26c64bf7cb7 100644
--- a/drivers/mfd/Makefile
+++ b/drivers/mfd/Makefile
@@ -276,7 +276,5 @@ obj-$(CONFIG_MFD_INTEL_M10_BMC)   += intel-m10-bmc.o
 obj-$(CONFIG_MFD_ATC260X)	+= atc260x-core.o
 obj-$(CONFIG_MFD_ATC260X_I2C)	+= atc260x-i2c.o
 
-rsmu-i2c-objs			:= rsmu_core.o rsmu_i2c.o
-rsmu-spi-objs			:= rsmu_core.o rsmu_spi.o
-obj-$(CONFIG_MFD_RSMU_I2C)	+= rsmu-i2c.o
-obj-$(CONFIG_MFD_RSMU_SPI)	+= rsmu-spi.o
+obj-$(CONFIG_MFD_RSMU_I2C)	+= rsmu_i2c.o rsmu_core.o
+obj-$(CONFIG_MFD_RSMU_SPI)	+= rsmu_spi.o rsmu_core.o
diff --git a/drivers/mfd/omap-usb-tll.c b/drivers/mfd/omap-usb-tll.c
index 080d7970a377..5971b5cb290a 100644
--- a/drivers/mfd/omap-usb-tll.c
+++ b/drivers/mfd/omap-usb-tll.c
@@ -237,8 +237,7 @@ static int usbtll_omap_probe(struct platform_device *pdev)
 		break;
 	}
 
-	tll = devm_kzalloc(dev, sizeof(*tll) + sizeof(tll->ch_clk[nch]),
-			   GFP_KERNEL);
+	tll = devm_kzalloc(dev, struct_size(tll, ch_clk, nch), GFP_KERNEL);
 	if (!tll) {
 		pm_runtime_put_sync(dev);
 		pm_runtime_disable(dev);
diff --git a/drivers/mfd/rsmu_core.c b/drivers/mfd/rsmu_core.c
index 29437fd0bd5b..fd04a6e5dfa3 100644
--- a/drivers/mfd/rsmu_core.c
+++ b/drivers/mfd/rsmu_core.c
@@ -78,11 +78,13 @@ int rsmu_core_init(struct rsmu_ddata *rsmu)
 
 	return ret;
 }
+EXPORT_SYMBOL_GPL(rsmu_core_init);
 
 void rsmu_core_exit(struct rsmu_ddata *rsmu)
 {
 	mutex_destroy(&rsmu->lock);
 }
+EXPORT_SYMBOL_GPL(rsmu_core_exit);
 
 MODULE_DESCRIPTION("Renesas SMU core driver");
 MODULE_LICENSE("GPL");
diff --git a/drivers/mtd/nand/raw/Kconfig b/drivers/mtd/nand/raw/Kconfig
index 4cd40af362de..900b12121939 100644
--- a/drivers/mtd/nand/raw/Kconfig
+++ b/drivers/mtd/nand/raw/Kconfig
@@ -248,8 +248,7 @@ config MTD_NAND_FSL_IFC
 	tristate "Freescale IFC NAND controller"
 	depends on FSL_SOC || ARCH_LAYERSCAPE || SOC_LS1021A || COMPILE_TEST
 	depends on HAS_IOMEM
-	select FSL_IFC
-	select MEMORY
+	depends on FSL_IFC
 	help
 	  Various Freescale chips e.g P1010, include a NAND Flash machine
 	  with built-in hardware ECC capabilities.
diff --git a/drivers/mtd/tests/Makefile b/drivers/mtd/tests/Makefile
index 5de0378f90db..7dae831ee8b6 100644
--- a/drivers/mtd/tests/Makefile
+++ b/drivers/mtd/tests/Makefile
@@ -1,19 +1,19 @@
 # SPDX-License-Identifier: GPL-2.0
-obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o
+obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o mtd_test.o
 
-mtd_oobtest-objs := oobtest.o mtd_test.o
-mtd_pagetest-objs := pagetest.o mtd_test.o
-mtd_readtest-objs := readtest.o mtd_test.o
-mtd_speedtest-objs := speedtest.o mtd_test.o
-mtd_stresstest-objs := stresstest.o mtd_test.o
-mtd_subpagetest-objs := subpagetest.o mtd_test.o
-mtd_torturetest-objs := torturetest.o mtd_test.o
-mtd_nandbiterrs-objs := nandbiterrs.o mtd_test.o
+mtd_oobtest-objs := oobtest.o
+mtd_pagetest-objs := pagetest.o
+mtd_readtest-objs := readtest.o
+mtd_speedtest-objs := speedtest.o
+mtd_stresstest-objs := stresstest.o
+mtd_subpagetest-objs := subpagetest.o
+mtd_torturetest-objs := torturetest.o
+mtd_nandbiterrs-objs := nandbiterrs.o
diff --git a/drivers/mtd/tests/mtd_test.c b/drivers/mtd/tests/mtd_test.c
index c84250beffdc..f391e0300cdc 100644
--- a/drivers/mtd/tests/mtd_test.c
+++ b/drivers/mtd/tests/mtd_test.c
@@ -25,6 +25,7 @@ int mtdtest_erase_eraseblock(struct mtd_info *mtd, unsigned int ebnum)
 
 	return 0;
 }
+EXPORT_SYMBOL_GPL(mtdtest_erase_eraseblock);
 
 static int is_block_bad(struct mtd_info *mtd, unsigned int ebnum)
 {
@@ -57,6 +58,7 @@ int mtdtest_scan_for_bad_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
 
 	return 0;
 }
+EXPORT_SYMBOL_GPL(mtdtest_scan_for_bad_eraseblocks);
 
 int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
 				unsigned int eb, int ebcnt)
@@ -75,6 +77,7 @@ int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
 
 	return 0;
 }
+EXPORT_SYMBOL_GPL(mtdtest_erase_good_eraseblocks);
 
 int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf)
 {
@@ -92,6 +95,7 @@ int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf)
 
 	return err;
 }
+EXPORT_SYMBOL_GPL(mtdtest_read);
 
 int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size,
 		const void *buf)
@@ -107,3 +111,8 @@ int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size,
 
 	return err;
 }
+EXPORT_SYMBOL_GPL(mtdtest_write);
+
+MODULE_LICENSE("GPL");
+MODULE_DESCRIPTION("MTD function test helpers");
+MODULE_AUTHOR("Akinobu Mita");
diff --git a/drivers/mtd/ubi/eba.c b/drivers/mtd/ubi/eba.c
index 4e1d80746b04..38f41ce72b6a 100644
--- a/drivers/mtd/ubi/eba.c
+++ b/drivers/mtd/ubi/eba.c
@@ -1560,6 +1560,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap,
 					  GFP_KERNEL);
 		if (!fm_eba[i]) {
 			ret = -ENOMEM;
+			kfree(scan_eba[i]);
 			goto out_free;
 		}
 
@@ -1595,7 +1596,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap,
 	}
 
 out_free:
-	for (i = 0; i < num_volumes; i++) {
+	while (--i >= 0) {
 		if (!ubi->volumes[i])
 			continue;
 
diff --git a/drivers/net/bonding/bond_main.c b/drivers/net/bonding/bond_main.c
index 710734a5af9b..be5348d0b22e 100644
--- a/drivers/net/bonding/bond_main.c
+++ b/drivers/net/bonding/bond_main.c
@@ -1117,13 +1117,10 @@ static struct slave *bond_find_best_slave(struct bonding *bond)
 	return bestslave;
 }
 
+/* must be called in RCU critical section or with RTNL held */
 static bool bond_should_notify_peers(struct bonding *bond)
 {
-	struct slave *slave;
-
-	rcu_read_lock();
-	slave = rcu_dereference(bond->curr_active_slave);
-	rcu_read_unlock();
+	struct slave *slave = rcu_dereference_rtnl(bond->curr_active_slave);
 
 	if (!slave || !bond->send_peer_notif ||
 	    bond->send_peer_notif %
diff --git a/drivers/net/dsa/b53/b53_common.c b/drivers/net/dsa/b53/b53_common.c
index 59cdfc51ce06..922e5934de73 100644
--- a/drivers/net/dsa/b53/b53_common.c
+++ b/drivers/net/dsa/b53/b53_common.c
@@ -2221,6 +2221,9 @@ static int b53_change_mtu(struct dsa_switch *ds, int port, int mtu)
 	if (is5325(dev) || is5365(dev))
 		return -EOPNOTSUPP;
 
+	if (!dsa_is_cpu_port(ds, port))
+		return 0;
+
 	enable_jumbo = (mtu >= JMS_MIN_SIZE);
 	allow_10_100 = (dev->chip_id == BCM583XX_DEVICE_ID);
 
diff --git a/drivers/net/dsa/mv88e6xxx/chip.c b/drivers/net/dsa/mv88e6xxx/chip.c
index 4938550a67c0..d94b46316a11 100644
--- a/drivers/net/dsa/mv88e6xxx/chip.c
+++ b/drivers/net/dsa/mv88e6xxx/chip.c
@@ -3606,7 +3606,8 @@ static int mv88e6xxx_change_mtu(struct dsa_switch *ds, int port, int new_mtu)
 	mv88e6xxx_reg_lock(chip);
 	if (chip->info->ops->port_set_jumbo_size)
 		ret = chip->info->ops->port_set_jumbo_size(chip, port, new_mtu);
-	else if (chip->info->ops->set_max_frame_size)
+	else if (chip->info->ops->set_max_frame_size &&
+		 dsa_is_cpu_port(ds, port))
 		ret = chip->info->ops->set_max_frame_size(chip, new_mtu);
 	mv88e6xxx_reg_unlock(chip);
 
diff --git a/drivers/net/ethernet/brocade/bna/bna_types.h b/drivers/net/ethernet/brocade/bna/bna_types.h
index 666b6922e24d..ebf54d74c2bb 100644
--- a/drivers/net/ethernet/brocade/bna/bna_types.h
+++ b/drivers/net/ethernet/brocade/bna/bna_types.h
@@ -410,7 +410,7 @@ struct bna_ib {
 /* Tx object */
 
 /* Tx datapath control structure */
-#define BNA_Q_NAME_SIZE		16
+#define BNA_Q_NAME_SIZE		(IFNAMSIZ + 6)
 struct bna_tcb {
 	/* Fast path */
 	void			**sw_qpt;
diff --git a/drivers/net/ethernet/brocade/bna/bnad.c b/drivers/net/ethernet/brocade/bna/bnad.c
index d6d90f9722a7..aecdb98f8a9c 100644
--- a/drivers/net/ethernet/brocade/bna/bnad.c
+++ b/drivers/net/ethernet/brocade/bna/bnad.c
@@ -1535,8 +1535,9 @@ bnad_tx_msix_register(struct bnad *bnad, struct bnad_tx_info *tx_info,
 
 	for (i = 0; i < num_txqs; i++) {
 		vector_num = tx_info->tcb[i]->intr_vector;
-		sprintf(tx_info->tcb[i]->name, "%s TXQ %d", bnad->netdev->name,
-				tx_id + tx_info->tcb[i]->id);
+		snprintf(tx_info->tcb[i]->name, BNA_Q_NAME_SIZE, "%s TXQ %d",
+			 bnad->netdev->name,
+			 tx_id + tx_info->tcb[i]->id);
 		err = request_irq(bnad->msix_table[vector_num].vector,
 				  (irq_handler_t)bnad_msix_tx, 0,
 				  tx_info->tcb[i]->name,
@@ -1586,9 +1587,9 @@ bnad_rx_msix_register(struct bnad *bnad, struct bnad_rx_info *rx_info,
 
 	for (i = 0; i < num_rxps; i++) {
 		vector_num = rx_info->rx_ctrl[i].ccb->intr_vector;
-		sprintf(rx_info->rx_ctrl[i].ccb->name, "%s CQ %d",
-			bnad->netdev->name,
-			rx_id + rx_info->rx_ctrl[i].ccb->id);
+		snprintf(rx_info->rx_ctrl[i].ccb->name, BNA_Q_NAME_SIZE,
+			 "%s CQ %d", bnad->netdev->name,
+			 rx_id + rx_info->rx_ctrl[i].ccb->id);
 		err = request_irq(bnad->msix_table[vector_num].vector,
 				  (irq_handler_t)bnad_msix_rx, 0,
 				  rx_info->rx_ctrl[i].ccb->name,
diff --git a/drivers/net/ethernet/freescale/fec_main.c b/drivers/net/ethernet/freescale/fec_main.c
index 0a3df468316e..0a5c3d27ed3b 100644
--- a/drivers/net/ethernet/freescale/fec_main.c
+++ b/drivers/net/ethernet/freescale/fec_main.c
@@ -267,8 +267,8 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address");
 #define PKT_MINBUF_SIZE		64
 
 /* FEC receive acceleration */
-#define FEC_RACC_IPDIS		(1 << 1)
-#define FEC_RACC_PRODIS		(1 << 2)
+#define FEC_RACC_IPDIS		BIT(1)
+#define FEC_RACC_PRODIS		BIT(2)
 #define FEC_RACC_SHIFT16	BIT(7)
 #define FEC_RACC_OPTIONS	(FEC_RACC_IPDIS | FEC_RACC_PRODIS)
 
@@ -300,8 +300,23 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address");
 #define FEC_MMFR_TA		(2 << 16)
 #define FEC_MMFR_DATA(v)	(v & 0xffff)
 /* FEC ECR bits definition */
-#define FEC_ECR_MAGICEN		(1 << 2)
-#define FEC_ECR_SLEEP		(1 << 3)
+#define FEC_ECR_RESET           BIT(0)
+#define FEC_ECR_ETHEREN         BIT(1)
+#define FEC_ECR_MAGICEN         BIT(2)
+#define FEC_ECR_SLEEP           BIT(3)
+#define FEC_ECR_EN1588          BIT(4)
+#define FEC_ECR_BYTESWP         BIT(8)
+/* FEC RCR bits definition */
+#define FEC_RCR_LOOP            BIT(0)
+#define FEC_RCR_HALFDPX         BIT(1)
+#define FEC_RCR_MII             BIT(2)
+#define FEC_RCR_PROMISC         BIT(3)
+#define FEC_RCR_BC_REJ          BIT(4)
+#define FEC_RCR_FLOWCTL         BIT(5)
+#define FEC_RCR_RMII            BIT(8)
+#define FEC_RCR_10BASET         BIT(9)
+/* TX WMARK bits */
+#define FEC_TXWMRK_STRFWD       BIT(8)
 
 #define FEC_MII_TIMEOUT		30000 /* us */
 
@@ -1038,7 +1053,7 @@ fec_restart(struct net_device *ndev)
 	struct fec_enet_private *fep = netdev_priv(ndev);
 	u32 temp_mac[2];
 	u32 rcntl = OPT_FRAME_SIZE | 0x04;
-	u32 ecntl = 0x2; /* ETHEREN */
+	u32 ecntl = FEC_ECR_ETHEREN;
 
 	/* Whack a reset.  We should wait for this.
 	 * For i.MX6SX SOC, enet use AXI bus, we use disable MAC
@@ -1116,18 +1131,18 @@ fec_restart(struct net_device *ndev)
 		    fep->phy_interface == PHY_INTERFACE_MODE_RGMII_TXID)
 			rcntl |= (1 << 6);
 		else if (fep->phy_interface == PHY_INTERFACE_MODE_RMII)
-			rcntl |= (1 << 8);
+			rcntl |= FEC_RCR_RMII;
 		else
-			rcntl &= ~(1 << 8);
+			rcntl &= ~FEC_RCR_RMII;
 
 		/* 1G, 100M or 10M */
 		if (ndev->phydev) {
 			if (ndev->phydev->speed == SPEED_1000)
 				ecntl |= (1 << 5);
 			else if (ndev->phydev->speed == SPEED_100)
-				rcntl &= ~(1 << 9);
+				rcntl &= ~FEC_RCR_10BASET;
 			else
-				rcntl |= (1 << 9);
+				rcntl |= FEC_RCR_10BASET;
 		}
 	} else {
 #ifdef FEC_MIIGSK_ENR
@@ -1186,13 +1201,13 @@ fec_restart(struct net_device *ndev)
 
 	if (fep->quirks & FEC_QUIRK_ENET_MAC) {
 		/* enable ENET endian swap */
-		ecntl |= (1 << 8);
+		ecntl |= FEC_ECR_BYTESWP;
 		/* enable ENET store and forward mode */
-		writel(1 << 8, fep->hwp + FEC_X_WMRK);
+		writel(FEC_TXWMRK_STRFWD, fep->hwp + FEC_X_WMRK);
 	}
 
 	if (fep->bufdesc_ex)
-		ecntl |= (1 << 4);
+		ecntl |= FEC_ECR_EN1588;
 
 	if (fep->quirks & FEC_QUIRK_DELAYED_CLKS_SUPPORT &&
 	    fep->rgmii_txc_dly)
@@ -1291,7 +1306,7 @@ static void
 fec_stop(struct net_device *ndev)
 {
 	struct fec_enet_private *fep = netdev_priv(ndev);
-	u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & (1 << 8);
+	u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & FEC_RCR_RMII;
 	u32 val;
 
 	/* We cannot expect a graceful transmit stop without link !!! */
@@ -1310,7 +1325,7 @@ fec_stop(struct net_device *ndev)
 		if (fep->quirks & FEC_QUIRK_HAS_MULTI_QUEUES) {
 			writel(0, fep->hwp + FEC_ECNTRL);
 		} else {
-			writel(1, fep->hwp + FEC_ECNTRL);
+			writel(FEC_ECR_RESET, fep->hwp + FEC_ECNTRL);
 			udelay(10);
 		}
 	} else {
@@ -1324,11 +1339,16 @@ fec_stop(struct net_device *ndev)
 	/* We have to keep ENET enabled to have MII interrupt stay working */
 	if (fep->quirks & FEC_QUIRK_ENET_MAC &&
 		!(fep->wol_flag & FEC_WOL_FLAG_SLEEP_ON)) {
-		writel(2, fep->hwp + FEC_ECNTRL);
+		writel(FEC_ECR_ETHEREN, fep->hwp + FEC_ECNTRL);
 		writel(rmii_mode, fep->hwp + FEC_R_CNTRL);
 	}
-}
 
+	if (fep->bufdesc_ex) {
+		val = readl(fep->hwp + FEC_ECNTRL);
+		val |= FEC_ECR_EN1588;
+		writel(val, fep->hwp + FEC_ECNTRL);
+	}
+}
 
 static void
 fec_timeout(struct net_device *ndev, unsigned int txqueue)
diff --git a/drivers/net/ethernet/google/gve/gve_tx_dqo.c b/drivers/net/ethernet/google/gve/gve_tx_dqo.c
index 5147fb37929e..eabed3deca76 100644
--- a/drivers/net/ethernet/google/gve/gve_tx_dqo.c
+++ b/drivers/net/ethernet/google/gve/gve_tx_dqo.c
@@ -596,22 +596,42 @@ static bool gve_can_send_tso(const struct sk_buff *skb)
 	const int header_len = skb_tcp_all_headers(skb);
 	const int gso_size = shinfo->gso_size;
 	int cur_seg_num_bufs;
+	int prev_frag_size;
 	int cur_seg_size;
 	int i;
 
 	cur_seg_size = skb_headlen(skb) - header_len;
+	prev_frag_size = skb_headlen(skb);
 	cur_seg_num_bufs = cur_seg_size > 0;
 
 	for (i = 0; i < shinfo->nr_frags; i++) {
 		if (cur_seg_size >= gso_size) {
 			cur_seg_size %= gso_size;
 			cur_seg_num_bufs = cur_seg_size > 0;
+
+			if (prev_frag_size > GVE_TX_MAX_BUF_SIZE_DQO) {
+				int prev_frag_remain = prev_frag_size %
+					GVE_TX_MAX_BUF_SIZE_DQO;
+
+				/* If the last descriptor of the previous frag
+				 * is less than cur_seg_size, the segment will
+				 * span two descriptors in the previous frag.
+				 * Since max gso size (9728) is less than
+				 * GVE_TX_MAX_BUF_SIZE_DQO, it is impossible
+				 * for the segment to span more than two
+				 * descriptors.
+				 */
+				if (prev_frag_remain &&
+				    cur_seg_size > prev_frag_remain)
+					cur_seg_num_bufs++;
+			}
 		}
 
 		if (unlikely(++cur_seg_num_bufs > max_bufs_per_seg))
 			return false;
 
-		cur_seg_size += skb_frag_size(&shinfo->frags[i]);
+		prev_frag_size = skb_frag_size(&shinfo->frags[i]);
+		cur_seg_size += prev_frag_size;
 	}
 
 	return true;
diff --git a/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c b/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
index 8c6e13f87b7d..1839a37139dc 100644
--- a/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
+++ b/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
@@ -531,7 +531,7 @@ ice_parse_rx_flow_user_data(struct ethtool_rx_flow_spec *fsp,
  *
  * Returns the number of available flow director filters to this VSI
  */
-static int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi)
+int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi)
 {
 	u16 vsi_num = ice_get_hw_vsi_num(hw, vsi->idx);
 	u16 num_guar;
diff --git a/drivers/net/ethernet/intel/ice/ice_fdir.h b/drivers/net/ethernet/intel/ice/ice_fdir.h
index 1b9b84490689..b384d2a4ab19 100644
--- a/drivers/net/ethernet/intel/ice/ice_fdir.h
+++ b/drivers/net/ethernet/intel/ice/ice_fdir.h
@@ -202,6 +202,8 @@ struct ice_fdir_base_pkt {
 	const u8 *tun_pkt;
 };
 
+struct ice_vsi;
+
 int ice_alloc_fd_res_cntr(struct ice_hw *hw, u16 *cntr_id);
 int ice_free_fd_res_cntr(struct ice_hw *hw, u16 cntr_id);
 int ice_alloc_fd_guar_item(struct ice_hw *hw, u16 *cntr_id, u16 num_fltr);
@@ -213,6 +215,7 @@ int
 ice_fdir_get_gen_prgm_pkt(struct ice_hw *hw, struct ice_fdir_fltr *input,
 			  u8 *pkt, bool frag, bool tun);
 int ice_get_fdir_cnt_all(struct ice_hw *hw);
+int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi);
 bool ice_fdir_is_dup_fltr(struct ice_hw *hw, struct ice_fdir_fltr *input);
 bool ice_fdir_has_frag(enum ice_fltr_ptype flow);
 struct ice_fdir_fltr *
diff --git a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
index fb8e85693309..bff3e9662a8f 100644
--- a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
+++ b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
@@ -551,6 +551,8 @@ static void ice_vc_fdir_reset_cnt_all(struct ice_vf_fdir *fdir)
 		fdir->fdir_fltr_cnt[flow][0] = 0;
 		fdir->fdir_fltr_cnt[flow][1] = 0;
 	}
+
+	fdir->fdir_fltr_cnt_total = 0;
 }
 
 /**
@@ -1567,6 +1569,7 @@ ice_vc_add_fdir_fltr_post(struct ice_vf *vf, struct ice_vf_fdir_ctx *ctx,
 	resp->status = status;
 	resp->flow_id = conf->flow_id;
 	vf->fdir.fdir_fltr_cnt[conf->input.flow_type][is_tun]++;
+	vf->fdir.fdir_fltr_cnt_total++;
 
 	ret = ice_vc_send_msg_to_vf(vf, ctx->v_opcode, v_ret,
 				    (u8 *)resp, len);
@@ -1631,6 +1634,7 @@ ice_vc_del_fdir_fltr_post(struct ice_vf *vf, struct ice_vf_fdir_ctx *ctx,
 	resp->status = status;
 	ice_vc_fdir_remove_entry(vf, conf, conf->flow_id);
 	vf->fdir.fdir_fltr_cnt[conf->input.flow_type][is_tun]--;
+	vf->fdir.fdir_fltr_cnt_total--;
 
 	ret = ice_vc_send_msg_to_vf(vf, ctx->v_opcode, v_ret,
 				    (u8 *)resp, len);
@@ -1797,6 +1801,7 @@ int ice_vc_add_fdir_fltr(struct ice_vf *vf, u8 *msg)
 	struct virtchnl_fdir_add *stat = NULL;
 	struct virtchnl_fdir_fltr_conf *conf;
 	enum virtchnl_status_code v_ret;
+	struct ice_vsi *vf_vsi;
 	struct device *dev;
 	struct ice_pf *pf;
 	int is_tun = 0;
@@ -1805,6 +1810,17 @@ int ice_vc_add_fdir_fltr(struct ice_vf *vf, u8 *msg)
 
 	pf = vf->pf;
 	dev = ice_pf_to_dev(pf);
+	vf_vsi = ice_get_vf_vsi(vf);
+
+#define ICE_VF_MAX_FDIR_FILTERS	128
+	if (!ice_fdir_num_avail_fltr(&pf->hw, vf_vsi) ||
+	    vf->fdir.fdir_fltr_cnt_total >= ICE_VF_MAX_FDIR_FILTERS) {
+		v_ret = VIRTCHNL_STATUS_ERR_PARAM;
+		dev_err(dev, "Max number of FDIR filters for VF %d is reached\n",
+			vf->vf_id);
+		goto err_exit;
+	}
+
 	ret = ice_vc_fdir_param_check(vf, fltr->vsi_id);
 	if (ret) {
 		v_ret = VIRTCHNL_STATUS_ERR_PARAM;
diff --git a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
index c5bcc8d7481c..ac6dcab454b4 100644
--- a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
+++ b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
@@ -29,6 +29,7 @@ struct ice_vf_fdir_ctx {
 struct ice_vf_fdir {
 	u16 fdir_fltr_cnt[ICE_FLTR_PTYPE_MAX][ICE_FD_HW_SEG_MAX];
 	int prof_entry_cnt[ICE_FLTR_PTYPE_MAX][ICE_FD_HW_SEG_MAX];
+	u16 fdir_fltr_cnt_total;
 	struct ice_fd_hw_prof **fdir_prof;
 
 	struct idr fdir_rule_idr;
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
index 4b713832fdd5..f5c0a4214c4e 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
@@ -391,7 +391,8 @@ mlxsw_sp_acl_atcam_region_entry_insert(struct mlxsw_sp *mlxsw_sp,
 	if (err)
 		return err;
 
-	lkey_id = aregion->ops->lkey_id_get(aregion, aentry->enc_key, erp_id);
+	lkey_id = aregion->ops->lkey_id_get(aregion, aentry->ht_key.enc_key,
+					    erp_id);
 	if (IS_ERR(lkey_id))
 		return PTR_ERR(lkey_id);
 	aentry->lkey_id = lkey_id;
@@ -399,7 +400,7 @@ mlxsw_sp_acl_atcam_region_entry_insert(struct mlxsw_sp *mlxsw_sp,
 	kvdl_index = mlxsw_afa_block_first_kvdl_index(rulei->act_block);
 	mlxsw_reg_ptce3_pack(ptce3_pl, true, MLXSW_REG_PTCE3_OP_WRITE_WRITE,
 			     priority, region->tcam_region_info,
-			     aentry->enc_key, erp_id,
+			     aentry->ht_key.enc_key, erp_id,
 			     aentry->delta_info.start,
 			     aentry->delta_info.mask,
 			     aentry->delta_info.value,
@@ -428,7 +429,7 @@ mlxsw_sp_acl_atcam_region_entry_remove(struct mlxsw_sp *mlxsw_sp,
 
 	mlxsw_reg_ptce3_pack(ptce3_pl, false, MLXSW_REG_PTCE3_OP_WRITE_WRITE, 0,
 			     region->tcam_region_info,
-			     aentry->enc_key, erp_id,
+			     aentry->ht_key.enc_key, erp_id,
 			     aentry->delta_info.start,
 			     aentry->delta_info.mask,
 			     aentry->delta_info.value,
@@ -457,7 +458,7 @@ mlxsw_sp_acl_atcam_region_entry_action_replace(struct mlxsw_sp *mlxsw_sp,
 	kvdl_index = mlxsw_afa_block_first_kvdl_index(rulei->act_block);
 	mlxsw_reg_ptce3_pack(ptce3_pl, true, MLXSW_REG_PTCE3_OP_WRITE_UPDATE,
 			     priority, region->tcam_region_info,
-			     aentry->enc_key, erp_id,
+			     aentry->ht_key.enc_key, erp_id,
 			     aentry->delta_info.start,
 			     aentry->delta_info.mask,
 			     aentry->delta_info.value,
@@ -480,15 +481,13 @@ __mlxsw_sp_acl_atcam_entry_add(struct mlxsw_sp *mlxsw_sp,
 	int err;
 
 	mlxsw_afk_encode(afk, region->key_info, &rulei->values,
-			 aentry->ht_key.full_enc_key, mask);
+			 aentry->ht_key.enc_key, mask);
 
 	erp_mask = mlxsw_sp_acl_erp_mask_get(aregion, mask, false);
 	if (IS_ERR(erp_mask))
 		return PTR_ERR(erp_mask);
 	aentry->erp_mask = erp_mask;
 	aentry->ht_key.erp_id = mlxsw_sp_acl_erp_mask_erp_id(erp_mask);
-	memcpy(aentry->enc_key, aentry->ht_key.full_enc_key,
-	       sizeof(aentry->enc_key));
 
 	/* Compute all needed delta information and clear the delta bits
 	 * from the encrypted key.
@@ -497,9 +496,8 @@ __mlxsw_sp_acl_atcam_entry_add(struct mlxsw_sp *mlxsw_sp,
 	aentry->delta_info.start = mlxsw_sp_acl_erp_delta_start(delta);
 	aentry->delta_info.mask = mlxsw_sp_acl_erp_delta_mask(delta);
 	aentry->delta_info.value =
-		mlxsw_sp_acl_erp_delta_value(delta,
-					     aentry->ht_key.full_enc_key);
-	mlxsw_sp_acl_erp_delta_clear(delta, aentry->enc_key);
+		mlxsw_sp_acl_erp_delta_value(delta, aentry->ht_key.enc_key);
+	mlxsw_sp_acl_erp_delta_clear(delta, aentry->ht_key.enc_key);
 
 	/* Add rule to the list of A-TCAM rules, assuming this
 	 * rule is intended to A-TCAM. In case this rule does
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
index 95f63fcf4ba1..a54eedb69a3f 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
@@ -249,7 +249,7 @@ __mlxsw_sp_acl_bf_key_encode(struct mlxsw_sp_acl_atcam_region *aregion,
 		memcpy(chunk + pad_bytes, &erp_region_id,
 		       sizeof(erp_region_id));
 		memcpy(chunk + key_offset,
-		       &aentry->enc_key[chunk_key_offsets[chunk_index]],
+		       &aentry->ht_key.enc_key[chunk_key_offsets[chunk_index]],
 		       chunk_key_len);
 		chunk += chunk_len;
 	}
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
index d231f4d2888b..9eee229303cc 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
@@ -1217,18 +1217,6 @@ static bool mlxsw_sp_acl_erp_delta_check(void *priv, const void *parent_obj,
 	return err ? false : true;
 }
 
-static int mlxsw_sp_acl_erp_hints_obj_cmp(const void *obj1, const void *obj2)
-{
-	const struct mlxsw_sp_acl_erp_key *key1 = obj1;
-	const struct mlxsw_sp_acl_erp_key *key2 = obj2;
-
-	/* For hints purposes, two objects are considered equal
-	 * in case the masks are the same. Does not matter what
-	 * the "ctcam" value is.
-	 */
-	return memcmp(key1->mask, key2->mask, sizeof(key1->mask));
-}
-
 static void *mlxsw_sp_acl_erp_delta_create(void *priv, void *parent_obj,
 					   void *obj)
 {
@@ -1308,7 +1296,6 @@ static void mlxsw_sp_acl_erp_root_destroy(void *priv, void *root_priv)
 static const struct objagg_ops mlxsw_sp_acl_erp_objagg_ops = {
 	.obj_size = sizeof(struct mlxsw_sp_acl_erp_key),
 	.delta_check = mlxsw_sp_acl_erp_delta_check,
-	.hints_obj_cmp = mlxsw_sp_acl_erp_hints_obj_cmp,
 	.delta_create = mlxsw_sp_acl_erp_delta_create,
 	.delta_destroy = mlxsw_sp_acl_erp_delta_destroy,
 	.root_create = mlxsw_sp_acl_erp_root_create,
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
index edbbc89e7a71..24ba15d8b416 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
@@ -171,9 +171,9 @@ struct mlxsw_sp_acl_atcam_region {
 };
 
 struct mlxsw_sp_acl_atcam_entry_ht_key {
-	char full_enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded
-								 * key.
-								 */
+	char enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded key, minus
+							    * delta bits.
+							    */
 	u8 erp_id;
 };
 
@@ -185,9 +185,6 @@ struct mlxsw_sp_acl_atcam_entry {
 	struct rhash_head ht_node;
 	struct list_head list; /* Member in entries_list */
 	struct mlxsw_sp_acl_atcam_entry_ht_key ht_key;
-	char enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded key,
-							    * minus delta bits.
-							    */
 	struct {
 		u16 start;
 		u8 mask;
diff --git a/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c b/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
index 39112d5cb5b8..687eb17e41c6 100644
--- a/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
+++ b/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
@@ -971,7 +971,7 @@ static void dwmac4_set_mac_loopback(void __iomem *ioaddr, bool enable)
 }
 
 static void dwmac4_update_vlan_hash(struct mac_device_info *hw, u32 hash,
-				    __le16 perfect_match, bool is_double)
+				    u16 perfect_match, bool is_double)
 {
 	void __iomem *ioaddr = hw->pcsr;
 	u32 value;
diff --git a/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c b/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
index dd73f38ec08d..813327d04c56 100644
--- a/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
+++ b/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
@@ -582,7 +582,7 @@ static int dwxgmac2_rss_configure(struct mac_device_info *hw,
 }
 
 static void dwxgmac2_update_vlan_hash(struct mac_device_info *hw, u32 hash,
-				      __le16 perfect_match, bool is_double)
+				      u16 perfect_match, bool is_double)
 {
 	void __iomem *ioaddr = hw->pcsr;
 
diff --git a/drivers/net/ethernet/stmicro/stmmac/hwif.h b/drivers/net/ethernet/stmicro/stmmac/hwif.h
index b2b9cf04bc72..820e2251b7c8 100644
--- a/drivers/net/ethernet/stmicro/stmmac/hwif.h
+++ b/drivers/net/ethernet/stmicro/stmmac/hwif.h
@@ -366,7 +366,7 @@ struct stmmac_ops {
 			     struct stmmac_rss *cfg, u32 num_rxq);
 	/* VLAN */
 	void (*update_vlan_hash)(struct mac_device_info *hw, u32 hash,
-				 __le16 perfect_match, bool is_double);
+				 u16 perfect_match, bool is_double);
 	void (*enable_vlan)(struct mac_device_info *hw, u32 type);
 	int (*add_hw_vlan_rx_fltr)(struct net_device *dev,
 				   struct mac_device_info *hw,
diff --git a/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c b/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
index e2d51014ab4b..93630840309e 100644
--- a/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
+++ b/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
@@ -6311,7 +6311,7 @@ static u32 stmmac_vid_crc32_le(__le16 vid_le)
 static int stmmac_vlan_update(struct stmmac_priv *priv, bool is_double)
 {
 	u32 crc, hash = 0;
-	__le16 pmatch = 0;
+	u16 pmatch = 0;
 	int count = 0;
 	u16 vid = 0;
 
@@ -6326,7 +6326,7 @@ static int stmmac_vlan_update(struct stmmac_priv *priv, bool is_double)
 		if (count > 2) /* VID = 0 always passes filter */
 			return -EOPNOTSUPP;
 
-		pmatch = cpu_to_le16(vid);
+		pmatch = vid;
 		hash = 0;
 	}
 
diff --git a/drivers/net/netconsole.c b/drivers/net/netconsole.c
index bdff9ac5056d..1e797f1ddc31 100644
--- a/drivers/net/netconsole.c
+++ b/drivers/net/netconsole.c
@@ -716,6 +716,7 @@ static int netconsole_netdev_event(struct notifier_block *this,
 				/* rtnl_lock already held
 				 * we might sleep in __netpoll_cleanup()
 				 */
+				nt->enabled = false;
 				spin_unlock_irqrestore(&target_list_lock, flags);
 
 				__netpoll_cleanup(&nt->np);
@@ -723,7 +724,6 @@ static int netconsole_netdev_event(struct notifier_block *this,
 				spin_lock_irqsave(&target_list_lock, flags);
 				netdev_put(nt->np.dev, &nt->np.dev_tracker);
 				nt->np.dev = NULL;
-				nt->enabled = false;
 				stopped = true;
 				netconsole_target_put(nt);
 				goto restart;
diff --git a/drivers/net/wireless/ath/ath11k/dp_rx.c b/drivers/net/wireless/ath/ath11k/dp_rx.c
index b1067bcdf88a..3746f9c95696 100644
--- a/drivers/net/wireless/ath/ath11k/dp_rx.c
+++ b/drivers/net/wireless/ath/ath11k/dp_rx.c
@@ -1879,8 +1879,7 @@ static void ath11k_dp_rx_h_csum_offload(struct ath11k *ar, struct sk_buff *msdu)
 			  CHECKSUM_NONE : CHECKSUM_UNNECESSARY;
 }
 
-static int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar,
-				       enum hal_encrypt_type enctype)
+int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar, enum hal_encrypt_type enctype)
 {
 	switch (enctype) {
 	case HAL_ENCRYPT_TYPE_OPEN:
diff --git a/drivers/net/wireless/ath/ath11k/dp_rx.h b/drivers/net/wireless/ath/ath11k/dp_rx.h
index 623da3bf9dc8..c322e30caa96 100644
--- a/drivers/net/wireless/ath/ath11k/dp_rx.h
+++ b/drivers/net/wireless/ath/ath11k/dp_rx.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2024 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 #ifndef ATH11K_DP_RX_H
 #define ATH11K_DP_RX_H
@@ -95,4 +96,6 @@ int ath11k_peer_rx_frag_setup(struct ath11k *ar, const u8 *peer_mac, int vdev_id
 int ath11k_dp_rx_pktlog_start(struct ath11k_base *ab);
 int ath11k_dp_rx_pktlog_stop(struct ath11k_base *ab, bool stop_timer);
 
+int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar, enum hal_encrypt_type enctype);
+
 #endif /* ATH11K_DP_RX_H */
diff --git a/drivers/net/wireless/ath/ath11k/mac.c b/drivers/net/wireless/ath/ath11k/mac.c
index b863ead198bd..8234e34269ed 100644
--- a/drivers/net/wireless/ath/ath11k/mac.c
+++ b/drivers/net/wireless/ath/ath11k/mac.c
@@ -3748,6 +3748,7 @@ static int ath11k_install_key(struct ath11k_vif *arvif,
 
 	switch (key->cipher) {
 	case WLAN_CIPHER_SUITE_CCMP:
+	case WLAN_CIPHER_SUITE_CCMP_256:
 		arg.key_cipher = WMI_CIPHER_AES_CCM;
 		/* TODO: Re-check if flag is valid */
 		key->flags |= IEEE80211_KEY_FLAG_GENERATE_IV_MGMT;
@@ -3757,12 +3758,10 @@ static int ath11k_install_key(struct ath11k_vif *arvif,
 		arg.key_txmic_len = 8;
 		arg.key_rxmic_len = 8;
 		break;
-	case WLAN_CIPHER_SUITE_CCMP_256:
-		arg.key_cipher = WMI_CIPHER_AES_CCM;
-		break;
 	case WLAN_CIPHER_SUITE_GCMP:
 	case WLAN_CIPHER_SUITE_GCMP_256:
 		arg.key_cipher = WMI_CIPHER_AES_GCM;
+		key->flags |= IEEE80211_KEY_FLAG_GENERATE_IV_MGMT;
 		break;
 	default:
 		ath11k_warn(ar->ab, "cipher %d is not supported\n", key->cipher);
@@ -5542,7 +5541,10 @@ static int ath11k_mac_mgmt_tx_wmi(struct ath11k *ar, struct ath11k_vif *arvif,
 {
 	struct ath11k_base *ab = ar->ab;
 	struct ieee80211_hdr *hdr = (struct ieee80211_hdr *)skb->data;
+	struct ath11k_skb_cb *skb_cb = ATH11K_SKB_CB(skb);
 	struct ieee80211_tx_info *info;
+	enum hal_encrypt_type enctype;
+	unsigned int mic_len;
 	dma_addr_t paddr;
 	int buf_id;
 	int ret;
@@ -5566,7 +5568,12 @@ static int ath11k_mac_mgmt_tx_wmi(struct ath11k *ar, struct ath11k_vif *arvif,
 		     ieee80211_is_deauth(hdr->frame_control) ||
 		     ieee80211_is_disassoc(hdr->frame_control)) &&
 		     ieee80211_has_protected(hdr->frame_control)) {
-			skb_put(skb, IEEE80211_CCMP_MIC_LEN);
+			if (!(skb_cb->flags & ATH11K_SKB_CIPHER_SET))
+				ath11k_warn(ab, "WMI management tx frame without ATH11K_SKB_CIPHER_SET");
+
+			enctype = ath11k_dp_tx_get_encrypt_type(skb_cb->cipher);
+			mic_len = ath11k_dp_rx_crypto_mic_len(ar, enctype);
+			skb_put(skb, mic_len);
 		}
 	}
 
diff --git a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
index 7717eb85a1db..47c0e8e429e5 100644
--- a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
+++ b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
@@ -2567,7 +2567,6 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
 
 	struct lcnphy_txgains cal_gains, temp_gains;
 	u16 hash;
-	u8 band_idx;
 	int j;
 	u16 ncorr_override[5];
 	u16 syst_coeffs[] = { 0x0000, 0x0000, 0x0000, 0x0000, 0x0000, 0x0000,
@@ -2599,6 +2598,9 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
 	u16 *values_to_save;
 	struct brcms_phy_lcnphy *pi_lcn = pi->u.pi_lcnphy;
 
+	if (WARN_ON(CHSPEC_IS5G(pi->radio_chanspec)))
+		return;
+
 	values_to_save = kmalloc_array(20, sizeof(u16), GFP_ATOMIC);
 	if (NULL == values_to_save)
 		return;
@@ -2662,20 +2664,18 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
 	hash = (target_gains->gm_gain << 8) |
 	       (target_gains->pga_gain << 4) | (target_gains->pad_gain);
 
-	band_idx = (CHSPEC_IS5G(pi->radio_chanspec) ? 1 : 0);
-
 	cal_gains = *target_gains;
 	memset(ncorr_override, 0, sizeof(ncorr_override));
-	for (j = 0; j < iqcal_gainparams_numgains_lcnphy[band_idx]; j++) {
-		if (hash == tbl_iqcal_gainparams_lcnphy[band_idx][j][0]) {
+	for (j = 0; j < iqcal_gainparams_numgains_lcnphy[0]; j++) {
+		if (hash == tbl_iqcal_gainparams_lcnphy[0][j][0]) {
 			cal_gains.gm_gain =
-				tbl_iqcal_gainparams_lcnphy[band_idx][j][1];
+				tbl_iqcal_gainparams_lcnphy[0][j][1];
 			cal_gains.pga_gain =
-				tbl_iqcal_gainparams_lcnphy[band_idx][j][2];
+				tbl_iqcal_gainparams_lcnphy[0][j][2];
 			cal_gains.pad_gain =
-				tbl_iqcal_gainparams_lcnphy[band_idx][j][3];
+				tbl_iqcal_gainparams_lcnphy[0][j][3];
 			memcpy(ncorr_override,
-			       &tbl_iqcal_gainparams_lcnphy[band_idx][j][3],
+			       &tbl_iqcal_gainparams_lcnphy[0][j][3],
 			       sizeof(ncorr_override));
 			break;
 		}
diff --git a/drivers/net/wireless/marvell/mwifiex/cfg80211.c b/drivers/net/wireless/marvell/mwifiex/cfg80211.c
index c907da2a4789..d1b23dba5ad5 100644
--- a/drivers/net/wireless/marvell/mwifiex/cfg80211.c
+++ b/drivers/net/wireless/marvell/mwifiex/cfg80211.c
@@ -926,6 +926,8 @@ mwifiex_init_new_priv_params(struct mwifiex_private *priv,
 		return -EOPNOTSUPP;
 	}
 
+	priv->bss_num = mwifiex_get_unused_bss_num(adapter, priv->bss_type);
+
 	spin_lock_irqsave(&adapter->main_proc_lock, flags);
 	adapter->main_locked = false;
 	spin_unlock_irqrestore(&adapter->main_proc_lock, flags);
diff --git a/drivers/net/wireless/realtek/rtw89/debug.c b/drivers/net/wireless/realtek/rtw89/debug.c
index 3a8fe60d0bb7..0e014d6afb84 100644
--- a/drivers/net/wireless/realtek/rtw89/debug.c
+++ b/drivers/net/wireless/realtek/rtw89/debug.c
@@ -2386,7 +2386,7 @@ static void rtw89_sta_info_get_iter(void *data, struct ieee80211_sta *sta)
 	case RX_ENC_HE:
 		seq_printf(m, "HE %dSS MCS-%d GI:%s", status->nss, status->rate_idx,
 			   status->he_gi <= NL80211_RATE_INFO_HE_GI_3_2 ?
-			   he_gi_str[rate->he_gi] : "N/A");
+			   he_gi_str[status->he_gi] : "N/A");
 		break;
 	}
 	seq_printf(m, "\t(hw_rate=0x%x)\n", rtwsta->rx_hw_rate);
diff --git a/drivers/net/wireless/virt_wifi.c b/drivers/net/wireless/virt_wifi.c
index ba14d83353a4..fb4d95a027fe 100644
--- a/drivers/net/wireless/virt_wifi.c
+++ b/drivers/net/wireless/virt_wifi.c
@@ -136,6 +136,9 @@ static struct ieee80211_supported_band band_5ghz = {
 /* Assigned at module init. Guaranteed locally-administered and unicast. */
 static u8 fake_router_bssid[ETH_ALEN] __ro_after_init = {};
 
+#define VIRT_WIFI_SSID "VirtWifi"
+#define VIRT_WIFI_SSID_LEN 8
+
 static void virt_wifi_inform_bss(struct wiphy *wiphy)
 {
 	u64 tsf = div_u64(ktime_get_boottime_ns(), 1000);
@@ -146,8 +149,8 @@ static void virt_wifi_inform_bss(struct wiphy *wiphy)
 		u8 ssid[8];
 	} __packed ssid = {
 		.tag = WLAN_EID_SSID,
-		.len = 8,
-		.ssid = "VirtWifi",
+		.len = VIRT_WIFI_SSID_LEN,
+		.ssid = VIRT_WIFI_SSID,
 	};
 
 	informed_bss = cfg80211_inform_bss(wiphy, &channel_5ghz,
@@ -213,6 +216,8 @@ struct virt_wifi_netdev_priv {
 	struct net_device *upperdev;
 	u32 tx_packets;
 	u32 tx_failed;
+	u32 connect_requested_ssid_len;
+	u8 connect_requested_ssid[IEEE80211_MAX_SSID_LEN];
 	u8 connect_requested_bss[ETH_ALEN];
 	bool is_up;
 	bool is_connected;
@@ -229,6 +234,12 @@ static int virt_wifi_connect(struct wiphy *wiphy, struct net_device *netdev,
 	if (priv->being_deleted || !priv->is_up)
 		return -EBUSY;
 
+	if (!sme->ssid)
+		return -EINVAL;
+
+	priv->connect_requested_ssid_len = sme->ssid_len;
+	memcpy(priv->connect_requested_ssid, sme->ssid, sme->ssid_len);
+
 	could_schedule = schedule_delayed_work(&priv->connect, HZ * 2);
 	if (!could_schedule)
 		return -EBUSY;
@@ -252,12 +263,15 @@ static void virt_wifi_connect_complete(struct work_struct *work)
 		container_of(work, struct virt_wifi_netdev_priv, connect.work);
 	u8 *requested_bss = priv->connect_requested_bss;
 	bool right_addr = ether_addr_equal(requested_bss, fake_router_bssid);
+	bool right_ssid = priv->connect_requested_ssid_len == VIRT_WIFI_SSID_LEN &&
+			  !memcmp(priv->connect_requested_ssid, VIRT_WIFI_SSID,
+				  priv->connect_requested_ssid_len);
 	u16 status = WLAN_STATUS_SUCCESS;
 
 	if (is_zero_ether_addr(requested_bss))
 		requested_bss = NULL;
 
-	if (!priv->is_up || (requested_bss && !right_addr))
+	if (!priv->is_up || (requested_bss && !right_addr) || !right_ssid)
 		status = WLAN_STATUS_UNSPECIFIED_FAILURE;
 	else
 		priv->is_connected = true;
diff --git a/drivers/nvme/host/pci.c b/drivers/nvme/host/pci.c
index 32e89ea853a4..27446fa84752 100644
--- a/drivers/nvme/host/pci.c
+++ b/drivers/nvme/host/pci.c
@@ -910,7 +910,8 @@ static blk_status_t nvme_prep_rq(struct nvme_dev *dev, struct request *req)
 	blk_mq_start_request(req);
 	return BLK_STS_OK;
 out_unmap_data:
-	nvme_unmap_data(dev, req);
+	if (blk_rq_nr_phys_segments(req))
+		nvme_unmap_data(dev, req);
 out_free_cmd:
 	nvme_cleanup_cmd(req);
 	return ret;
@@ -1322,7 +1323,7 @@ static void nvme_warn_reset(struct nvme_dev *dev, u32 csts)
 	dev_warn(dev->ctrl.device,
 		 "Does your device have a faulty power saving mode enabled?\n");
 	dev_warn(dev->ctrl.device,
-		 "Try \"nvme_core.default_ps_max_latency_us=0 pcie_aspm=off\" and report a bug\n");
+		 "Try \"nvme_core.default_ps_max_latency_us=0 pcie_aspm=off pcie_port_pm=off\" and report a bug\n");
 }
 
 static enum blk_eh_timer_return nvme_timeout(struct request *req)
diff --git a/drivers/nvme/target/auth.c b/drivers/nvme/target/auth.c
index e900525b7866..aacc05ec00c2 100644
--- a/drivers/nvme/target/auth.c
+++ b/drivers/nvme/target/auth.c
@@ -314,7 +314,7 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
 						    req->sq->dhchap_c1,
 						    challenge, shash_len);
 		if (ret)
-			goto out_free_response;
+			goto out_free_challenge;
 	}
 
 	pr_debug("ctrl %d qid %d host response seq %u transaction %d\n",
@@ -325,7 +325,7 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
 			GFP_KERNEL);
 	if (!shash) {
 		ret = -ENOMEM;
-		goto out_free_response;
+		goto out_free_challenge;
 	}
 	shash->tfm = shash_tfm;
 	ret = crypto_shash_init(shash);
@@ -361,9 +361,10 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
 		goto out;
 	ret = crypto_shash_final(shash, response);
 out:
+	kfree(shash);
+out_free_challenge:
 	if (challenge != req->sq->dhchap_c1)
 		kfree(challenge);
-	kfree(shash);
 out_free_response:
 	kfree_sensitive(host_response);
 out_free_tfm:
@@ -426,14 +427,14 @@ int nvmet_auth_ctrl_hash(struct nvmet_req *req, u8 *response,
 						    req->sq->dhchap_c2,
 						    challenge, shash_len);
 		if (ret)
-			goto out_free_response;
+			goto out_free_challenge;
 	}
 
 	shash = kzalloc(sizeof(*shash) + crypto_shash_descsize(shash_tfm),
 			GFP_KERNEL);
 	if (!shash) {
 		ret = -ENOMEM;
-		goto out_free_response;
+		goto out_free_challenge;
 	}
 	shash->tfm = shash_tfm;
 
@@ -470,9 +471,10 @@ int nvmet_auth_ctrl_hash(struct nvmet_req *req, u8 *response,
 		goto out;
 	ret = crypto_shash_final(shash, response);
 out:
+	kfree(shash);
+out_free_challenge:
 	if (challenge != req->sq->dhchap_c2)
 		kfree(challenge);
-	kfree(shash);
 out_free_response:
 	kfree_sensitive(ctrl_response);
 out_free_tfm:
diff --git a/drivers/opp/ti-opp-supply.c b/drivers/opp/ti-opp-supply.c
index 8f3f13fbbb25..a8a696d2e03a 100644
--- a/drivers/opp/ti-opp-supply.c
+++ b/drivers/opp/ti-opp-supply.c
@@ -400,10 +400,12 @@ static int ti_opp_supply_probe(struct platform_device *pdev)
 	}
 
 	ret = dev_pm_opp_set_config_regulators(cpu_dev, ti_opp_config_regulators);
-	if (ret < 0)
+	if (ret < 0) {
 		_free_optimized_voltages(dev, &opp_data);
+		return ret;
+	}
 
-	return ret;
+	return 0;
 }
 
 static struct platform_driver ti_opp_supply_driver = {
diff --git a/drivers/parport/procfs.c b/drivers/parport/procfs.c
index d740eba3c099..8400a379186e 100644
--- a/drivers/parport/procfs.c
+++ b/drivers/parport/procfs.c
@@ -51,12 +51,12 @@ static int do_active_device(struct ctl_table *table, int write,
 	
 	for (dev = port->devices; dev ; dev = dev->next) {
 		if(dev == port->cad) {
-			len += sprintf(buffer, "%s\n", dev->name);
+			len += snprintf(buffer, sizeof(buffer), "%s\n", dev->name);
 		}
 	}
 
 	if(!len) {
-		len += sprintf(buffer, "%s\n", "none");
+		len += snprintf(buffer, sizeof(buffer), "%s\n", "none");
 	}
 
 	if (len > *lenp)
@@ -87,19 +87,19 @@ static int do_autoprobe(struct ctl_table *table, int write,
 	}
 	
 	if ((str = info->class_name) != NULL)
-		len += sprintf (buffer + len, "CLASS:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "CLASS:%s;\n", str);
 
 	if ((str = info->model) != NULL)
-		len += sprintf (buffer + len, "MODEL:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "MODEL:%s;\n", str);
 
 	if ((str = info->mfr) != NULL)
-		len += sprintf (buffer + len, "MANUFACTURER:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "MANUFACTURER:%s;\n", str);
 
 	if ((str = info->description) != NULL)
-		len += sprintf (buffer + len, "DESCRIPTION:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "DESCRIPTION:%s;\n", str);
 
 	if ((str = info->cmdset) != NULL)
-		len += sprintf (buffer + len, "COMMAND SET:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "COMMAND SET:%s;\n", str);
 
 	if (len > *lenp)
 		len = *lenp;
@@ -117,7 +117,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write,
 				 void *result, size_t *lenp, loff_t *ppos)
 {
 	struct parport *port = (struct parport *)table->extra1;
-	char buffer[20];
+	char buffer[64];
 	int len = 0;
 
 	if (*ppos) {
@@ -128,7 +128,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write,
 	if (write) /* permissions prevent this anyway */
 		return -EACCES;
 
-	len += sprintf (buffer, "%lu\t%lu\n", port->base, port->base_hi);
+	len += snprintf (buffer, sizeof(buffer), "%lu\t%lu\n", port->base, port->base_hi);
 
 	if (len > *lenp)
 		len = *lenp;
@@ -155,7 +155,7 @@ static int do_hardware_irq(struct ctl_table *table, int write,
 	if (write) /* permissions prevent this anyway */
 		return -EACCES;
 
-	len += sprintf (buffer, "%d\n", port->irq);
+	len += snprintf (buffer, sizeof(buffer), "%d\n", port->irq);
 
 	if (len > *lenp)
 		len = *lenp;
@@ -182,7 +182,7 @@ static int do_hardware_dma(struct ctl_table *table, int write,
 	if (write) /* permissions prevent this anyway */
 		return -EACCES;
 
-	len += sprintf (buffer, "%d\n", port->dma);
+	len += snprintf (buffer, sizeof(buffer), "%d\n", port->dma);
 
 	if (len > *lenp)
 		len = *lenp;
@@ -213,7 +213,7 @@ static int do_hardware_modes(struct ctl_table *table, int write,
 #define printmode(x)							\
 do {									\
 	if (port->modes & PARPORT_MODE_##x)				\
-		len += sprintf(buffer + len, "%s%s", f++ ? "," : "", #x); \
+		len += snprintf(buffer + len, sizeof(buffer) - len, "%s%s", f++ ? "," : "", #x); \
 } while (0)
 		int f = 0;
 		printmode(PCSPP);
diff --git a/drivers/pci/controller/dwc/pci-keystone.c b/drivers/pci/controller/dwc/pci-keystone.c
index 7ecad72cff7e..6007ffcb4752 100644
--- a/drivers/pci/controller/dwc/pci-keystone.c
+++ b/drivers/pci/controller/dwc/pci-keystone.c
@@ -247,8 +247,68 @@ static struct irq_chip ks_pcie_msi_irq_chip = {
 	.irq_unmask = ks_pcie_msi_unmask,
 };
 
+/**
+ * ks_pcie_set_dbi_mode() - Set DBI mode to access overlaid BAR mask registers
+ * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
+ *	     PCIe host controller driver information.
+ *
+ * Since modification of dbi_cs2 involves different clock domain, read the
+ * status back to ensure the transition is complete.
+ */
+static void ks_pcie_set_dbi_mode(struct keystone_pcie *ks_pcie)
+{
+	u32 val;
+
+	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+	val |= DBI_CS2;
+	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+	do {
+		val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+	} while (!(val & DBI_CS2));
+}
+
+/**
+ * ks_pcie_clear_dbi_mode() - Disable DBI mode
+ * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
+ *	     PCIe host controller driver information.
+ *
+ * Since modification of dbi_cs2 involves different clock domain, read the
+ * status back to ensure the transition is complete.
+ */
+static void ks_pcie_clear_dbi_mode(struct keystone_pcie *ks_pcie)
+{
+	u32 val;
+
+	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+	val &= ~DBI_CS2;
+	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+	do {
+		val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+	} while (val & DBI_CS2);
+}
+
 static int ks_pcie_msi_host_init(struct dw_pcie_rp *pp)
 {
+	struct dw_pcie *pci = to_dw_pcie_from_pp(pp);
+	struct keystone_pcie *ks_pcie = to_keystone_pcie(pci);
+
+	/* Configure and set up BAR0 */
+	ks_pcie_set_dbi_mode(ks_pcie);
+
+	/* Enable BAR0 */
+	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, 1);
+	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, SZ_4K - 1);
+
+	ks_pcie_clear_dbi_mode(ks_pcie);
+
+	/*
+	 * For BAR0, just setting bus address for inbound writes (MSI) should
+	 * be sufficient.  Use physical address to avoid any conflicts.
+	 */
+	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, ks_pcie->app.start);
+
 	pp->msi_irq_chip = &ks_pcie_msi_irq_chip;
 	return dw_pcie_allocate_domains(pp);
 }
@@ -343,59 +403,22 @@ static const struct irq_domain_ops ks_pcie_legacy_irq_domain_ops = {
 	.xlate = irq_domain_xlate_onetwocell,
 };
 
-/**
- * ks_pcie_set_dbi_mode() - Set DBI mode to access overlaid BAR mask registers
- * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
- *	     PCIe host controller driver information.
- *
- * Since modification of dbi_cs2 involves different clock domain, read the
- * status back to ensure the transition is complete.
- */
-static void ks_pcie_set_dbi_mode(struct keystone_pcie *ks_pcie)
-{
-	u32 val;
-
-	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
-	val |= DBI_CS2;
-	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
-
-	do {
-		val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
-	} while (!(val & DBI_CS2));
-}
-
-/**
- * ks_pcie_clear_dbi_mode() - Disable DBI mode
- * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
- *	     PCIe host controller driver information.
- *
- * Since modification of dbi_cs2 involves different clock domain, read the
- * status back to ensure the transition is complete.
- */
-static void ks_pcie_clear_dbi_mode(struct keystone_pcie *ks_pcie)
-{
-	u32 val;
-
-	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
-	val &= ~DBI_CS2;
-	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
-
-	do {
-		val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
-	} while (val & DBI_CS2);
-}
-
-static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
+static int ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
 {
 	u32 val;
 	u32 num_viewport = ks_pcie->num_viewport;
 	struct dw_pcie *pci = ks_pcie->pci;
 	struct dw_pcie_rp *pp = &pci->pp;
-	u64 start, end;
+	struct resource_entry *entry;
 	struct resource *mem;
+	u64 start, end;
 	int i;
 
-	mem = resource_list_first_type(&pp->bridge->windows, IORESOURCE_MEM)->res;
+	entry = resource_list_first_type(&pp->bridge->windows, IORESOURCE_MEM);
+	if (!entry)
+		return -ENODEV;
+
+	mem = entry->res;
 	start = mem->start;
 	end = mem->end;
 
@@ -406,7 +429,7 @@ static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
 	ks_pcie_clear_dbi_mode(ks_pcie);
 
 	if (ks_pcie->is_am6)
-		return;
+		return 0;
 
 	val = ilog2(OB_WIN_SIZE);
 	ks_pcie_app_writel(ks_pcie, OB_SIZE, val);
@@ -423,6 +446,8 @@ static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
 	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
 	val |= OB_XLAT_EN_VAL;
 	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+	return 0;
 }
 
 static void __iomem *ks_pcie_other_map_bus(struct pci_bus *bus,
@@ -448,44 +473,10 @@ static struct pci_ops ks_child_pcie_ops = {
 	.write = pci_generic_config_write,
 };
 
-/**
- * ks_pcie_v3_65_add_bus() - keystone add_bus post initialization
- * @bus: A pointer to the PCI bus structure.
- *
- * This sets BAR0 to enable inbound access for MSI_IRQ register
- */
-static int ks_pcie_v3_65_add_bus(struct pci_bus *bus)
-{
-	struct dw_pcie_rp *pp = bus->sysdata;
-	struct dw_pcie *pci = to_dw_pcie_from_pp(pp);
-	struct keystone_pcie *ks_pcie = to_keystone_pcie(pci);
-
-	if (!pci_is_root_bus(bus))
-		return 0;
-
-	/* Configure and set up BAR0 */
-	ks_pcie_set_dbi_mode(ks_pcie);
-
-	/* Enable BAR0 */
-	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, 1);
-	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, SZ_4K - 1);
-
-	ks_pcie_clear_dbi_mode(ks_pcie);
-
-	 /*
-	  * For BAR0, just setting bus address for inbound writes (MSI) should
-	  * be sufficient.  Use physical address to avoid any conflicts.
-	  */
-	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, ks_pcie->app.start);
-
-	return 0;
-}
-
 static struct pci_ops ks_pcie_ops = {
 	.map_bus = dw_pcie_own_conf_map_bus,
 	.read = pci_generic_config_read,
 	.write = pci_generic_config_write,
-	.add_bus = ks_pcie_v3_65_add_bus,
 };
 
 /**
@@ -818,7 +809,10 @@ static int __init ks_pcie_host_init(struct dw_pcie_rp *pp)
 		return ret;
 
 	ks_pcie_stop_link(pci);
-	ks_pcie_setup_rc_app_regs(ks_pcie);
+	ret = ks_pcie_setup_rc_app_regs(ks_pcie);
+	if (ret)
+		return ret;
+
 	writew(PCI_IO_RANGE_TYPE_32 | (PCI_IO_RANGE_TYPE_32 << 8),
 			pci->dbi_base + PCI_IO_BASE);
 
diff --git a/drivers/pci/controller/dwc/pcie-designware-ep.c b/drivers/pci/controller/dwc/pcie-designware-ep.c
index 506d6d061d4c..449ad709495d 100644
--- a/drivers/pci/controller/dwc/pcie-designware-ep.c
+++ b/drivers/pci/controller/dwc/pcie-designware-ep.c
@@ -165,7 +165,7 @@ static int dw_pcie_ep_inbound_atu(struct dw_pcie_ep *ep, u8 func_no, int type,
 	if (!ep->bar_to_atu[bar])
 		free_win = find_first_zero_bit(ep->ib_window_map, pci->num_ib_windows);
 	else
-		free_win = ep->bar_to_atu[bar];
+		free_win = ep->bar_to_atu[bar] - 1;
 
 	if (free_win >= pci->num_ib_windows) {
 		dev_err(pci->dev, "No free inbound window\n");
@@ -179,7 +179,11 @@ static int dw_pcie_ep_inbound_atu(struct dw_pcie_ep *ep, u8 func_no, int type,
 		return ret;
 	}
 
-	ep->bar_to_atu[bar] = free_win;
+	/*
+	 * Always increment free_win before assignment, since value 0 is used to identify
+	 * unallocated mapping.
+	 */
+	ep->bar_to_atu[bar] = free_win + 1;
 	set_bit(free_win, ep->ib_window_map);
 
 	return 0;
@@ -216,7 +220,10 @@ static void dw_pcie_ep_clear_bar(struct pci_epc *epc, u8 func_no, u8 vfunc_no,
 	struct dw_pcie_ep *ep = epc_get_drvdata(epc);
 	struct dw_pcie *pci = to_dw_pcie_from_ep(ep);
 	enum pci_barno bar = epf_bar->barno;
-	u32 atu_index = ep->bar_to_atu[bar];
+	u32 atu_index = ep->bar_to_atu[bar] - 1;
+
+	if (!ep->bar_to_atu[bar])
+		return;
 
 	__dw_pcie_ep_reset_bar(pci, func_no, bar, epf_bar->flags);
 
diff --git a/drivers/pci/controller/dwc/pcie-dw-rockchip.c b/drivers/pci/controller/dwc/pcie-dw-rockchip.c
index c1e7653e508e..4332370fefa0 100644
--- a/drivers/pci/controller/dwc/pcie-dw-rockchip.c
+++ b/drivers/pci/controller/dwc/pcie-dw-rockchip.c
@@ -240,7 +240,7 @@ static int rockchip_pcie_resource_get(struct platform_device *pdev,
 		return PTR_ERR(rockchip->apb_base);
 
 	rockchip->rst_gpio = devm_gpiod_get_optional(&pdev->dev, "reset",
-						     GPIOD_OUT_HIGH);
+						     GPIOD_OUT_LOW);
 	if (IS_ERR(rockchip->rst_gpio))
 		return PTR_ERR(rockchip->rst_gpio);
 
diff --git a/drivers/pci/controller/dwc/pcie-qcom-ep.c b/drivers/pci/controller/dwc/pcie-qcom-ep.c
index 1c7fd05ce028..f2bf3eba2254 100644
--- a/drivers/pci/controller/dwc/pcie-qcom-ep.c
+++ b/drivers/pci/controller/dwc/pcie-qcom-ep.c
@@ -446,12 +446,6 @@ static int qcom_pcie_perst_deassert(struct dw_pcie *pci)
 static void qcom_pcie_perst_assert(struct dw_pcie *pci)
 {
 	struct qcom_pcie_ep *pcie_ep = to_pcie_ep(pci);
-	struct device *dev = pci->dev;
-
-	if (pcie_ep->link_status == QCOM_PCIE_EP_LINK_DISABLED) {
-		dev_dbg(dev, "Link is already disabled\n");
-		return;
-	}
 
 	qcom_pcie_disable_resources(pcie_ep);
 	pcie_ep->link_status = QCOM_PCIE_EP_LINK_DISABLED;
diff --git a/drivers/pci/controller/pci-hyperv.c b/drivers/pci/controller/pci-hyperv.c
index b36cbc9136ae..09491d06589e 100644
--- a/drivers/pci/controller/pci-hyperv.c
+++ b/drivers/pci/controller/pci-hyperv.c
@@ -1092,8 +1092,8 @@ static void _hv_pcifront_read_config(struct hv_pci_dev *hpdev, int where,
 		   PCI_CAPABILITY_LIST) {
 		/* ROM BARs are unimplemented */
 		*val = 0;
-	} else if (where >= PCI_INTERRUPT_LINE && where + size <=
-		   PCI_INTERRUPT_PIN) {
+	} else if ((where >= PCI_INTERRUPT_LINE && where + size <= PCI_INTERRUPT_PIN) ||
+		   (where >= PCI_INTERRUPT_PIN && where + size <= PCI_MIN_GNT)) {
 		/*
 		 * Interrupt Line and Interrupt PIN are hard-wired to zero
 		 * because this front-end only supports message-signaled
diff --git a/drivers/pci/controller/pci-loongson.c b/drivers/pci/controller/pci-loongson.c
index a860f25473df..76f125d556eb 100644
--- a/drivers/pci/controller/pci-loongson.c
+++ b/drivers/pci/controller/pci-loongson.c
@@ -163,6 +163,19 @@ DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON,
 DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON,
 			DEV_LS7A_HDMI, loongson_pci_pin_quirk);
 
+static void loongson_pci_msi_quirk(struct pci_dev *dev)
+{
+	u16 val, class = dev->class >> 8;
+
+	if (class != PCI_CLASS_BRIDGE_HOST)
+		return;
+
+	pci_read_config_word(dev, dev->msi_cap + PCI_MSI_FLAGS, &val);
+	val |= PCI_MSI_FLAGS_ENABLE;
+	pci_write_config_word(dev, dev->msi_cap + PCI_MSI_FLAGS, val);
+}
+DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON, DEV_LS7A_PCIE_PORT5, loongson_pci_msi_quirk);
+
 static struct loongson_pci *pci_bus_to_loongson_pci(struct pci_bus *bus)
 {
 	struct pci_config_window *cfg;
diff --git a/drivers/pci/controller/pcie-rcar-host.c b/drivers/pci/controller/pcie-rcar-host.c
index e4faf90feaf5..d0fe5076d977 100644
--- a/drivers/pci/controller/pcie-rcar-host.c
+++ b/drivers/pci/controller/pcie-rcar-host.c
@@ -92,7 +92,11 @@ static int rcar_pcie_wakeup(struct device *pcie_dev, void __iomem *pcie_base)
 		writel(L1IATN, pcie_base + PMCTLR);
 		ret = readl_poll_timeout_atomic(pcie_base + PMSR, val,
 						val & L1FAEG, 10, 1000);
-		WARN(ret, "Timeout waiting for L1 link state, ret=%d\n", ret);
+		if (ret) {
+			dev_warn_ratelimited(pcie_dev,
+					     "Timeout waiting for L1 link state, ret=%d\n",
+					     ret);
+		}
 		writel(L1FAEG | PMEL1RX, pcie_base + PMSR);
 	}
 
diff --git a/drivers/pci/controller/pcie-rockchip.c b/drivers/pci/controller/pcie-rockchip.c
index 1aa84035a8bc..bdce1ba7c1bc 100644
--- a/drivers/pci/controller/pcie-rockchip.c
+++ b/drivers/pci/controller/pcie-rockchip.c
@@ -120,7 +120,7 @@ int rockchip_pcie_parse_dt(struct rockchip_pcie *rockchip)
 
 	if (rockchip->is_rc) {
 		rockchip->ep_gpio = devm_gpiod_get_optional(dev, "ep",
-							    GPIOD_OUT_HIGH);
+							    GPIOD_OUT_LOW);
 		if (IS_ERR(rockchip->ep_gpio))
 			return dev_err_probe(dev, PTR_ERR(rockchip->ep_gpio),
 					     "failed to get ep GPIO\n");
diff --git a/drivers/pci/endpoint/functions/pci-epf-vntb.c b/drivers/pci/endpoint/functions/pci-epf-vntb.c
index b4c1a4f6029d..6708d2e789cb 100644
--- a/drivers/pci/endpoint/functions/pci-epf-vntb.c
+++ b/drivers/pci/endpoint/functions/pci-epf-vntb.c
@@ -813,8 +813,9 @@ static int epf_ntb_epc_init(struct epf_ntb *ntb)
  */
 static void epf_ntb_epc_cleanup(struct epf_ntb *ntb)
 {
-	epf_ntb_db_bar_clear(ntb);
 	epf_ntb_mw_bar_clear(ntb, ntb->num_mws);
+	epf_ntb_db_bar_clear(ntb);
+	epf_ntb_config_sspad_bar_clear(ntb);
 }
 
 #define EPF_NTB_R(_name)						\
@@ -1032,8 +1033,10 @@ static int vpci_scan_bus(void *sysdata)
 	struct epf_ntb *ndev = sysdata;
 
 	vpci_bus = pci_scan_bus(ndev->vbus_number, &vpci_ops, sysdata);
-	if (vpci_bus)
-		pr_err("create pci bus\n");
+	if (!vpci_bus) {
+		pr_err("create pci bus failed\n");
+		return -EINVAL;
+	}
 
 	pci_bus_add_devices(vpci_bus);
 
@@ -1352,13 +1355,19 @@ static int epf_ntb_bind(struct pci_epf *epf)
 	ret = pci_register_driver(&vntb_pci_driver);
 	if (ret) {
 		dev_err(dev, "failure register vntb pci driver\n");
-		goto err_bar_alloc;
+		goto err_epc_cleanup;
 	}
 
-	vpci_scan_bus(ntb);
+	ret = vpci_scan_bus(ntb);
+	if (ret)
+		goto err_unregister;
 
 	return 0;
 
+err_unregister:
+	pci_unregister_driver(&vntb_pci_driver);
+err_epc_cleanup:
+	epf_ntb_epc_cleanup(ntb);
 err_bar_alloc:
 	epf_ntb_config_spad_bar_free(ntb);
 
diff --git a/drivers/pci/pci.c b/drivers/pci/pci.c
index 0399204941db..2d373ab3ccb3 100644
--- a/drivers/pci/pci.c
+++ b/drivers/pci/pci.c
@@ -5007,7 +5007,7 @@ static int pci_bus_max_d3cold_delay(const struct pci_bus *bus)
 int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type,
 				      int timeout)
 {
-	struct pci_dev *child;
+	struct pci_dev *child __free(pci_dev_put) = NULL;
 	int delay;
 
 	if (pci_dev_is_disconnected(dev))
@@ -5036,8 +5036,8 @@ int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type,
 		return 0;
 	}
 
-	child = list_first_entry(&dev->subordinate->devices, struct pci_dev,
-				 bus_list);
+	child = pci_dev_get(list_first_entry(&dev->subordinate->devices,
+					     struct pci_dev, bus_list));
 	up_read(&pci_bus_sem);
 
 	/*
diff --git a/drivers/pci/setup-bus.c b/drivers/pci/setup-bus.c
index c690572b10ce..b8cb990044fb 100644
--- a/drivers/pci/setup-bus.c
+++ b/drivers/pci/setup-bus.c
@@ -824,11 +824,9 @@ static resource_size_t calculate_memsize(resource_size_t size,
 		size = min_size;
 	if (old_size == 1)
 		old_size = 0;
-	if (size < old_size)
-		size = old_size;
 
-	size = ALIGN(max(size, add_size) + children_add_size, align);
-	return size;
+	size = max(size, add_size) + children_add_size;
+	return ALIGN(max(size, old_size), align);
 }
 
 resource_size_t __weak pcibios_window_alignment(struct pci_bus *bus,
diff --git a/drivers/phy/cadence/phy-cadence-torrent.c b/drivers/phy/cadence/phy-cadence-torrent.c
index f099053c583c..34a380ce533a 100644
--- a/drivers/phy/cadence/phy-cadence-torrent.c
+++ b/drivers/phy/cadence/phy-cadence-torrent.c
@@ -1087,6 +1087,9 @@ static int cdns_torrent_dp_set_power_state(struct cdns_torrent_phy *cdns_phy,
 	ret = regmap_read_poll_timeout(regmap, PHY_PMA_XCVR_POWER_STATE_ACK,
 				       read_val, (read_val & mask) == value, 0,
 				       POLL_TIMEOUT_US);
+	if (ret)
+		return ret;
+
 	cdns_torrent_dp_write(regmap, PHY_PMA_XCVR_POWER_STATE_REQ, 0x00000000);
 	ndelay(100);
 
diff --git a/drivers/pinctrl/core.c b/drivers/pinctrl/core.c
index db5fc55a5c96..3b6051d63218 100644
--- a/drivers/pinctrl/core.c
+++ b/drivers/pinctrl/core.c
@@ -2062,6 +2062,14 @@ pinctrl_init_controller(struct pinctrl_desc *pctldesc, struct device *dev,
 	return ERR_PTR(ret);
 }
 
+static void pinctrl_uninit_controller(struct pinctrl_dev *pctldev, struct pinctrl_desc *pctldesc)
+{
+	pinctrl_free_pindescs(pctldev, pctldesc->pins,
+			      pctldesc->npins);
+	mutex_destroy(&pctldev->mutex);
+	kfree(pctldev);
+}
+
 static int pinctrl_claim_hogs(struct pinctrl_dev *pctldev)
 {
 	pctldev->p = create_pinctrl(pctldev->dev, pctldev);
@@ -2142,8 +2150,10 @@ struct pinctrl_dev *pinctrl_register(struct pinctrl_desc *pctldesc,
 		return pctldev;
 
 	error = pinctrl_enable(pctldev);
-	if (error)
+	if (error) {
+		pinctrl_uninit_controller(pctldev, pctldesc);
 		return ERR_PTR(error);
+	}
 
 	return pctldev;
 }
diff --git a/drivers/pinctrl/freescale/pinctrl-mxs.c b/drivers/pinctrl/freescale/pinctrl-mxs.c
index 735cedd0958a..5b0fcf15f280 100644
--- a/drivers/pinctrl/freescale/pinctrl-mxs.c
+++ b/drivers/pinctrl/freescale/pinctrl-mxs.c
@@ -405,8 +405,8 @@ static int mxs_pinctrl_probe_dt(struct platform_device *pdev,
 	int ret;
 	u32 val;
 
-	child = of_get_next_child(np, NULL);
-	if (!child) {
+	val = of_get_child_count(np);
+	if (val == 0) {
 		dev_err(&pdev->dev, "no group is defined\n");
 		return -ENOENT;
 	}
diff --git a/drivers/pinctrl/pinctrl-rockchip.c b/drivers/pinctrl/pinctrl-rockchip.c
index d26682f21ad1..6d140a60888c 100644
--- a/drivers/pinctrl/pinctrl-rockchip.c
+++ b/drivers/pinctrl/pinctrl-rockchip.c
@@ -916,9 +916,8 @@ static struct rockchip_mux_route_data rk3308_mux_route_data[] = {
 	RK_MUXROUTE_SAME(0, RK_PC3, 1, 0x314, BIT(16 + 0) | BIT(0)), /* rtc_clk */
 	RK_MUXROUTE_SAME(1, RK_PC6, 2, 0x314, BIT(16 + 2) | BIT(16 + 3)), /* uart2_rxm0 */
 	RK_MUXROUTE_SAME(4, RK_PD2, 2, 0x314, BIT(16 + 2) | BIT(16 + 3) | BIT(2)), /* uart2_rxm1 */
-	RK_MUXROUTE_SAME(0, RK_PB7, 2, 0x608, BIT(16 + 8) | BIT(16 + 9)), /* i2c3_sdam0 */
-	RK_MUXROUTE_SAME(3, RK_PB4, 2, 0x608, BIT(16 + 8) | BIT(16 + 9) | BIT(8)), /* i2c3_sdam1 */
-	RK_MUXROUTE_SAME(2, RK_PA0, 3, 0x608, BIT(16 + 8) | BIT(16 + 9) | BIT(9)), /* i2c3_sdam2 */
+	RK_MUXROUTE_SAME(0, RK_PB7, 2, 0x314, BIT(16 + 4)), /* i2c3_sdam0 */
+	RK_MUXROUTE_SAME(3, RK_PB4, 2, 0x314, BIT(16 + 4) | BIT(4)), /* i2c3_sdam1 */
 	RK_MUXROUTE_SAME(1, RK_PA3, 2, 0x308, BIT(16 + 3)), /* i2s-8ch-1-sclktxm0 */
 	RK_MUXROUTE_SAME(1, RK_PA4, 2, 0x308, BIT(16 + 3)), /* i2s-8ch-1-sclkrxm0 */
 	RK_MUXROUTE_SAME(1, RK_PB5, 2, 0x308, BIT(16 + 3) | BIT(3)), /* i2s-8ch-1-sclktxm1 */
@@ -927,18 +926,6 @@ static struct rockchip_mux_route_data rk3308_mux_route_data[] = {
 	RK_MUXROUTE_SAME(1, RK_PB6, 4, 0x308, BIT(16 + 12) | BIT(16 + 13) | BIT(12)), /* pdm-clkm1 */
 	RK_MUXROUTE_SAME(2, RK_PA6, 2, 0x308, BIT(16 + 12) | BIT(16 + 13) | BIT(13)), /* pdm-clkm2 */
 	RK_MUXROUTE_SAME(2, RK_PA4, 3, 0x600, BIT(16 + 2) | BIT(2)), /* pdm-clkm-m2 */
-	RK_MUXROUTE_SAME(3, RK_PB2, 3, 0x314, BIT(16 + 9)), /* spi1_miso */
-	RK_MUXROUTE_SAME(2, RK_PA4, 2, 0x314, BIT(16 + 9) | BIT(9)), /* spi1_miso_m1 */
-	RK_MUXROUTE_SAME(0, RK_PB3, 3, 0x314, BIT(16 + 10) | BIT(16 + 11)), /* owire_m0 */
-	RK_MUXROUTE_SAME(1, RK_PC6, 7, 0x314, BIT(16 + 10) | BIT(16 + 11) | BIT(10)), /* owire_m1 */
-	RK_MUXROUTE_SAME(2, RK_PA2, 5, 0x314, BIT(16 + 10) | BIT(16 + 11) | BIT(11)), /* owire_m2 */
-	RK_MUXROUTE_SAME(0, RK_PB3, 2, 0x314, BIT(16 + 12) | BIT(16 + 13)), /* can_rxd_m0 */
-	RK_MUXROUTE_SAME(1, RK_PC6, 5, 0x314, BIT(16 + 12) | BIT(16 + 13) | BIT(12)), /* can_rxd_m1 */
-	RK_MUXROUTE_SAME(2, RK_PA2, 4, 0x314, BIT(16 + 12) | BIT(16 + 13) | BIT(13)), /* can_rxd_m2 */
-	RK_MUXROUTE_SAME(1, RK_PC4, 3, 0x314, BIT(16 + 14)), /* mac_rxd0_m0 */
-	RK_MUXROUTE_SAME(4, RK_PA2, 2, 0x314, BIT(16 + 14) | BIT(14)), /* mac_rxd0_m1 */
-	RK_MUXROUTE_SAME(3, RK_PB4, 4, 0x314, BIT(16 + 15)), /* uart3_rx */
-	RK_MUXROUTE_SAME(0, RK_PC1, 3, 0x314, BIT(16 + 15) | BIT(15)), /* uart3_rx_m1 */
 };
 
 static struct rockchip_mux_route_data rk3328_mux_route_data[] = {
diff --git a/drivers/pinctrl/pinctrl-single.c b/drivers/pinctrl/pinctrl-single.c
index 9ad8f7020614..cd23479f352a 100644
--- a/drivers/pinctrl/pinctrl-single.c
+++ b/drivers/pinctrl/pinctrl-single.c
@@ -1328,7 +1328,6 @@ static void pcs_irq_free(struct pcs_device *pcs)
 static void pcs_free_resources(struct pcs_device *pcs)
 {
 	pcs_irq_free(pcs);
-	pinctrl_unregister(pcs->pctl);
 
 #if IS_BUILTIN(CONFIG_PINCTRL_SINGLE)
 	if (pcs->missing_nr_pinctrl_cells)
@@ -1885,7 +1884,7 @@ static int pcs_probe(struct platform_device *pdev)
 	if (ret < 0)
 		goto free;
 
-	ret = pinctrl_register_and_init(&pcs->desc, pcs->dev, pcs, &pcs->pctl);
+	ret = devm_pinctrl_register_and_init(pcs->dev, &pcs->desc, pcs, &pcs->pctl);
 	if (ret) {
 		dev_err(pcs->dev, "could not register single pinctrl driver\n");
 		goto free;
@@ -1918,8 +1917,10 @@ static int pcs_probe(struct platform_device *pdev)
 
 	dev_info(pcs->dev, "%i pins, size %u\n", pcs->desc.npins, pcs->size);
 
-	return pinctrl_enable(pcs->pctl);
+	if (pinctrl_enable(pcs->pctl))
+		goto free;
 
+	return 0;
 free:
 	pcs_free_resources(pcs);
 
diff --git a/drivers/pinctrl/renesas/pfc-r8a779g0.c b/drivers/pinctrl/renesas/pfc-r8a779g0.c
index acf7664ea835..595a5a4b02ec 100644
--- a/drivers/pinctrl/renesas/pfc-r8a779g0.c
+++ b/drivers/pinctrl/renesas/pfc-r8a779g0.c
@@ -62,20 +62,20 @@
 #define GPSR0_9		F_(MSIOF5_SYNC,		IP1SR0_7_4)
 #define GPSR0_8		F_(MSIOF5_SS1,		IP1SR0_3_0)
 #define GPSR0_7		F_(MSIOF5_SS2,		IP0SR0_31_28)
-#define GPSR0_6		F_(IRQ0,		IP0SR0_27_24)
-#define GPSR0_5		F_(IRQ1,		IP0SR0_23_20)
-#define GPSR0_4		F_(IRQ2,		IP0SR0_19_16)
-#define GPSR0_3		F_(IRQ3,		IP0SR0_15_12)
+#define GPSR0_6		F_(IRQ0_A,		IP0SR0_27_24)
+#define GPSR0_5		F_(IRQ1_A,		IP0SR0_23_20)
+#define GPSR0_4		F_(IRQ2_A,		IP0SR0_19_16)
+#define GPSR0_3		F_(IRQ3_A,		IP0SR0_15_12)
 #define GPSR0_2		F_(GP0_02,		IP0SR0_11_8)
 #define GPSR0_1		F_(GP0_01,		IP0SR0_7_4)
 #define GPSR0_0		F_(GP0_00,		IP0SR0_3_0)
 
 /* GPSR1 */
-#define GPSR1_28	F_(HTX3,		IP3SR1_19_16)
-#define GPSR1_27	F_(HCTS3_N,		IP3SR1_15_12)
-#define GPSR1_26	F_(HRTS3_N,		IP3SR1_11_8)
-#define GPSR1_25	F_(HSCK3,		IP3SR1_7_4)
-#define GPSR1_24	F_(HRX3,		IP3SR1_3_0)
+#define GPSR1_28	F_(HTX3_A,		IP3SR1_19_16)
+#define GPSR1_27	F_(HCTS3_N_A,		IP3SR1_15_12)
+#define GPSR1_26	F_(HRTS3_N_A,		IP3SR1_11_8)
+#define GPSR1_25	F_(HSCK3_A,		IP3SR1_7_4)
+#define GPSR1_24	F_(HRX3_A,		IP3SR1_3_0)
 #define GPSR1_23	F_(GP1_23,		IP2SR1_31_28)
 #define GPSR1_22	F_(AUDIO_CLKIN,		IP2SR1_27_24)
 #define GPSR1_21	F_(AUDIO_CLKOUT,	IP2SR1_23_20)
@@ -113,14 +113,14 @@
 #define GPSR2_11	F_(CANFD0_RX,		IP1SR2_15_12)
 #define GPSR2_10	F_(CANFD0_TX,		IP1SR2_11_8)
 #define GPSR2_9		F_(CAN_CLK,		IP1SR2_7_4)
-#define GPSR2_8		F_(TPU0TO0,		IP1SR2_3_0)
-#define GPSR2_7		F_(TPU0TO1,		IP0SR2_31_28)
+#define GPSR2_8		F_(TPU0TO0_A,		IP1SR2_3_0)
+#define GPSR2_7		F_(TPU0TO1_A,		IP0SR2_31_28)
 #define GPSR2_6		F_(FXR_TXDB,		IP0SR2_27_24)
-#define GPSR2_5		F_(FXR_TXENB_N,		IP0SR2_23_20)
+#define GPSR2_5		F_(FXR_TXENB_N_A,	IP0SR2_23_20)
 #define GPSR2_4		F_(RXDB_EXTFXR,		IP0SR2_19_16)
 #define GPSR2_3		F_(CLK_EXTFXR,		IP0SR2_15_12)
 #define GPSR2_2		F_(RXDA_EXTFXR,		IP0SR2_11_8)
-#define GPSR2_1		F_(FXR_TXENA_N,		IP0SR2_7_4)
+#define GPSR2_1		F_(FXR_TXENA_N_A,	IP0SR2_7_4)
 #define GPSR2_0		F_(FXR_TXDA,		IP0SR2_3_0)
 
 /* GPSR3 */
@@ -269,13 +269,13 @@
 
 /* SR0 */
 /* IP0SR0 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP0SR0_3_0	F_(0, 0)		FM(ERROROUTC_N_B)	FM(TCLK2_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_3_0	F_(0, 0)		FM(ERROROUTC_N_B)	FM(TCLK2_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR0_7_4	F_(0, 0)		FM(MSIOF3_SS1)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR0_11_8	F_(0, 0)		FM(MSIOF3_SS2)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_15_12	FM(IRQ3)		FM(MSIOF3_SCK)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_19_16	FM(IRQ2)		FM(MSIOF3_TXD)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_23_20	FM(IRQ1)		FM(MSIOF3_RXD)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_27_24	FM(IRQ0)		FM(MSIOF3_SYNC)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_15_12	FM(IRQ3_A)		FM(MSIOF3_SCK)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_19_16	FM(IRQ2_A)		FM(MSIOF3_TXD)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_23_20	FM(IRQ1_A)		FM(MSIOF3_RXD)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_27_24	FM(IRQ0_A)		FM(MSIOF3_SYNC)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR0_31_28	FM(MSIOF5_SS2)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP1SR0 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
@@ -284,72 +284,72 @@
 #define IP1SR0_11_8	FM(MSIOF5_TXD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR0_15_12	FM(MSIOF5_SCK)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR0_19_16	FM(MSIOF5_RXD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_23_20	FM(MSIOF2_SS2)		FM(TCLK1)		FM(IRQ2_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_27_24	FM(MSIOF2_SS1)		FM(HTX1)		FM(TX1)			F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_31_28	FM(MSIOF2_SYNC)		FM(HRX1)		FM(RX1)			F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_23_20	FM(MSIOF2_SS2)		FM(TCLK1_A)		FM(IRQ2_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_27_24	FM(MSIOF2_SS1)		FM(HTX1_A)		FM(TX1_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_31_28	FM(MSIOF2_SYNC)		FM(HRX1_A)		FM(RX1_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP2SR0 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP2SR0_3_0	FM(MSIOF2_TXD)		FM(HCTS1_N)		FM(CTS1_N)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR0_7_4	FM(MSIOF2_SCK)		FM(HRTS1_N)		FM(RTS1_N)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR0_11_8	FM(MSIOF2_RXD)		FM(HSCK1)		FM(SCK1)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_3_0	FM(MSIOF2_TXD)		FM(HCTS1_N_A)		FM(CTS1_N_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_7_4	FM(MSIOF2_SCK)		FM(HRTS1_N_A)		FM(RTS1_N_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_11_8	FM(MSIOF2_RXD)		FM(HSCK1_A)		FM(SCK1_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* SR1 */
 /* IP0SR1 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP0SR1_3_0	FM(MSIOF1_SS2)		FM(HTX3_A)		FM(TX3)			F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_7_4	FM(MSIOF1_SS1)		FM(HCTS3_N_A)		FM(RX3)			F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_11_8	FM(MSIOF1_SYNC)		FM(HRTS3_N_A)		FM(RTS3_N)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_15_12	FM(MSIOF1_SCK)		FM(HSCK3_A)		FM(CTS3_N)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_19_16	FM(MSIOF1_TXD)		FM(HRX3_A)		FM(SCK3)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_3_0	FM(MSIOF1_SS2)		FM(HTX3_B)		FM(TX3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_7_4	FM(MSIOF1_SS1)		FM(HCTS3_N_B)		FM(RX3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_11_8	FM(MSIOF1_SYNC)		FM(HRTS3_N_B)		FM(RTS3_N_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_15_12	FM(MSIOF1_SCK)		FM(HSCK3_B)		FM(CTS3_N_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_19_16	FM(MSIOF1_TXD)		FM(HRX3_B)		FM(SCK3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR1_23_20	FM(MSIOF1_RXD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_27_24	FM(MSIOF0_SS2)		FM(HTX1_X)		FM(TX1_X)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_31_28	FM(MSIOF0_SS1)		FM(HRX1_X)		FM(RX1_X)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_27_24	FM(MSIOF0_SS2)		FM(HTX1_B)		FM(TX1_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_31_28	FM(MSIOF0_SS1)		FM(HRX1_B)		FM(RX1_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP1SR1 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP1SR1_3_0	FM(MSIOF0_SYNC)		FM(HCTS1_N_X)		FM(CTS1_N_X)		FM(CANFD5_TX_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_7_4	FM(MSIOF0_TXD)		FM(HRTS1_N_X)		FM(RTS1_N_X)		FM(CANFD5_RX_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_11_8	FM(MSIOF0_SCK)		FM(HSCK1_X)		FM(SCK1_X)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_3_0	FM(MSIOF0_SYNC)		FM(HCTS1_N_B)		FM(CTS1_N_B)		FM(CANFD5_TX_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_7_4	FM(MSIOF0_TXD)		FM(HRTS1_N_B)		FM(RTS1_N_B)		FM(CANFD5_RX_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_11_8	FM(MSIOF0_SCK)		FM(HSCK1_B)		FM(SCK1_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR1_15_12	FM(MSIOF0_RXD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR1_19_16	FM(HTX0)		FM(TX0)			F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_23_20	FM(HCTS0_N)		FM(CTS0_N)		FM(PWM8_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_27_24	FM(HRTS0_N)		FM(RTS0_N)		FM(PWM9_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_31_28	FM(HSCK0)		FM(SCK0)		FM(PWM0_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_23_20	FM(HCTS0_N)		FM(CTS0_N)		FM(PWM8)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_27_24	FM(HRTS0_N)		FM(RTS0_N)		FM(PWM9)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_31_28	FM(HSCK0)		FM(SCK0)		FM(PWM0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP2SR1 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
 #define IP2SR1_3_0	FM(HRX0)		FM(RX0)			F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP2SR1_7_4	FM(SCIF_CLK)		FM(IRQ4_A)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_11_8	FM(SSI_SCK)		FM(TCLK3)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_15_12	FM(SSI_WS)		FM(TCLK4)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_19_16	FM(SSI_SD)		FM(IRQ0_A)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_23_20	FM(AUDIO_CLKOUT)	FM(IRQ1_A)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_11_8	FM(SSI_SCK)		FM(TCLK3_B)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_15_12	FM(SSI_WS)		FM(TCLK4_B)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_19_16	FM(SSI_SD)		FM(IRQ0_B)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_23_20	FM(AUDIO_CLKOUT)	FM(IRQ1_B)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP2SR1_27_24	FM(AUDIO_CLKIN)		FM(PWM3_A)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_31_28	F_(0, 0)		FM(TCLK2)		FM(MSIOF4_SS1)		FM(IRQ3_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_31_28	F_(0, 0)		FM(TCLK2_A)		FM(MSIOF4_SS1)		FM(IRQ3_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP3SR1 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP3SR1_3_0	FM(HRX3)		FM(SCK3_A)		FM(MSIOF4_SS2)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_7_4	FM(HSCK3)		FM(CTS3_N_A)		FM(MSIOF4_SCK)		FM(TPU0TO0_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_11_8	FM(HRTS3_N)		FM(RTS3_N_A)		FM(MSIOF4_TXD)		FM(TPU0TO1_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_15_12	FM(HCTS3_N)		FM(RX3_A)		FM(MSIOF4_RXD)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_19_16	FM(HTX3)		FM(TX3_A)		FM(MSIOF4_SYNC)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_3_0	FM(HRX3_A)		FM(SCK3_A)		FM(MSIOF4_SS2)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_7_4	FM(HSCK3_A)		FM(CTS3_N_A)		FM(MSIOF4_SCK)		FM(TPU0TO0_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_11_8	FM(HRTS3_N_A)		FM(RTS3_N_A)		FM(MSIOF4_TXD)		FM(TPU0TO1_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_15_12	FM(HCTS3_N_A)		FM(RX3_A)		FM(MSIOF4_RXD)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_19_16	FM(HTX3_A)		FM(TX3_A)		FM(MSIOF4_SYNC)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* SR2 */
 /* IP0SR2 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP0SR2_3_0	FM(FXR_TXDA)		FM(CANFD1_TX)		FM(TPU0TO2_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_7_4	FM(FXR_TXENA_N)		FM(CANFD1_RX)		FM(TPU0TO3_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_11_8	FM(RXDA_EXTFXR)		FM(CANFD5_TX)		FM(IRQ5)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_15_12	FM(CLK_EXTFXR)		FM(CANFD5_RX)		FM(IRQ4_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_3_0	FM(FXR_TXDA)		FM(CANFD1_TX)		FM(TPU0TO2_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_7_4	FM(FXR_TXENA_N_A)	FM(CANFD1_RX)		FM(TPU0TO3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_11_8	FM(RXDA_EXTFXR)		FM(CANFD5_TX_A)		FM(IRQ5)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_15_12	FM(CLK_EXTFXR)		FM(CANFD5_RX_A)		FM(IRQ4_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR2_19_16	FM(RXDB_EXTFXR)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_23_20	FM(FXR_TXENB_N)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_23_20	FM(FXR_TXENB_N_A)	F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR2_27_24	FM(FXR_TXDB)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_31_28	FM(TPU0TO1)		FM(CANFD6_TX)		F_(0, 0)		FM(TCLK2_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_31_28	FM(TPU0TO1_A)		FM(CANFD6_TX)		F_(0, 0)		FM(TCLK2_C)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP1SR2 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP1SR2_3_0	FM(TPU0TO0)		FM(CANFD6_RX)		F_(0, 0)		FM(TCLK1_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_7_4	FM(CAN_CLK)		FM(FXR_TXENA_N_X)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_11_8	FM(CANFD0_TX)		FM(FXR_TXENB_N_X)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_3_0	FM(TPU0TO0_A)		FM(CANFD6_RX)		F_(0, 0)		FM(TCLK1_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_7_4	FM(CAN_CLK)		FM(FXR_TXENA_N_B)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_11_8	FM(CANFD0_TX)		FM(FXR_TXENB_N_B)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR2_15_12	FM(CANFD0_RX)		FM(STPWT_EXTFXR)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_19_16	FM(CANFD2_TX)		FM(TPU0TO2)		F_(0, 0)		FM(TCLK3_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_23_20	FM(CANFD2_RX)		FM(TPU0TO3)		FM(PWM1_B)		FM(TCLK4_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_27_24	FM(CANFD3_TX)		F_(0, 0)		FM(PWM2_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_19_16	FM(CANFD2_TX)		FM(TPU0TO2_A)		F_(0, 0)		FM(TCLK3_C)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_23_20	FM(CANFD2_RX)		FM(TPU0TO3_A)		FM(PWM1_B)		FM(TCLK4_C)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_27_24	FM(CANFD3_TX)		F_(0, 0)		FM(PWM2)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR2_31_28	FM(CANFD3_RX)		F_(0, 0)		FM(PWM3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP2SR2 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
@@ -375,8 +375,8 @@
 #define IP1SR3_11_8	FM(MMC_SD_CMD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR3_15_12	FM(SD_CD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR3_19_16	FM(SD_WP)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR3_23_20	FM(IPC_CLKIN)		FM(IPC_CLKEN_IN)	FM(PWM1_A)		FM(TCLK3_X)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR3_27_24	FM(IPC_CLKOUT)		FM(IPC_CLKEN_OUT)	FM(ERROROUTC_N_A)	FM(TCLK4_X)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR3_23_20	FM(IPC_CLKIN)		FM(IPC_CLKEN_IN)	FM(PWM1_A)		FM(TCLK3_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR3_27_24	FM(IPC_CLKOUT)		FM(IPC_CLKEN_OUT)	FM(ERROROUTC_N_A)	FM(TCLK4_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR3_31_28	FM(QSPI0_SSL)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP2SR3 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
@@ -712,22 +712,22 @@ static const u16 pinmux_data[] = {
 
 	/* IP0SR0 */
 	PINMUX_IPSR_GPSR(IP0SR0_3_0,	ERROROUTC_N_B),
-	PINMUX_IPSR_GPSR(IP0SR0_3_0,	TCLK2_A),
+	PINMUX_IPSR_GPSR(IP0SR0_3_0,	TCLK2_B),
 
 	PINMUX_IPSR_GPSR(IP0SR0_7_4,	MSIOF3_SS1),
 
 	PINMUX_IPSR_GPSR(IP0SR0_11_8,	MSIOF3_SS2),
 
-	PINMUX_IPSR_GPSR(IP0SR0_15_12,	IRQ3),
+	PINMUX_IPSR_GPSR(IP0SR0_15_12,	IRQ3_A),
 	PINMUX_IPSR_GPSR(IP0SR0_15_12,	MSIOF3_SCK),
 
-	PINMUX_IPSR_GPSR(IP0SR0_19_16,	IRQ2),
+	PINMUX_IPSR_GPSR(IP0SR0_19_16,	IRQ2_A),
 	PINMUX_IPSR_GPSR(IP0SR0_19_16,	MSIOF3_TXD),
 
-	PINMUX_IPSR_GPSR(IP0SR0_23_20,	IRQ1),
+	PINMUX_IPSR_GPSR(IP0SR0_23_20,	IRQ1_A),
 	PINMUX_IPSR_GPSR(IP0SR0_23_20,	MSIOF3_RXD),
 
-	PINMUX_IPSR_GPSR(IP0SR0_27_24,	IRQ0),
+	PINMUX_IPSR_GPSR(IP0SR0_27_24,	IRQ0_A),
 	PINMUX_IPSR_GPSR(IP0SR0_27_24,	MSIOF3_SYNC),
 
 	PINMUX_IPSR_GPSR(IP0SR0_31_28,	MSIOF5_SS2),
@@ -744,75 +744,75 @@ static const u16 pinmux_data[] = {
 	PINMUX_IPSR_GPSR(IP1SR0_19_16,	MSIOF5_RXD),
 
 	PINMUX_IPSR_GPSR(IP1SR0_23_20,	MSIOF2_SS2),
-	PINMUX_IPSR_GPSR(IP1SR0_23_20,	TCLK1),
-	PINMUX_IPSR_GPSR(IP1SR0_23_20,	IRQ2_A),
+	PINMUX_IPSR_GPSR(IP1SR0_23_20,	TCLK1_A),
+	PINMUX_IPSR_GPSR(IP1SR0_23_20,	IRQ2_B),
 
 	PINMUX_IPSR_GPSR(IP1SR0_27_24,	MSIOF2_SS1),
-	PINMUX_IPSR_GPSR(IP1SR0_27_24,	HTX1),
-	PINMUX_IPSR_GPSR(IP1SR0_27_24,	TX1),
+	PINMUX_IPSR_GPSR(IP1SR0_27_24,	HTX1_A),
+	PINMUX_IPSR_GPSR(IP1SR0_27_24,	TX1_A),
 
 	PINMUX_IPSR_GPSR(IP1SR0_31_28,	MSIOF2_SYNC),
-	PINMUX_IPSR_GPSR(IP1SR0_31_28,	HRX1),
-	PINMUX_IPSR_GPSR(IP1SR0_31_28,	RX1),
+	PINMUX_IPSR_GPSR(IP1SR0_31_28,	HRX1_A),
+	PINMUX_IPSR_GPSR(IP1SR0_31_28,	RX1_A),
 
 	/* IP2SR0 */
 	PINMUX_IPSR_GPSR(IP2SR0_3_0,	MSIOF2_TXD),
-	PINMUX_IPSR_GPSR(IP2SR0_3_0,	HCTS1_N),
-	PINMUX_IPSR_GPSR(IP2SR0_3_0,	CTS1_N),
+	PINMUX_IPSR_GPSR(IP2SR0_3_0,	HCTS1_N_A),
+	PINMUX_IPSR_GPSR(IP2SR0_3_0,	CTS1_N_A),
 
 	PINMUX_IPSR_GPSR(IP2SR0_7_4,	MSIOF2_SCK),
-	PINMUX_IPSR_GPSR(IP2SR0_7_4,	HRTS1_N),
-	PINMUX_IPSR_GPSR(IP2SR0_7_4,	RTS1_N),
+	PINMUX_IPSR_GPSR(IP2SR0_7_4,	HRTS1_N_A),
+	PINMUX_IPSR_GPSR(IP2SR0_7_4,	RTS1_N_A),
 
 	PINMUX_IPSR_GPSR(IP2SR0_11_8,	MSIOF2_RXD),
-	PINMUX_IPSR_GPSR(IP2SR0_11_8,	HSCK1),
-	PINMUX_IPSR_GPSR(IP2SR0_11_8,	SCK1),
+	PINMUX_IPSR_GPSR(IP2SR0_11_8,	HSCK1_A),
+	PINMUX_IPSR_GPSR(IP2SR0_11_8,	SCK1_A),
 
 	/* IP0SR1 */
 	PINMUX_IPSR_GPSR(IP0SR1_3_0,	MSIOF1_SS2),
-	PINMUX_IPSR_GPSR(IP0SR1_3_0,	HTX3_A),
-	PINMUX_IPSR_GPSR(IP0SR1_3_0,	TX3),
+	PINMUX_IPSR_GPSR(IP0SR1_3_0,	HTX3_B),
+	PINMUX_IPSR_GPSR(IP0SR1_3_0,	TX3_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_7_4,	MSIOF1_SS1),
-	PINMUX_IPSR_GPSR(IP0SR1_7_4,	HCTS3_N_A),
-	PINMUX_IPSR_GPSR(IP0SR1_7_4,	RX3),
+	PINMUX_IPSR_GPSR(IP0SR1_7_4,	HCTS3_N_B),
+	PINMUX_IPSR_GPSR(IP0SR1_7_4,	RX3_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_11_8,	MSIOF1_SYNC),
-	PINMUX_IPSR_GPSR(IP0SR1_11_8,	HRTS3_N_A),
-	PINMUX_IPSR_GPSR(IP0SR1_11_8,	RTS3_N),
+	PINMUX_IPSR_GPSR(IP0SR1_11_8,	HRTS3_N_B),
+	PINMUX_IPSR_GPSR(IP0SR1_11_8,	RTS3_N_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_15_12,	MSIOF1_SCK),
-	PINMUX_IPSR_GPSR(IP0SR1_15_12,	HSCK3_A),
-	PINMUX_IPSR_GPSR(IP0SR1_15_12,	CTS3_N),
+	PINMUX_IPSR_GPSR(IP0SR1_15_12,	HSCK3_B),
+	PINMUX_IPSR_GPSR(IP0SR1_15_12,	CTS3_N_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_19_16,	MSIOF1_TXD),
-	PINMUX_IPSR_GPSR(IP0SR1_19_16,	HRX3_A),
-	PINMUX_IPSR_GPSR(IP0SR1_19_16,	SCK3),
+	PINMUX_IPSR_GPSR(IP0SR1_19_16,	HRX3_B),
+	PINMUX_IPSR_GPSR(IP0SR1_19_16,	SCK3_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_23_20,	MSIOF1_RXD),
 
 	PINMUX_IPSR_GPSR(IP0SR1_27_24,	MSIOF0_SS2),
-	PINMUX_IPSR_GPSR(IP0SR1_27_24,	HTX1_X),
-	PINMUX_IPSR_GPSR(IP0SR1_27_24,	TX1_X),
+	PINMUX_IPSR_GPSR(IP0SR1_27_24,	HTX1_B),
+	PINMUX_IPSR_GPSR(IP0SR1_27_24,	TX1_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_31_28,	MSIOF0_SS1),
-	PINMUX_IPSR_GPSR(IP0SR1_31_28,	HRX1_X),
-	PINMUX_IPSR_GPSR(IP0SR1_31_28,	RX1_X),
+	PINMUX_IPSR_GPSR(IP0SR1_31_28,	HRX1_B),
+	PINMUX_IPSR_GPSR(IP0SR1_31_28,	RX1_B),
 
 	/* IP1SR1 */
 	PINMUX_IPSR_GPSR(IP1SR1_3_0,	MSIOF0_SYNC),
-	PINMUX_IPSR_GPSR(IP1SR1_3_0,	HCTS1_N_X),
-	PINMUX_IPSR_GPSR(IP1SR1_3_0,	CTS1_N_X),
+	PINMUX_IPSR_GPSR(IP1SR1_3_0,	HCTS1_N_B),
+	PINMUX_IPSR_GPSR(IP1SR1_3_0,	CTS1_N_B),
 	PINMUX_IPSR_GPSR(IP1SR1_3_0,	CANFD5_TX_B),
 
 	PINMUX_IPSR_GPSR(IP1SR1_7_4,	MSIOF0_TXD),
-	PINMUX_IPSR_GPSR(IP1SR1_7_4,	HRTS1_N_X),
-	PINMUX_IPSR_GPSR(IP1SR1_7_4,	RTS1_N_X),
+	PINMUX_IPSR_GPSR(IP1SR1_7_4,	HRTS1_N_B),
+	PINMUX_IPSR_GPSR(IP1SR1_7_4,	RTS1_N_B),
 	PINMUX_IPSR_GPSR(IP1SR1_7_4,	CANFD5_RX_B),
 
 	PINMUX_IPSR_GPSR(IP1SR1_11_8,	MSIOF0_SCK),
-	PINMUX_IPSR_GPSR(IP1SR1_11_8,	HSCK1_X),
-	PINMUX_IPSR_GPSR(IP1SR1_11_8,	SCK1_X),
+	PINMUX_IPSR_GPSR(IP1SR1_11_8,	HSCK1_B),
+	PINMUX_IPSR_GPSR(IP1SR1_11_8,	SCK1_B),
 
 	PINMUX_IPSR_GPSR(IP1SR1_15_12,	MSIOF0_RXD),
 
@@ -821,15 +821,15 @@ static const u16 pinmux_data[] = {
 
 	PINMUX_IPSR_GPSR(IP1SR1_23_20,	HCTS0_N),
 	PINMUX_IPSR_GPSR(IP1SR1_23_20,	CTS0_N),
-	PINMUX_IPSR_GPSR(IP1SR1_23_20,	PWM8_A),
+	PINMUX_IPSR_GPSR(IP1SR1_23_20,	PWM8),
 
 	PINMUX_IPSR_GPSR(IP1SR1_27_24,	HRTS0_N),
 	PINMUX_IPSR_GPSR(IP1SR1_27_24,	RTS0_N),
-	PINMUX_IPSR_GPSR(IP1SR1_27_24,	PWM9_A),
+	PINMUX_IPSR_GPSR(IP1SR1_27_24,	PWM9),
 
 	PINMUX_IPSR_GPSR(IP1SR1_31_28,	HSCK0),
 	PINMUX_IPSR_GPSR(IP1SR1_31_28,	SCK0),
-	PINMUX_IPSR_GPSR(IP1SR1_31_28,	PWM0_A),
+	PINMUX_IPSR_GPSR(IP1SR1_31_28,	PWM0),
 
 	/* IP2SR1 */
 	PINMUX_IPSR_GPSR(IP2SR1_3_0,	HRX0),
@@ -839,99 +839,99 @@ static const u16 pinmux_data[] = {
 	PINMUX_IPSR_GPSR(IP2SR1_7_4,	IRQ4_A),
 
 	PINMUX_IPSR_GPSR(IP2SR1_11_8,	SSI_SCK),
-	PINMUX_IPSR_GPSR(IP2SR1_11_8,	TCLK3),
+	PINMUX_IPSR_GPSR(IP2SR1_11_8,	TCLK3_B),
 
 	PINMUX_IPSR_GPSR(IP2SR1_15_12,	SSI_WS),
-	PINMUX_IPSR_GPSR(IP2SR1_15_12,	TCLK4),
+	PINMUX_IPSR_GPSR(IP2SR1_15_12,	TCLK4_B),
 
 	PINMUX_IPSR_GPSR(IP2SR1_19_16,	SSI_SD),
-	PINMUX_IPSR_GPSR(IP2SR1_19_16,	IRQ0_A),
+	PINMUX_IPSR_GPSR(IP2SR1_19_16,	IRQ0_B),
 
 	PINMUX_IPSR_GPSR(IP2SR1_23_20,	AUDIO_CLKOUT),
-	PINMUX_IPSR_GPSR(IP2SR1_23_20,	IRQ1_A),
+	PINMUX_IPSR_GPSR(IP2SR1_23_20,	IRQ1_B),
 
 	PINMUX_IPSR_GPSR(IP2SR1_27_24,	AUDIO_CLKIN),
 	PINMUX_IPSR_GPSR(IP2SR1_27_24,	PWM3_A),
 
-	PINMUX_IPSR_GPSR(IP2SR1_31_28,	TCLK2),
+	PINMUX_IPSR_GPSR(IP2SR1_31_28,	TCLK2_A),
 	PINMUX_IPSR_GPSR(IP2SR1_31_28,	MSIOF4_SS1),
 	PINMUX_IPSR_GPSR(IP2SR1_31_28,	IRQ3_B),
 
 	/* IP3SR1 */
-	PINMUX_IPSR_GPSR(IP3SR1_3_0,	HRX3),
+	PINMUX_IPSR_GPSR(IP3SR1_3_0,	HRX3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_3_0,	SCK3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_3_0,	MSIOF4_SS2),
 
-	PINMUX_IPSR_GPSR(IP3SR1_7_4,	HSCK3),
+	PINMUX_IPSR_GPSR(IP3SR1_7_4,	HSCK3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_7_4,	CTS3_N_A),
 	PINMUX_IPSR_GPSR(IP3SR1_7_4,	MSIOF4_SCK),
-	PINMUX_IPSR_GPSR(IP3SR1_7_4,	TPU0TO0_A),
+	PINMUX_IPSR_GPSR(IP3SR1_7_4,	TPU0TO0_B),
 
-	PINMUX_IPSR_GPSR(IP3SR1_11_8,	HRTS3_N),
+	PINMUX_IPSR_GPSR(IP3SR1_11_8,	HRTS3_N_A),
 	PINMUX_IPSR_GPSR(IP3SR1_11_8,	RTS3_N_A),
 	PINMUX_IPSR_GPSR(IP3SR1_11_8,	MSIOF4_TXD),
-	PINMUX_IPSR_GPSR(IP3SR1_11_8,	TPU0TO1_A),
+	PINMUX_IPSR_GPSR(IP3SR1_11_8,	TPU0TO1_B),
 
-	PINMUX_IPSR_GPSR(IP3SR1_15_12,	HCTS3_N),
+	PINMUX_IPSR_GPSR(IP3SR1_15_12,	HCTS3_N_A),
 	PINMUX_IPSR_GPSR(IP3SR1_15_12,	RX3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_15_12,	MSIOF4_RXD),
 
-	PINMUX_IPSR_GPSR(IP3SR1_19_16,	HTX3),
+	PINMUX_IPSR_GPSR(IP3SR1_19_16,	HTX3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_19_16,	TX3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_19_16,	MSIOF4_SYNC),
 
 	/* IP0SR2 */
 	PINMUX_IPSR_GPSR(IP0SR2_3_0,	FXR_TXDA),
 	PINMUX_IPSR_GPSR(IP0SR2_3_0,	CANFD1_TX),
-	PINMUX_IPSR_GPSR(IP0SR2_3_0,	TPU0TO2_A),
+	PINMUX_IPSR_GPSR(IP0SR2_3_0,	TPU0TO2_B),
 
-	PINMUX_IPSR_GPSR(IP0SR2_7_4,	FXR_TXENA_N),
+	PINMUX_IPSR_GPSR(IP0SR2_7_4,	FXR_TXENA_N_A),
 	PINMUX_IPSR_GPSR(IP0SR2_7_4,	CANFD1_RX),
-	PINMUX_IPSR_GPSR(IP0SR2_7_4,	TPU0TO3_A),
+	PINMUX_IPSR_GPSR(IP0SR2_7_4,	TPU0TO3_B),
 
 	PINMUX_IPSR_GPSR(IP0SR2_11_8,	RXDA_EXTFXR),
-	PINMUX_IPSR_GPSR(IP0SR2_11_8,	CANFD5_TX),
+	PINMUX_IPSR_GPSR(IP0SR2_11_8,	CANFD5_TX_A),
 	PINMUX_IPSR_GPSR(IP0SR2_11_8,	IRQ5),
 
 	PINMUX_IPSR_GPSR(IP0SR2_15_12,	CLK_EXTFXR),
-	PINMUX_IPSR_GPSR(IP0SR2_15_12,	CANFD5_RX),
+	PINMUX_IPSR_GPSR(IP0SR2_15_12,	CANFD5_RX_A),
 	PINMUX_IPSR_GPSR(IP0SR2_15_12,	IRQ4_B),
 
 	PINMUX_IPSR_GPSR(IP0SR2_19_16,	RXDB_EXTFXR),
 
-	PINMUX_IPSR_GPSR(IP0SR2_23_20,	FXR_TXENB_N),
+	PINMUX_IPSR_GPSR(IP0SR2_23_20,	FXR_TXENB_N_A),
 
 	PINMUX_IPSR_GPSR(IP0SR2_27_24,	FXR_TXDB),
 
-	PINMUX_IPSR_GPSR(IP0SR2_31_28,	TPU0TO1),
+	PINMUX_IPSR_GPSR(IP0SR2_31_28,	TPU0TO1_A),
 	PINMUX_IPSR_GPSR(IP0SR2_31_28,	CANFD6_TX),
-	PINMUX_IPSR_GPSR(IP0SR2_31_28,	TCLK2_B),
+	PINMUX_IPSR_GPSR(IP0SR2_31_28,	TCLK2_C),
 
 	/* IP1SR2 */
-	PINMUX_IPSR_GPSR(IP1SR2_3_0,	TPU0TO0),
+	PINMUX_IPSR_GPSR(IP1SR2_3_0,	TPU0TO0_A),
 	PINMUX_IPSR_GPSR(IP1SR2_3_0,	CANFD6_RX),
-	PINMUX_IPSR_GPSR(IP1SR2_3_0,	TCLK1_A),
+	PINMUX_IPSR_GPSR(IP1SR2_3_0,	TCLK1_B),
 
 	PINMUX_IPSR_GPSR(IP1SR2_7_4,	CAN_CLK),
-	PINMUX_IPSR_GPSR(IP1SR2_7_4,	FXR_TXENA_N_X),
+	PINMUX_IPSR_GPSR(IP1SR2_7_4,	FXR_TXENA_N_B),
 
 	PINMUX_IPSR_GPSR(IP1SR2_11_8,	CANFD0_TX),
-	PINMUX_IPSR_GPSR(IP1SR2_11_8,	FXR_TXENB_N_X),
+	PINMUX_IPSR_GPSR(IP1SR2_11_8,	FXR_TXENB_N_B),
 
 	PINMUX_IPSR_GPSR(IP1SR2_15_12,	CANFD0_RX),
 	PINMUX_IPSR_GPSR(IP1SR2_15_12,	STPWT_EXTFXR),
 
 	PINMUX_IPSR_GPSR(IP1SR2_19_16,	CANFD2_TX),
-	PINMUX_IPSR_GPSR(IP1SR2_19_16,	TPU0TO2),
-	PINMUX_IPSR_GPSR(IP1SR2_19_16,	TCLK3_A),
+	PINMUX_IPSR_GPSR(IP1SR2_19_16,	TPU0TO2_A),
+	PINMUX_IPSR_GPSR(IP1SR2_19_16,	TCLK3_C),
 
 	PINMUX_IPSR_GPSR(IP1SR2_23_20,	CANFD2_RX),
-	PINMUX_IPSR_GPSR(IP1SR2_23_20,	TPU0TO3),
+	PINMUX_IPSR_GPSR(IP1SR2_23_20,	TPU0TO3_A),
 	PINMUX_IPSR_GPSR(IP1SR2_23_20,	PWM1_B),
-	PINMUX_IPSR_GPSR(IP1SR2_23_20,	TCLK4_A),
+	PINMUX_IPSR_GPSR(IP1SR2_23_20,	TCLK4_C),
 
 	PINMUX_IPSR_GPSR(IP1SR2_27_24,	CANFD3_TX),
-	PINMUX_IPSR_GPSR(IP1SR2_27_24,	PWM2_B),
+	PINMUX_IPSR_GPSR(IP1SR2_27_24,	PWM2),
 
 	PINMUX_IPSR_GPSR(IP1SR2_31_28,	CANFD3_RX),
 	PINMUX_IPSR_GPSR(IP1SR2_31_28,	PWM3_B),
@@ -973,12 +973,12 @@ static const u16 pinmux_data[] = {
 	PINMUX_IPSR_GPSR(IP1SR3_23_20,	IPC_CLKIN),
 	PINMUX_IPSR_GPSR(IP1SR3_23_20,	IPC_CLKEN_IN),
 	PINMUX_IPSR_GPSR(IP1SR3_23_20,	PWM1_A),
-	PINMUX_IPSR_GPSR(IP1SR3_23_20,	TCLK3_X),
+	PINMUX_IPSR_GPSR(IP1SR3_23_20,	TCLK3_A),
 
 	PINMUX_IPSR_GPSR(IP1SR3_27_24,	IPC_CLKOUT),
 	PINMUX_IPSR_GPSR(IP1SR3_27_24,	IPC_CLKEN_OUT),
 	PINMUX_IPSR_GPSR(IP1SR3_27_24,	ERROROUTC_N_A),
-	PINMUX_IPSR_GPSR(IP1SR3_27_24,	TCLK4_X),
+	PINMUX_IPSR_GPSR(IP1SR3_27_24,	TCLK4_A),
 
 	PINMUX_IPSR_GPSR(IP1SR3_31_28,	QSPI0_SSL),
 
@@ -1507,15 +1507,14 @@ static const unsigned int canfd4_data_mux[] = {
 };
 
 /* - CANFD5 ----------------------------------------------------------------- */
-static const unsigned int canfd5_data_pins[] = {
-	/* CANFD5_TX, CANFD5_RX */
+static const unsigned int canfd5_data_a_pins[] = {
+	/* CANFD5_TX_A, CANFD5_RX_A */
 	RCAR_GP_PIN(2, 2), RCAR_GP_PIN(2, 3),
 };
-static const unsigned int canfd5_data_mux[] = {
-	CANFD5_TX_MARK, CANFD5_RX_MARK,
+static const unsigned int canfd5_data_a_mux[] = {
+	CANFD5_TX_A_MARK, CANFD5_RX_A_MARK,
 };
 
-/* - CANFD5_B ----------------------------------------------------------------- */
 static const unsigned int canfd5_data_b_pins[] = {
 	/* CANFD5_TX_B, CANFD5_RX_B */
 	RCAR_GP_PIN(1, 8), RCAR_GP_PIN(1, 9),
@@ -1575,49 +1574,48 @@ static const unsigned int hscif0_ctrl_mux[] = {
 };
 
 /* - HSCIF1 ----------------------------------------------------------------- */
-static const unsigned int hscif1_data_pins[] = {
-	/* HRX1, HTX1 */
+static const unsigned int hscif1_data_a_pins[] = {
+	/* HRX1_A, HTX1_A */
 	RCAR_GP_PIN(0, 15), RCAR_GP_PIN(0, 14),
 };
-static const unsigned int hscif1_data_mux[] = {
-	HRX1_MARK, HTX1_MARK,
+static const unsigned int hscif1_data_a_mux[] = {
+	HRX1_A_MARK, HTX1_A_MARK,
 };
-static const unsigned int hscif1_clk_pins[] = {
-	/* HSCK1 */
+static const unsigned int hscif1_clk_a_pins[] = {
+	/* HSCK1_A */
 	RCAR_GP_PIN(0, 18),
 };
-static const unsigned int hscif1_clk_mux[] = {
-	HSCK1_MARK,
+static const unsigned int hscif1_clk_a_mux[] = {
+	HSCK1_A_MARK,
 };
-static const unsigned int hscif1_ctrl_pins[] = {
-	/* HRTS1_N, HCTS1_N */
+static const unsigned int hscif1_ctrl_a_pins[] = {
+	/* HRTS1_N_A, HCTS1_N_A */
 	RCAR_GP_PIN(0, 17), RCAR_GP_PIN(0, 16),
 };
-static const unsigned int hscif1_ctrl_mux[] = {
-	HRTS1_N_MARK, HCTS1_N_MARK,
+static const unsigned int hscif1_ctrl_a_mux[] = {
+	HRTS1_N_A_MARK, HCTS1_N_A_MARK,
 };
 
-/* - HSCIF1_X---------------------------------------------------------------- */
-static const unsigned int hscif1_data_x_pins[] = {
-	/* HRX1_X, HTX1_X */
+static const unsigned int hscif1_data_b_pins[] = {
+	/* HRX1_B, HTX1_B */
 	RCAR_GP_PIN(1, 7), RCAR_GP_PIN(1, 6),
 };
-static const unsigned int hscif1_data_x_mux[] = {
-	HRX1_X_MARK, HTX1_X_MARK,
+static const unsigned int hscif1_data_b_mux[] = {
+	HRX1_B_MARK, HTX1_B_MARK,
 };
-static const unsigned int hscif1_clk_x_pins[] = {
-	/* HSCK1_X */
+static const unsigned int hscif1_clk_b_pins[] = {
+	/* HSCK1_B */
 	RCAR_GP_PIN(1, 10),
 };
-static const unsigned int hscif1_clk_x_mux[] = {
-	HSCK1_X_MARK,
+static const unsigned int hscif1_clk_b_mux[] = {
+	HSCK1_B_MARK,
 };
-static const unsigned int hscif1_ctrl_x_pins[] = {
-	/* HRTS1_N_X, HCTS1_N_X */
+static const unsigned int hscif1_ctrl_b_pins[] = {
+	/* HRTS1_N_B, HCTS1_N_B */
 	RCAR_GP_PIN(1, 9), RCAR_GP_PIN(1, 8),
 };
-static const unsigned int hscif1_ctrl_x_mux[] = {
-	HRTS1_N_X_MARK, HCTS1_N_X_MARK,
+static const unsigned int hscif1_ctrl_b_mux[] = {
+	HRTS1_N_B_MARK, HCTS1_N_B_MARK,
 };
 
 /* - HSCIF2 ----------------------------------------------------------------- */
@@ -1644,49 +1642,48 @@ static const unsigned int hscif2_ctrl_mux[] = {
 };
 
 /* - HSCIF3 ----------------------------------------------------------------- */
-static const unsigned int hscif3_data_pins[] = {
-	/* HRX3, HTX3 */
+static const unsigned int hscif3_data_a_pins[] = {
+	/* HRX3_A, HTX3_A */
 	RCAR_GP_PIN(1, 24), RCAR_GP_PIN(1, 28),
 };
-static const unsigned int hscif3_data_mux[] = {
-	HRX3_MARK, HTX3_MARK,
+static const unsigned int hscif3_data_a_mux[] = {
+	HRX3_A_MARK, HTX3_A_MARK,
 };
-static const unsigned int hscif3_clk_pins[] = {
-	/* HSCK3 */
+static const unsigned int hscif3_clk_a_pins[] = {
+	/* HSCK3_A */
 	RCAR_GP_PIN(1, 25),
 };
-static const unsigned int hscif3_clk_mux[] = {
-	HSCK3_MARK,
+static const unsigned int hscif3_clk_a_mux[] = {
+	HSCK3_A_MARK,
 };
-static const unsigned int hscif3_ctrl_pins[] = {
-	/* HRTS3_N, HCTS3_N */
+static const unsigned int hscif3_ctrl_a_pins[] = {
+	/* HRTS3_N_A, HCTS3_N_A */
 	RCAR_GP_PIN(1, 26), RCAR_GP_PIN(1, 27),
 };
-static const unsigned int hscif3_ctrl_mux[] = {
-	HRTS3_N_MARK, HCTS3_N_MARK,
+static const unsigned int hscif3_ctrl_a_mux[] = {
+	HRTS3_N_A_MARK, HCTS3_N_A_MARK,
 };
 
-/* - HSCIF3_A ----------------------------------------------------------------- */
-static const unsigned int hscif3_data_a_pins[] = {
-	/* HRX3_A, HTX3_A */
+static const unsigned int hscif3_data_b_pins[] = {
+	/* HRX3_B, HTX3_B */
 	RCAR_GP_PIN(1, 4), RCAR_GP_PIN(1, 0),
 };
-static const unsigned int hscif3_data_a_mux[] = {
-	HRX3_A_MARK, HTX3_A_MARK,
+static const unsigned int hscif3_data_b_mux[] = {
+	HRX3_B_MARK, HTX3_B_MARK,
 };
-static const unsigned int hscif3_clk_a_pins[] = {
-	/* HSCK3_A */
+static const unsigned int hscif3_clk_b_pins[] = {
+	/* HSCK3_B */
 	RCAR_GP_PIN(1, 3),
 };
-static const unsigned int hscif3_clk_a_mux[] = {
-	HSCK3_A_MARK,
+static const unsigned int hscif3_clk_b_mux[] = {
+	HSCK3_B_MARK,
 };
-static const unsigned int hscif3_ctrl_a_pins[] = {
-	/* HRTS3_N_A, HCTS3_N_A */
+static const unsigned int hscif3_ctrl_b_pins[] = {
+	/* HRTS3_N_B, HCTS3_N_B */
 	RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 1),
 };
-static const unsigned int hscif3_ctrl_a_mux[] = {
-	HRTS3_N_A_MARK, HCTS3_N_A_MARK,
+static const unsigned int hscif3_ctrl_b_mux[] = {
+	HRTS3_N_B_MARK, HCTS3_N_B_MARK,
 };
 
 /* - I2C0 ------------------------------------------------------------------- */
@@ -2069,13 +2066,13 @@ static const unsigned int pcie1_clkreq_n_mux[] = {
 	PCIE1_CLKREQ_N_MARK,
 };
 
-/* - PWM0_A ------------------------------------------------------------------- */
-static const unsigned int pwm0_a_pins[] = {
-	/* PWM0_A */
+/* - PWM0 ------------------------------------------------------------------- */
+static const unsigned int pwm0_pins[] = {
+	/* PWM0 */
 	RCAR_GP_PIN(1, 15),
 };
-static const unsigned int pwm0_a_mux[] = {
-	PWM0_A_MARK,
+static const unsigned int pwm0_mux[] = {
+	PWM0_MARK,
 };
 
 /* - PWM1_A ------------------------------------------------------------------- */
@@ -2096,13 +2093,13 @@ static const unsigned int pwm1_b_mux[] = {
 	PWM1_B_MARK,
 };
 
-/* - PWM2_B ------------------------------------------------------------------- */
-static const unsigned int pwm2_b_pins[] = {
-	/* PWM2_B */
+/* - PWM2 ------------------------------------------------------------------- */
+static const unsigned int pwm2_pins[] = {
+	/* PWM2 */
 	RCAR_GP_PIN(2, 14),
 };
-static const unsigned int pwm2_b_mux[] = {
-	PWM2_B_MARK,
+static const unsigned int pwm2_mux[] = {
+	PWM2_MARK,
 };
 
 /* - PWM3_A ------------------------------------------------------------------- */
@@ -2159,22 +2156,22 @@ static const unsigned int pwm7_mux[] = {
 	PWM7_MARK,
 };
 
-/* - PWM8_A ------------------------------------------------------------------- */
-static const unsigned int pwm8_a_pins[] = {
-	/* PWM8_A */
+/* - PWM8 ------------------------------------------------------------------- */
+static const unsigned int pwm8_pins[] = {
+	/* PWM8 */
 	RCAR_GP_PIN(1, 13),
 };
-static const unsigned int pwm8_a_mux[] = {
-	PWM8_A_MARK,
+static const unsigned int pwm8_mux[] = {
+	PWM8_MARK,
 };
 
-/* - PWM9_A ------------------------------------------------------------------- */
-static const unsigned int pwm9_a_pins[] = {
-	/* PWM9_A */
+/* - PWM9 ------------------------------------------------------------------- */
+static const unsigned int pwm9_pins[] = {
+	/* PWM9 */
 	RCAR_GP_PIN(1, 14),
 };
-static const unsigned int pwm9_a_mux[] = {
-	PWM9_A_MARK,
+static const unsigned int pwm9_mux[] = {
+	PWM9_MARK,
 };
 
 /* - QSPI0 ------------------------------------------------------------------ */
@@ -2237,75 +2234,51 @@ static const unsigned int scif0_ctrl_mux[] = {
 };
 
 /* - SCIF1 ------------------------------------------------------------------ */
-static const unsigned int scif1_data_pins[] = {
-	/* RX1, TX1 */
+static const unsigned int scif1_data_a_pins[] = {
+	/* RX1_A, TX1_A */
 	RCAR_GP_PIN(0, 15), RCAR_GP_PIN(0, 14),
 };
-static const unsigned int scif1_data_mux[] = {
-	RX1_MARK, TX1_MARK,
+static const unsigned int scif1_data_a_mux[] = {
+	RX1_A_MARK, TX1_A_MARK,
 };
-static const unsigned int scif1_clk_pins[] = {
-	/* SCK1 */
+static const unsigned int scif1_clk_a_pins[] = {
+	/* SCK1_A */
 	RCAR_GP_PIN(0, 18),
 };
-static const unsigned int scif1_clk_mux[] = {
-	SCK1_MARK,
+static const unsigned int scif1_clk_a_mux[] = {
+	SCK1_A_MARK,
 };
-static const unsigned int scif1_ctrl_pins[] = {
-	/* RTS1_N, CTS1_N */
+static const unsigned int scif1_ctrl_a_pins[] = {
+	/* RTS1_N_A, CTS1_N_A */
 	RCAR_GP_PIN(0, 17), RCAR_GP_PIN(0, 16),
 };
-static const unsigned int scif1_ctrl_mux[] = {
-	RTS1_N_MARK, CTS1_N_MARK,
+static const unsigned int scif1_ctrl_a_mux[] = {
+	RTS1_N_A_MARK, CTS1_N_A_MARK,
 };
 
-/* - SCIF1_X ------------------------------------------------------------------ */
-static const unsigned int scif1_data_x_pins[] = {
-	/* RX1_X, TX1_X */
+static const unsigned int scif1_data_b_pins[] = {
+	/* RX1_B, TX1_B */
 	RCAR_GP_PIN(1, 7), RCAR_GP_PIN(1, 6),
 };
-static const unsigned int scif1_data_x_mux[] = {
-	RX1_X_MARK, TX1_X_MARK,
+static const unsigned int scif1_data_b_mux[] = {
+	RX1_B_MARK, TX1_B_MARK,
 };
-static const unsigned int scif1_clk_x_pins[] = {
-	/* SCK1_X */
+static const unsigned int scif1_clk_b_pins[] = {
+	/* SCK1_B */
 	RCAR_GP_PIN(1, 10),
 };
-static const unsigned int scif1_clk_x_mux[] = {
-	SCK1_X_MARK,
+static const unsigned int scif1_clk_b_mux[] = {
+	SCK1_B_MARK,
 };
-static const unsigned int scif1_ctrl_x_pins[] = {
-	/* RTS1_N_X, CTS1_N_X */
+static const unsigned int scif1_ctrl_b_pins[] = {
+	/* RTS1_N_B, CTS1_N_B */
 	RCAR_GP_PIN(1, 9), RCAR_GP_PIN(1, 8),
 };
-static const unsigned int scif1_ctrl_x_mux[] = {
-	RTS1_N_X_MARK, CTS1_N_X_MARK,
+static const unsigned int scif1_ctrl_b_mux[] = {
+	RTS1_N_B_MARK, CTS1_N_B_MARK,
 };
 
 /* - SCIF3 ------------------------------------------------------------------ */
-static const unsigned int scif3_data_pins[] = {
-	/* RX3, TX3 */
-	RCAR_GP_PIN(1, 1), RCAR_GP_PIN(1, 0),
-};
-static const unsigned int scif3_data_mux[] = {
-	RX3_MARK, TX3_MARK,
-};
-static const unsigned int scif3_clk_pins[] = {
-	/* SCK3 */
-	RCAR_GP_PIN(1, 4),
-};
-static const unsigned int scif3_clk_mux[] = {
-	SCK3_MARK,
-};
-static const unsigned int scif3_ctrl_pins[] = {
-	/* RTS3_N, CTS3_N */
-	RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 3),
-};
-static const unsigned int scif3_ctrl_mux[] = {
-	RTS3_N_MARK, CTS3_N_MARK,
-};
-
-/* - SCIF3_A ------------------------------------------------------------------ */
 static const unsigned int scif3_data_a_pins[] = {
 	/* RX3_A, TX3_A */
 	RCAR_GP_PIN(1, 27), RCAR_GP_PIN(1, 28),
@@ -2328,6 +2301,28 @@ static const unsigned int scif3_ctrl_a_mux[] = {
 	RTS3_N_A_MARK, CTS3_N_A_MARK,
 };
 
+static const unsigned int scif3_data_b_pins[] = {
+	/* RX3_B, TX3_B */
+	RCAR_GP_PIN(1, 1), RCAR_GP_PIN(1, 0),
+};
+static const unsigned int scif3_data_b_mux[] = {
+	RX3_B_MARK, TX3_B_MARK,
+};
+static const unsigned int scif3_clk_b_pins[] = {
+	/* SCK3_B */
+	RCAR_GP_PIN(1, 4),
+};
+static const unsigned int scif3_clk_b_mux[] = {
+	SCK3_B_MARK,
+};
+static const unsigned int scif3_ctrl_b_pins[] = {
+	/* RTS3_N_B, CTS3_N_B */
+	RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 3),
+};
+static const unsigned int scif3_ctrl_b_mux[] = {
+	RTS3_N_B_MARK, CTS3_N_B_MARK,
+};
+
 /* - SCIF4 ------------------------------------------------------------------ */
 static const unsigned int scif4_data_pins[] = {
 	/* RX4, TX4 */
@@ -2384,64 +2379,63 @@ static const unsigned int ssi_ctrl_mux[] = {
 	SSI_SCK_MARK, SSI_WS_MARK,
 };
 
-/* - TPU ------------------------------------------------------------------- */
-static const unsigned int tpu_to0_pins[] = {
-	/* TPU0TO0 */
+/* - TPU -------------------------------------------------------------------- */
+static const unsigned int tpu_to0_a_pins[] = {
+	/* TPU0TO0_A */
 	RCAR_GP_PIN(2, 8),
 };
-static const unsigned int tpu_to0_mux[] = {
-	TPU0TO0_MARK,
+static const unsigned int tpu_to0_a_mux[] = {
+	TPU0TO0_A_MARK,
 };
-static const unsigned int tpu_to1_pins[] = {
-	/* TPU0TO1 */
+static const unsigned int tpu_to1_a_pins[] = {
+	/* TPU0TO1_A */
 	RCAR_GP_PIN(2, 7),
 };
-static const unsigned int tpu_to1_mux[] = {
-	TPU0TO1_MARK,
+static const unsigned int tpu_to1_a_mux[] = {
+	TPU0TO1_A_MARK,
 };
-static const unsigned int tpu_to2_pins[] = {
-	/* TPU0TO2 */
+static const unsigned int tpu_to2_a_pins[] = {
+	/* TPU0TO2_A */
 	RCAR_GP_PIN(2, 12),
 };
-static const unsigned int tpu_to2_mux[] = {
-	TPU0TO2_MARK,
+static const unsigned int tpu_to2_a_mux[] = {
+	TPU0TO2_A_MARK,
 };
-static const unsigned int tpu_to3_pins[] = {
-	/* TPU0TO3 */
+static const unsigned int tpu_to3_a_pins[] = {
+	/* TPU0TO3_A */
 	RCAR_GP_PIN(2, 13),
 };
-static const unsigned int tpu_to3_mux[] = {
-	TPU0TO3_MARK,
+static const unsigned int tpu_to3_a_mux[] = {
+	TPU0TO3_A_MARK,
 };
 
-/* - TPU_A ------------------------------------------------------------------- */
-static const unsigned int tpu_to0_a_pins[] = {
-	/* TPU0TO0_A */
+static const unsigned int tpu_to0_b_pins[] = {
+	/* TPU0TO0_B */
 	RCAR_GP_PIN(1, 25),
 };
-static const unsigned int tpu_to0_a_mux[] = {
-	TPU0TO0_A_MARK,
+static const unsigned int tpu_to0_b_mux[] = {
+	TPU0TO0_B_MARK,
 };
-static const unsigned int tpu_to1_a_pins[] = {
-	/* TPU0TO1_A */
+static const unsigned int tpu_to1_b_pins[] = {
+	/* TPU0TO1_B */
 	RCAR_GP_PIN(1, 26),
 };
-static const unsigned int tpu_to1_a_mux[] = {
-	TPU0TO1_A_MARK,
+static const unsigned int tpu_to1_b_mux[] = {
+	TPU0TO1_B_MARK,
 };
-static const unsigned int tpu_to2_a_pins[] = {
-	/* TPU0TO2_A */
+static const unsigned int tpu_to2_b_pins[] = {
+	/* TPU0TO2_B */
 	RCAR_GP_PIN(2, 0),
 };
-static const unsigned int tpu_to2_a_mux[] = {
-	TPU0TO2_A_MARK,
+static const unsigned int tpu_to2_b_mux[] = {
+	TPU0TO2_B_MARK,
 };
-static const unsigned int tpu_to3_a_pins[] = {
-	/* TPU0TO3_A */
+static const unsigned int tpu_to3_b_pins[] = {
+	/* TPU0TO3_B */
 	RCAR_GP_PIN(2, 1),
 };
-static const unsigned int tpu_to3_a_mux[] = {
-	TPU0TO3_A_MARK,
+static const unsigned int tpu_to3_b_mux[] = {
+	TPU0TO3_B_MARK,
 };
 
 /* - TSN0 ------------------------------------------------ */
@@ -2551,8 +2545,8 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(canfd2_data),
 	SH_PFC_PIN_GROUP(canfd3_data),
 	SH_PFC_PIN_GROUP(canfd4_data),
-	SH_PFC_PIN_GROUP(canfd5_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(canfd5_data_b),	/* suffix might be updated */
+	SH_PFC_PIN_GROUP(canfd5_data_a),
+	SH_PFC_PIN_GROUP(canfd5_data_b),
 	SH_PFC_PIN_GROUP(canfd6_data),
 	SH_PFC_PIN_GROUP(canfd7_data),
 	SH_PFC_PIN_GROUP(can_clk),
@@ -2560,21 +2554,21 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(hscif0_data),
 	SH_PFC_PIN_GROUP(hscif0_clk),
 	SH_PFC_PIN_GROUP(hscif0_ctrl),
-	SH_PFC_PIN_GROUP(hscif1_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_clk),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_ctrl),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_data_x),	/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_clk_x),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_ctrl_x),	/* suffix might be updated */
+	SH_PFC_PIN_GROUP(hscif1_data_a),
+	SH_PFC_PIN_GROUP(hscif1_clk_a),
+	SH_PFC_PIN_GROUP(hscif1_ctrl_a),
+	SH_PFC_PIN_GROUP(hscif1_data_b),
+	SH_PFC_PIN_GROUP(hscif1_clk_b),
+	SH_PFC_PIN_GROUP(hscif1_ctrl_b),
 	SH_PFC_PIN_GROUP(hscif2_data),
 	SH_PFC_PIN_GROUP(hscif2_clk),
 	SH_PFC_PIN_GROUP(hscif2_ctrl),
-	SH_PFC_PIN_GROUP(hscif3_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_clk),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_ctrl),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_data_a),	/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_clk_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_ctrl_a),	/* suffix might be updated */
+	SH_PFC_PIN_GROUP(hscif3_data_a),
+	SH_PFC_PIN_GROUP(hscif3_clk_a),
+	SH_PFC_PIN_GROUP(hscif3_ctrl_a),
+	SH_PFC_PIN_GROUP(hscif3_data_b),
+	SH_PFC_PIN_GROUP(hscif3_clk_b),
+	SH_PFC_PIN_GROUP(hscif3_ctrl_b),
 
 	SH_PFC_PIN_GROUP(i2c0),
 	SH_PFC_PIN_GROUP(i2c1),
@@ -2636,18 +2630,18 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(pcie0_clkreq_n),
 	SH_PFC_PIN_GROUP(pcie1_clkreq_n),
 
-	SH_PFC_PIN_GROUP(pwm0_a),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(pwm0),
 	SH_PFC_PIN_GROUP(pwm1_a),
 	SH_PFC_PIN_GROUP(pwm1_b),
-	SH_PFC_PIN_GROUP(pwm2_b),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(pwm2),
 	SH_PFC_PIN_GROUP(pwm3_a),
 	SH_PFC_PIN_GROUP(pwm3_b),
 	SH_PFC_PIN_GROUP(pwm4),
 	SH_PFC_PIN_GROUP(pwm5),
 	SH_PFC_PIN_GROUP(pwm6),
 	SH_PFC_PIN_GROUP(pwm7),
-	SH_PFC_PIN_GROUP(pwm8_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(pwm9_a),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(pwm8),
+	SH_PFC_PIN_GROUP(pwm9),
 
 	SH_PFC_PIN_GROUP(qspi0_ctrl),
 	BUS_DATA_PIN_GROUP(qspi0_data, 2),
@@ -2659,18 +2653,18 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(scif0_data),
 	SH_PFC_PIN_GROUP(scif0_clk),
 	SH_PFC_PIN_GROUP(scif0_ctrl),
-	SH_PFC_PIN_GROUP(scif1_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_clk),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_ctrl),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_data_x),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_clk_x),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_ctrl_x),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_clk),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_ctrl),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_data_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_clk_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_ctrl_a),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(scif1_data_a),
+	SH_PFC_PIN_GROUP(scif1_clk_a),
+	SH_PFC_PIN_GROUP(scif1_ctrl_a),
+	SH_PFC_PIN_GROUP(scif1_data_b),
+	SH_PFC_PIN_GROUP(scif1_clk_b),
+	SH_PFC_PIN_GROUP(scif1_ctrl_b),
+	SH_PFC_PIN_GROUP(scif3_data_a),
+	SH_PFC_PIN_GROUP(scif3_clk_a),
+	SH_PFC_PIN_GROUP(scif3_ctrl_a),
+	SH_PFC_PIN_GROUP(scif3_data_b),
+	SH_PFC_PIN_GROUP(scif3_clk_b),
+	SH_PFC_PIN_GROUP(scif3_ctrl_b),
 	SH_PFC_PIN_GROUP(scif4_data),
 	SH_PFC_PIN_GROUP(scif4_clk),
 	SH_PFC_PIN_GROUP(scif4_ctrl),
@@ -2680,14 +2674,14 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(ssi_data),
 	SH_PFC_PIN_GROUP(ssi_ctrl),
 
-	SH_PFC_PIN_GROUP(tpu_to0),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to0_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to1),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to1_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to2),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to2_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to3),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to3_a),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(tpu_to0_a),
+	SH_PFC_PIN_GROUP(tpu_to0_b),
+	SH_PFC_PIN_GROUP(tpu_to1_a),
+	SH_PFC_PIN_GROUP(tpu_to1_b),
+	SH_PFC_PIN_GROUP(tpu_to2_a),
+	SH_PFC_PIN_GROUP(tpu_to2_b),
+	SH_PFC_PIN_GROUP(tpu_to3_a),
+	SH_PFC_PIN_GROUP(tpu_to3_b),
 
 	SH_PFC_PIN_GROUP(tsn0_link),
 	SH_PFC_PIN_GROUP(tsn0_phy_int),
@@ -2756,8 +2750,7 @@ static const char * const canfd4_groups[] = {
 };
 
 static const char * const canfd5_groups[] = {
-	/* suffix might be updated */
-	"canfd5_data",
+	"canfd5_data_a",
 	"canfd5_data_b",
 };
 
@@ -2780,13 +2773,12 @@ static const char * const hscif0_groups[] = {
 };
 
 static const char * const hscif1_groups[] = {
-	/* suffix might be updated */
-	"hscif1_data",
-	"hscif1_clk",
-	"hscif1_ctrl",
-	"hscif1_data_x",
-	"hscif1_clk_x",
-	"hscif1_ctrl_x",
+	"hscif1_data_a",
+	"hscif1_clk_a",
+	"hscif1_ctrl_a",
+	"hscif1_data_b",
+	"hscif1_clk_b",
+	"hscif1_ctrl_b",
 };
 
 static const char * const hscif2_groups[] = {
@@ -2796,13 +2788,12 @@ static const char * const hscif2_groups[] = {
 };
 
 static const char * const hscif3_groups[] = {
-	/* suffix might be updated */
-	"hscif3_data",
-	"hscif3_clk",
-	"hscif3_ctrl",
 	"hscif3_data_a",
 	"hscif3_clk_a",
 	"hscif3_ctrl_a",
+	"hscif3_data_b",
+	"hscif3_clk_b",
+	"hscif3_ctrl_b",
 };
 
 static const char * const i2c0_groups[] = {
@@ -2899,8 +2890,7 @@ static const char * const pcie_groups[] = {
 };
 
 static const char * const pwm0_groups[] = {
-	/* suffix might be updated */
-	"pwm0_a",
+	"pwm0",
 };
 
 static const char * const pwm1_groups[] = {
@@ -2909,8 +2899,7 @@ static const char * const pwm1_groups[] = {
 };
 
 static const char * const pwm2_groups[] = {
-	/* suffix might be updated */
-	"pwm2_b",
+	"pwm2",
 };
 
 static const char * const pwm3_groups[] = {
@@ -2935,13 +2924,11 @@ static const char * const pwm7_groups[] = {
 };
 
 static const char * const pwm8_groups[] = {
-	/* suffix might be updated */
-	"pwm8_a",
+	"pwm8",
 };
 
 static const char * const pwm9_groups[] = {
-	/* suffix might be updated */
-	"pwm9_a",
+	"pwm9",
 };
 
 static const char * const qspi0_groups[] = {
@@ -2963,23 +2950,21 @@ static const char * const scif0_groups[] = {
 };
 
 static const char * const scif1_groups[] = {
-	/* suffix might be updated */
-	"scif1_data",
-	"scif1_clk",
-	"scif1_ctrl",
-	"scif1_data_x",
-	"scif1_clk_x",
-	"scif1_ctrl_x",
+	"scif1_data_a",
+	"scif1_clk_a",
+	"scif1_ctrl_a",
+	"scif1_data_b",
+	"scif1_clk_b",
+	"scif1_ctrl_b",
 };
 
 static const char * const scif3_groups[] = {
-	/* suffix might be updated */
-	"scif3_data",
-	"scif3_clk",
-	"scif3_ctrl",
 	"scif3_data_a",
 	"scif3_clk_a",
 	"scif3_ctrl_a",
+	"scif3_data_b",
+	"scif3_clk_b",
+	"scif3_ctrl_b",
 };
 
 static const char * const scif4_groups[] = {
@@ -3002,15 +2987,14 @@ static const char * const ssi_groups[] = {
 };
 
 static const char * const tpu_groups[] = {
-	/* suffix might be updated */
-	"tpu_to0",
 	"tpu_to0_a",
-	"tpu_to1",
+	"tpu_to0_b",
 	"tpu_to1_a",
-	"tpu_to2",
+	"tpu_to1_b",
 	"tpu_to2_a",
-	"tpu_to3",
+	"tpu_to2_b",
 	"tpu_to3_a",
+	"tpu_to3_b",
 };
 
 static const char * const tsn0_groups[] = {
diff --git a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
index 4e2382778d38..f3411e3eaf2e 100644
--- a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
+++ b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
@@ -883,7 +883,7 @@ static int ti_iodelay_probe(struct platform_device *pdev)
 	iod->desc.name = dev_name(dev);
 	iod->desc.owner = THIS_MODULE;
 
-	ret = pinctrl_register_and_init(&iod->desc, dev, iod, &iod->pctl);
+	ret = devm_pinctrl_register_and_init(dev, &iod->desc, iod, &iod->pctl);
 	if (ret) {
 		dev_err(dev, "Failed to register pinctrl\n");
 		goto exit_out;
@@ -891,7 +891,11 @@ static int ti_iodelay_probe(struct platform_device *pdev)
 
 	platform_set_drvdata(pdev, iod);
 
-	return pinctrl_enable(iod->pctl);
+	ret = pinctrl_enable(iod->pctl);
+	if (ret)
+		goto exit_out;
+
+	return 0;
 
 exit_out:
 	of_node_put(np);
@@ -908,12 +912,6 @@ static int ti_iodelay_remove(struct platform_device *pdev)
 {
 	struct ti_iodelay_device *iod = platform_get_drvdata(pdev);
 
-	if (!iod)
-		return 0;
-
-	if (iod->pctl)
-		pinctrl_unregister(iod->pctl);
-
 	ti_iodelay_pinconf_deinit_dev(iod);
 
 	/* Expect other allocations to be freed by devm */
diff --git a/drivers/platform/chrome/cros_ec_debugfs.c b/drivers/platform/chrome/cros_ec_debugfs.c
index 4e63adf083ea..b19207f3aecf 100644
--- a/drivers/platform/chrome/cros_ec_debugfs.c
+++ b/drivers/platform/chrome/cros_ec_debugfs.c
@@ -326,6 +326,7 @@ static int ec_read_version_supported(struct cros_ec_dev *ec)
 	if (!msg)
 		return 0;
 
+	msg->version = 1;
 	msg->command = EC_CMD_GET_CMD_VERSIONS + ec->cmd_offset;
 	msg->outsize = sizeof(*params);
 	msg->insize = sizeof(*response);
diff --git a/drivers/platform/mips/cpu_hwmon.c b/drivers/platform/mips/cpu_hwmon.c
index d8c5f9195f85..2ac2f31090f9 100644
--- a/drivers/platform/mips/cpu_hwmon.c
+++ b/drivers/platform/mips/cpu_hwmon.c
@@ -139,6 +139,9 @@ static int __init loongson_hwmon_init(void)
 		csr_temp_enable = csr_readl(LOONGSON_CSR_FEATURES) &
 				  LOONGSON_CSRF_TEMP;
 
+	if (!csr_temp_enable && !loongson_chiptemp[0])
+		return -ENODEV;
+
 	nr_packages = loongson_sysconf.nr_cpus /
 		loongson_sysconf.cores_per_package;
 
diff --git a/drivers/pwm/pwm-atmel-tcb.c b/drivers/pwm/pwm-atmel-tcb.c
index 2826fc216d29..e74b45f00a9a 100644
--- a/drivers/pwm/pwm-atmel-tcb.c
+++ b/drivers/pwm/pwm-atmel-tcb.c
@@ -34,7 +34,6 @@
 				 ATMEL_TC_BEEVT | ATMEL_TC_BSWTRG)
 
 struct atmel_tcb_pwm_device {
-	enum pwm_polarity polarity;	/* PWM polarity */
 	unsigned div;			/* PWM clock divider */
 	unsigned duty;			/* PWM duty expressed in clk cycles */
 	unsigned period;		/* PWM period expressed in clk cycles */
@@ -57,7 +56,7 @@ struct atmel_tcb_pwm_chip {
 	struct clk *clk;
 	struct clk *gclk;
 	struct clk *slow_clk;
-	struct atmel_tcb_pwm_device *pwms[NPWM];
+	struct atmel_tcb_pwm_device pwms[NPWM];
 	struct atmel_tcb_channel bkup;
 };
 
@@ -68,42 +67,24 @@ static inline struct atmel_tcb_pwm_chip *to_tcb_chip(struct pwm_chip *chip)
 	return container_of(chip, struct atmel_tcb_pwm_chip, chip);
 }
 
-static int atmel_tcb_pwm_set_polarity(struct pwm_chip *chip,
-				      struct pwm_device *pwm,
-				      enum pwm_polarity polarity)
-{
-	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
-	struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
-
-	tcbpwm->polarity = polarity;
-
-	return 0;
-}
-
 static int atmel_tcb_pwm_request(struct pwm_chip *chip,
 				 struct pwm_device *pwm)
 {
 	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
-	struct atmel_tcb_pwm_device *tcbpwm;
+	struct atmel_tcb_pwm_device *tcbpwm = &tcbpwmc->pwms[pwm->hwpwm];
 	unsigned cmr;
 	int ret;
 
-	tcbpwm = devm_kzalloc(chip->dev, sizeof(*tcbpwm), GFP_KERNEL);
-	if (!tcbpwm)
-		return -ENOMEM;
-
 	ret = clk_prepare_enable(tcbpwmc->clk);
-	if (ret) {
-		devm_kfree(chip->dev, tcbpwm);
+	if (ret)
 		return ret;
-	}
 
-	tcbpwm->polarity = PWM_POLARITY_NORMAL;
 	tcbpwm->duty = 0;
 	tcbpwm->period = 0;
 	tcbpwm->div = 0;
 
-	spin_lock(&tcbpwmc->lock);
+	guard(spinlock)(&tcbpwmc->lock);
+
 	regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
 	/*
 	 * Get init config from Timer Counter registers if
@@ -129,9 +110,6 @@ static int atmel_tcb_pwm_request(struct pwm_chip *chip,
 
 	cmr |= ATMEL_TC_WAVE | ATMEL_TC_WAVESEL_UP_AUTO | ATMEL_TC_EEVT_XC0;
 	regmap_write(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), cmr);
-	spin_unlock(&tcbpwmc->lock);
-
-	tcbpwmc->pwms[pwm->hwpwm] = tcbpwm;
 
 	return 0;
 }
@@ -139,19 +117,16 @@ static int atmel_tcb_pwm_request(struct pwm_chip *chip,
 static void atmel_tcb_pwm_free(struct pwm_chip *chip, struct pwm_device *pwm)
 {
 	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
-	struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
 
 	clk_disable_unprepare(tcbpwmc->clk);
-	tcbpwmc->pwms[pwm->hwpwm] = NULL;
-	devm_kfree(chip->dev, tcbpwm);
 }
 
-static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm)
+static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm,
+				  enum pwm_polarity polarity)
 {
 	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
-	struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
+	struct atmel_tcb_pwm_device *tcbpwm = &tcbpwmc->pwms[pwm->hwpwm];
 	unsigned cmr;
-	enum pwm_polarity polarity = tcbpwm->polarity;
 
 	/*
 	 * If duty is 0 the timer will be stopped and we have to
@@ -164,7 +139,6 @@ static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm)
 	if (tcbpwm->duty == 0)
 		polarity = !polarity;
 
-	spin_lock(&tcbpwmc->lock);
 	regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
 
 	/* flush old setting and set the new one */
@@ -199,16 +173,14 @@ static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm)
 			     ATMEL_TC_SWTRG);
 		tcbpwmc->bkup.enabled = 0;
 	}
-
-	spin_unlock(&tcbpwmc->lock);
 }
 
-static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm)
+static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm,
+				enum pwm_polarity polarity)
 {
 	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
-	struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
+	struct atmel_tcb_pwm_device *tcbpwm = &tcbpwmc->pwms[pwm->hwpwm];
 	u32 cmr;
-	enum pwm_polarity polarity = tcbpwm->polarity;
 
 	/*
 	 * If duty is 0 the timer will be stopped and we have to
@@ -221,7 +193,6 @@ static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm)
 	if (tcbpwm->duty == 0)
 		polarity = !polarity;
 
-	spin_lock(&tcbpwmc->lock);
 	regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
 
 	/* flush old setting and set the new one */
@@ -283,7 +254,6 @@ static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm)
 	regmap_write(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CCR),
 		     ATMEL_TC_SWTRG | ATMEL_TC_CLKEN);
 	tcbpwmc->bkup.enabled = 1;
-	spin_unlock(&tcbpwmc->lock);
 	return 0;
 }
 
@@ -291,7 +261,7 @@ static int atmel_tcb_pwm_config(struct pwm_chip *chip, struct pwm_device *pwm,
 				int duty_ns, int period_ns)
 {
 	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
-	struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
+	struct atmel_tcb_pwm_device *tcbpwm = &tcbpwmc->pwms[pwm->hwpwm];
 	struct atmel_tcb_pwm_device *atcbpwm = NULL;
 	int i = 0;
 	int slowclk = 0;
@@ -338,9 +308,9 @@ static int atmel_tcb_pwm_config(struct pwm_chip *chip, struct pwm_device *pwm,
 	period = div_u64(period_ns, min);
 
 	if (pwm->hwpwm == 0)
-		atcbpwm = tcbpwmc->pwms[1];
+		atcbpwm = &tcbpwmc->pwms[1];
 	else
-		atcbpwm = tcbpwmc->pwms[0];
+		atcbpwm = &tcbpwmc->pwms[0];
 
 	/*
 	 * PWM devices provided by the TCB driver are grouped by 2.
@@ -368,14 +338,14 @@ static int atmel_tcb_pwm_config(struct pwm_chip *chip, struct pwm_device *pwm,
 static int atmel_tcb_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm,
 			       const struct pwm_state *state)
 {
+	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
 	int duty_cycle, period;
 	int ret;
 
-	/* This function only sets a flag in driver data */
-	atmel_tcb_pwm_set_polarity(chip, pwm, state->polarity);
+	guard(spinlock)(&tcbpwmc->lock);
 
 	if (!state->enabled) {
-		atmel_tcb_pwm_disable(chip, pwm);
+		atmel_tcb_pwm_disable(chip, pwm, state->polarity);
 		return 0;
 	}
 
@@ -386,7 +356,7 @@ static int atmel_tcb_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm,
 	if (ret)
 		return ret;
 
-	return atmel_tcb_pwm_enable(chip, pwm);
+	return atmel_tcb_pwm_enable(chip, pwm, state->polarity);
 }
 
 static const struct pwm_ops atmel_tcb_pwm_ops = {
diff --git a/drivers/pwm/pwm-stm32.c b/drivers/pwm/pwm-stm32.c
index c40a6548ce7d..2070d107c632 100644
--- a/drivers/pwm/pwm-stm32.c
+++ b/drivers/pwm/pwm-stm32.c
@@ -452,8 +452,9 @@ static int stm32_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm,
 
 	enabled = pwm->state.enabled;
 
-	if (enabled && !state->enabled) {
-		stm32_pwm_disable(priv, pwm->hwpwm);
+	if (!state->enabled) {
+		if (enabled)
+			stm32_pwm_disable(priv, pwm->hwpwm);
 		return 0;
 	}
 
diff --git a/drivers/remoteproc/imx_rproc.c b/drivers/remoteproc/imx_rproc.c
index 8a2a7112678c..bc26fe541662 100644
--- a/drivers/remoteproc/imx_rproc.c
+++ b/drivers/remoteproc/imx_rproc.c
@@ -596,31 +596,37 @@ static int imx_rproc_addr_init(struct imx_rproc *priv,
 		struct resource res;
 
 		node = of_parse_phandle(np, "memory-region", a);
+		if (!node)
+			continue;
 		/* Not map vdevbuffer, vdevring region */
 		if (!strncmp(node->name, "vdev", strlen("vdev"))) {
 			of_node_put(node);
 			continue;
 		}
 		err = of_address_to_resource(node, 0, &res);
-		of_node_put(node);
 		if (err) {
 			dev_err(dev, "unable to resolve memory region\n");
+			of_node_put(node);
 			return err;
 		}
 
-		if (b >= IMX_RPROC_MEM_MAX)
+		if (b >= IMX_RPROC_MEM_MAX) {
+			of_node_put(node);
 			break;
+		}
 
 		/* Not use resource version, because we might share region */
 		priv->mem[b].cpu_addr = devm_ioremap_wc(&pdev->dev, res.start, resource_size(&res));
 		if (!priv->mem[b].cpu_addr) {
 			dev_err(dev, "failed to remap %pr\n", &res);
+			of_node_put(node);
 			return -ENOMEM;
 		}
 		priv->mem[b].sys_addr = res.start;
 		priv->mem[b].size = resource_size(&res);
 		if (!strcmp(node->name, "rsc-table"))
 			priv->rsc_table = priv->mem[b].cpu_addr;
+		of_node_put(node);
 		b++;
 	}
 
diff --git a/drivers/remoteproc/stm32_rproc.c b/drivers/remoteproc/stm32_rproc.c
index 74da0393172c..d88220a8fb0c 100644
--- a/drivers/remoteproc/stm32_rproc.c
+++ b/drivers/remoteproc/stm32_rproc.c
@@ -293,7 +293,7 @@ static void stm32_rproc_mb_vq_work(struct work_struct *work)
 
 	mutex_lock(&rproc->lock);
 
-	if (rproc->state != RPROC_RUNNING)
+	if (rproc->state != RPROC_RUNNING && rproc->state != RPROC_ATTACHED)
 		goto unlock_mutex;
 
 	if (rproc_vq_interrupt(rproc, mb->vq_id) == IRQ_NONE)
diff --git a/drivers/rtc/interface.c b/drivers/rtc/interface.c
index 3d0fbc644f57..c928037bf6f3 100644
--- a/drivers/rtc/interface.c
+++ b/drivers/rtc/interface.c
@@ -274,10 +274,9 @@ int __rtc_read_alarm(struct rtc_device *rtc, struct rtc_wkalrm *alarm)
 			return err;
 
 		/* full-function RTCs won't have such missing fields */
-		if (rtc_valid_tm(&alarm->time) == 0) {
-			rtc_add_offset(rtc, &alarm->time);
-			return 0;
-		}
+		err = rtc_valid_tm(&alarm->time);
+		if (!err)
+			goto done;
 
 		/* get the "after" timestamp, to detect wrapped fields */
 		err = rtc_read_time(rtc, &now);
@@ -379,6 +378,8 @@ int __rtc_read_alarm(struct rtc_device *rtc, struct rtc_wkalrm *alarm)
 	if (err)
 		dev_warn(&rtc->dev, "invalid alarm value: %ptR\n",
 			 &alarm->time);
+	else
+		rtc_add_offset(rtc, &alarm->time);
 
 	return err;
 }
diff --git a/drivers/rtc/rtc-cmos.c b/drivers/rtc/rtc-cmos.c
index e0a798923ce0..542568cd72b3 100644
--- a/drivers/rtc/rtc-cmos.c
+++ b/drivers/rtc/rtc-cmos.c
@@ -643,11 +643,10 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val,
 			   size_t count)
 {
 	unsigned char *buf = val;
-	int	retval;
 
 	off += NVRAM_OFFSET;
 	spin_lock_irq(&rtc_lock);
-	for (retval = 0; count; count--, off++, retval++) {
+	for (; count; count--, off++) {
 		if (off < 128)
 			*buf++ = CMOS_READ(off);
 		else if (can_bank2)
@@ -657,7 +656,7 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val,
 	}
 	spin_unlock_irq(&rtc_lock);
 
-	return retval;
+	return count ? -EIO : 0;
 }
 
 static int cmos_nvram_write(void *priv, unsigned int off, void *val,
@@ -665,7 +664,6 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
 {
 	struct cmos_rtc	*cmos = priv;
 	unsigned char	*buf = val;
-	int		retval;
 
 	/* NOTE:  on at least PCs and Ataris, the boot firmware uses a
 	 * checksum on part of the NVRAM data.  That's currently ignored
@@ -674,7 +672,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
 	 */
 	off += NVRAM_OFFSET;
 	spin_lock_irq(&rtc_lock);
-	for (retval = 0; count; count--, off++, retval++) {
+	for (; count; count--, off++) {
 		/* don't trash RTC registers */
 		if (off == cmos->day_alrm
 				|| off == cmos->mon_alrm
@@ -689,7 +687,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
 	}
 	spin_unlock_irq(&rtc_lock);
 
-	return retval;
+	return count ? -EIO : 0;
 }
 
 /*----------------------------------------------------------------*/
diff --git a/drivers/rtc/rtc-isl1208.c b/drivers/rtc/rtc-isl1208.c
index f448a525333e..2615b2cf8334 100644
--- a/drivers/rtc/rtc-isl1208.c
+++ b/drivers/rtc/rtc-isl1208.c
@@ -743,14 +743,13 @@ static int isl1208_nvmem_read(void *priv, unsigned int off, void *buf,
 {
 	struct isl1208_state *isl1208 = priv;
 	struct i2c_client *client = to_i2c_client(isl1208->rtc->dev.parent);
-	int ret;
 
 	/* nvmem sanitizes offset/count for us, but count==0 is possible */
 	if (!count)
 		return count;
-	ret = isl1208_i2c_read_regs(client, ISL1208_REG_USR1 + off, buf,
+
+	return isl1208_i2c_read_regs(client, ISL1208_REG_USR1 + off, buf,
 				    count);
-	return ret == 0 ? count : ret;
 }
 
 static int isl1208_nvmem_write(void *priv, unsigned int off, void *buf,
@@ -758,15 +757,13 @@ static int isl1208_nvmem_write(void *priv, unsigned int off, void *buf,
 {
 	struct isl1208_state *isl1208 = priv;
 	struct i2c_client *client = to_i2c_client(isl1208->rtc->dev.parent);
-	int ret;
 
 	/* nvmem sanitizes off/count for us, but count==0 is possible */
 	if (!count)
 		return count;
-	ret = isl1208_i2c_set_regs(client, ISL1208_REG_USR1 + off, buf,
-				   count);
 
-	return ret == 0 ? count : ret;
+	return isl1208_i2c_set_regs(client, ISL1208_REG_USR1 + off, buf,
+				   count);
 }
 
 static const struct nvmem_config isl1208_nvmem_config = {
diff --git a/drivers/s390/block/dasd_devmap.c b/drivers/s390/block/dasd_devmap.c
index b2a4c3433057..1129f6ae98b5 100644
--- a/drivers/s390/block/dasd_devmap.c
+++ b/drivers/s390/block/dasd_devmap.c
@@ -2135,13 +2135,19 @@ static ssize_t dasd_copy_pair_store(struct device *dev,
 
 	/* allocate primary devmap if needed */
 	prim_devmap = dasd_find_busid(prim_busid);
-	if (IS_ERR(prim_devmap))
+	if (IS_ERR(prim_devmap)) {
 		prim_devmap = dasd_add_busid(prim_busid, DASD_FEATURE_DEFAULT);
+		if (IS_ERR(prim_devmap))
+			return PTR_ERR(prim_devmap);
+	}
 
 	/* allocate secondary devmap if needed */
 	sec_devmap = dasd_find_busid(sec_busid);
-	if (IS_ERR(sec_devmap))
+	if (IS_ERR(sec_devmap)) {
 		sec_devmap = dasd_add_busid(sec_busid, DASD_FEATURE_DEFAULT);
+		if (IS_ERR(sec_devmap))
+			return PTR_ERR(sec_devmap);
+	}
 
 	/* setting copy relation is only allowed for offline secondary */
 	if (sec_devmap->device)
diff --git a/drivers/scsi/qla2xxx/qla_bsg.c b/drivers/scsi/qla2xxx/qla_bsg.c
index 19bb64bdd88b..52dc9604f567 100644
--- a/drivers/scsi/qla2xxx/qla_bsg.c
+++ b/drivers/scsi/qla2xxx/qla_bsg.c
@@ -324,7 +324,7 @@ qla2x00_process_els(struct bsg_job *bsg_job)
 		    "request_sg_cnt=%x reply_sg_cnt=%x.\n",
 		    bsg_job->request_payload.sg_cnt,
 		    bsg_job->reply_payload.sg_cnt);
-		rval = -EPERM;
+		rval = -ENOBUFS;
 		goto done;
 	}
 
@@ -3059,17 +3059,61 @@ qla24xx_bsg_request(struct bsg_job *bsg_job)
 	return ret;
 }
 
-int
-qla24xx_bsg_timeout(struct bsg_job *bsg_job)
+static bool qla_bsg_found(struct qla_qpair *qpair, struct bsg_job *bsg_job)
 {
+	bool found = false;
 	struct fc_bsg_reply *bsg_reply = bsg_job->reply;
 	scsi_qla_host_t *vha = shost_priv(fc_bsg_to_shost(bsg_job));
 	struct qla_hw_data *ha = vha->hw;
-	srb_t *sp;
-	int cnt, que;
+	srb_t *sp = NULL;
+	int cnt;
 	unsigned long flags;
 	struct req_que *req;
 
+	spin_lock_irqsave(qpair->qp_lock_ptr, flags);
+	req = qpair->req;
+
+	for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
+		sp = req->outstanding_cmds[cnt];
+		if (sp &&
+		    (sp->type == SRB_CT_CMD ||
+		     sp->type == SRB_ELS_CMD_HST ||
+		     sp->type == SRB_ELS_CMD_HST_NOLOGIN) &&
+		    sp->u.bsg_job == bsg_job) {
+			req->outstanding_cmds[cnt] = NULL;
+			spin_unlock_irqrestore(qpair->qp_lock_ptr, flags);
+
+			if (!ha->flags.eeh_busy && ha->isp_ops->abort_command(sp)) {
+				ql_log(ql_log_warn, vha, 0x7089,
+						"mbx abort_command failed.\n");
+				bsg_reply->result = -EIO;
+			} else {
+				ql_dbg(ql_dbg_user, vha, 0x708a,
+						"mbx abort_command success.\n");
+				bsg_reply->result = 0;
+			}
+			/* ref: INIT */
+			kref_put(&sp->cmd_kref, qla2x00_sp_release);
+
+			found = true;
+			goto done;
+		}
+	}
+	spin_unlock_irqrestore(qpair->qp_lock_ptr, flags);
+
+done:
+	return found;
+}
+
+int
+qla24xx_bsg_timeout(struct bsg_job *bsg_job)
+{
+	struct fc_bsg_reply *bsg_reply = bsg_job->reply;
+	scsi_qla_host_t *vha = shost_priv(fc_bsg_to_shost(bsg_job));
+	struct qla_hw_data *ha = vha->hw;
+	int i;
+	struct qla_qpair *qpair;
+
 	ql_log(ql_log_info, vha, 0x708b, "%s CMD timeout. bsg ptr %p.\n",
 	    __func__, bsg_job);
 
@@ -3079,48 +3123,22 @@ qla24xx_bsg_timeout(struct bsg_job *bsg_job)
 		qla_pci_set_eeh_busy(vha);
 	}
 
+	if (qla_bsg_found(ha->base_qpair, bsg_job))
+		goto done;
+
 	/* find the bsg job from the active list of commands */
-	spin_lock_irqsave(&ha->hardware_lock, flags);
-	for (que = 0; que < ha->max_req_queues; que++) {
-		req = ha->req_q_map[que];
-		if (!req)
+	for (i = 0; i < ha->max_qpairs; i++) {
+		qpair = vha->hw->queue_pair_map[i];
+		if (!qpair)
 			continue;
-
-		for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
-			sp = req->outstanding_cmds[cnt];
-			if (sp &&
-			    (sp->type == SRB_CT_CMD ||
-			     sp->type == SRB_ELS_CMD_HST ||
-			     sp->type == SRB_ELS_CMD_HST_NOLOGIN ||
-			     sp->type == SRB_FXIOCB_BCMD) &&
-			    sp->u.bsg_job == bsg_job) {
-				req->outstanding_cmds[cnt] = NULL;
-				spin_unlock_irqrestore(&ha->hardware_lock, flags);
-
-				if (!ha->flags.eeh_busy && ha->isp_ops->abort_command(sp)) {
-					ql_log(ql_log_warn, vha, 0x7089,
-					    "mbx abort_command failed.\n");
-					bsg_reply->result = -EIO;
-				} else {
-					ql_dbg(ql_dbg_user, vha, 0x708a,
-					    "mbx abort_command success.\n");
-					bsg_reply->result = 0;
-				}
-				spin_lock_irqsave(&ha->hardware_lock, flags);
-				goto done;
-
-			}
-		}
+		if (qla_bsg_found(qpair, bsg_job))
+			goto done;
 	}
-	spin_unlock_irqrestore(&ha->hardware_lock, flags);
+
 	ql_log(ql_log_info, vha, 0x708b, "SRB not found to abort.\n");
 	bsg_reply->result = -ENXIO;
-	return 0;
 
 done:
-	spin_unlock_irqrestore(&ha->hardware_lock, flags);
-	/* ref: INIT */
-	kref_put(&sp->cmd_kref, qla2x00_sp_release);
 	return 0;
 }
 
diff --git a/drivers/scsi/qla2xxx/qla_def.h b/drivers/scsi/qla2xxx/qla_def.h
index 31c451daeeb8..8490181424c7 100644
--- a/drivers/scsi/qla2xxx/qla_def.h
+++ b/drivers/scsi/qla2xxx/qla_def.h
@@ -3278,6 +3278,8 @@ struct fab_scan_rp {
 struct fab_scan {
 	struct fab_scan_rp *l;
 	u32 size;
+	u32 rscn_gen_start;
+	u32 rscn_gen_end;
 	u16 scan_retry;
 #define MAX_SCAN_RETRIES 5
 	enum scan_flags_t scan_flags;
@@ -4985,6 +4987,7 @@ typedef struct scsi_qla_host {
 
 	/* Counter to detect races between ELS and RSCN events */
 	atomic_t		generation_tick;
+	atomic_t		rscn_gen;
 	/* Time when global fcport update has been scheduled */
 	int			total_fcport_update_gen;
 	/* List of pending LOGOs, protected by tgt_mutex */
diff --git a/drivers/scsi/qla2xxx/qla_gs.c b/drivers/scsi/qla2xxx/qla_gs.c
index 64ab070b8716..9c707d677f64 100644
--- a/drivers/scsi/qla2xxx/qla_gs.c
+++ b/drivers/scsi/qla2xxx/qla_gs.c
@@ -1710,7 +1710,7 @@ qla2x00_hba_attributes(scsi_qla_host_t *vha, void *entries,
 	eiter->type = cpu_to_be16(FDMI_HBA_OPTION_ROM_VERSION);
 	alen = scnprintf(
 		eiter->a.orom_version, sizeof(eiter->a.orom_version),
-		"%d.%02d", ha->bios_revision[1], ha->bios_revision[0]);
+		"%d.%02d", ha->efi_revision[1], ha->efi_revision[0]);
 	alen += FDMI_ATTR_ALIGNMENT(alen);
 	alen += FDMI_ATTR_TYPELEN(eiter);
 	eiter->len = cpu_to_be16(alen);
@@ -3465,6 +3465,29 @@ static int qla2x00_is_a_vp(scsi_qla_host_t *vha, u64 wwn)
 	return rc;
 }
 
+static bool qla_ok_to_clear_rscn(scsi_qla_host_t *vha, fc_port_t *fcport)
+{
+	u32 rscn_gen;
+
+	rscn_gen = atomic_read(&vha->rscn_gen);
+	ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x2017,
+	    "%s %d %8phC rscn_gen %x start %x end %x current %x\n",
+	    __func__, __LINE__, fcport->port_name, fcport->rscn_gen,
+	    vha->scan.rscn_gen_start, vha->scan.rscn_gen_end, rscn_gen);
+
+	if (val_is_in_range(fcport->rscn_gen, vha->scan.rscn_gen_start,
+	    vha->scan.rscn_gen_end))
+		/* rscn came in before fabric scan */
+		return true;
+
+	if (val_is_in_range(fcport->rscn_gen, vha->scan.rscn_gen_end, rscn_gen))
+		/* rscn came in after fabric scan */
+		return false;
+
+	/* rare: fcport's scan_needed + rscn_gen must be stale */
+	return true;
+}
+
 void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
 {
 	fc_port_t *fcport;
@@ -3578,10 +3601,10 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
 				   (fcport->scan_needed &&
 				    fcport->port_type != FCT_INITIATOR &&
 				    fcport->port_type != FCT_NVME_INITIATOR)) {
+				fcport->scan_needed = 0;
 				qlt_schedule_sess_for_deletion(fcport);
 			}
 			fcport->d_id.b24 = rp->id.b24;
-			fcport->scan_needed = 0;
 			break;
 		}
 
@@ -3622,7 +3645,9 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
 				do_delete = true;
 			}
 
-			fcport->scan_needed = 0;
+			if (qla_ok_to_clear_rscn(vha, fcport))
+				fcport->scan_needed = 0;
+
 			if (((qla_dual_mode_enabled(vha) ||
 			      qla_ini_mode_enabled(vha)) &&
 			    atomic_read(&fcport->state) == FCS_ONLINE) ||
@@ -3652,7 +3677,9 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
 					    fcport->port_name, fcport->loop_id,
 					    fcport->login_retry);
 				}
-				fcport->scan_needed = 0;
+
+				if (qla_ok_to_clear_rscn(vha, fcport))
+					fcport->scan_needed = 0;
 				qla24xx_fcport_handle_login(vha, fcport);
 			}
 		}
diff --git a/drivers/scsi/qla2xxx/qla_init.c b/drivers/scsi/qla2xxx/qla_init.c
index 6dce3f166564..a65c60160820 100644
--- a/drivers/scsi/qla2xxx/qla_init.c
+++ b/drivers/scsi/qla2xxx/qla_init.c
@@ -1843,10 +1843,18 @@ int qla24xx_post_newsess_work(struct scsi_qla_host *vha, port_id_t *id,
 	return qla2x00_post_work(vha, e);
 }
 
+static void qla_rscn_gen_tick(scsi_qla_host_t *vha, u32 *ret_rscn_gen)
+{
+	*ret_rscn_gen = atomic_inc_return(&vha->rscn_gen);
+	/* memory barrier */
+	wmb();
+}
+
 void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 {
 	fc_port_t *fcport;
 	unsigned long flags;
+	u32 rscn_gen;
 
 	switch (ea->id.b.rsvd_1) {
 	case RSCN_PORT_ADDR:
@@ -1876,15 +1884,16 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 					 * Otherwise we're already in the middle of a relogin
 					 */
 					fcport->scan_needed = 1;
-					fcport->rscn_gen++;
+					qla_rscn_gen_tick(vha, &fcport->rscn_gen);
 				}
 			} else {
 				fcport->scan_needed = 1;
-				fcport->rscn_gen++;
+				qla_rscn_gen_tick(vha, &fcport->rscn_gen);
 			}
 		}
 		break;
 	case RSCN_AREA_ADDR:
+		qla_rscn_gen_tick(vha, &rscn_gen);
 		list_for_each_entry(fcport, &vha->vp_fcports, list) {
 			if (fcport->flags & FCF_FCP2_DEVICE &&
 			    atomic_read(&fcport->state) == FCS_ONLINE)
@@ -1892,11 +1901,12 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 
 			if ((ea->id.b24 & 0xffff00) == (fcport->d_id.b24 & 0xffff00)) {
 				fcport->scan_needed = 1;
-				fcport->rscn_gen++;
+				fcport->rscn_gen = rscn_gen;
 			}
 		}
 		break;
 	case RSCN_DOM_ADDR:
+		qla_rscn_gen_tick(vha, &rscn_gen);
 		list_for_each_entry(fcport, &vha->vp_fcports, list) {
 			if (fcport->flags & FCF_FCP2_DEVICE &&
 			    atomic_read(&fcport->state) == FCS_ONLINE)
@@ -1904,19 +1914,20 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 
 			if ((ea->id.b24 & 0xff0000) == (fcport->d_id.b24 & 0xff0000)) {
 				fcport->scan_needed = 1;
-				fcport->rscn_gen++;
+				fcport->rscn_gen = rscn_gen;
 			}
 		}
 		break;
 	case RSCN_FAB_ADDR:
 	default:
+		qla_rscn_gen_tick(vha, &rscn_gen);
 		list_for_each_entry(fcport, &vha->vp_fcports, list) {
 			if (fcport->flags & FCF_FCP2_DEVICE &&
 			    atomic_read(&fcport->state) == FCS_ONLINE)
 				continue;
 
 			fcport->scan_needed = 1;
-			fcport->rscn_gen++;
+			fcport->rscn_gen = rscn_gen;
 		}
 		break;
 	}
@@ -1925,6 +1936,7 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 	if (vha->scan.scan_flags == 0) {
 		ql_dbg(ql_dbg_disc, vha, 0xffff, "%s: schedule\n", __func__);
 		vha->scan.scan_flags |= SF_QUEUED;
+		vha->scan.rscn_gen_start = atomic_read(&vha->rscn_gen);
 		schedule_delayed_work(&vha->scan.scan_work, 5);
 	}
 	spin_unlock_irqrestore(&vha->work_lock, flags);
@@ -6419,6 +6431,8 @@ qla2x00_configure_fabric(scsi_qla_host_t *vha)
 		qlt_do_generation_tick(vha, &discovery_gen);
 
 		if (USE_ASYNC_SCAN(ha)) {
+			/* start of scan begins here */
+			vha->scan.rscn_gen_end = atomic_read(&vha->rscn_gen);
 			rval = qla24xx_async_gpnft(vha, FC4_TYPE_FCP_SCSI,
 			    NULL);
 			if (rval)
@@ -8260,15 +8274,21 @@ qla28xx_get_aux_images(
 	struct qla27xx_image_status pri_aux_image_status, sec_aux_image_status;
 	bool valid_pri_image = false, valid_sec_image = false;
 	bool active_pri_image = false, active_sec_image = false;
+	int rc;
 
 	if (!ha->flt_region_aux_img_status_pri) {
 		ql_dbg(ql_dbg_init, vha, 0x018a, "Primary aux image not addressed\n");
 		goto check_sec_image;
 	}
 
-	qla24xx_read_flash_data(vha, (uint32_t *)&pri_aux_image_status,
+	rc = qla24xx_read_flash_data(vha, (uint32_t *)&pri_aux_image_status,
 	    ha->flt_region_aux_img_status_pri,
 	    sizeof(pri_aux_image_status) >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x01a1,
+		    "Unable to read Primary aux image(%x).\n", rc);
+		goto check_sec_image;
+	}
 	qla27xx_print_image(vha, "Primary aux image", &pri_aux_image_status);
 
 	if (qla28xx_check_aux_image_status_signature(&pri_aux_image_status)) {
@@ -8299,9 +8319,15 @@ qla28xx_get_aux_images(
 		goto check_valid_image;
 	}
 
-	qla24xx_read_flash_data(vha, (uint32_t *)&sec_aux_image_status,
+	rc = qla24xx_read_flash_data(vha, (uint32_t *)&sec_aux_image_status,
 	    ha->flt_region_aux_img_status_sec,
 	    sizeof(sec_aux_image_status) >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x01a2,
+		    "Unable to read Secondary aux image(%x).\n", rc);
+		goto check_valid_image;
+	}
+
 	qla27xx_print_image(vha, "Secondary aux image", &sec_aux_image_status);
 
 	if (qla28xx_check_aux_image_status_signature(&sec_aux_image_status)) {
@@ -8359,6 +8385,7 @@ qla27xx_get_active_image(struct scsi_qla_host *vha,
 	struct qla27xx_image_status pri_image_status, sec_image_status;
 	bool valid_pri_image = false, valid_sec_image = false;
 	bool active_pri_image = false, active_sec_image = false;
+	int rc;
 
 	if (!ha->flt_region_img_status_pri) {
 		ql_dbg(ql_dbg_init, vha, 0x018a, "Primary image not addressed\n");
@@ -8400,8 +8427,14 @@ qla27xx_get_active_image(struct scsi_qla_host *vha,
 		goto check_valid_image;
 	}
 
-	qla24xx_read_flash_data(vha, (uint32_t *)(&sec_image_status),
+	rc = qla24xx_read_flash_data(vha, (uint32_t *)(&sec_image_status),
 	    ha->flt_region_img_status_sec, sizeof(sec_image_status) >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x01a3,
+		    "Unable to read Secondary image status(%x).\n", rc);
+		goto check_valid_image;
+	}
+
 	qla27xx_print_image(vha, "Secondary image", &sec_image_status);
 
 	if (qla27xx_check_image_status_signature(&sec_image_status)) {
@@ -8473,11 +8506,10 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 	    "FW: Loading firmware from flash (%x).\n", faddr);
 
 	dcode = (uint32_t *)req->ring;
-	qla24xx_read_flash_data(vha, dcode, faddr, 8);
-	if (qla24xx_risc_firmware_invalid(dcode)) {
+	rval = qla24xx_read_flash_data(vha, dcode, faddr, 8);
+	if (rval || qla24xx_risc_firmware_invalid(dcode)) {
 		ql_log(ql_log_fatal, vha, 0x008c,
-		    "Unable to verify the integrity of flash firmware "
-		    "image.\n");
+		    "Unable to verify the integrity of flash firmware image (rval %x).\n", rval);
 		ql_log(ql_log_fatal, vha, 0x008d,
 		    "Firmware data: %08x %08x %08x %08x.\n",
 		    dcode[0], dcode[1], dcode[2], dcode[3]);
@@ -8491,7 +8523,12 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 	for (j = 0; j < segments; j++) {
 		ql_dbg(ql_dbg_init, vha, 0x008d,
 		    "-> Loading segment %u...\n", j);
-		qla24xx_read_flash_data(vha, dcode, faddr, 10);
+		rval = qla24xx_read_flash_data(vha, dcode, faddr, 10);
+		if (rval) {
+			ql_log(ql_log_fatal, vha, 0x016a,
+			    "-> Unable to read segment addr + size .\n");
+			return QLA_FUNCTION_FAILED;
+		}
 		risc_addr = be32_to_cpu((__force __be32)dcode[2]);
 		risc_size = be32_to_cpu((__force __be32)dcode[3]);
 		if (!*srisc_addr) {
@@ -8507,7 +8544,13 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 			ql_dbg(ql_dbg_init, vha, 0x008e,
 			    "-> Loading fragment %u: %#x <- %#x (%#lx dwords)...\n",
 			    fragment, risc_addr, faddr, dlen);
-			qla24xx_read_flash_data(vha, dcode, faddr, dlen);
+			rval = qla24xx_read_flash_data(vha, dcode, faddr, dlen);
+			if (rval) {
+				ql_log(ql_log_fatal, vha, 0x016b,
+				    "-> Unable to read fragment(faddr %#x dlen %#lx).\n",
+				    faddr, dlen);
+				return QLA_FUNCTION_FAILED;
+			}
 			for (i = 0; i < dlen; i++)
 				dcode[i] = swab32(dcode[i]);
 
@@ -8536,7 +8579,14 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 		fwdt->length = 0;
 
 		dcode = (uint32_t *)req->ring;
-		qla24xx_read_flash_data(vha, dcode, faddr, 7);
+
+		rval = qla24xx_read_flash_data(vha, dcode, faddr, 7);
+		if (rval) {
+			ql_log(ql_log_fatal, vha, 0x016c,
+			    "-> Unable to read template size.\n");
+			goto failed;
+		}
+
 		risc_size = be32_to_cpu((__force __be32)dcode[2]);
 		ql_dbg(ql_dbg_init, vha, 0x0161,
 		    "-> fwdt%u template array at %#x (%#x dwords)\n",
@@ -8562,11 +8612,12 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 		}
 
 		dcode = fwdt->template;
-		qla24xx_read_flash_data(vha, dcode, faddr, risc_size);
+		rval = qla24xx_read_flash_data(vha, dcode, faddr, risc_size);
 
-		if (!qla27xx_fwdt_template_valid(dcode)) {
+		if (rval || !qla27xx_fwdt_template_valid(dcode)) {
 			ql_log(ql_log_warn, vha, 0x0165,
-			    "-> fwdt%u failed template validate\n", j);
+			    "-> fwdt%u failed template validate (rval %x)\n",
+			    j, rval);
 			goto failed;
 		}
 
diff --git a/drivers/scsi/qla2xxx/qla_inline.h b/drivers/scsi/qla2xxx/qla_inline.h
index a4a56ab0ba74..ef4b3cc1cd77 100644
--- a/drivers/scsi/qla2xxx/qla_inline.h
+++ b/drivers/scsi/qla2xxx/qla_inline.h
@@ -631,3 +631,11 @@ static inline int qla_mapq_alloc_qp_cpu_map(struct qla_hw_data *ha)
 	}
 	return 0;
 }
+
+static inline bool val_is_in_range(u32 val, u32 start, u32 end)
+{
+	if (val >= start && val <= end)
+		return true;
+	else
+		return false;
+}
diff --git a/drivers/scsi/qla2xxx/qla_mid.c b/drivers/scsi/qla2xxx/qla_mid.c
index 16a9f22bb860..9e8df452ee14 100644
--- a/drivers/scsi/qla2xxx/qla_mid.c
+++ b/drivers/scsi/qla2xxx/qla_mid.c
@@ -180,7 +180,7 @@ qla24xx_disable_vp(scsi_qla_host_t *vha)
 	atomic_set(&vha->loop_state, LOOP_DOWN);
 	atomic_set(&vha->loop_down_timer, LOOP_DOWN_TIME);
 	list_for_each_entry(fcport, &vha->vp_fcports, list)
-		fcport->logout_on_delete = 0;
+		fcport->logout_on_delete = 1;
 
 	if (!vha->hw->flags.edif_enabled)
 		qla2x00_wait_for_sess_deletion(vha);
diff --git a/drivers/scsi/qla2xxx/qla_nvme.c b/drivers/scsi/qla2xxx/qla_nvme.c
index 9941b38eac93..622b11660b67 100644
--- a/drivers/scsi/qla2xxx/qla_nvme.c
+++ b/drivers/scsi/qla2xxx/qla_nvme.c
@@ -29,7 +29,10 @@ int qla_nvme_register_remote(struct scsi_qla_host *vha, struct fc_port *fcport)
 		return 0;
 	}
 
-	if (!vha->nvme_local_port && qla_nvme_register_hba(vha))
+	if (qla_nvme_register_hba(vha))
+		return 0;
+
+	if (!vha->nvme_local_port)
 		return 0;
 
 	if (!(fcport->nvme_prli_service_param &
diff --git a/drivers/scsi/qla2xxx/qla_os.c b/drivers/scsi/qla2xxx/qla_os.c
index 25d0c2bfdd74..41a7ffaabfd1 100644
--- a/drivers/scsi/qla2xxx/qla_os.c
+++ b/drivers/scsi/qla2xxx/qla_os.c
@@ -1869,14 +1869,9 @@ __qla2x00_abort_all_cmds(struct qla_qpair *qp, int res)
 	for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
 		sp = req->outstanding_cmds[cnt];
 		if (sp) {
-			/*
-			 * perform lockless completion during driver unload
-			 */
 			if (qla2x00_chip_is_down(vha)) {
 				req->outstanding_cmds[cnt] = NULL;
-				spin_unlock_irqrestore(qp->qp_lock_ptr, flags);
 				sp->done(sp, res);
-				spin_lock_irqsave(qp->qp_lock_ptr, flags);
 				continue;
 			}
 
@@ -4667,7 +4662,7 @@ static void
 qla2x00_number_of_exch(scsi_qla_host_t *vha, u32 *ret_cnt, u16 max_cnt)
 {
 	u32 temp;
-	struct init_cb_81xx *icb = (struct init_cb_81xx *)&vha->hw->init_cb;
+	struct init_cb_81xx *icb = (struct init_cb_81xx *)vha->hw->init_cb;
 	*ret_cnt = FW_DEF_EXCHANGES_CNT;
 
 	if (max_cnt > vha->hw->max_exchg)
diff --git a/drivers/scsi/qla2xxx/qla_sup.c b/drivers/scsi/qla2xxx/qla_sup.c
index c092a6b1ced4..6d16546e1729 100644
--- a/drivers/scsi/qla2xxx/qla_sup.c
+++ b/drivers/scsi/qla2xxx/qla_sup.c
@@ -555,6 +555,7 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
 	struct qla_flt_location *fltl = (void *)req->ring;
 	uint32_t *dcode = (uint32_t *)req->ring;
 	uint8_t *buf = (void *)req->ring, *bcode,  last_image;
+	int rc;
 
 	/*
 	 * FLT-location structure resides after the last PCI region.
@@ -584,14 +585,24 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
 	pcihdr = 0;
 	do {
 		/* Verify PCI expansion ROM header. */
-		qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+		rc = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+		if (rc) {
+			ql_log(ql_log_info, vha, 0x016d,
+			    "Unable to read PCI Expansion Rom Header (%x).\n", rc);
+			return QLA_FUNCTION_FAILED;
+		}
 		bcode = buf + (pcihdr % 4);
 		if (bcode[0x0] != 0x55 || bcode[0x1] != 0xaa)
 			goto end;
 
 		/* Locate PCI data structure. */
 		pcids = pcihdr + ((bcode[0x19] << 8) | bcode[0x18]);
-		qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+		rc = qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+		if (rc) {
+			ql_log(ql_log_info, vha, 0x0179,
+			    "Unable to read PCI Data Structure (%x).\n", rc);
+			return QLA_FUNCTION_FAILED;
+		}
 		bcode = buf + (pcihdr % 4);
 
 		/* Validate signature of PCI data structure. */
@@ -606,7 +617,12 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
 	} while (!last_image);
 
 	/* Now verify FLT-location structure. */
-	qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, sizeof(*fltl) >> 2);
+	rc = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, sizeof(*fltl) >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x017a,
+		    "Unable to read FLT (%x).\n", rc);
+		return QLA_FUNCTION_FAILED;
+	}
 	if (memcmp(fltl->sig, "QFLT", 4))
 		goto end;
 
@@ -2605,13 +2621,18 @@ qla24xx_read_optrom_data(struct scsi_qla_host *vha, void *buf,
     uint32_t offset, uint32_t length)
 {
 	struct qla_hw_data *ha = vha->hw;
+	int rc;
 
 	/* Suspend HBA. */
 	scsi_block_requests(vha->host);
 	set_bit(MBX_UPDATE_FLASH_ACTIVE, &ha->mbx_cmd_flags);
 
 	/* Go with read. */
-	qla24xx_read_flash_data(vha, buf, offset >> 2, length >> 2);
+	rc = qla24xx_read_flash_data(vha, buf, offset >> 2, length >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x01a0,
+		    "Unable to perform optrom read(%x).\n", rc);
+	}
 
 	/* Resume HBA. */
 	clear_bit(MBX_UPDATE_FLASH_ACTIVE, &ha->mbx_cmd_flags);
@@ -3412,7 +3433,7 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 	struct active_regions active_regions = { };
 
 	if (IS_P3P_TYPE(ha))
-		return ret;
+		return QLA_SUCCESS;
 
 	if (!mbuf)
 		return QLA_FUNCTION_FAILED;
@@ -3432,20 +3453,31 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 
 	do {
 		/* Verify PCI expansion ROM header. */
-		qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+		ret = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+		if (ret) {
+			ql_log(ql_log_info, vha, 0x017d,
+			    "Unable to read PCI EXP Rom Header(%x).\n", ret);
+			return QLA_FUNCTION_FAILED;
+		}
+
 		bcode = mbuf + (pcihdr % 4);
 		if (memcmp(bcode, "\x55\xaa", 2)) {
 			/* No signature */
 			ql_log(ql_log_fatal, vha, 0x0059,
 			    "No matching ROM signature.\n");
-			ret = QLA_FUNCTION_FAILED;
-			break;
+			return QLA_FUNCTION_FAILED;
 		}
 
 		/* Locate PCI data structure. */
 		pcids = pcihdr + ((bcode[0x19] << 8) | bcode[0x18]);
 
-		qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+		ret = qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+		if (ret) {
+			ql_log(ql_log_info, vha, 0x018e,
+			    "Unable to read PCI Data Structure (%x).\n", ret);
+			return QLA_FUNCTION_FAILED;
+		}
+
 		bcode = mbuf + (pcihdr % 4);
 
 		/* Validate signature of PCI data structure. */
@@ -3454,8 +3486,7 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 			ql_log(ql_log_fatal, vha, 0x005a,
 			    "PCI data struct not found pcir_adr=%x.\n", pcids);
 			ql_dump_buffer(ql_dbg_init, vha, 0x0059, dcode, 32);
-			ret = QLA_FUNCTION_FAILED;
-			break;
+			return QLA_FUNCTION_FAILED;
 		}
 
 		/* Read version */
@@ -3507,20 +3538,26 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 			faddr = ha->flt_region_fw_sec;
 	}
 
-	qla24xx_read_flash_data(vha, dcode, faddr, 8);
-	if (qla24xx_risc_firmware_invalid(dcode)) {
-		ql_log(ql_log_warn, vha, 0x005f,
-		    "Unrecognized fw revision at %x.\n",
-		    ha->flt_region_fw * 4);
-		ql_dump_buffer(ql_dbg_init, vha, 0x005f, dcode, 32);
+	ret = qla24xx_read_flash_data(vha, dcode, faddr, 8);
+	if (ret) {
+		ql_log(ql_log_info, vha, 0x019e,
+		    "Unable to read FW version (%x).\n", ret);
+		return ret;
 	} else {
-		for (i = 0; i < 4; i++)
-			ha->fw_revision[i] =
+		if (qla24xx_risc_firmware_invalid(dcode)) {
+			ql_log(ql_log_warn, vha, 0x005f,
+			    "Unrecognized fw revision at %x.\n",
+			    ha->flt_region_fw * 4);
+			ql_dump_buffer(ql_dbg_init, vha, 0x005f, dcode, 32);
+		} else {
+			for (i = 0; i < 4; i++)
+				ha->fw_revision[i] =
 				be32_to_cpu((__force __be32)dcode[4+i]);
-		ql_dbg(ql_dbg_init, vha, 0x0060,
-		    "Firmware revision (flash) %u.%u.%u (%x).\n",
-		    ha->fw_revision[0], ha->fw_revision[1],
-		    ha->fw_revision[2], ha->fw_revision[3]);
+			ql_dbg(ql_dbg_init, vha, 0x0060,
+			    "Firmware revision (flash) %u.%u.%u (%x).\n",
+			    ha->fw_revision[0], ha->fw_revision[1],
+			    ha->fw_revision[2], ha->fw_revision[3]);
+		}
 	}
 
 	/* Check for golden firmware and get version if available */
@@ -3531,18 +3568,23 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 
 	memset(ha->gold_fw_version, 0, sizeof(ha->gold_fw_version));
 	faddr = ha->flt_region_gold_fw;
-	qla24xx_read_flash_data(vha, dcode, ha->flt_region_gold_fw, 8);
-	if (qla24xx_risc_firmware_invalid(dcode)) {
-		ql_log(ql_log_warn, vha, 0x0056,
-		    "Unrecognized golden fw at %#x.\n", faddr);
-		ql_dump_buffer(ql_dbg_init, vha, 0x0056, dcode, 32);
+	ret = qla24xx_read_flash_data(vha, dcode, ha->flt_region_gold_fw, 8);
+	if (ret) {
+		ql_log(ql_log_info, vha, 0x019f,
+		    "Unable to read Gold FW version (%x).\n", ret);
 		return ret;
-	}
-
-	for (i = 0; i < 4; i++)
-		ha->gold_fw_version[i] =
-			be32_to_cpu((__force __be32)dcode[4+i]);
+	} else {
+		if (qla24xx_risc_firmware_invalid(dcode)) {
+			ql_log(ql_log_warn, vha, 0x0056,
+			    "Unrecognized golden fw at %#x.\n", faddr);
+			ql_dump_buffer(ql_dbg_init, vha, 0x0056, dcode, 32);
+			return QLA_FUNCTION_FAILED;
+		}
 
+		for (i = 0; i < 4; i++)
+			ha->gold_fw_version[i] =
+			   be32_to_cpu((__force __be32)dcode[4+i]);
+	}
 	return ret;
 }
 
diff --git a/drivers/soc/qcom/pdr_interface.c b/drivers/soc/qcom/pdr_interface.c
index 0034af927b48..c7cd4daa10b0 100644
--- a/drivers/soc/qcom/pdr_interface.c
+++ b/drivers/soc/qcom/pdr_interface.c
@@ -76,12 +76,12 @@ static int pdr_locator_new_server(struct qmi_handle *qmi,
 					      locator_hdl);
 	struct pdr_service *pds;
 
+	mutex_lock(&pdr->lock);
 	/* Create a local client port for QMI communication */
 	pdr->locator_addr.sq_family = AF_QIPCRTR;
 	pdr->locator_addr.sq_node = svc->node;
 	pdr->locator_addr.sq_port = svc->port;
 
-	mutex_lock(&pdr->lock);
 	pdr->locator_init_complete = true;
 	mutex_unlock(&pdr->lock);
 
@@ -104,10 +104,10 @@ static void pdr_locator_del_server(struct qmi_handle *qmi,
 
 	mutex_lock(&pdr->lock);
 	pdr->locator_init_complete = false;
-	mutex_unlock(&pdr->lock);
 
 	pdr->locator_addr.sq_node = 0;
 	pdr->locator_addr.sq_port = 0;
+	mutex_unlock(&pdr->lock);
 }
 
 static const struct qmi_ops pdr_locator_ops = {
@@ -365,12 +365,14 @@ static int pdr_get_domain_list(struct servreg_get_domain_list_req *req,
 	if (ret < 0)
 		return ret;
 
+	mutex_lock(&pdr->lock);
 	ret = qmi_send_request(&pdr->locator_hdl,
 			       &pdr->locator_addr,
 			       &txn, SERVREG_GET_DOMAIN_LIST_REQ,
 			       SERVREG_GET_DOMAIN_LIST_REQ_MAX_LEN,
 			       servreg_get_domain_list_req_ei,
 			       req);
+	mutex_unlock(&pdr->lock);
 	if (ret < 0) {
 		qmi_txn_cancel(&txn);
 		return ret;
@@ -415,7 +417,7 @@ static int pdr_locate_service(struct pdr_handle *pdr, struct pdr_service *pds)
 		if (ret < 0)
 			goto out;
 
-		for (i = domains_read; i < resp->domain_list_len; i++) {
+		for (i = 0; i < resp->domain_list_len; i++) {
 			entry = &resp->domain_list[i];
 
 			if (strnlen(entry->name, sizeof(entry->name)) == sizeof(entry->name))
diff --git a/drivers/soc/qcom/rpmh-rsc.c b/drivers/soc/qcom/rpmh-rsc.c
index 5e7bb6338707..ff2b9eb9f669 100644
--- a/drivers/soc/qcom/rpmh-rsc.c
+++ b/drivers/soc/qcom/rpmh-rsc.c
@@ -608,13 +608,14 @@ int rpmh_rsc_send_data(struct rsc_drv *drv, const struct tcs_request *msg)
 {
 	struct tcs_group *tcs;
 	int tcs_id;
-	unsigned long flags;
+
+	might_sleep();
 
 	tcs = get_tcs_for_msg(drv, msg);
 	if (IS_ERR(tcs))
 		return PTR_ERR(tcs);
 
-	spin_lock_irqsave(&drv->lock, flags);
+	spin_lock_irq(&drv->lock);
 
 	/* Wait forever for a free tcs. It better be there eventually! */
 	wait_event_lock_irq(drv->tcs_wait,
@@ -632,7 +633,7 @@ int rpmh_rsc_send_data(struct rsc_drv *drv, const struct tcs_request *msg)
 		write_tcs_reg_sync(drv, RSC_DRV_CMD_ENABLE, tcs_id, 0);
 		enable_tcs_irq(drv, tcs_id, true);
 	}
-	spin_unlock_irqrestore(&drv->lock, flags);
+	spin_unlock_irq(&drv->lock);
 
 	/*
 	 * These two can be done after the lock is released because:
diff --git a/drivers/soc/qcom/rpmh.c b/drivers/soc/qcom/rpmh.c
index 01765ee9cdfb..c6df7ac0afeb 100644
--- a/drivers/soc/qcom/rpmh.c
+++ b/drivers/soc/qcom/rpmh.c
@@ -189,7 +189,6 @@ static int __rpmh_write(const struct device *dev, enum rpmh_state state,
 	}
 
 	if (state == RPMH_ACTIVE_ONLY_STATE) {
-		WARN_ON(irqs_disabled());
 		ret = rpmh_rsc_send_data(ctrlr_to_drv(ctrlr), &rpm_msg->msg);
 	} else {
 		/* Clean up our call by spoofing tx_done */
diff --git a/drivers/soc/xilinx/xlnx_event_manager.c b/drivers/soc/xilinx/xlnx_event_manager.c
index 8293cc40047f..82e317474023 100644
--- a/drivers/soc/xilinx/xlnx_event_manager.c
+++ b/drivers/soc/xilinx/xlnx_event_manager.c
@@ -3,6 +3,7 @@
  * Xilinx Event Management Driver
  *
  *  Copyright (C) 2021 Xilinx, Inc.
+ *  Copyright (C) 2024 Advanced Micro Devices, Inc.
  *
  *  Abhyuday Godhasara <abhyuday.godhasara@xilinx.com>
  */
@@ -19,7 +20,7 @@
 #include <linux/platform_device.h>
 #include <linux/slab.h>
 
-static DEFINE_PER_CPU_READ_MOSTLY(int, cpu_number1);
+static DEFINE_PER_CPU_READ_MOSTLY(int, dummy_cpu_number);
 
 static int virq_sgi;
 static int event_manager_availability = -EACCES;
@@ -555,7 +556,6 @@ static void xlnx_disable_percpu_irq(void *data)
 static int xlnx_event_init_sgi(struct platform_device *pdev)
 {
 	int ret = 0;
-	int cpu;
 	/*
 	 * IRQ related structures are used for the following:
 	 * for each SGI interrupt ensure its mapped by GIC IRQ domain
@@ -592,11 +592,8 @@ static int xlnx_event_init_sgi(struct platform_device *pdev)
 	sgi_fwspec.param[0] = sgi_num;
 	virq_sgi = irq_create_fwspec_mapping(&sgi_fwspec);
 
-	cpu = get_cpu();
-	per_cpu(cpu_number1, cpu) = cpu;
 	ret = request_percpu_irq(virq_sgi, xlnx_event_handler, "xlnx_event_mgmt",
-				 &cpu_number1);
-	put_cpu();
+				 &dummy_cpu_number);
 
 	WARN_ON(ret);
 	if (ret) {
@@ -612,16 +609,12 @@ static int xlnx_event_init_sgi(struct platform_device *pdev)
 
 static void xlnx_event_cleanup_sgi(struct platform_device *pdev)
 {
-	int cpu = smp_processor_id();
-
-	per_cpu(cpu_number1, cpu) = cpu;
-
 	cpuhp_remove_state(CPUHP_AP_ONLINE_DYN);
 
 	on_each_cpu(xlnx_disable_percpu_irq, NULL, 1);
 
 	irq_clear_status_flags(virq_sgi, IRQ_PER_CPU);
-	free_percpu_irq(virq_sgi, &cpu_number1);
+	free_percpu_irq(virq_sgi, &dummy_cpu_number);
 	irq_dispose_mapping(virq_sgi);
 }
 
diff --git a/drivers/soc/xilinx/zynqmp_power.c b/drivers/soc/xilinx/zynqmp_power.c
index 78a8a7545d1e..5d41763414ad 100644
--- a/drivers/soc/xilinx/zynqmp_power.c
+++ b/drivers/soc/xilinx/zynqmp_power.c
@@ -187,7 +187,9 @@ static int zynqmp_pm_probe(struct platform_device *pdev)
 	u32 pm_api_version;
 	struct mbox_client *client;
 
-	zynqmp_pm_get_api_version(&pm_api_version);
+	ret = zynqmp_pm_get_api_version(&pm_api_version);
+	if (ret)
+		return ret;
 
 	/* Check PM API version number */
 	if (pm_api_version < ZYNQMP_PM_VERSION)
diff --git a/drivers/spi/atmel-quadspi.c b/drivers/spi/atmel-quadspi.c
index 7e05b48dbd71..1f1aee28b1f7 100644
--- a/drivers/spi/atmel-quadspi.c
+++ b/drivers/spi/atmel-quadspi.c
@@ -724,8 +724,15 @@ static int __maybe_unused atmel_qspi_resume(struct device *dev)
 	struct atmel_qspi *aq = spi_controller_get_devdata(ctrl);
 	int ret;
 
-	clk_prepare(aq->pclk);
-	clk_prepare(aq->qspick);
+	ret = clk_prepare(aq->pclk);
+	if (ret)
+		return ret;
+
+	ret = clk_prepare(aq->qspick);
+	if (ret) {
+		clk_unprepare(aq->pclk);
+		return ret;
+	}
 
 	ret = pm_runtime_force_resume(dev);
 	if (ret < 0)
diff --git a/drivers/spi/spi-microchip-core.c b/drivers/spi/spi-microchip-core.c
index d352844c798c..bfad0fe743ad 100644
--- a/drivers/spi/spi-microchip-core.c
+++ b/drivers/spi/spi-microchip-core.c
@@ -21,7 +21,7 @@
 #include <linux/spi/spi.h>
 
 #define MAX_LEN				(0xffff)
-#define MAX_CS				(8)
+#define MAX_CS				(1)
 #define DEFAULT_FRAMESIZE		(8)
 #define FIFO_DEPTH			(32)
 #define CLK_GEN_MODE1_MAX		(255)
@@ -75,6 +75,7 @@
 
 #define REG_CONTROL		(0x00)
 #define REG_FRAME_SIZE		(0x04)
+#define  FRAME_SIZE_MASK	GENMASK(5, 0)
 #define REG_STATUS		(0x08)
 #define REG_INT_CLEAR		(0x0c)
 #define REG_RX_DATA		(0x10)
@@ -89,6 +90,7 @@
 #define REG_RIS			(0x24)
 #define REG_CONTROL2		(0x28)
 #define REG_COMMAND		(0x2c)
+#define  COMMAND_CLRFRAMECNT	BIT(4)
 #define REG_PKTSIZE		(0x30)
 #define REG_CMD_SIZE		(0x34)
 #define REG_HWSTATUS		(0x38)
@@ -157,62 +159,59 @@ static inline void mchp_corespi_read_fifo(struct mchp_corespi *spi)
 
 static void mchp_corespi_enable_ints(struct mchp_corespi *spi)
 {
-	u32 control, mask = INT_ENABLE_MASK;
-
-	mchp_corespi_disable(spi);
-
-	control = mchp_corespi_read(spi, REG_CONTROL);
-
-	control |= mask;
-	mchp_corespi_write(spi, REG_CONTROL, control);
+	u32 control = mchp_corespi_read(spi, REG_CONTROL);
 
-	control |= CONTROL_ENABLE;
+	control |= INT_ENABLE_MASK;
 	mchp_corespi_write(spi, REG_CONTROL, control);
 }
 
 static void mchp_corespi_disable_ints(struct mchp_corespi *spi)
 {
-	u32 control, mask = INT_ENABLE_MASK;
-
-	mchp_corespi_disable(spi);
-
-	control = mchp_corespi_read(spi, REG_CONTROL);
-	control &= ~mask;
-	mchp_corespi_write(spi, REG_CONTROL, control);
+	u32 control = mchp_corespi_read(spi, REG_CONTROL);
 
-	control |= CONTROL_ENABLE;
+	control &= ~INT_ENABLE_MASK;
 	mchp_corespi_write(spi, REG_CONTROL, control);
 }
 
 static inline void mchp_corespi_set_xfer_size(struct mchp_corespi *spi, int len)
 {
 	u32 control;
-	u16 lenpart;
+	u32 lenpart;
+	u32 frames = mchp_corespi_read(spi, REG_FRAMESUP);
 
 	/*
-	 * Disable the SPI controller. Writes to transfer length have
-	 * no effect when the controller is enabled.
+	 * Writing to FRAMECNT in REG_CONTROL will reset the frame count, taking
+	 * a shortcut requires an explicit clear.
 	 */
-	mchp_corespi_disable(spi);
+	if (frames == len) {
+		mchp_corespi_write(spi, REG_COMMAND, COMMAND_CLRFRAMECNT);
+		return;
+	}
 
 	/*
 	 * The lower 16 bits of the frame count are stored in the control reg
 	 * for legacy reasons, but the upper 16 written to a different register:
 	 * FRAMESUP. While both the upper and lower bits can be *READ* from the
-	 * FRAMESUP register, writing to the lower 16 bits is a NOP
+	 * FRAMESUP register, writing to the lower 16 bits is (supposedly) a NOP.
+	 *
+	 * The driver used to disable the controller while modifying the frame
+	 * count, and mask off the lower 16 bits of len while writing to
+	 * FRAMES_UP. When the driver was changed to disable the controller as
+	 * infrequently as possible, it was discovered that the logic of
+	 * lenpart = len & 0xffff_0000
+	 * write(REG_FRAMESUP, lenpart)
+	 * would actually write zeros into the lower 16 bits on an mpfs250t-es,
+	 * despite documentation stating these bits were read-only.
+	 * Writing len unmasked into FRAMES_UP ensures those bits aren't zeroed
+	 * on an mpfs250t-es and will be a NOP for the lower 16 bits on hardware
+	 * that matches the documentation.
 	 */
 	lenpart = len & 0xffff;
-
 	control = mchp_corespi_read(spi, REG_CONTROL);
 	control &= ~CONTROL_FRAMECNT_MASK;
 	control |= lenpart << CONTROL_FRAMECNT_SHIFT;
 	mchp_corespi_write(spi, REG_CONTROL, control);
-
-	lenpart = len & 0xffff0000;
-	mchp_corespi_write(spi, REG_FRAMESUP, lenpart);
-
-	control |= CONTROL_ENABLE;
-	mchp_corespi_write(spi, REG_CONTROL, control);
+	mchp_corespi_write(spi, REG_FRAMESUP, len);
 }
 
 static inline void mchp_corespi_write_fifo(struct mchp_corespi *spi)
@@ -235,17 +234,22 @@ static inline void mchp_corespi_write_fifo(struct mchp_corespi *spi)
 
 static inline void mchp_corespi_set_framesize(struct mchp_corespi *spi, int bt)
 {
+	u32 frame_size = mchp_corespi_read(spi, REG_FRAME_SIZE);
 	u32 control;
 
+	if ((frame_size & FRAME_SIZE_MASK) == bt)
+		return;
+
 	/*
 	 * Disable the SPI controller. Writes to the frame size have
 	 * no effect when the controller is enabled.
 	 */
-	mchp_corespi_disable(spi);
+	control = mchp_corespi_read(spi, REG_CONTROL);
+	control &= ~CONTROL_ENABLE;
+	mchp_corespi_write(spi, REG_CONTROL, control);
 
 	mchp_corespi_write(spi, REG_FRAME_SIZE, bt);
 
-	control = mchp_corespi_read(spi, REG_CONTROL);
 	control |= CONTROL_ENABLE;
 	mchp_corespi_write(spi, REG_CONTROL, control);
 }
@@ -253,7 +257,7 @@ static inline void mchp_corespi_set_framesize(struct mchp_corespi *spi, int bt)
 static void mchp_corespi_set_cs(struct spi_device *spi, bool disable)
 {
 	u32 reg;
-	struct mchp_corespi *corespi = spi_master_get_devdata(spi->master);
+	struct mchp_corespi *corespi = spi_controller_get_devdata(spi->controller);
 
 	reg = mchp_corespi_read(corespi, REG_SLAVE_SELECT);
 	reg &= ~BIT(spi->chip_select);
@@ -264,11 +268,11 @@ static void mchp_corespi_set_cs(struct spi_device *spi, bool disable)
 
 static int mchp_corespi_setup(struct spi_device *spi)
 {
-	struct mchp_corespi *corespi = spi_master_get_devdata(spi->master);
+	struct mchp_corespi *corespi = spi_controller_get_devdata(spi->controller);
 	u32 reg;
 
 	/*
-	 * Active high slaves need to be specifically set to their inactive
+	 * Active high targets need to be specifically set to their inactive
 	 * states during probe by adding them to the "control group" & thus
 	 * driving their select line low.
 	 */
@@ -280,22 +284,18 @@ static int mchp_corespi_setup(struct spi_device *spi)
 	return 0;
 }
 
-static void mchp_corespi_init(struct spi_master *master, struct mchp_corespi *spi)
+static void mchp_corespi_init(struct spi_controller *host, struct mchp_corespi *spi)
 {
 	unsigned long clk_hz;
 	u32 control = mchp_corespi_read(spi, REG_CONTROL);
 
-	control |= CONTROL_MASTER;
+	control &= ~CONTROL_ENABLE;
+	mchp_corespi_write(spi, REG_CONTROL, control);
 
+	control |= CONTROL_MASTER;
 	control &= ~CONTROL_MODE_MASK;
 	control |= MOTOROLA_MODE;
 
-	mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
-
-	/* max. possible spi clock rate is the apb clock rate */
-	clk_hz = clk_get_rate(spi->clk);
-	master->max_speed_hz = clk_hz;
-
 	/*
 	 * The controller must be configured so that it doesn't remove Chip
 	 * Select until the entire message has been transferred, even if at
@@ -304,17 +304,22 @@ static void mchp_corespi_init(struct spi_master *master, struct mchp_corespi *sp
 	 * BIGFIFO mode is also enabled, which sets the fifo depth to 32 frames
 	 * for the 8 bit transfers that this driver uses.
 	 */
-	control = mchp_corespi_read(spi, REG_CONTROL);
 	control |= CONTROL_SPS | CONTROL_BIGFIFO;
 
 	mchp_corespi_write(spi, REG_CONTROL, control);
 
+	mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
+
+	/* max. possible spi clock rate is the apb clock rate */
+	clk_hz = clk_get_rate(spi->clk);
+	host->max_speed_hz = clk_hz;
+
 	mchp_corespi_enable_ints(spi);
 
 	/*
 	 * It is required to enable direct mode, otherwise control over the chip
 	 * select is relinquished to the hardware. SSELOUT is enabled too so we
-	 * can deal with active high slaves.
+	 * can deal with active high targets.
 	 */
 	mchp_corespi_write(spi, REG_SLAVE_SELECT, SSELOUT | SSEL_DIRECT);
 
@@ -330,8 +335,6 @@ static inline void mchp_corespi_set_clk_gen(struct mchp_corespi *spi)
 {
 	u32 control;
 
-	mchp_corespi_disable(spi);
-
 	control = mchp_corespi_read(spi, REG_CONTROL);
 	if (spi->clk_mode)
 		control |= CONTROL_CLKMODE;
@@ -340,12 +343,12 @@ static inline void mchp_corespi_set_clk_gen(struct mchp_corespi *spi)
 
 	mchp_corespi_write(spi, REG_CLK_GEN, spi->clk_gen);
 	mchp_corespi_write(spi, REG_CONTROL, control);
-	mchp_corespi_write(spi, REG_CONTROL, control | CONTROL_ENABLE);
 }
 
 static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int mode)
 {
-	u32 control, mode_val;
+	u32 mode_val;
+	u32 control = mchp_corespi_read(spi, REG_CONTROL);
 
 	switch (mode & SPI_MODE_X_MASK) {
 	case SPI_MODE_0:
@@ -363,12 +366,13 @@ static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int
 	}
 
 	/*
-	 * Disable the SPI controller. Writes to the frame size have
+	 * Disable the SPI controller. Writes to the frame protocol have
 	 * no effect when the controller is enabled.
 	 */
-	mchp_corespi_disable(spi);
 
-	control = mchp_corespi_read(spi, REG_CONTROL);
+	control &= ~CONTROL_ENABLE;
+	mchp_corespi_write(spi, REG_CONTROL, control);
+
 	control &= ~(SPI_MODE_X_MASK << MODE_X_MASK_SHIFT);
 	control |= mode_val;
 
@@ -380,8 +384,8 @@ static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int
 
 static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
 {
-	struct spi_master *master = dev_id;
-	struct mchp_corespi *spi = spi_master_get_devdata(master);
+	struct spi_controller *host = dev_id;
+	struct mchp_corespi *spi = spi_controller_get_devdata(host);
 	u32 intfield = mchp_corespi_read(spi, REG_MIS) & 0xf;
 	bool finalise = false;
 
@@ -389,26 +393,23 @@ static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
 	if (intfield == 0)
 		return IRQ_NONE;
 
-	if (intfield & INT_TXDONE) {
+	if (intfield & INT_TXDONE)
 		mchp_corespi_write(spi, REG_INT_CLEAR, INT_TXDONE);
 
+	if (intfield & INT_RXRDY) {
+		mchp_corespi_write(spi, REG_INT_CLEAR, INT_RXRDY);
+
 		if (spi->rx_len)
 			mchp_corespi_read_fifo(spi);
-
-		if (spi->tx_len)
-			mchp_corespi_write_fifo(spi);
-
-		if (!spi->rx_len)
-			finalise = true;
 	}
 
-	if (intfield & INT_RXRDY)
-		mchp_corespi_write(spi, REG_INT_CLEAR, INT_RXRDY);
+	if (!spi->rx_len && !spi->tx_len)
+		finalise = true;
 
 	if (intfield & INT_RX_CHANNEL_OVERFLOW) {
 		mchp_corespi_write(spi, REG_INT_CLEAR, INT_RX_CHANNEL_OVERFLOW);
 		finalise = true;
-		dev_err(&master->dev,
+		dev_err(&host->dev,
 			"%s: RX OVERFLOW: rxlen: %d, txlen: %d\n", __func__,
 			spi->rx_len, spi->tx_len);
 	}
@@ -416,13 +417,13 @@ static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
 	if (intfield & INT_TX_CHANNEL_UNDERRUN) {
 		mchp_corespi_write(spi, REG_INT_CLEAR, INT_TX_CHANNEL_UNDERRUN);
 		finalise = true;
-		dev_err(&master->dev,
+		dev_err(&host->dev,
 			"%s: TX UNDERFLOW: rxlen: %d, txlen: %d\n", __func__,
 			spi->rx_len, spi->tx_len);
 	}
 
 	if (finalise)
-		spi_finalize_current_transfer(master);
+		spi_finalize_current_transfer(host);
 
 	return IRQ_HANDLED;
 }
@@ -464,16 +465,16 @@ static int mchp_corespi_calculate_clkgen(struct mchp_corespi *spi,
 	return 0;
 }
 
-static int mchp_corespi_transfer_one(struct spi_master *master,
+static int mchp_corespi_transfer_one(struct spi_controller *host,
 				     struct spi_device *spi_dev,
 				     struct spi_transfer *xfer)
 {
-	struct mchp_corespi *spi = spi_master_get_devdata(master);
+	struct mchp_corespi *spi = spi_controller_get_devdata(host);
 	int ret;
 
 	ret = mchp_corespi_calculate_clkgen(spi, (unsigned long)xfer->speed_hz);
 	if (ret) {
-		dev_err(&master->dev, "failed to set clk_gen for target %u Hz\n", xfer->speed_hz);
+		dev_err(&host->dev, "failed to set clk_gen for target %u Hz\n", xfer->speed_hz);
 		return ret;
 	}
 
@@ -488,16 +489,17 @@ static int mchp_corespi_transfer_one(struct spi_master *master,
 	mchp_corespi_set_xfer_size(spi, (spi->tx_len > FIFO_DEPTH)
 				   ? FIFO_DEPTH : spi->tx_len);
 
-	if (spi->tx_len)
+	while (spi->tx_len)
 		mchp_corespi_write_fifo(spi);
+
 	return 1;
 }
 
-static int mchp_corespi_prepare_message(struct spi_master *master,
+static int mchp_corespi_prepare_message(struct spi_controller *host,
 					struct spi_message *msg)
 {
 	struct spi_device *spi_dev = msg->spi;
-	struct mchp_corespi *spi = spi_master_get_devdata(master);
+	struct mchp_corespi *spi = spi_controller_get_devdata(host);
 
 	mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
 	mchp_corespi_set_mode(spi, spi_dev->mode);
@@ -507,32 +509,32 @@ static int mchp_corespi_prepare_message(struct spi_master *master,
 
 static int mchp_corespi_probe(struct platform_device *pdev)
 {
-	struct spi_master *master;
+	struct spi_controller *host;
 	struct mchp_corespi *spi;
 	struct resource *res;
 	u32 num_cs;
 	int ret = 0;
 
-	master = devm_spi_alloc_master(&pdev->dev, sizeof(*spi));
-	if (!master)
+	host = devm_spi_alloc_host(&pdev->dev, sizeof(*spi));
+	if (!host)
 		return dev_err_probe(&pdev->dev, -ENOMEM,
-				     "unable to allocate master for SPI controller\n");
+				     "unable to allocate host for SPI controller\n");
 
-	platform_set_drvdata(pdev, master);
+	platform_set_drvdata(pdev, host);
 
 	if (of_property_read_u32(pdev->dev.of_node, "num-cs", &num_cs))
 		num_cs = MAX_CS;
 
-	master->num_chipselect = num_cs;
-	master->mode_bits = SPI_CPOL | SPI_CPHA | SPI_CS_HIGH;
-	master->setup = mchp_corespi_setup;
-	master->bits_per_word_mask = SPI_BPW_MASK(8);
-	master->transfer_one = mchp_corespi_transfer_one;
-	master->prepare_message = mchp_corespi_prepare_message;
-	master->set_cs = mchp_corespi_set_cs;
-	master->dev.of_node = pdev->dev.of_node;
+	host->num_chipselect = num_cs;
+	host->mode_bits = SPI_CPOL | SPI_CPHA | SPI_CS_HIGH;
+	host->setup = mchp_corespi_setup;
+	host->bits_per_word_mask = SPI_BPW_MASK(8);
+	host->transfer_one = mchp_corespi_transfer_one;
+	host->prepare_message = mchp_corespi_prepare_message;
+	host->set_cs = mchp_corespi_set_cs;
+	host->dev.of_node = pdev->dev.of_node;
 
-	spi = spi_master_get_devdata(master);
+	spi = spi_controller_get_devdata(host);
 
 	spi->regs = devm_platform_get_and_ioremap_resource(pdev, 0, &res);
 	if (IS_ERR(spi->regs))
@@ -545,7 +547,7 @@ static int mchp_corespi_probe(struct platform_device *pdev)
 				     spi->irq);
 
 	ret = devm_request_irq(&pdev->dev, spi->irq, mchp_corespi_interrupt,
-			       IRQF_SHARED, dev_name(&pdev->dev), master);
+			       IRQF_SHARED, dev_name(&pdev->dev), host);
 	if (ret)
 		return dev_err_probe(&pdev->dev, ret,
 				     "could not request irq\n");
@@ -560,25 +562,25 @@ static int mchp_corespi_probe(struct platform_device *pdev)
 		return dev_err_probe(&pdev->dev, ret,
 				     "failed to enable clock\n");
 
-	mchp_corespi_init(master, spi);
+	mchp_corespi_init(host, spi);
 
-	ret = devm_spi_register_master(&pdev->dev, master);
+	ret = devm_spi_register_controller(&pdev->dev, host);
 	if (ret) {
 		mchp_corespi_disable(spi);
 		clk_disable_unprepare(spi->clk);
 		return dev_err_probe(&pdev->dev, ret,
-				     "unable to register master for SPI controller\n");
+				     "unable to register host for SPI controller\n");
 	}
 
-	dev_info(&pdev->dev, "Registered SPI controller %d\n", master->bus_num);
+	dev_info(&pdev->dev, "Registered SPI controller %d\n", host->bus_num);
 
 	return 0;
 }
 
 static int mchp_corespi_remove(struct platform_device *pdev)
 {
-	struct spi_master *master  = platform_get_drvdata(pdev);
-	struct mchp_corespi *spi = spi_master_get_devdata(master);
+	struct spi_controller *host  = platform_get_drvdata(pdev);
+	struct mchp_corespi *spi = spi_controller_get_devdata(host);
 
 	mchp_corespi_disable_ints(spi);
 	clk_disable_unprepare(spi->clk);
diff --git a/drivers/spi/spidev.c b/drivers/spi/spidev.c
index 71c3db60e968..00612efc2277 100644
--- a/drivers/spi/spidev.c
+++ b/drivers/spi/spidev.c
@@ -700,6 +700,7 @@ static const struct spi_device_id spidev_spi_ids[] = {
 	{ .name = "m53cpld" },
 	{ .name = "spi-petra" },
 	{ .name = "spi-authenta" },
+	{ .name = "em3581" },
 	{},
 };
 MODULE_DEVICE_TABLE(spi, spidev_spi_ids);
@@ -718,14 +719,16 @@ static int spidev_of_check(struct device *dev)
 }
 
 static const struct of_device_id spidev_dt_ids[] = {
-	{ .compatible = "rohm,dh2228fv", .data = &spidev_of_check },
+	{ .compatible = "cisco,spi-petra", .data = &spidev_of_check },
+	{ .compatible = "dh,dhcom-board", .data = &spidev_of_check },
 	{ .compatible = "lineartechnology,ltc2488", .data = &spidev_of_check },
-	{ .compatible = "semtech,sx1301", .data = &spidev_of_check },
 	{ .compatible = "lwn,bk4", .data = &spidev_of_check },
-	{ .compatible = "dh,dhcom-board", .data = &spidev_of_check },
 	{ .compatible = "menlo,m53cpld", .data = &spidev_of_check },
-	{ .compatible = "cisco,spi-petra", .data = &spidev_of_check },
 	{ .compatible = "micron,spi-authenta", .data = &spidev_of_check },
+	{ .compatible = "rohm,bh2228fv", .data = &spidev_of_check },
+	{ .compatible = "rohm,dh2228fv", .data = &spidev_of_check },
+	{ .compatible = "semtech,sx1301", .data = &spidev_of_check },
+	{ .compatible = "silabs,em3581", .data = &spidev_of_check },
 	{},
 };
 MODULE_DEVICE_TABLE(of, spidev_dt_ids);
diff --git a/drivers/vhost/vsock.c b/drivers/vhost/vsock.c
index 1f3b89c885cc..c00f5821d6ec 100644
--- a/drivers/vhost/vsock.c
+++ b/drivers/vhost/vsock.c
@@ -654,6 +654,7 @@ static int vhost_vsock_dev_open(struct inode *inode, struct file *file)
 	}
 
 	vsock->guest_cid = 0; /* no CID assigned yet */
+	vsock->seqpacket_allow = false;
 
 	atomic_set(&vsock->queued_replies, 0);
 
@@ -797,8 +798,7 @@ static int vhost_vsock_set_features(struct vhost_vsock *vsock, u64 features)
 			goto err;
 	}
 
-	if (features & (1ULL << VIRTIO_VSOCK_F_SEQPACKET))
-		vsock->seqpacket_allow = true;
+	vsock->seqpacket_allow = features & (1ULL << VIRTIO_VSOCK_F_SEQPACKET);
 
 	for (i = 0; i < ARRAY_SIZE(vsock->vqs); i++) {
 		vq = &vsock->vqs[i];
diff --git a/drivers/watchdog/rzg2l_wdt.c b/drivers/watchdog/rzg2l_wdt.c
index d404953d0e0f..9b2698a4fc1a 100644
--- a/drivers/watchdog/rzg2l_wdt.c
+++ b/drivers/watchdog/rzg2l_wdt.c
@@ -123,8 +123,11 @@ static void rzg2l_wdt_init_timeout(struct watchdog_device *wdev)
 static int rzg2l_wdt_start(struct watchdog_device *wdev)
 {
 	struct rzg2l_wdt_priv *priv = watchdog_get_drvdata(wdev);
+	int ret;
 
-	pm_runtime_get_sync(wdev->parent);
+	ret = pm_runtime_resume_and_get(wdev->parent);
+	if (ret)
+		return ret;
 
 	/* Initialize time out */
 	rzg2l_wdt_init_timeout(wdev);
@@ -141,15 +144,21 @@ static int rzg2l_wdt_start(struct watchdog_device *wdev)
 static int rzg2l_wdt_stop(struct watchdog_device *wdev)
 {
 	struct rzg2l_wdt_priv *priv = watchdog_get_drvdata(wdev);
+	int ret;
 
 	rzg2l_wdt_reset(priv);
-	pm_runtime_put(wdev->parent);
+
+	ret = pm_runtime_put(wdev->parent);
+	if (ret < 0)
+		return ret;
 
 	return 0;
 }
 
 static int rzg2l_wdt_set_timeout(struct watchdog_device *wdev, unsigned int timeout)
 {
+	int ret = 0;
+
 	wdev->timeout = timeout;
 
 	/*
@@ -158,11 +167,14 @@ static int rzg2l_wdt_set_timeout(struct watchdog_device *wdev, unsigned int time
 	 * to reset the module) so that it is updated with new timeout values.
 	 */
 	if (watchdog_active(wdev)) {
-		rzg2l_wdt_stop(wdev);
-		rzg2l_wdt_start(wdev);
+		ret = rzg2l_wdt_stop(wdev);
+		if (ret)
+			return ret;
+
+		ret = rzg2l_wdt_start(wdev);
 	}
 
-	return 0;
+	return ret;
 }
 
 static int rzg2l_wdt_restart(struct watchdog_device *wdev,
diff --git a/fs/ceph/super.c b/fs/ceph/super.c
index 281b493fdac8..aa75aa796e43 100644
--- a/fs/ceph/super.c
+++ b/fs/ceph/super.c
@@ -924,7 +924,8 @@ static int __init init_caches(void)
 	if (!ceph_mds_request_cachep)
 		goto bad_mds_req;
 
-	ceph_wb_pagevec_pool = mempool_create_kmalloc_pool(10, CEPH_MAX_WRITE_SIZE >> PAGE_SHIFT);
+	ceph_wb_pagevec_pool = mempool_create_kmalloc_pool(10,
+	    (CEPH_MAX_WRITE_SIZE >> PAGE_SHIFT) * sizeof(struct page *));
 	if (!ceph_wb_pagevec_pool)
 		goto bad_pagevec_pool;
 
diff --git a/fs/ext2/balloc.c b/fs/ext2/balloc.c
index 5dc0a31f4a08..d2eb4d291985 100644
--- a/fs/ext2/balloc.c
+++ b/fs/ext2/balloc.c
@@ -79,26 +79,33 @@ static int ext2_valid_block_bitmap(struct super_block *sb,
 	ext2_grpblk_t next_zero_bit;
 	ext2_fsblk_t bitmap_blk;
 	ext2_fsblk_t group_first_block;
+	ext2_grpblk_t max_bit;
 
 	group_first_block = ext2_group_first_block_no(sb, block_group);
+	max_bit = ext2_group_last_block_no(sb, block_group) - group_first_block;
 
 	/* check whether block bitmap block number is set */
 	bitmap_blk = le32_to_cpu(desc->bg_block_bitmap);
 	offset = bitmap_blk - group_first_block;
-	if (!ext2_test_bit(offset, bh->b_data))
+	if (offset < 0 || offset > max_bit ||
+	    !ext2_test_bit(offset, bh->b_data))
 		/* bad block bitmap */
 		goto err_out;
 
 	/* check whether the inode bitmap block number is set */
 	bitmap_blk = le32_to_cpu(desc->bg_inode_bitmap);
 	offset = bitmap_blk - group_first_block;
-	if (!ext2_test_bit(offset, bh->b_data))
+	if (offset < 0 || offset > max_bit ||
+	    !ext2_test_bit(offset, bh->b_data))
 		/* bad block bitmap */
 		goto err_out;
 
 	/* check whether the inode table block number is set */
 	bitmap_blk = le32_to_cpu(desc->bg_inode_table);
 	offset = bitmap_blk - group_first_block;
+	if (offset < 0 || offset > max_bit ||
+	    offset + EXT2_SB(sb)->s_itb_per_group - 1 > max_bit)
+		goto err_out;
 	next_zero_bit = ext2_find_next_zero_bit(bh->b_data,
 				offset + EXT2_SB(sb)->s_itb_per_group,
 				offset);
diff --git a/fs/ext4/extents_status.c b/fs/ext4/extents_status.c
index 470d29fb407a..9766d3b21ca2 100644
--- a/fs/ext4/extents_status.c
+++ b/fs/ext4/extents_status.c
@@ -312,6 +312,8 @@ void ext4_es_find_extent_range(struct inode *inode,
 			       ext4_lblk_t lblk, ext4_lblk_t end,
 			       struct extent_status *es)
 {
+	es->es_lblk = es->es_len = es->es_pblk = 0;
+
 	if (EXT4_SB(inode->i_sb)->s_mount_state & EXT4_FC_REPLAY)
 		return;
 
diff --git a/fs/ext4/fast_commit.c b/fs/ext4/fast_commit.c
index 1110bfa0a5b7..19353a2f44bb 100644
--- a/fs/ext4/fast_commit.c
+++ b/fs/ext4/fast_commit.c
@@ -649,6 +649,12 @@ void ext4_fc_track_range(handle_t *handle, struct inode *inode, ext4_lblk_t star
 	if (ext4_test_mount_flag(inode->i_sb, EXT4_MF_FC_INELIGIBLE))
 		return;
 
+	if (ext4_has_inline_data(inode)) {
+		ext4_fc_mark_ineligible(inode->i_sb, EXT4_FC_REASON_XATTR,
+					handle);
+		return;
+	}
+
 	args.start = start;
 	args.end = end;
 
diff --git a/fs/ext4/namei.c b/fs/ext4/namei.c
index 8b1383223848..173f46fa1068 100644
--- a/fs/ext4/namei.c
+++ b/fs/ext4/namei.c
@@ -151,10 +151,11 @@ static struct buffer_head *__ext4_read_dirblock(struct inode *inode,
 
 		return bh;
 	}
-	if (!bh && (type == INDEX || type == DIRENT_HTREE)) {
+	/* The first directory block must not be a hole. */
+	if (!bh && (type == INDEX || type == DIRENT_HTREE || block == 0)) {
 		ext4_error_inode(inode, func, line, block,
-				 "Directory hole found for htree %s block",
-				 (type == INDEX) ? "index" : "leaf");
+				 "Directory hole found for htree %s block %u",
+				 (type == INDEX) ? "index" : "leaf", block);
 		return ERR_PTR(-EFSCORRUPTED);
 	}
 	if (!bh)
@@ -2218,6 +2219,52 @@ static int add_dirent_to_buf(handle_t *handle, struct ext4_filename *fname,
 	return err ? err : err2;
 }
 
+static bool ext4_check_dx_root(struct inode *dir, struct dx_root *root)
+{
+	struct fake_dirent *fde;
+	const char *error_msg;
+	unsigned int rlen;
+	unsigned int blocksize = dir->i_sb->s_blocksize;
+	char *blockend = (char *)root + dir->i_sb->s_blocksize;
+
+	fde = &root->dot;
+	if (unlikely(fde->name_len != 1)) {
+		error_msg = "invalid name_len for '.'";
+		goto corrupted;
+	}
+	if (unlikely(strncmp(root->dot_name, ".", fde->name_len))) {
+		error_msg = "invalid name for '.'";
+		goto corrupted;
+	}
+	rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize);
+	if (unlikely((char *)fde + rlen >= blockend)) {
+		error_msg = "invalid rec_len for '.'";
+		goto corrupted;
+	}
+
+	fde = &root->dotdot;
+	if (unlikely(fde->name_len != 2)) {
+		error_msg = "invalid name_len for '..'";
+		goto corrupted;
+	}
+	if (unlikely(strncmp(root->dotdot_name, "..", fde->name_len))) {
+		error_msg = "invalid name for '..'";
+		goto corrupted;
+	}
+	rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize);
+	if (unlikely((char *)fde + rlen >= blockend)) {
+		error_msg = "invalid rec_len for '..'";
+		goto corrupted;
+	}
+
+	return true;
+
+corrupted:
+	EXT4_ERROR_INODE(dir, "Corrupt dir, %s, running e2fsck is recommended",
+			 error_msg);
+	return false;
+}
+
 /*
  * This converts a one block unindexed directory to a 3 block indexed
  * directory, and adds the dentry to the indexed directory.
@@ -2252,17 +2299,17 @@ static int make_indexed_dir(handle_t *handle, struct ext4_filename *fname,
 		brelse(bh);
 		return retval;
 	}
+
 	root = (struct dx_root *) bh->b_data;
+	if (!ext4_check_dx_root(dir, root)) {
+		brelse(bh);
+		return -EFSCORRUPTED;
+	}
 
 	/* The 0th block becomes the root, move the dirents out */
 	fde = &root->dotdot;
 	de = (struct ext4_dir_entry_2 *)((char *)fde +
 		ext4_rec_len_from_disk(fde->rec_len, blocksize));
-	if ((char *) de >= (((char *) root) + blocksize)) {
-		EXT4_ERROR_INODE(dir, "invalid rec_len for '..'");
-		brelse(bh);
-		return -EFSCORRUPTED;
-	}
 	len = ((char *) root) + (blocksize - csum_size) - (char *) de;
 
 	/* Allocate new block for the 0th block's dirents */
@@ -3087,10 +3134,7 @@ bool ext4_empty_dir(struct inode *inode)
 		EXT4_ERROR_INODE(inode, "invalid size");
 		return false;
 	}
-	/* The first directory block must not be a hole,
-	 * so treat it as DIRENT_HTREE
-	 */
-	bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE);
+	bh = ext4_read_dirblock(inode, 0, EITHER);
 	if (IS_ERR(bh))
 		return false;
 
@@ -3534,10 +3578,7 @@ static struct buffer_head *ext4_get_first_dir_block(handle_t *handle,
 		struct ext4_dir_entry_2 *de;
 		unsigned int offset;
 
-		/* The first directory block must not be a hole, so
-		 * treat it as DIRENT_HTREE
-		 */
-		bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE);
+		bh = ext4_read_dirblock(inode, 0, EITHER);
 		if (IS_ERR(bh)) {
 			*retval = PTR_ERR(bh);
 			return NULL;
diff --git a/fs/ext4/xattr.c b/fs/ext4/xattr.c
index 28d00ed833db..f0a45d3ec4eb 100644
--- a/fs/ext4/xattr.c
+++ b/fs/ext4/xattr.c
@@ -1384,6 +1384,12 @@ static int ext4_xattr_inode_write(handle_t *handle, struct inode *ea_inode,
 			goto out;
 
 		memcpy(bh->b_data, buf, csize);
+		/*
+		 * Zero out block tail to avoid writing uninitialized memory
+		 * to disk.
+		 */
+		if (csize < blocksize)
+			memset(bh->b_data + csize, 0, blocksize - csize);
 		set_buffer_uptodate(bh);
 		ext4_handle_dirty_metadata(handle, ea_inode, bh);
 
diff --git a/fs/f2fs/checkpoint.c b/fs/f2fs/checkpoint.c
index 13d877470675..ad4073cde397 100644
--- a/fs/f2fs/checkpoint.c
+++ b/fs/f2fs/checkpoint.c
@@ -1178,6 +1178,11 @@ static void __prepare_cp_block(struct f2fs_sb_info *sbi)
 	ckpt->valid_node_count = cpu_to_le32(valid_node_count(sbi));
 	ckpt->valid_inode_count = cpu_to_le32(valid_inode_count(sbi));
 	ckpt->next_free_nid = cpu_to_le32(last_nid);
+
+	/* update user_block_counts */
+	sbi->last_valid_block_count = sbi->total_valid_block_count;
+	percpu_counter_set(&sbi->alloc_valid_block_count, 0);
+	percpu_counter_set(&sbi->rf_node_block_count, 0);
 }
 
 static bool __need_flush_quota(struct f2fs_sb_info *sbi)
@@ -1569,11 +1574,6 @@ static int do_checkpoint(struct f2fs_sb_info *sbi, struct cp_control *cpc)
 		start_blk += NR_CURSEG_NODE_TYPE;
 	}
 
-	/* update user_block_counts */
-	sbi->last_valid_block_count = sbi->total_valid_block_count;
-	percpu_counter_set(&sbi->alloc_valid_block_count, 0);
-	percpu_counter_set(&sbi->rf_node_block_count, 0);
-
 	/* Here, we have one bio having CP pack except cp pack 2 page */
 	f2fs_sync_meta_pages(sbi, META, LONG_MAX, FS_CP_META_IO);
 	/* Wait for all dirty meta pages to be submitted for IO */
diff --git a/fs/f2fs/file.c b/fs/f2fs/file.c
index 1d73582d1f63..c6fb179f9d4a 100644
--- a/fs/f2fs/file.c
+++ b/fs/f2fs/file.c
@@ -812,6 +812,8 @@ static bool f2fs_force_buffered_io(struct inode *inode, int rw)
 		return true;
 	if (f2fs_compressed_file(inode))
 		return true;
+	if (f2fs_has_inline_data(inode))
+		return true;
 
 	/* disallow direct IO if any of devices has unaligned blksize */
 	if (f2fs_is_multi_device(sbi) && !sbi->aligned_blksize)
diff --git a/fs/f2fs/inline.c b/fs/f2fs/inline.c
index 8747eec3d0a3..7a2fb9789e5e 100644
--- a/fs/f2fs/inline.c
+++ b/fs/f2fs/inline.c
@@ -204,8 +204,10 @@ int f2fs_convert_inline_inode(struct inode *inode)
 	struct page *ipage, *page;
 	int err = 0;
 
-	if (!f2fs_has_inline_data(inode) ||
-			f2fs_hw_is_readonly(sbi) || f2fs_readonly(sbi->sb))
+	if (f2fs_hw_is_readonly(sbi) || f2fs_readonly(sbi->sb))
+		return -EROFS;
+
+	if (!f2fs_has_inline_data(inode))
 		return 0;
 
 	err = f2fs_dquot_initialize(inode);
diff --git a/fs/f2fs/inode.c b/fs/f2fs/inode.c
index 35b1c672644e..ff4a4e92a40c 100644
--- a/fs/f2fs/inode.c
+++ b/fs/f2fs/inode.c
@@ -27,6 +27,9 @@ void f2fs_mark_inode_dirty_sync(struct inode *inode, bool sync)
 	if (is_inode_flag_set(inode, FI_NEW_INODE))
 		return;
 
+	if (f2fs_readonly(F2FS_I_SB(inode)->sb))
+		return;
+
 	if (f2fs_inode_dirtied(inode, sync))
 		return;
 
diff --git a/fs/f2fs/segment.h b/fs/f2fs/segment.h
index aa9ad85e0901..17d1723d98a0 100644
--- a/fs/f2fs/segment.h
+++ b/fs/f2fs/segment.h
@@ -373,7 +373,8 @@ static inline unsigned int get_ckpt_valid_blocks(struct f2fs_sb_info *sbi,
 				unsigned int segno, bool use_section)
 {
 	if (use_section && __is_large_section(sbi)) {
-		unsigned int start_segno = START_SEGNO(segno);
+		unsigned int secno = GET_SEC_FROM_SEG(sbi, segno);
+		unsigned int start_segno = GET_SEG_FROM_SEC(sbi, secno);
 		unsigned int blocks = 0;
 		int i;
 
diff --git a/fs/fuse/inode.c b/fs/fuse/inode.c
index 367e3b276092..f19bdd7cbd77 100644
--- a/fs/fuse/inode.c
+++ b/fs/fuse/inode.c
@@ -724,6 +724,8 @@ static int fuse_parse_param(struct fs_context *fsc, struct fs_parameter *param)
 	struct fs_parse_result result;
 	struct fuse_fs_context *ctx = fsc->fs_private;
 	int opt;
+	kuid_t kuid;
+	kgid_t kgid;
 
 	if (fsc->purpose == FS_CONTEXT_FOR_RECONFIGURE) {
 		/*
@@ -768,16 +770,30 @@ static int fuse_parse_param(struct fs_context *fsc, struct fs_parameter *param)
 		break;
 
 	case OPT_USER_ID:
-		ctx->user_id = make_kuid(fsc->user_ns, result.uint_32);
-		if (!uid_valid(ctx->user_id))
+		kuid =  make_kuid(fsc->user_ns, result.uint_32);
+		if (!uid_valid(kuid))
 			return invalfc(fsc, "Invalid user_id");
+		/*
+		 * The requested uid must be representable in the
+		 * filesystem's idmapping.
+		 */
+		if (!kuid_has_mapping(fsc->user_ns, kuid))
+			return invalfc(fsc, "Invalid user_id");
+		ctx->user_id = kuid;
 		ctx->user_id_present = true;
 		break;
 
 	case OPT_GROUP_ID:
-		ctx->group_id = make_kgid(fsc->user_ns, result.uint_32);
-		if (!gid_valid(ctx->group_id))
+		kgid = make_kgid(fsc->user_ns, result.uint_32);;
+		if (!gid_valid(kgid))
+			return invalfc(fsc, "Invalid group_id");
+		/*
+		 * The requested gid must be representable in the
+		 * filesystem's idmapping.
+		 */
+		if (!kgid_has_mapping(fsc->user_ns, kgid))
 			return invalfc(fsc, "Invalid group_id");
+		ctx->group_id = kgid;
 		ctx->group_id_present = true;
 		break;
 
diff --git a/fs/hfs/inode.c b/fs/hfs/inode.c
index 80d17c520d0b..aedb4b262189 100644
--- a/fs/hfs/inode.c
+++ b/fs/hfs/inode.c
@@ -204,6 +204,7 @@ struct inode *hfs_new_inode(struct inode *dir, const struct qstr *name, umode_t
 	HFS_I(inode)->flags = 0;
 	HFS_I(inode)->rsrc_inode = NULL;
 	HFS_I(inode)->fs_blocks = 0;
+	HFS_I(inode)->tz_secondswest = sys_tz.tz_minuteswest * 60;
 	if (S_ISDIR(mode)) {
 		inode->i_size = 2;
 		HFS_SB(sb)->folder_count++;
@@ -279,6 +280,8 @@ void hfs_inode_read_fork(struct inode *inode, struct hfs_extent *ext,
 	for (count = 0, i = 0; i < 3; i++)
 		count += be16_to_cpu(ext[i].count);
 	HFS_I(inode)->first_blocks = count;
+	HFS_I(inode)->cached_start = 0;
+	HFS_I(inode)->cached_blocks = 0;
 
 	inode->i_size = HFS_I(inode)->phys_size = log_size;
 	HFS_I(inode)->fs_blocks = (log_size + sb->s_blocksize - 1) >> sb->s_blocksize_bits;
diff --git a/fs/hfsplus/bfind.c b/fs/hfsplus/bfind.c
index ca2ba8c9f82e..901e83d65d20 100644
--- a/fs/hfsplus/bfind.c
+++ b/fs/hfsplus/bfind.c
@@ -25,19 +25,8 @@ int hfs_find_init(struct hfs_btree *tree, struct hfs_find_data *fd)
 	fd->key = ptr + tree->max_key_len + 2;
 	hfs_dbg(BNODE_REFS, "find_init: %d (%p)\n",
 		tree->cnid, __builtin_return_address(0));
-	switch (tree->cnid) {
-	case HFSPLUS_CAT_CNID:
-		mutex_lock_nested(&tree->tree_lock, CATALOG_BTREE_MUTEX);
-		break;
-	case HFSPLUS_EXT_CNID:
-		mutex_lock_nested(&tree->tree_lock, EXTENTS_BTREE_MUTEX);
-		break;
-	case HFSPLUS_ATTR_CNID:
-		mutex_lock_nested(&tree->tree_lock, ATTR_BTREE_MUTEX);
-		break;
-	default:
-		BUG();
-	}
+	mutex_lock_nested(&tree->tree_lock,
+			hfsplus_btree_lock_class(tree));
 	return 0;
 }
 
diff --git a/fs/hfsplus/extents.c b/fs/hfsplus/extents.c
index 721f779b4ec3..91354e769642 100644
--- a/fs/hfsplus/extents.c
+++ b/fs/hfsplus/extents.c
@@ -430,7 +430,8 @@ int hfsplus_free_fork(struct super_block *sb, u32 cnid,
 		hfsplus_free_extents(sb, ext_entry, total_blocks - start,
 				     total_blocks);
 		total_blocks = start;
-		mutex_lock(&fd.tree->tree_lock);
+		mutex_lock_nested(&fd.tree->tree_lock,
+			hfsplus_btree_lock_class(fd.tree));
 	} while (total_blocks > blocks);
 	hfs_find_exit(&fd);
 
@@ -592,7 +593,8 @@ void hfsplus_file_truncate(struct inode *inode)
 					     alloc_cnt, alloc_cnt - blk_cnt);
 			hfsplus_dump_extent(hip->first_extents);
 			hip->first_blocks = blk_cnt;
-			mutex_lock(&fd.tree->tree_lock);
+			mutex_lock_nested(&fd.tree->tree_lock,
+				hfsplus_btree_lock_class(fd.tree));
 			break;
 		}
 		res = __hfsplus_ext_cache_extent(&fd, inode, alloc_cnt);
@@ -606,7 +608,8 @@ void hfsplus_file_truncate(struct inode *inode)
 		hfsplus_free_extents(sb, hip->cached_extents,
 				     alloc_cnt - start, alloc_cnt - blk_cnt);
 		hfsplus_dump_extent(hip->cached_extents);
-		mutex_lock(&fd.tree->tree_lock);
+		mutex_lock_nested(&fd.tree->tree_lock,
+				hfsplus_btree_lock_class(fd.tree));
 		if (blk_cnt > start) {
 			hip->extent_state |= HFSPLUS_EXT_DIRTY;
 			break;
diff --git a/fs/hfsplus/hfsplus_fs.h b/fs/hfsplus/hfsplus_fs.h
index 6aa919e59483..7db213cd1eea 100644
--- a/fs/hfsplus/hfsplus_fs.h
+++ b/fs/hfsplus/hfsplus_fs.h
@@ -552,6 +552,27 @@ static inline __be32 __hfsp_ut2mt(time64_t ut)
 	return cpu_to_be32(lower_32_bits(ut) + HFSPLUS_UTC_OFFSET);
 }
 
+static inline enum hfsplus_btree_mutex_classes
+hfsplus_btree_lock_class(struct hfs_btree *tree)
+{
+	enum hfsplus_btree_mutex_classes class;
+
+	switch (tree->cnid) {
+	case HFSPLUS_CAT_CNID:
+		class = CATALOG_BTREE_MUTEX;
+		break;
+	case HFSPLUS_EXT_CNID:
+		class = EXTENTS_BTREE_MUTEX;
+		break;
+	case HFSPLUS_ATTR_CNID:
+		class = ATTR_BTREE_MUTEX;
+		break;
+	default:
+		BUG();
+	}
+	return class;
+}
+
 /* compatibility */
 #define hfsp_mt2ut(t)		(struct timespec64){ .tv_sec = __hfsp_mt2ut(t) }
 #define hfsp_ut2mt(t)		__hfsp_ut2mt((t).tv_sec)
diff --git a/fs/jbd2/commit.c b/fs/jbd2/commit.c
index 556b259a00ba..7b34deec8b87 100644
--- a/fs/jbd2/commit.c
+++ b/fs/jbd2/commit.c
@@ -801,7 +801,7 @@ void jbd2_journal_commit_transaction(journal_t *journal)
 		if (first_block < journal->j_tail)
 			freed += journal->j_last - journal->j_first;
 		/* Update tail only if we free significant amount of space */
-		if (freed < jbd2_journal_get_max_txn_bufs(journal))
+		if (freed < journal->j_max_transaction_buffers)
 			update_tail = 0;
 	}
 	J_ASSERT(commit_transaction->t_state == T_COMMIT);
diff --git a/fs/jbd2/journal.c b/fs/jbd2/journal.c
index 3df45e4699f1..b136b46b63bc 100644
--- a/fs/jbd2/journal.c
+++ b/fs/jbd2/journal.c
@@ -1532,6 +1532,11 @@ static void journal_fail_superblock(journal_t *journal)
 	journal->j_sb_buffer = NULL;
 }
 
+static int jbd2_journal_get_max_txn_bufs(journal_t *journal)
+{
+	return (journal->j_total_len - journal->j_fc_wbufsize) / 4;
+}
+
 /*
  * Given a journal_t structure, initialise the various fields for
  * startup of a new journaling session.  We use this both when creating
diff --git a/fs/jfs/jfs_imap.c b/fs/jfs/jfs_imap.c
index ac42f8ee553f..ba6f28521360 100644
--- a/fs/jfs/jfs_imap.c
+++ b/fs/jfs/jfs_imap.c
@@ -290,7 +290,7 @@ int diSync(struct inode *ipimap)
 int diRead(struct inode *ip)
 {
 	struct jfs_sb_info *sbi = JFS_SBI(ip->i_sb);
-	int iagno, ino, extno, rc;
+	int iagno, ino, extno, rc, agno;
 	struct inode *ipimap;
 	struct dinode *dp;
 	struct iag *iagp;
@@ -339,8 +339,11 @@ int diRead(struct inode *ip)
 
 	/* get the ag for the iag */
 	agstart = le64_to_cpu(iagp->agstart);
+	agno = BLKTOAG(agstart, JFS_SBI(ip->i_sb));
 
 	release_metapage(mp);
+	if (agno >= MAXAG || agno < 0)
+		return -EIO;
 
 	rel_inode = (ino & (INOSPERPAGE - 1));
 	pageno = blkno >> sbi->l2nbperpage;
diff --git a/fs/kernfs/dir.c b/fs/kernfs/dir.c
index a00e11ebfa77..2c74b24fc22a 100644
--- a/fs/kernfs/dir.c
+++ b/fs/kernfs/dir.c
@@ -125,9 +125,9 @@ static struct kernfs_node *kernfs_common_ancestor(struct kernfs_node *a,
  * kn_to:   /n1/n2/n3         [depth=3]
  * result:  /../..
  *
- * [3] when @kn_to is NULL result will be "(null)"
+ * [3] when @kn_to is %NULL result will be "(null)"
  *
- * Returns the length of the full path.  If the full length is equal to or
+ * Return: the length of the constructed path.  If the path would have been
  * greater than @buflen, @buf contains the truncated path with the trailing
  * '\0'.  On error, -errno is returned.
  */
@@ -138,16 +138,17 @@ static int kernfs_path_from_node_locked(struct kernfs_node *kn_to,
 	struct kernfs_node *kn, *common;
 	const char parent_str[] = "/..";
 	size_t depth_from, depth_to, len = 0;
+	ssize_t copied;
 	int i, j;
 
 	if (!kn_to)
-		return strlcpy(buf, "(null)", buflen);
+		return strscpy(buf, "(null)", buflen);
 
 	if (!kn_from)
 		kn_from = kernfs_root(kn_to)->kn;
 
 	if (kn_from == kn_to)
-		return strlcpy(buf, "/", buflen);
+		return strscpy(buf, "/", buflen);
 
 	if (!buf)
 		return -EINVAL;
@@ -161,18 +162,19 @@ static int kernfs_path_from_node_locked(struct kernfs_node *kn_to,
 
 	buf[0] = '\0';
 
-	for (i = 0; i < depth_from; i++)
-		len += strlcpy(buf + len, parent_str,
-			       len < buflen ? buflen - len : 0);
+	for (i = 0; i < depth_from; i++) {
+		copied = strscpy(buf + len, parent_str, buflen - len);
+		if (copied < 0)
+			return copied;
+		len += copied;
+	}
 
 	/* Calculate how many bytes we need for the rest */
 	for (i = depth_to - 1; i >= 0; i--) {
 		for (kn = kn_to, j = 0; j < i; j++)
 			kn = kn->parent;
-		len += strlcpy(buf + len, "/",
-			       len < buflen ? buflen - len : 0);
-		len += strlcpy(buf + len, kn->name,
-			       len < buflen ? buflen - len : 0);
+
+		len += scnprintf(buf + len, buflen - len, "/%s", kn->name);
 	}
 
 	return len;
@@ -185,10 +187,12 @@ static int kernfs_path_from_node_locked(struct kernfs_node *kn_to,
  * @buflen: size of @buf
  *
  * Copies the name of @kn into @buf of @buflen bytes.  The behavior is
- * similar to strlcpy().  It returns the length of @kn's name and if @buf
- * isn't long enough, it's filled upto @buflen-1 and nul terminated.
+ * similar to strlcpy().
  *
- * Fills buffer with "(null)" if @kn is NULL.
+ * Fills buffer with "(null)" if @kn is %NULL.
+ *
+ * Return: the length of @kn's name and if @buf isn't long enough,
+ * it's filled up to @buflen-1 and nul terminated.
  *
  * This function can be called from any context.
  */
@@ -215,7 +219,7 @@ int kernfs_name(struct kernfs_node *kn, char *buf, size_t buflen)
  * path (which includes '..'s) as needed to reach from @from to @to is
  * returned.
  *
- * Returns the length of the full path.  If the full length is equal to or
+ * Return: the length of the constructed path.  If the path would have been
  * greater than @buflen, @buf contains the truncated path with the trailing
  * '\0'.  On error, -errno is returned.
  */
@@ -266,12 +270,10 @@ void pr_cont_kernfs_path(struct kernfs_node *kn)
 	sz = kernfs_path_from_node(kn, NULL, kernfs_pr_cont_buf,
 				   sizeof(kernfs_pr_cont_buf));
 	if (sz < 0) {
-		pr_cont("(error)");
-		goto out;
-	}
-
-	if (sz >= sizeof(kernfs_pr_cont_buf)) {
-		pr_cont("(name too long)");
+		if (sz == -E2BIG)
+			pr_cont("(name too long)");
+		else
+			pr_cont("(error)");
 		goto out;
 	}
 
@@ -287,6 +289,8 @@ void pr_cont_kernfs_path(struct kernfs_node *kn)
  *
  * Determines @kn's parent, pins and returns it.  This function can be
  * called from any context.
+ *
+ * Return: parent node of @kn
  */
 struct kernfs_node *kernfs_get_parent(struct kernfs_node *kn)
 {
@@ -302,11 +306,11 @@ struct kernfs_node *kernfs_get_parent(struct kernfs_node *kn)
 }
 
 /**
- *	kernfs_name_hash
+ *	kernfs_name_hash - calculate hash of @ns + @name
  *	@name: Null terminated string to hash
  *	@ns:   Namespace tag to hash
  *
- *	Returns 31 bit hash of ns + name (so it fits in an off_t )
+ *	Return: 31-bit hash of ns + name (so it fits in an off_t)
  */
 static unsigned int kernfs_name_hash(const char *name, const void *ns)
 {
@@ -354,8 +358,8 @@ static int kernfs_sd_compare(const struct kernfs_node *left,
  *	Locking:
  *	kernfs_rwsem held exclusive
  *
- *	RETURNS:
- *	0 on susccess -EEXIST on failure.
+ *	Return:
+ *	%0 on success, -EEXIST on failure.
  */
 static int kernfs_link_sibling(struct kernfs_node *kn)
 {
@@ -394,8 +398,10 @@ static int kernfs_link_sibling(struct kernfs_node *kn)
  *	@kn: kernfs_node of interest
  *
  *	Try to unlink @kn from its sibling rbtree which starts from
- *	kn->parent->dir.children.  Returns %true if @kn was actually
- *	removed, %false if @kn wasn't on the rbtree.
+ *	kn->parent->dir.children.
+ *
+ *	Return: %true if @kn was actually removed,
+ *	%false if @kn wasn't on the rbtree.
  *
  *	Locking:
  *	kernfs_rwsem held exclusive
@@ -419,10 +425,10 @@ static bool kernfs_unlink_sibling(struct kernfs_node *kn)
  *	@kn: kernfs_node to get an active reference to
  *
  *	Get an active reference of @kn.  This function is noop if @kn
- *	is NULL.
+ *	is %NULL.
  *
- *	RETURNS:
- *	Pointer to @kn on success, NULL on failure.
+ *	Return:
+ *	Pointer to @kn on success, %NULL on failure.
  */
 struct kernfs_node *kernfs_get_active(struct kernfs_node *kn)
 {
@@ -442,7 +448,7 @@ struct kernfs_node *kernfs_get_active(struct kernfs_node *kn)
  *	@kn: kernfs_node to put an active reference to
  *
  *	Put an active reference to @kn.  This function is noop if @kn
- *	is NULL.
+ *	is %NULL.
  */
 void kernfs_put_active(struct kernfs_node *kn)
 {
@@ -464,7 +470,7 @@ void kernfs_put_active(struct kernfs_node *kn)
  * kernfs_drain - drain kernfs_node
  * @kn: kernfs_node to drain
  *
- * Drain existing usages and nuke all existing mmaps of @kn.  Mutiple
+ * Drain existing usages and nuke all existing mmaps of @kn.  Multiple
  * removers may invoke this function concurrently on @kn and all will
  * return after draining is complete.
  */
@@ -577,7 +583,7 @@ EXPORT_SYMBOL_GPL(kernfs_put);
  * kernfs_node_from_dentry - determine kernfs_node associated with a dentry
  * @dentry: the dentry in question
  *
- * Return the kernfs_node associated with @dentry.  If @dentry is not a
+ * Return: the kernfs_node associated with @dentry.  If @dentry is not a
  * kernfs one, %NULL is returned.
  *
  * While the returned kernfs_node will stay accessible as long as @dentry
@@ -698,8 +704,8 @@ struct kernfs_node *kernfs_new_node(struct kernfs_node *parent,
  * @id's lower 32bits encode ino and upper gen.  If the gen portion is
  * zero, all generations are matched.
  *
- * RETURNS:
- * NULL on failure. Return a kernfs node with reference counter incremented
+ * Return: %NULL on failure,
+ * otherwise a kernfs node with reference counter incremented.
  */
 struct kernfs_node *kernfs_find_and_get_node_by_id(struct kernfs_root *root,
 						   u64 id)
@@ -747,8 +753,8 @@ struct kernfs_node *kernfs_find_and_get_node_by_id(struct kernfs_root *root,
  *	function increments nlink of the parent's inode if @kn is a
  *	directory and link into the children list of the parent.
  *
- *	RETURNS:
- *	0 on success, -EEXIST if entry with the given name already
+ *	Return:
+ *	%0 on success, -EEXIST if entry with the given name already
  *	exists.
  */
 int kernfs_add_one(struct kernfs_node *kn)
@@ -811,8 +817,9 @@ int kernfs_add_one(struct kernfs_node *kn)
  * @name: name to look for
  * @ns: the namespace tag to use
  *
- * Look for kernfs_node with name @name under @parent.  Returns pointer to
- * the found kernfs_node on success, %NULL on failure.
+ * Look for kernfs_node with name @name under @parent.
+ *
+ * Return: pointer to the found kernfs_node on success, %NULL on failure.
  */
 static struct kernfs_node *kernfs_find_ns(struct kernfs_node *parent,
 					  const unsigned char *name,
@@ -885,8 +892,9 @@ static struct kernfs_node *kernfs_walk_ns(struct kernfs_node *parent,
  * @ns: the namespace tag to use
  *
  * Look for kernfs_node with name @name under @parent and get a reference
- * if found.  This function may sleep and returns pointer to the found
- * kernfs_node on success, %NULL on failure.
+ * if found.  This function may sleep.
+ *
+ * Return: pointer to the found kernfs_node on success, %NULL on failure.
  */
 struct kernfs_node *kernfs_find_and_get_ns(struct kernfs_node *parent,
 					   const char *name, const void *ns)
@@ -910,8 +918,9 @@ EXPORT_SYMBOL_GPL(kernfs_find_and_get_ns);
  * @ns: the namespace tag to use
  *
  * Look for kernfs_node with path @path under @parent and get a reference
- * if found.  This function may sleep and returns pointer to the found
- * kernfs_node on success, %NULL on failure.
+ * if found.  This function may sleep.
+ *
+ * Return: pointer to the found kernfs_node on success, %NULL on failure.
  */
 struct kernfs_node *kernfs_walk_and_get_ns(struct kernfs_node *parent,
 					   const char *path, const void *ns)
@@ -933,7 +942,7 @@ struct kernfs_node *kernfs_walk_and_get_ns(struct kernfs_node *parent,
  * @flags: KERNFS_ROOT_* flags
  * @priv: opaque data associated with the new directory
  *
- * Returns the root of the new hierarchy on success, ERR_PTR() value on
+ * Return: the root of the new hierarchy on success, ERR_PTR() value on
  * failure.
  */
 struct kernfs_root *kernfs_create_root(struct kernfs_syscall_ops *scops,
@@ -1005,6 +1014,8 @@ void kernfs_destroy_root(struct kernfs_root *root)
 /**
  * kernfs_root_to_node - return the kernfs_node associated with a kernfs_root
  * @root: root to use to lookup
+ *
+ * Return: @root's kernfs_node
  */
 struct kernfs_node *kernfs_root_to_node(struct kernfs_root *root)
 {
@@ -1021,7 +1032,7 @@ struct kernfs_node *kernfs_root_to_node(struct kernfs_root *root)
  * @priv: opaque data associated with the new directory
  * @ns: optional namespace tag of the directory
  *
- * Returns the created node on success, ERR_PTR() value on failure.
+ * Return: the created node on success, ERR_PTR() value on failure.
  */
 struct kernfs_node *kernfs_create_dir_ns(struct kernfs_node *parent,
 					 const char *name, umode_t mode,
@@ -1055,7 +1066,7 @@ struct kernfs_node *kernfs_create_dir_ns(struct kernfs_node *parent,
  * @parent: parent in which to create a new directory
  * @name: name of the new directory
  *
- * Returns the created node on success, ERR_PTR() value on failure.
+ * Return: the created node on success, ERR_PTR() value on failure.
  */
 struct kernfs_node *kernfs_create_empty_dir(struct kernfs_node *parent,
 					    const char *name)
@@ -1304,6 +1315,8 @@ static struct kernfs_node *kernfs_leftmost_descendant(struct kernfs_node *pos)
  * Find the next descendant to visit for post-order traversal of @root's
  * descendants.  @root is included in the iteration and the last node to be
  * visited.
+ *
+ * Return: the next descendant to visit or %NULL when done.
  */
 static struct kernfs_node *kernfs_next_descendant_post(struct kernfs_node *pos,
 						       struct kernfs_node *root)
@@ -1567,6 +1580,8 @@ void kernfs_unbreak_active_protection(struct kernfs_node *kn)
  * the whole kernfs_ops which won the arbitration.  This can be used to
  * guarantee, for example, all concurrent writes to a "delete" file to
  * finish only after the whole operation is complete.
+ *
+ * Return: %true if @kn is removed by this call, otherwise %false.
  */
 bool kernfs_remove_self(struct kernfs_node *kn)
 {
@@ -1627,7 +1642,8 @@ bool kernfs_remove_self(struct kernfs_node *kn)
  * @ns: namespace tag of the kernfs_node to remove
  *
  * Look for the kernfs_node with @name and @ns under @parent and remove it.
- * Returns 0 on success, -ENOENT if such entry doesn't exist.
+ *
+ * Return: %0 on success, -ENOENT if such entry doesn't exist.
  */
 int kernfs_remove_by_name_ns(struct kernfs_node *parent, const char *name,
 			     const void *ns)
@@ -1665,6 +1681,8 @@ int kernfs_remove_by_name_ns(struct kernfs_node *parent, const char *name,
  * @new_parent: new parent to put @sd under
  * @new_name: new name
  * @new_ns: new namespace tag
+ *
+ * Return: %0 on success, -errno on failure.
  */
 int kernfs_rename_ns(struct kernfs_node *kn, struct kernfs_node *new_parent,
 		     const char *new_name, const void *new_ns)
diff --git a/fs/kernfs/file.c b/fs/kernfs/file.c
index 9ab6c92e02da..e4a50e4ff0d2 100644
--- a/fs/kernfs/file.c
+++ b/fs/kernfs/file.c
@@ -33,7 +33,7 @@ struct kernfs_open_node {
  * pending queue is implemented as a singly linked list of kernfs_nodes.
  * The list is terminated with the self pointer so that whether a
  * kernfs_node is on the list or not can be determined by testing the next
- * pointer for NULL.
+ * pointer for %NULL.
  */
 #define KERNFS_NOTIFY_EOL			((void *)&kernfs_notify_list)
 
@@ -59,8 +59,10 @@ static inline struct mutex *kernfs_open_file_mutex_lock(struct kernfs_node *kn)
 }
 
 /**
- * of_on - Return the kernfs_open_node of the specified kernfs_open_file
- * @of: taret kernfs_open_file
+ * of_on - Get the kernfs_open_node of the specified kernfs_open_file
+ * @of: target kernfs_open_file
+ *
+ * Return: the kernfs_open_node of the kernfs_open_file
  */
 static struct kernfs_open_node *of_on(struct kernfs_open_file *of)
 {
@@ -82,6 +84,8 @@ static struct kernfs_open_node *of_on(struct kernfs_open_file *of)
  * outside RCU read-side critical section.
  *
  * The caller needs to make sure that kernfs_open_file_mutex is held.
+ *
+ * Return: @kn->attr.open when kernfs_open_file_mutex is held.
  */
 static struct kernfs_open_node *
 kernfs_deref_open_node_locked(struct kernfs_node *kn)
@@ -548,11 +552,11 @@ static int kernfs_fop_mmap(struct file *file, struct vm_area_struct *vma)
  *	If @kn->attr.open exists, increment its reference count; otherwise,
  *	create one.  @of is chained to the files list.
  *
- *	LOCKING:
+ *	Locking:
  *	Kernel thread context (may sleep).
  *
- *	RETURNS:
- *	0 on success, -errno on failure.
+ *	Return:
+ *	%0 on success, -errno on failure.
  */
 static int kernfs_get_open_node(struct kernfs_node *kn,
 				struct kernfs_open_file *of)
@@ -1024,7 +1028,7 @@ const struct file_operations kernfs_file_fops = {
  * @ns: optional namespace tag of the file
  * @key: lockdep key for the file's active_ref, %NULL to disable lockdep
  *
- * Returns the created node on success, ERR_PTR() value on error.
+ * Return: the created node on success, ERR_PTR() value on error.
  */
 struct kernfs_node *__kernfs_create_file(struct kernfs_node *parent,
 					 const char *name,
diff --git a/fs/kernfs/inode.c b/fs/kernfs/inode.c
index 3d783d80f5da..076ba9884916 100644
--- a/fs/kernfs/inode.c
+++ b/fs/kernfs/inode.c
@@ -94,7 +94,7 @@ int __kernfs_setattr(struct kernfs_node *kn, const struct iattr *iattr)
  * @kn: target node
  * @iattr: iattr to set
  *
- * Returns 0 on success, -errno on failure.
+ * Return: %0 on success, -errno on failure.
  */
 int kernfs_setattr(struct kernfs_node *kn, const struct iattr *iattr)
 {
@@ -241,11 +241,11 @@ static void kernfs_init_inode(struct kernfs_node *kn, struct inode *inode)
  *	allocated and basics are initialized.  New inode is returned
  *	locked.
  *
- *	LOCKING:
+ *	Locking:
  *	Kernel thread context (may sleep).
  *
- *	RETURNS:
- *	Pointer to allocated inode on success, NULL on failure.
+ *	Return:
+ *	Pointer to allocated inode on success, %NULL on failure.
  */
 struct inode *kernfs_get_inode(struct super_block *sb, struct kernfs_node *kn)
 {
diff --git a/fs/kernfs/kernfs-internal.h b/fs/kernfs/kernfs-internal.h
index fc5821effd97..9046d9f39e63 100644
--- a/fs/kernfs/kernfs-internal.h
+++ b/fs/kernfs/kernfs-internal.h
@@ -58,7 +58,7 @@ struct kernfs_root {
  * kernfs_root - find out the kernfs_root a kernfs_node belongs to
  * @kn: kernfs_node of interest
  *
- * Return the kernfs_root @kn belongs to.
+ * Return: the kernfs_root @kn belongs to.
  */
 static inline struct kernfs_root *kernfs_root(struct kernfs_node *kn)
 {
diff --git a/fs/kernfs/mount.c b/fs/kernfs/mount.c
index d0859f72d2d6..e08e8d999807 100644
--- a/fs/kernfs/mount.c
+++ b/fs/kernfs/mount.c
@@ -153,7 +153,7 @@ static const struct export_operations kernfs_export_ops = {
  * kernfs_root_from_sb - determine kernfs_root associated with a super_block
  * @sb: the super_block in question
  *
- * Return the kernfs_root associated with @sb.  If @sb is not a kernfs one,
+ * Return: the kernfs_root associated with @sb.  If @sb is not a kernfs one,
  * %NULL is returned.
  */
 struct kernfs_root *kernfs_root_from_sb(struct super_block *sb)
@@ -167,7 +167,7 @@ struct kernfs_root *kernfs_root_from_sb(struct super_block *sb)
  * find the next ancestor in the path down to @child, where @parent was the
  * ancestor whose descendant we want to find.
  *
- * Say the path is /a/b/c/d.  @child is d, @parent is NULL.  We return the root
+ * Say the path is /a/b/c/d.  @child is d, @parent is %NULL.  We return the root
  * node.  If @parent is b, then we return the node for c.
  * Passing in d as @parent is not ok.
  */
@@ -192,6 +192,8 @@ static struct kernfs_node *find_next_ancestor(struct kernfs_node *child,
  * kernfs_node_dentry - get a dentry for the given kernfs_node
  * @kn: kernfs_node for which a dentry is needed
  * @sb: the kernfs super_block
+ *
+ * Return: the dentry pointer
  */
 struct dentry *kernfs_node_dentry(struct kernfs_node *kn,
 				  struct super_block *sb)
@@ -296,7 +298,7 @@ static int kernfs_set_super(struct super_block *sb, struct fs_context *fc)
  * kernfs_super_ns - determine the namespace tag of a kernfs super_block
  * @sb: super_block of interest
  *
- * Return the namespace tag associated with kernfs super_block @sb.
+ * Return: the namespace tag associated with kernfs super_block @sb.
  */
 const void *kernfs_super_ns(struct super_block *sb)
 {
@@ -313,6 +315,8 @@ const void *kernfs_super_ns(struct super_block *sb)
  * implementation, which should set the specified ->@fs_type and ->@flags, and
  * specify the hierarchy and namespace tag to mount via ->@root and ->@ns,
  * respectively.
+ *
+ * Return: %0 on success, -errno on failure.
  */
 int kernfs_get_tree(struct fs_context *fc)
 {
diff --git a/fs/kernfs/symlink.c b/fs/kernfs/symlink.c
index 0ab13824822f..45371a70caa7 100644
--- a/fs/kernfs/symlink.c
+++ b/fs/kernfs/symlink.c
@@ -19,7 +19,7 @@
  * @name: name of the symlink
  * @target: target node for the symlink to point to
  *
- * Returns the created node on success, ERR_PTR() value on error.
+ * Return: the created node on success, ERR_PTR() value on error.
  * Ownership of the link matches ownership of the target.
  */
 struct kernfs_node *kernfs_create_link(struct kernfs_node *parent,
diff --git a/fs/nfs/nfs4client.c b/fs/nfs/nfs4client.c
index 84b345efcec0..02caeec2c173 100644
--- a/fs/nfs/nfs4client.c
+++ b/fs/nfs/nfs4client.c
@@ -230,9 +230,8 @@ struct nfs_client *nfs4_alloc_client(const struct nfs_client_initdata *cl_init)
 		__set_bit(NFS_CS_INFINITE_SLOTS, &clp->cl_flags);
 	__set_bit(NFS_CS_DISCRTRY, &clp->cl_flags);
 	__set_bit(NFS_CS_NO_RETRANS_TIMEOUT, &clp->cl_flags);
-
-	if (test_bit(NFS_CS_DS, &cl_init->init_flags))
-		__set_bit(NFS_CS_DS, &clp->cl_flags);
+	if (test_bit(NFS_CS_PNFS, &cl_init->init_flags))
+		__set_bit(NFS_CS_PNFS, &clp->cl_flags);
 	/*
 	 * Set up the connection to the server before we add add to the
 	 * global list.
@@ -997,7 +996,6 @@ struct nfs_client *nfs4_set_ds_client(struct nfs_server *mds_srv,
 	if (mds_srv->flags & NFS_MOUNT_NORESVPORT)
 		__set_bit(NFS_CS_NORESVPORT, &cl_init.init_flags);
 
-	__set_bit(NFS_CS_DS, &cl_init.init_flags);
 	__set_bit(NFS_CS_PNFS, &cl_init.init_flags);
 	cl_init.max_connect = NFS_MAX_TRANSPORTS;
 	/*
diff --git a/fs/nfs/nfs4proc.c b/fs/nfs/nfs4proc.c
index cc620fc7aaf7..467e9439eded 100644
--- a/fs/nfs/nfs4proc.c
+++ b/fs/nfs/nfs4proc.c
@@ -8821,7 +8821,7 @@ nfs4_run_exchange_id(struct nfs_client *clp, const struct cred *cred,
 #ifdef CONFIG_NFS_V4_1_MIGRATION
 	calldata->args.flags |= EXCHGID4_FLAG_SUPP_MOVED_MIGR;
 #endif
-	if (test_bit(NFS_CS_DS, &clp->cl_flags))
+	if (test_bit(NFS_CS_PNFS, &clp->cl_flags))
 		calldata->args.flags |= EXCHGID4_FLAG_USE_PNFS_DS;
 	msg.rpc_argp = &calldata->args;
 	msg.rpc_resp = &calldata->res;
diff --git a/fs/nilfs2/btnode.c b/fs/nilfs2/btnode.c
index ee2cde07264b..19ed9015bd66 100644
--- a/fs/nilfs2/btnode.c
+++ b/fs/nilfs2/btnode.c
@@ -51,12 +51,21 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr)
 
 	bh = nilfs_grab_buffer(inode, btnc, blocknr, BIT(BH_NILFS_Node));
 	if (unlikely(!bh))
-		return NULL;
+		return ERR_PTR(-ENOMEM);
 
 	if (unlikely(buffer_mapped(bh) || buffer_uptodate(bh) ||
 		     buffer_dirty(bh))) {
-		brelse(bh);
-		BUG();
+		/*
+		 * The block buffer at the specified new address was already
+		 * in use.  This can happen if it is a virtual block number
+		 * and has been reallocated due to corruption of the bitmap
+		 * used to manage its allocation state (if not, the buffer
+		 * clearing of an abandoned b-tree node is missing somewhere).
+		 */
+		nilfs_error(inode->i_sb,
+			    "state inconsistency probably due to duplicate use of b-tree node block address %llu (ino=%lu)",
+			    (unsigned long long)blocknr, inode->i_ino);
+		goto failed;
 	}
 	memset(bh->b_data, 0, i_blocksize(inode));
 	bh->b_bdev = inode->i_sb->s_bdev;
@@ -67,6 +76,12 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr)
 	unlock_page(bh->b_page);
 	put_page(bh->b_page);
 	return bh;
+
+failed:
+	unlock_page(bh->b_page);
+	put_page(bh->b_page);
+	brelse(bh);
+	return ERR_PTR(-EIO);
 }
 
 int nilfs_btnode_submit_block(struct address_space *btnc, __u64 blocknr,
@@ -217,8 +232,8 @@ int nilfs_btnode_prepare_change_key(struct address_space *btnc,
 	}
 
 	nbh = nilfs_btnode_create_block(btnc, newkey);
-	if (!nbh)
-		return -ENOMEM;
+	if (IS_ERR(nbh))
+		return PTR_ERR(nbh);
 
 	BUG_ON(nbh == obh);
 	ctxt->newbh = nbh;
diff --git a/fs/nilfs2/btree.c b/fs/nilfs2/btree.c
index 146640f0607a..bd24a33fc72e 100644
--- a/fs/nilfs2/btree.c
+++ b/fs/nilfs2/btree.c
@@ -63,8 +63,8 @@ static int nilfs_btree_get_new_block(const struct nilfs_bmap *btree,
 	struct buffer_head *bh;
 
 	bh = nilfs_btnode_create_block(btnc, ptr);
-	if (!bh)
-		return -ENOMEM;
+	if (IS_ERR(bh))
+		return PTR_ERR(bh);
 
 	set_buffer_nilfs_volatile(bh);
 	*bhp = bh;
diff --git a/fs/nilfs2/segment.c b/fs/nilfs2/segment.c
index 04943ab40a01..5110c50be291 100644
--- a/fs/nilfs2/segment.c
+++ b/fs/nilfs2/segment.c
@@ -136,7 +136,7 @@ static void nilfs_dispose_list(struct the_nilfs *, struct list_head *, int);
 
 #define nilfs_cnt32_ge(a, b)   \
 	(typecheck(__u32, a) && typecheck(__u32, b) && \
-	 ((__s32)(a) - (__s32)(b) >= 0))
+	 ((__s32)((a) - (b)) >= 0))
 
 static int nilfs_prepare_segment_lock(struct super_block *sb,
 				      struct nilfs_transaction_info *ti)
diff --git a/fs/ntfs3/attrib.c b/fs/ntfs3/attrib.c
index 2618bf5a3789..0388e6b42100 100644
--- a/fs/ntfs3/attrib.c
+++ b/fs/ntfs3/attrib.c
@@ -242,7 +242,7 @@ int attr_make_nonresident(struct ntfs_inode *ni, struct ATTRIB *attr,
 	struct ntfs_sb_info *sbi;
 	struct ATTRIB *attr_s;
 	struct MFT_REC *rec;
-	u32 used, asize, rsize, aoff, align;
+	u32 used, asize, rsize, aoff;
 	bool is_data;
 	CLST len, alen;
 	char *next;
@@ -263,10 +263,13 @@ int attr_make_nonresident(struct ntfs_inode *ni, struct ATTRIB *attr,
 	rsize = le32_to_cpu(attr->res.data_size);
 	is_data = attr->type == ATTR_DATA && !attr->name_len;
 
-	align = sbi->cluster_size;
-	if (is_attr_compressed(attr))
-		align <<= COMPRESSION_UNIT;
-	len = (rsize + align - 1) >> sbi->cluster_bits;
+	/* len - how many clusters required to store 'rsize' bytes */
+	if (is_attr_compressed(attr)) {
+		u8 shift = sbi->cluster_bits + NTFS_LZNT_CUNIT;
+		len = ((rsize + (1u << shift) - 1) >> shift) << NTFS_LZNT_CUNIT;
+	} else {
+		len = bytes_to_cluster(sbi, rsize);
+	}
 
 	run_init(run);
 
@@ -678,7 +681,8 @@ int attr_set_size(struct ntfs_inode *ni, enum ATTR_TYPE type,
 			goto undo_2;
 		}
 
-		if (!is_mft)
+		/* keep runs for $MFT::$ATTR_DATA and $MFT::$ATTR_BITMAP. */
+		if (ni->mi.rno != MFT_REC_MFT)
 			run_truncate_head(run, evcn + 1);
 
 		svcn = le64_to_cpu(attr->nres.svcn);
@@ -1637,6 +1641,7 @@ int attr_allocate_frame(struct ntfs_inode *ni, CLST frame, size_t compr_size,
 
 	attr_b->nres.total_size = cpu_to_le64(total_size);
 	inode_set_bytes(&ni->vfs_inode, total_size);
+	ni->ni_flags |= NI_FLAG_UPDATE_PARENT;
 
 	mi_b->dirty = true;
 	mark_inode_dirty(&ni->vfs_inode);
diff --git a/fs/ntfs3/bitmap.c b/fs/ntfs3/bitmap.c
index c055bbdfe0f7..dfe4930ccec6 100644
--- a/fs/ntfs3/bitmap.c
+++ b/fs/ntfs3/bitmap.c
@@ -1356,7 +1356,7 @@ int wnd_extend(struct wnd_bitmap *wnd, size_t new_bits)
 
 		err = ntfs_vbo_to_lbo(sbi, &wnd->run, vbo, &lbo, &bytes);
 		if (err)
-			break;
+			return err;
 
 		bh = ntfs_bread(sb, lbo >> sb->s_blocksize_bits);
 		if (!bh)
diff --git a/fs/ntfs3/dir.c b/fs/ntfs3/dir.c
index 98f57d0c702e..dcd689ed4baa 100644
--- a/fs/ntfs3/dir.c
+++ b/fs/ntfs3/dir.c
@@ -326,7 +326,8 @@ static inline int ntfs_filldir(struct ntfs_sb_info *sbi, struct ntfs_inode *ni,
 	 * It does additional locks/reads just to get the type of name.
 	 * Should we use additional mount option to enable branch below?
 	 */
-	if ((fname->dup.fa & FILE_ATTRIBUTE_REPARSE_POINT) &&
+	if (((fname->dup.fa & FILE_ATTRIBUTE_REPARSE_POINT) ||
+	     fname->dup.ea_size) &&
 	    ino != ni->mi.rno) {
 		struct inode *inode = ntfs_iget5(sbi->sb, &e->ref, NULL);
 		if (!IS_ERR_OR_NULL(inode)) {
diff --git a/fs/ntfs3/file.c b/fs/ntfs3/file.c
index 14efe46df91e..6f03de747e37 100644
--- a/fs/ntfs3/file.c
+++ b/fs/ntfs3/file.c
@@ -396,10 +396,7 @@ static int ntfs_file_mmap(struct file *file, struct vm_area_struct *vma)
 		}
 
 		if (ni->i_valid < to) {
-			if (!inode_trylock(inode)) {
-				err = -EAGAIN;
-				goto out;
-			}
+			inode_lock(inode);
 			err = ntfs_extend_initialized_size(file, ni,
 							   ni->i_valid, to);
 			inode_unlock(inode);
diff --git a/fs/ntfs3/frecord.c b/fs/ntfs3/frecord.c
index d26026090024..02465ab3f398 100644
--- a/fs/ntfs3/frecord.c
+++ b/fs/ntfs3/frecord.c
@@ -1501,7 +1501,7 @@ int ni_insert_nonresident(struct ntfs_inode *ni, enum ATTR_TYPE type,
 
 	if (is_ext) {
 		if (flags & ATTR_FLAG_COMPRESSED)
-			attr->nres.c_unit = COMPRESSION_UNIT;
+			attr->nres.c_unit = NTFS_LZNT_CUNIT;
 		attr->nres.total_size = attr->nres.alloc_size;
 	}
 
diff --git a/fs/ntfs3/fslog.c b/fs/ntfs3/fslog.c
index 6d0d9b1c3b2e..8e23bd6cd0f2 100644
--- a/fs/ntfs3/fslog.c
+++ b/fs/ntfs3/fslog.c
@@ -2999,7 +2999,7 @@ static struct ATTRIB *attr_create_nonres_log(struct ntfs_sb_info *sbi,
 	if (is_ext) {
 		attr->name_off = SIZEOF_NONRESIDENT_EX_LE;
 		if (is_attr_compressed(attr))
-			attr->nres.c_unit = COMPRESSION_UNIT;
+			attr->nres.c_unit = NTFS_LZNT_CUNIT;
 
 		attr->nres.run_off =
 			cpu_to_le16(SIZEOF_NONRESIDENT_EX + name_size);
@@ -3937,6 +3937,9 @@ int log_replay(struct ntfs_inode *ni, bool *initialized)
 		goto out;
 	}
 
+	log->page_mask = log->page_size - 1;
+	log->page_bits = blksize_bits(log->page_size);
+
 	/* If the file size has shrunk then we won't mount it. */
 	if (l_size < le64_to_cpu(ra2->l_size)) {
 		err = -EINVAL;
diff --git a/fs/ntfs3/fsntfs.c b/fs/ntfs3/fsntfs.c
index 4c2d079b3d49..97723a839c81 100644
--- a/fs/ntfs3/fsntfs.c
+++ b/fs/ntfs3/fsntfs.c
@@ -475,7 +475,7 @@ static int ntfs_extend_mft(struct ntfs_sb_info *sbi)
 	struct ATTRIB *attr;
 	struct wnd_bitmap *wnd = &sbi->mft.bitmap;
 
-	new_mft_total = (wnd->nbits + MFT_INCREASE_CHUNK + 127) & (CLST)~127;
+	new_mft_total = ALIGN(wnd->nbits + NTFS_MFT_INCREASE_STEP, 128);
 	new_mft_bytes = (u64)new_mft_total << sbi->record_bits;
 
 	/* Step 1: Resize $MFT::DATA. */
diff --git a/fs/ntfs3/index.c b/fs/ntfs3/index.c
index 730629235ffa..9c36e0f3468d 100644
--- a/fs/ntfs3/index.c
+++ b/fs/ntfs3/index.c
@@ -979,7 +979,7 @@ static struct indx_node *indx_new(struct ntfs_index *indx,
 		hdr->used =
 			cpu_to_le32(eo + sizeof(struct NTFS_DE) + sizeof(u64));
 		de_set_vbn_le(e, *sub_vbn);
-		hdr->flags = 1;
+		hdr->flags = NTFS_INDEX_HDR_HAS_SUBNODES;
 	} else {
 		e->size = cpu_to_le16(sizeof(struct NTFS_DE));
 		hdr->used = cpu_to_le32(eo + sizeof(struct NTFS_DE));
@@ -1677,7 +1677,7 @@ static int indx_insert_into_root(struct ntfs_index *indx, struct ntfs_inode *ni,
 	e->size = cpu_to_le16(sizeof(struct NTFS_DE) + sizeof(u64));
 	e->flags = NTFS_IE_HAS_SUBNODES | NTFS_IE_LAST;
 
-	hdr->flags = 1;
+	hdr->flags = NTFS_INDEX_HDR_HAS_SUBNODES;
 	hdr->used = hdr->total =
 		cpu_to_le32(new_root_size - offsetof(struct INDEX_ROOT, ihdr));
 
diff --git a/fs/ntfs3/inode.c b/fs/ntfs3/inode.c
index 2c8c32d9fcaa..28cbae395431 100644
--- a/fs/ntfs3/inode.c
+++ b/fs/ntfs3/inode.c
@@ -1459,7 +1459,7 @@ struct inode *ntfs_create_inode(struct user_namespace *mnt_userns,
 			attr->size = cpu_to_le32(SIZEOF_NONRESIDENT_EX + 8);
 			attr->name_off = SIZEOF_NONRESIDENT_EX_LE;
 			attr->flags = ATTR_FLAG_COMPRESSED;
-			attr->nres.c_unit = COMPRESSION_UNIT;
+			attr->nres.c_unit = NTFS_LZNT_CUNIT;
 			asize = SIZEOF_NONRESIDENT_EX + 8;
 		} else {
 			attr->size = cpu_to_le32(SIZEOF_NONRESIDENT + 8);
@@ -1967,5 +1967,6 @@ const struct address_space_operations ntfs_aops = {
 const struct address_space_operations ntfs_aops_cmpr = {
 	.read_folio	= ntfs_read_folio,
 	.readahead	= ntfs_readahead,
+	.dirty_folio	= block_dirty_folio,
 };
 // clang-format on
diff --git a/fs/ntfs3/ntfs.h b/fs/ntfs3/ntfs.h
index 324c0b036fdc..625f2b52bd58 100644
--- a/fs/ntfs3/ntfs.h
+++ b/fs/ntfs3/ntfs.h
@@ -82,10 +82,6 @@ typedef u32 CLST;
 #define RESIDENT_LCN   ((CLST)-2)
 #define COMPRESSED_LCN ((CLST)-3)
 
-#define COMPRESSION_UNIT     4
-#define COMPRESS_MAX_CLUSTER 0x1000
-#define MFT_INCREASE_CHUNK   1024
-
 enum RECORD_NUM {
 	MFT_REC_MFT		= 0,
 	MFT_REC_MIRR		= 1,
@@ -690,14 +686,15 @@ static inline bool de_has_vcn_ex(const struct NTFS_DE *e)
 	      offsetof(struct ATTR_FILE_NAME, name) + \
 	      NTFS_NAME_LEN * sizeof(short), 8)
 
+#define NTFS_INDEX_HDR_HAS_SUBNODES cpu_to_le32(1)
+
 struct INDEX_HDR {
 	__le32 de_off;	// 0x00: The offset from the start of this structure
 			// to the first NTFS_DE.
 	__le32 used;	// 0x04: The size of this structure plus all
 			// entries (quad-word aligned).
 	__le32 total;	// 0x08: The allocated size of for this structure plus all entries.
-	u8 flags;	// 0x0C: 0x00 = Small directory, 0x01 = Large directory.
-	u8 res[3];
+	__le32 flags;	// 0x0C: 0x00 = Small directory, 0x01 = Large directory.
 
 	//
 	// de_off + used <= total
@@ -744,7 +741,7 @@ static inline struct NTFS_DE *hdr_next_de(const struct INDEX_HDR *hdr,
 
 static inline bool hdr_has_subnode(const struct INDEX_HDR *hdr)
 {
-	return hdr->flags & 1;
+	return hdr->flags & NTFS_INDEX_HDR_HAS_SUBNODES;
 }
 
 struct INDEX_BUFFER {
@@ -764,7 +761,7 @@ static inline bool ib_is_empty(const struct INDEX_BUFFER *ib)
 
 static inline bool ib_is_leaf(const struct INDEX_BUFFER *ib)
 {
-	return !(ib->ihdr.flags & 1);
+	return !(ib->ihdr.flags & NTFS_INDEX_HDR_HAS_SUBNODES);
 }
 
 /* Index root structure ( 0x90 ). */
diff --git a/fs/ntfs3/ntfs_fs.h b/fs/ntfs3/ntfs_fs.h
index 0f9bec29f2b7..3e65ccccdb89 100644
--- a/fs/ntfs3/ntfs_fs.h
+++ b/fs/ntfs3/ntfs_fs.h
@@ -197,6 +197,8 @@ struct ntfs_index {
 
 /* Minimum MFT zone. */
 #define NTFS_MIN_MFT_ZONE 100
+/* Step to increase the MFT. */
+#define NTFS_MFT_INCREASE_STEP 1024
 
 /* Ntfs file system in-core superblock data. */
 struct ntfs_sb_info {
diff --git a/fs/proc/task_mmu.c b/fs/proc/task_mmu.c
index a954305fbc31..484886cdd272 100644
--- a/fs/proc/task_mmu.c
+++ b/fs/proc/task_mmu.c
@@ -1513,6 +1513,8 @@ static int pagemap_pmd_range(pmd_t *pmdp, unsigned long addr, unsigned long end,
 		}
 #endif
 
+		if (page && !PageAnon(page))
+			flags |= PM_FILE;
 		if (page && !migration && page_mapcount(page) == 1)
 			flags |= PM_MMAP_EXCLUSIVE;
 
diff --git a/fs/smb/client/cifsfs.c b/fs/smb/client/cifsfs.c
index 78340d904c7b..6384e1b2b2ef 100644
--- a/fs/smb/client/cifsfs.c
+++ b/fs/smb/client/cifsfs.c
@@ -1872,12 +1872,12 @@ init_cifs(void)
 					   WQ_FREEZABLE|WQ_MEM_RECLAIM, 0);
 	if (!serverclose_wq) {
 		rc = -ENOMEM;
-		goto out_destroy_serverclose_wq;
+		goto out_destroy_deferredclose_wq;
 	}
 
 	rc = cifs_init_inodecache();
 	if (rc)
-		goto out_destroy_deferredclose_wq;
+		goto out_destroy_serverclose_wq;
 
 	rc = init_mids();
 	if (rc)
@@ -1939,6 +1939,8 @@ init_cifs(void)
 	destroy_mids();
 out_destroy_inodecache:
 	cifs_destroy_inodecache();
+out_destroy_serverclose_wq:
+	destroy_workqueue(serverclose_wq);
 out_destroy_deferredclose_wq:
 	destroy_workqueue(deferredclose_wq);
 out_destroy_cifsoplockd_wq:
@@ -1949,8 +1951,6 @@ init_cifs(void)
 	destroy_workqueue(decrypt_wq);
 out_destroy_cifsiod_wq:
 	destroy_workqueue(cifsiod_wq);
-out_destroy_serverclose_wq:
-	destroy_workqueue(serverclose_wq);
 out_clean_proc:
 	cifs_proc_clean();
 	return rc;
diff --git a/fs/smb/client/connect.c b/fs/smb/client/connect.c
index 8c2a784200ec..21b344762d0f 100644
--- a/fs/smb/client/connect.c
+++ b/fs/smb/client/connect.c
@@ -2592,6 +2592,13 @@ cifs_get_tcon(struct cifs_ses *ses, struct smb3_fs_context *ctx)
 			cifs_dbg(VFS, "Server does not support mounting with posix SMB3.11 extensions\n");
 			rc = -EOPNOTSUPP;
 			goto out_fail;
+		} else if (ses->server->vals->protocol_id == SMB10_PROT_ID)
+			if (cap_unix(ses))
+				cifs_dbg(FYI, "Unix Extensions requested on SMB1 mount\n");
+			else {
+				cifs_dbg(VFS, "SMB1 Unix Extensions not supported by server\n");
+				rc = -EOPNOTSUPP;
+				goto out_fail;
 		} else {
 			cifs_dbg(VFS, "Check vers= mount option. SMB3.11 "
 				"disabled but required for POSIX extensions\n");
@@ -3975,6 +3982,7 @@ int cifs_mount(struct cifs_sb_info *cifs_sb, struct smb3_fs_context *ctx)
 }
 #endif
 
+#ifdef CONFIG_CIFS_ALLOW_INSECURE_LEGACY
 /*
  * Issue a TREE_CONNECT request.
  */
@@ -4096,11 +4104,25 @@ CIFSTCon(const unsigned int xid, struct cifs_ses *ses,
 		else
 			tcon->Flags = 0;
 		cifs_dbg(FYI, "Tcon flags: 0x%x\n", tcon->Flags);
-	}
 
+		/*
+		 * reset_cifs_unix_caps calls QFSInfo which requires
+		 * need_reconnect to be false, but we would not need to call
+		 * reset_caps if this were not a reconnect case so must check
+		 * need_reconnect flag here.  The caller will also clear
+		 * need_reconnect when tcon was successful but needed to be
+		 * cleared earlier in the case of unix extensions reconnect
+		 */
+		if (tcon->need_reconnect && tcon->unix_ext) {
+			cifs_dbg(FYI, "resetting caps for %s\n", tcon->tree_name);
+			tcon->need_reconnect = false;
+			reset_cifs_unix_caps(xid, tcon, NULL, NULL);
+		}
+	}
 	cifs_buf_release(smb_buffer);
 	return rc;
 }
+#endif /* CONFIG_CIFS_ALLOW_INSECURE_LEGACY */
 
 static void delayed_free(struct rcu_head *p)
 {
diff --git a/fs/super.c b/fs/super.c
index d138332e57a9..b116f72cd122 100644
--- a/fs/super.c
+++ b/fs/super.c
@@ -569,6 +569,17 @@ struct super_block *sget_fc(struct fs_context *fc,
 	struct user_namespace *user_ns = fc->global ? &init_user_ns : fc->user_ns;
 	int err;
 
+	/*
+	 * Never allow s_user_ns != &init_user_ns when FS_USERNS_MOUNT is
+	 * not set, as the filesystem is likely unprepared to handle it.
+	 * This can happen when fsconfig() is called from init_user_ns with
+	 * an fs_fd opened in another user namespace.
+	 */
+	if (user_ns != &init_user_ns && !(fc->fs_type->fs_flags & FS_USERNS_MOUNT)) {
+		errorfc(fc, "VFS: Mounting from non-initial user namespace is not allowed");
+		return ERR_PTR(-EPERM);
+	}
+
 retry:
 	spin_lock(&sb_lock);
 	if (test) {
diff --git a/fs/udf/balloc.c b/fs/udf/balloc.c
index f416b7fe092f..c4c18eeacb60 100644
--- a/fs/udf/balloc.c
+++ b/fs/udf/balloc.c
@@ -68,8 +68,12 @@ static int read_block_bitmap(struct super_block *sb,
 	}
 
 	for (i = 0; i < count; i++)
-		if (udf_test_bit(i + off, bh->b_data))
+		if (udf_test_bit(i + off, bh->b_data)) {
+			bitmap->s_block_bitmap[bitmap_nr] =
+							ERR_PTR(-EFSCORRUPTED);
+			brelse(bh);
 			return -EFSCORRUPTED;
+		}
 	return 0;
 }
 
@@ -85,8 +89,15 @@ static int __load_block_bitmap(struct super_block *sb,
 			  block_group, nr_groups);
 	}
 
-	if (bitmap->s_block_bitmap[block_group])
+	if (bitmap->s_block_bitmap[block_group]) {
+		/*
+		 * The bitmap failed verification in the past. No point in
+		 * trying again.
+		 */
+		if (IS_ERR(bitmap->s_block_bitmap[block_group]))
+			return PTR_ERR(bitmap->s_block_bitmap[block_group]);
 		return block_group;
+	}
 
 	retval = read_block_bitmap(sb, bitmap, block_group, block_group);
 	if (retval < 0)
diff --git a/fs/udf/super.c b/fs/udf/super.c
index 6dc9d8dad88e..65fbc60a88e4 100644
--- a/fs/udf/super.c
+++ b/fs/udf/super.c
@@ -266,7 +266,8 @@ static void udf_sb_free_bitmap(struct udf_bitmap *bitmap)
 	int nr_groups = bitmap->s_nr_groups;
 
 	for (i = 0; i < nr_groups; i++)
-		brelse(bitmap->s_block_bitmap[i]);
+		if (!IS_ERR_OR_NULL(bitmap->s_block_bitmap[i]))
+			brelse(bitmap->s_block_bitmap[i]);
 
 	kvfree(bitmap);
 }
diff --git a/include/asm-generic/vmlinux.lds.h b/include/asm-generic/vmlinux.lds.h
index 1d1f480a5e9e..e7539dc02498 100644
--- a/include/asm-generic/vmlinux.lds.h
+++ b/include/asm-generic/vmlinux.lds.h
@@ -101,7 +101,7 @@
 #define DATA_MAIN .data .data.[0-9a-zA-Z_]* .data..L* .data..compoundliteral* .data.$__unnamed_* .data.$L*
 #define SDATA_MAIN .sdata .sdata.[0-9a-zA-Z_]*
 #define RODATA_MAIN .rodata .rodata.[0-9a-zA-Z_]* .rodata..L*
-#define BSS_MAIN .bss .bss.[0-9a-zA-Z_]* .bss..compoundliteral*
+#define BSS_MAIN .bss .bss.[0-9a-zA-Z_]* .bss..L* .bss..compoundliteral*
 #define SBSS_MAIN .sbss .sbss.[0-9a-zA-Z_]*
 #else
 #define TEXT_MAIN .text
diff --git a/include/drm/drm_mipi_dsi.h b/include/drm/drm_mipi_dsi.h
index 66a7e01c6260..1a921e8943a0 100644
--- a/include/drm/drm_mipi_dsi.h
+++ b/include/drm/drm_mipi_dsi.h
@@ -309,15 +309,18 @@ int mipi_dsi_dcs_get_display_brightness_large(struct mipi_dsi_device *dsi,
  * @cmd: Command
  * @seq: buffer containing data to be transmitted
  */
-#define mipi_dsi_dcs_write_seq(dsi, cmd, seq...) do {				\
-		static const u8 d[] = { cmd, seq };				\
-		struct device *dev = &dsi->dev;	\
-		int ret;						\
-		ret = mipi_dsi_dcs_write_buffer(dsi, d, ARRAY_SIZE(d));	\
-		if (ret < 0) {						\
-			dev_err_ratelimited(dev, "sending command %#02x failed: %d\n", cmd, ret); \
-			return ret;						\
-		}						\
+#define mipi_dsi_dcs_write_seq(dsi, cmd, seq...)                            \
+	do {                                                                \
+		static const u8 d[] = { cmd, seq };                         \
+		struct device *dev = &dsi->dev;                             \
+		ssize_t ret;                                                \
+		ret = mipi_dsi_dcs_write_buffer(dsi, d, ARRAY_SIZE(d));     \
+		if (ret < 0) {                                              \
+			dev_err_ratelimited(                                \
+				dev, "sending command %#02x failed: %zd\n", \
+				cmd, ret);                                  \
+			return ret;                                         \
+		}                                                           \
 	} while (0)
 
 /**
diff --git a/include/linux/bpf_verifier.h b/include/linux/bpf_verifier.h
index f080ccf27d25..6a524c5462a6 100644
--- a/include/linux/bpf_verifier.h
+++ b/include/linux/bpf_verifier.h
@@ -645,7 +645,7 @@ static inline u32 type_flag(u32 type)
 /* only use after check_attach_btf_id() */
 static inline enum bpf_prog_type resolve_prog_type(const struct bpf_prog *prog)
 {
-	return prog->type == BPF_PROG_TYPE_EXT ?
+	return (prog->type == BPF_PROG_TYPE_EXT && prog->aux->dst_prog) ?
 		prog->aux->dst_prog->type : prog->type;
 }
 
diff --git a/include/linux/hugetlb.h b/include/linux/hugetlb.h
index 37eeef9841c4..cc555072940f 100644
--- a/include/linux/hugetlb.h
+++ b/include/linux/hugetlb.h
@@ -694,6 +694,7 @@ HPAGEFLAG(RawHwpUnreliable, raw_hwp_unreliable)
 /* Defines one hugetlb page size */
 struct hstate {
 	struct mutex resize_lock;
+	struct lock_class_key resize_key;
 	int next_nid_to_alloc;
 	int next_nid_to_free;
 	unsigned int order;
diff --git a/include/linux/jbd2.h b/include/linux/jbd2.h
index 6611af5f1d0c..e301d323108d 100644
--- a/include/linux/jbd2.h
+++ b/include/linux/jbd2.h
@@ -1665,11 +1665,6 @@ int jbd2_wait_inode_data(journal_t *journal, struct jbd2_inode *jinode);
 int jbd2_fc_wait_bufs(journal_t *journal, int num_blks);
 int jbd2_fc_release_bufs(journal_t *journal);
 
-static inline int jbd2_journal_get_max_txn_bufs(journal_t *journal)
-{
-	return (journal->j_total_len - journal->j_fc_wbufsize) / 4;
-}
-
 /*
  * is_journal_abort
  *
diff --git a/include/linux/jump_label.h b/include/linux/jump_label.h
index 570831ca9951..4e968ebadce6 100644
--- a/include/linux/jump_label.h
+++ b/include/linux/jump_label.h
@@ -224,9 +224,10 @@ extern bool arch_jump_label_transform_queue(struct jump_entry *entry,
 					    enum jump_label_type type);
 extern void arch_jump_label_transform_apply(void);
 extern int jump_label_text_reserved(void *start, void *end);
-extern void static_key_slow_inc(struct static_key *key);
+extern bool static_key_slow_inc(struct static_key *key);
+extern bool static_key_fast_inc_not_disabled(struct static_key *key);
 extern void static_key_slow_dec(struct static_key *key);
-extern void static_key_slow_inc_cpuslocked(struct static_key *key);
+extern bool static_key_slow_inc_cpuslocked(struct static_key *key);
 extern void static_key_slow_dec_cpuslocked(struct static_key *key);
 extern int static_key_count(struct static_key *key);
 extern void static_key_enable(struct static_key *key);
@@ -278,11 +279,23 @@ static __always_inline bool static_key_true(struct static_key *key)
 	return false;
 }
 
-static inline void static_key_slow_inc(struct static_key *key)
+static inline bool static_key_fast_inc_not_disabled(struct static_key *key)
 {
+	int v;
+
 	STATIC_KEY_CHECK_USE(key);
-	atomic_inc(&key->enabled);
+	/*
+	 * Prevent key->enabled getting negative to follow the same semantics
+	 * as for CONFIG_JUMP_LABEL=y, see kernel/jump_label.c comment.
+	 */
+	v = atomic_read(&key->enabled);
+	do {
+		if (v < 0 || (v + 1) < 0)
+			return false;
+	} while (!likely(atomic_try_cmpxchg(&key->enabled, &v, v + 1)));
+	return true;
 }
+#define static_key_slow_inc(key)	static_key_fast_inc_not_disabled(key)
 
 static inline void static_key_slow_dec(struct static_key *key)
 {
diff --git a/include/linux/mlx5/qp.h b/include/linux/mlx5/qp.h
index ca0eee571ad7..15e8d7fd3879 100644
--- a/include/linux/mlx5/qp.h
+++ b/include/linux/mlx5/qp.h
@@ -566,9 +566,12 @@ static inline const char *mlx5_qp_state_str(int state)
 
 static inline int mlx5_get_qp_default_ts(struct mlx5_core_dev *dev)
 {
-	return !MLX5_CAP_ROCE(dev, qp_ts_format) ?
-		       MLX5_TIMESTAMP_FORMAT_FREE_RUNNING :
-		       MLX5_TIMESTAMP_FORMAT_DEFAULT;
+	u8 supported_ts_cap = mlx5_get_roce_state(dev) ?
+			      MLX5_CAP_ROCE(dev, qp_ts_format) :
+			      MLX5_CAP_GEN(dev, sq_ts_format);
+
+	return supported_ts_cap ? MLX5_TIMESTAMP_FORMAT_DEFAULT :
+	       MLX5_TIMESTAMP_FORMAT_FREE_RUNNING;
 }
 
 #endif /* MLX5_QP_H */
diff --git a/include/linux/objagg.h b/include/linux/objagg.h
index 78021777df46..6df5b887dc54 100644
--- a/include/linux/objagg.h
+++ b/include/linux/objagg.h
@@ -8,7 +8,6 @@ struct objagg_ops {
 	size_t obj_size;
 	bool (*delta_check)(void *priv, const void *parent_obj,
 			    const void *obj);
-	int (*hints_obj_cmp)(const void *obj1, const void *obj2);
 	void * (*delta_create)(void *priv, void *parent_obj, void *obj);
 	void (*delta_destroy)(void *priv, void *delta_priv);
 	void * (*root_create)(void *priv, void *obj, unsigned int root_id);
diff --git a/include/linux/pci.h b/include/linux/pci.h
index 4da7411da9ba..df73fb26b825 100644
--- a/include/linux/pci.h
+++ b/include/linux/pci.h
@@ -1138,6 +1138,7 @@ int pci_get_interrupt_pin(struct pci_dev *dev, struct pci_dev **bridge);
 u8 pci_common_swizzle(struct pci_dev *dev, u8 *pinp);
 struct pci_dev *pci_dev_get(struct pci_dev *dev);
 void pci_dev_put(struct pci_dev *dev);
+DEFINE_FREE(pci_dev_put, struct pci_dev *, if (_T) pci_dev_put(_T))
 void pci_remove_bus(struct pci_bus *b);
 void pci_stop_and_remove_bus_device(struct pci_dev *dev);
 void pci_stop_and_remove_bus_device_locked(struct pci_dev *dev);
@@ -1746,6 +1747,7 @@ void pci_cfg_access_unlock(struct pci_dev *dev);
 void pci_dev_lock(struct pci_dev *dev);
 int pci_dev_trylock(struct pci_dev *dev);
 void pci_dev_unlock(struct pci_dev *dev);
+DEFINE_GUARD(pci_dev, struct pci_dev *, pci_dev_lock(_T), pci_dev_unlock(_T))
 
 /*
  * PCI domain support.  Sometimes called PCI segment (eg by ACPI),
diff --git a/include/linux/perf_event.h b/include/linux/perf_event.h
index 1578a4de1f3c..27b694552d58 100644
--- a/include/linux/perf_event.h
+++ b/include/linux/perf_event.h
@@ -765,6 +765,7 @@ struct perf_event {
 	struct irq_work			pending_irq;
 	struct callback_head		pending_task;
 	unsigned int			pending_work;
+	struct rcuwait			pending_work_wait;
 
 	atomic_t			event_limit;
 
diff --git a/include/linux/sbitmap.h b/include/linux/sbitmap.h
index d662cf136021..c09cdcc99471 100644
--- a/include/linux/sbitmap.h
+++ b/include/linux/sbitmap.h
@@ -36,6 +36,11 @@ struct sbitmap_word {
 	 * @cleared: word holding cleared bits
 	 */
 	unsigned long cleared ____cacheline_aligned_in_smp;
+
+	/**
+	 * @swap_lock: serializes simultaneous updates of ->word and ->cleared
+	 */
+	spinlock_t swap_lock;
 } ____cacheline_aligned_in_smp;
 
 /**
diff --git a/include/linux/task_work.h b/include/linux/task_work.h
index 795ef5a68429..26b8a47f41fc 100644
--- a/include/linux/task_work.h
+++ b/include/linux/task_work.h
@@ -30,7 +30,8 @@ int task_work_add(struct task_struct *task, struct callback_head *twork,
 
 struct callback_head *task_work_cancel_match(struct task_struct *task,
 	bool (*match)(struct callback_head *, void *data), void *data);
-struct callback_head *task_work_cancel(struct task_struct *, task_work_func_t);
+struct callback_head *task_work_cancel_func(struct task_struct *, task_work_func_t);
+bool task_work_cancel(struct task_struct *task, struct callback_head *cb);
 void task_work_run(void);
 
 static inline void exit_task_work(struct task_struct *task)
diff --git a/include/linux/virtio_net.h b/include/linux/virtio_net.h
index 6047058d6703..29b19d0a324c 100644
--- a/include/linux/virtio_net.h
+++ b/include/linux/virtio_net.h
@@ -51,6 +51,7 @@ static inline int virtio_net_hdr_to_skb(struct sk_buff *skb,
 	unsigned int thlen = 0;
 	unsigned int p_off = 0;
 	unsigned int ip_proto;
+	u64 ret, remainder, gso_size;
 
 	if (hdr->gso_type != VIRTIO_NET_HDR_GSO_NONE) {
 		switch (hdr->gso_type & ~VIRTIO_NET_HDR_GSO_ECN) {
@@ -87,6 +88,16 @@ static inline int virtio_net_hdr_to_skb(struct sk_buff *skb,
 		u32 off = __virtio16_to_cpu(little_endian, hdr->csum_offset);
 		u32 needed = start + max_t(u32, thlen, off + sizeof(__sum16));
 
+		if (hdr->gso_size) {
+			gso_size = __virtio16_to_cpu(little_endian, hdr->gso_size);
+			ret = div64_u64_rem(skb->len, gso_size, &remainder);
+			if (!(ret && (hdr->gso_size > needed) &&
+						((remainder > needed) || (remainder == 0)))) {
+				return -EINVAL;
+			}
+			skb_shinfo(skb)->tx_flags |= SKBFL_SHARED_FRAG;
+		}
+
 		if (!pskb_may_pull(skb, needed))
 			return -EINVAL;
 
diff --git a/include/net/ip_fib.h b/include/net/ip_fib.h
index 15de07d36540..ca1700c2a573 100644
--- a/include/net/ip_fib.h
+++ b/include/net/ip_fib.h
@@ -173,6 +173,7 @@ struct fib_result {
 	unsigned char		type;
 	unsigned char		scope;
 	u32			tclassid;
+	dscp_t			dscp;
 	struct fib_nh_common	*nhc;
 	struct fib_info		*fi;
 	struct fib_table	*table;
diff --git a/include/net/tcp.h b/include/net/tcp.h
index 8ea1fba84eff..cc314c383c53 100644
--- a/include/net/tcp.h
+++ b/include/net/tcp.h
@@ -633,6 +633,7 @@ void tcp_skb_collapse_tstamp(struct sk_buff *skb,
 /* tcp_input.c */
 void tcp_rearm_rto(struct sock *sk);
 void tcp_synack_rtt_meas(struct sock *sk, struct request_sock *req);
+void tcp_done_with_error(struct sock *sk, int err);
 void tcp_reset(struct sock *sk, struct sk_buff *skb);
 void tcp_skb_mark_lost_uncond_verify(struct tcp_sock *tp, struct sk_buff *skb);
 void tcp_fin(struct sock *sk);
diff --git a/include/trace/events/rpcgss.h b/include/trace/events/rpcgss.h
index 894d9fc8bd94..e228a44af291 100644
--- a/include/trace/events/rpcgss.h
+++ b/include/trace/events/rpcgss.h
@@ -54,7 +54,7 @@ TRACE_DEFINE_ENUM(GSS_S_UNSEQ_TOKEN);
 TRACE_DEFINE_ENUM(GSS_S_GAP_TOKEN);
 
 #define show_gss_status(x)						\
-	__print_flags(x, "|",						\
+	__print_symbolic(x, 						\
 		{ GSS_S_BAD_MECH, "GSS_S_BAD_MECH" },			\
 		{ GSS_S_BAD_NAME, "GSS_S_BAD_NAME" },			\
 		{ GSS_S_BAD_NAMETYPE, "GSS_S_BAD_NAMETYPE" },		\
diff --git a/include/uapi/linux/netfilter/nf_tables.h b/include/uapi/linux/netfilter/nf_tables.h
index 707af820f1a9..672b2e1b47f2 100644
--- a/include/uapi/linux/netfilter/nf_tables.h
+++ b/include/uapi/linux/netfilter/nf_tables.h
@@ -1324,7 +1324,7 @@ enum nft_secmark_attributes {
 #define NFTA_SECMARK_MAX	(__NFTA_SECMARK_MAX - 1)
 
 /* Max security context length */
-#define NFT_SECMARK_CTX_MAXLEN		256
+#define NFT_SECMARK_CTX_MAXLEN		4096
 
 /**
  * enum nft_reject_types - nf_tables reject expression reject types
diff --git a/include/uapi/linux/zorro_ids.h b/include/uapi/linux/zorro_ids.h
index 6e574d7b7d79..393f2ee9c042 100644
--- a/include/uapi/linux/zorro_ids.h
+++ b/include/uapi/linux/zorro_ids.h
@@ -449,6 +449,9 @@
 #define  ZORRO_PROD_VMC_ISDN_BLASTER_Z2				ZORRO_ID(VMC, 0x01, 0)
 #define  ZORRO_PROD_VMC_HYPERCOM_4				ZORRO_ID(VMC, 0x02, 0)
 
+#define ZORRO_MANUF_CSLAB					0x1400
+#define  ZORRO_PROD_CSLAB_WARP_1260				ZORRO_ID(CSLAB, 0x65, 0)
+
 #define ZORRO_MANUF_INFORMATION					0x157C
 #define  ZORRO_PROD_INFORMATION_ISDN_ENGINE_I			ZORRO_ID(INFORMATION, 0x64, 0)
 
diff --git a/io_uring/io-wq.c b/io_uring/io-wq.c
index 98ac9dbcec2f..04503118cdc1 100644
--- a/io_uring/io-wq.c
+++ b/io_uring/io-wq.c
@@ -22,6 +22,7 @@
 #include "io_uring.h"
 
 #define WORKER_IDLE_TIMEOUT	(5 * HZ)
+#define WORKER_INIT_LIMIT	3
 
 enum {
 	IO_WORKER_F_UP		= 1,	/* up and active */
@@ -58,6 +59,7 @@ struct io_worker {
 	unsigned long create_state;
 	struct callback_head create_work;
 	int create_index;
+	int init_retries;
 
 	union {
 		struct rcu_head rcu;
@@ -729,7 +731,7 @@ static bool io_wq_work_match_all(struct io_wq_work *work, void *data)
 	return true;
 }
 
-static inline bool io_should_retry_thread(long err)
+static inline bool io_should_retry_thread(struct io_worker *worker, long err)
 {
 	/*
 	 * Prevent perpetual task_work retry, if the task (or its group) is
@@ -737,6 +739,8 @@ static inline bool io_should_retry_thread(long err)
 	 */
 	if (fatal_signal_pending(current))
 		return false;
+	if (worker->init_retries++ >= WORKER_INIT_LIMIT)
+		return false;
 
 	switch (err) {
 	case -EAGAIN:
@@ -763,7 +767,7 @@ static void create_worker_cont(struct callback_head *cb)
 		io_init_new_worker(wqe, worker, tsk);
 		io_worker_release(worker);
 		return;
-	} else if (!io_should_retry_thread(PTR_ERR(tsk))) {
+	} else if (!io_should_retry_thread(worker, PTR_ERR(tsk))) {
 		struct io_wqe_acct *acct = io_wqe_get_acct(worker);
 
 		atomic_dec(&acct->nr_running);
@@ -830,7 +834,7 @@ static bool create_io_worker(struct io_wq *wq, struct io_wqe *wqe, int index)
 	tsk = create_io_thread(io_wqe_worker, worker, wqe->node);
 	if (!IS_ERR(tsk)) {
 		io_init_new_worker(wqe, worker, tsk);
-	} else if (!io_should_retry_thread(PTR_ERR(tsk))) {
+	} else if (!io_should_retry_thread(worker, PTR_ERR(tsk))) {
 		kfree(worker);
 		goto fail;
 	} else {
diff --git a/io_uring/io_uring.c b/io_uring/io_uring.c
index 958c3b619020..b21f2bafaeb0 100644
--- a/io_uring/io_uring.c
+++ b/io_uring/io_uring.c
@@ -3000,8 +3000,11 @@ __cold void io_uring_cancel_generic(bool cancel_all, struct io_sq_data *sqd)
 		bool loop = false;
 
 		io_uring_drop_tctx_refs(current);
+		if (!tctx_inflight(tctx, !cancel_all))
+			break;
+
 		/* read completions before cancelations */
-		inflight = tctx_inflight(tctx, !cancel_all);
+		inflight = tctx_inflight(tctx, false);
 		if (!inflight)
 			break;
 
diff --git a/io_uring/timeout.c b/io_uring/timeout.c
index b0cf05ebcbcc..7cdc234c5f53 100644
--- a/io_uring/timeout.c
+++ b/io_uring/timeout.c
@@ -601,7 +601,7 @@ void io_queue_linked_timeout(struct io_kiocb *req)
 
 static bool io_match_task(struct io_kiocb *head, struct task_struct *task,
 			  bool cancel_all)
-	__must_hold(&req->ctx->timeout_lock)
+	__must_hold(&head->ctx->timeout_lock)
 {
 	struct io_kiocb *req;
 
diff --git a/kernel/bpf/btf.c b/kernel/bpf/btf.c
index 7582ec4fd413..bb88fd2266a8 100644
--- a/kernel/bpf/btf.c
+++ b/kernel/bpf/btf.c
@@ -378,7 +378,7 @@ const char *btf_type_str(const struct btf_type *t)
 struct btf_show {
 	u64 flags;
 	void *target;	/* target of show operation (seq file, buffer) */
-	void (*showfn)(struct btf_show *show, const char *fmt, va_list args);
+	__printf(2, 0) void (*showfn)(struct btf_show *show, const char *fmt, va_list args);
 	const struct btf *btf;
 	/* below are used during iteration */
 	struct {
@@ -6792,8 +6792,8 @@ static void btf_type_show(const struct btf *btf, u32 type_id, void *obj,
 	btf_type_ops(t)->show(btf, t, type_id, obj, 0, show);
 }
 
-static void btf_seq_show(struct btf_show *show, const char *fmt,
-			 va_list args)
+__printf(2, 0) static void btf_seq_show(struct btf_show *show, const char *fmt,
+					va_list args)
 {
 	seq_vprintf((struct seq_file *)show->target, fmt, args);
 }
@@ -6826,8 +6826,8 @@ struct btf_show_snprintf {
 	int len;		/* length we would have written */
 };
 
-static void btf_snprintf_show(struct btf_show *show, const char *fmt,
-			      va_list args)
+__printf(2, 0) static void btf_snprintf_show(struct btf_show *show, const char *fmt,
+					     va_list args)
 {
 	struct btf_show_snprintf *ssnprintf = (struct btf_show_snprintf *)show;
 	int len;
diff --git a/kernel/bpf/dispatcher.c b/kernel/bpf/dispatcher.c
index c19719f48ce0..fa3e9225aedc 100644
--- a/kernel/bpf/dispatcher.c
+++ b/kernel/bpf/dispatcher.c
@@ -125,6 +125,11 @@ static void bpf_dispatcher_update(struct bpf_dispatcher *d, int prev_num_progs)
 
 	__BPF_DISPATCHER_UPDATE(d, new ?: (void *)&bpf_dispatcher_nop_func);
 
+	/* Make sure all the callers executing the previous/old half of the
+	 * image leave it, so following update call can modify it safely.
+	 */
+	synchronize_rcu();
+
 	if (new)
 		d->image_off = noff;
 }
diff --git a/kernel/cgroup/cgroup-v1.c b/kernel/cgroup/cgroup-v1.c
index 289cc873cb71..c2d28ffee3b7 100644
--- a/kernel/cgroup/cgroup-v1.c
+++ b/kernel/cgroup/cgroup-v1.c
@@ -802,7 +802,7 @@ void cgroup1_release_agent(struct work_struct *work)
 		goto out_free;
 
 	ret = cgroup_path_ns(cgrp, pathbuf, PATH_MAX, &init_cgroup_ns);
-	if (ret < 0 || ret >= PATH_MAX)
+	if (ret < 0)
 		goto out_free;
 
 	argv[0] = agentbuf;
diff --git a/kernel/cgroup/cgroup.c b/kernel/cgroup/cgroup.c
index 97ecca43386d..1e008ea467c0 100644
--- a/kernel/cgroup/cgroup.c
+++ b/kernel/cgroup/cgroup.c
@@ -1910,7 +1910,7 @@ int cgroup_show_path(struct seq_file *sf, struct kernfs_node *kf_node,
 	len = kernfs_path_from_node(kf_node, ns_cgroup->kn, buf, PATH_MAX);
 	spin_unlock_irq(&css_set_lock);
 
-	if (len >= PATH_MAX)
+	if (len == -E2BIG)
 		len = -ERANGE;
 	else if (len > 0) {
 		seq_escape(sf, buf, " \t\n\\");
@@ -6287,7 +6287,7 @@ int proc_cgroup_show(struct seq_file *m, struct pid_namespace *ns,
 		if (cgroup_on_dfl(cgrp) || !(tsk->flags & PF_EXITING)) {
 			retval = cgroup_path_ns_locked(cgrp, buf, PATH_MAX,
 						current->nsproxy->cgroup_ns);
-			if (retval >= PATH_MAX)
+			if (retval == -E2BIG)
 				retval = -ENAMETOOLONG;
 			if (retval < 0)
 				goto out_unlock;
diff --git a/kernel/cgroup/cpuset.c b/kernel/cgroup/cpuset.c
index 01f5a019e0f5..370a6bce20a8 100644
--- a/kernel/cgroup/cpuset.c
+++ b/kernel/cgroup/cpuset.c
@@ -21,6 +21,7 @@
  *  License.  See the file COPYING in the main directory of the Linux
  *  distribution for more details.
  */
+#include "cgroup-internal.h"
 
 #include <linux/cpu.h>
 #include <linux/cpumask.h>
@@ -4213,11 +4214,15 @@ int proc_cpuset_show(struct seq_file *m, struct pid_namespace *ns,
 	if (!buf)
 		goto out;
 
-	css = task_get_css(tsk, cpuset_cgrp_id);
-	retval = cgroup_path_ns(css->cgroup, buf, PATH_MAX,
-				current->nsproxy->cgroup_ns);
-	css_put(css);
-	if (retval >= PATH_MAX)
+	rcu_read_lock();
+	spin_lock_irq(&css_set_lock);
+	css = task_css(tsk, cpuset_cgrp_id);
+	retval = cgroup_path_ns_locked(css->cgroup, buf, PATH_MAX,
+				       current->nsproxy->cgroup_ns);
+	spin_unlock_irq(&css_set_lock);
+	rcu_read_unlock();
+
+	if (retval == -E2BIG)
 		retval = -ENAMETOOLONG;
 	if (retval < 0)
 		goto out_free;
diff --git a/kernel/debug/kdb/kdb_io.c b/kernel/debug/kdb/kdb_io.c
index b1f79d5a5a60..d545abe08087 100644
--- a/kernel/debug/kdb/kdb_io.c
+++ b/kernel/debug/kdb/kdb_io.c
@@ -193,7 +193,7 @@ char kdb_getchar(void)
  */
 static void kdb_position_cursor(char *prompt, char *buffer, char *cp)
 {
-	kdb_printf("\r%s", kdb_prompt_str);
+	kdb_printf("\r%s", prompt);
 	if (cp > buffer)
 		kdb_printf("%.*s", (int)(cp - buffer), buffer);
 }
@@ -357,7 +357,7 @@ static char *kdb_read(char *buffer, size_t bufsize)
 			if (i >= dtab_count)
 				kdb_printf("...");
 			kdb_printf("\n");
-			kdb_printf(kdb_prompt_str);
+			kdb_printf("%s",  kdb_prompt_str);
 			kdb_printf("%s", buffer);
 			if (cp != lastchar)
 				kdb_position_cursor(kdb_prompt_str, buffer, cp);
@@ -449,7 +449,7 @@ char *kdb_getstr(char *buffer, size_t bufsize, const char *prompt)
 {
 	if (prompt && kdb_prompt_str != prompt)
 		strscpy(kdb_prompt_str, prompt, CMD_BUFLEN);
-	kdb_printf(kdb_prompt_str);
+	kdb_printf("%s", kdb_prompt_str);
 	kdb_nextline = 1;	/* Prompt and input resets line number */
 	return kdb_read(buffer, bufsize);
 }
diff --git a/kernel/dma/mapping.c b/kernel/dma/mapping.c
index 33437d620644..f1051ad0da7c 100644
--- a/kernel/dma/mapping.c
+++ b/kernel/dma/mapping.c
@@ -63,8 +63,8 @@ void dmam_free_coherent(struct device *dev, size_t size, void *vaddr,
 {
 	struct dma_devres match_data = { size, vaddr, dma_handle };
 
-	dma_free_coherent(dev, size, vaddr, dma_handle);
 	WARN_ON(devres_destroy(dev, dmam_release, dmam_match, &match_data));
+	dma_free_coherent(dev, size, vaddr, dma_handle);
 }
 EXPORT_SYMBOL(dmam_free_coherent);
 
diff --git a/kernel/events/core.c b/kernel/events/core.c
index 413a69aecf5c..ba099d5b41cd 100644
--- a/kernel/events/core.c
+++ b/kernel/events/core.c
@@ -2316,18 +2316,14 @@ event_sched_out(struct perf_event *event,
 	}
 
 	if (event->pending_sigtrap) {
-		bool dec = true;
-
 		event->pending_sigtrap = 0;
 		if (state != PERF_EVENT_STATE_OFF &&
-		    !event->pending_work) {
+		    !event->pending_work &&
+		    !task_work_add(current, &event->pending_task, TWA_RESUME)) {
 			event->pending_work = 1;
-			dec = false;
-			WARN_ON_ONCE(!atomic_long_inc_not_zero(&event->refcount));
-			task_work_add(current, &event->pending_task, TWA_RESUME);
-		}
-		if (dec)
+		} else {
 			local_dec(&event->ctx->nr_pending);
+		}
 	}
 
 	perf_event_set_state(event, state);
@@ -5007,9 +5003,35 @@ static bool exclusive_event_installable(struct perf_event *event,
 static void perf_addr_filters_splice(struct perf_event *event,
 				       struct list_head *head);
 
+static void perf_pending_task_sync(struct perf_event *event)
+{
+	struct callback_head *head = &event->pending_task;
+
+	if (!event->pending_work)
+		return;
+	/*
+	 * If the task is queued to the current task's queue, we
+	 * obviously can't wait for it to complete. Simply cancel it.
+	 */
+	if (task_work_cancel(current, head)) {
+		event->pending_work = 0;
+		local_dec(&event->ctx->nr_pending);
+		return;
+	}
+
+	/*
+	 * All accesses related to the event are within the same
+	 * non-preemptible section in perf_pending_task(). The RCU
+	 * grace period before the event is freed will make sure all
+	 * those accesses are complete by then.
+	 */
+	rcuwait_wait_event(&event->pending_work_wait, !event->pending_work, TASK_UNINTERRUPTIBLE);
+}
+
 static void _free_event(struct perf_event *event)
 {
 	irq_work_sync(&event->pending_irq);
+	perf_pending_task_sync(event);
 
 	unaccount_event(event);
 
@@ -6307,6 +6329,8 @@ static int perf_mmap(struct file *file, struct vm_area_struct *vma)
 			return -EINVAL;
 
 		nr_pages = vma_size / PAGE_SIZE;
+		if (nr_pages > INT_MAX)
+			return -ENOMEM;
 
 		mutex_lock(&event->mmap_mutex);
 		ret = -EINVAL;
@@ -6637,24 +6661,28 @@ static void perf_pending_task(struct callback_head *head)
 	struct perf_event *event = container_of(head, struct perf_event, pending_task);
 	int rctx;
 
+	/*
+	 * All accesses to the event must belong to the same implicit RCU read-side
+	 * critical section as the ->pending_work reset. See comment in
+	 * perf_pending_task_sync().
+	 */
+	preempt_disable_notrace();
 	/*
 	 * If we 'fail' here, that's OK, it means recursion is already disabled
 	 * and we won't recurse 'further'.
 	 */
-	preempt_disable_notrace();
 	rctx = perf_swevent_get_recursion_context();
 
 	if (event->pending_work) {
 		event->pending_work = 0;
 		perf_sigtrap(event);
 		local_dec(&event->ctx->nr_pending);
+		rcuwait_wake_up(&event->pending_work_wait);
 	}
 
 	if (rctx >= 0)
 		perf_swevent_put_recursion_context(rctx);
 	preempt_enable_notrace();
-
-	put_event(event);
 }
 
 #ifdef CONFIG_GUEST_PERF_EVENTS
@@ -9095,21 +9123,19 @@ static void perf_event_bpf_emit_ksymbols(struct bpf_prog *prog,
 	bool unregister = type == PERF_BPF_EVENT_PROG_UNLOAD;
 	int i;
 
-	if (prog->aux->func_cnt == 0) {
-		perf_event_ksymbol(PERF_RECORD_KSYMBOL_TYPE_BPF,
-				   (u64)(unsigned long)prog->bpf_func,
-				   prog->jited_len, unregister,
-				   prog->aux->ksym.name);
-	} else {
-		for (i = 0; i < prog->aux->func_cnt; i++) {
-			struct bpf_prog *subprog = prog->aux->func[i];
-
-			perf_event_ksymbol(
-				PERF_RECORD_KSYMBOL_TYPE_BPF,
-				(u64)(unsigned long)subprog->bpf_func,
-				subprog->jited_len, unregister,
-				subprog->aux->ksym.name);
-		}
+	perf_event_ksymbol(PERF_RECORD_KSYMBOL_TYPE_BPF,
+			   (u64)(unsigned long)prog->bpf_func,
+			   prog->jited_len, unregister,
+			   prog->aux->ksym.name);
+
+	for (i = 1; i < prog->aux->func_cnt; i++) {
+		struct bpf_prog *subprog = prog->aux->func[i];
+
+		perf_event_ksymbol(
+			PERF_RECORD_KSYMBOL_TYPE_BPF,
+			(u64)(unsigned long)subprog->bpf_func,
+			subprog->jited_len, unregister,
+			subprog->aux->ksym.name);
 	}
 }
 
@@ -11780,6 +11806,7 @@ perf_event_alloc(struct perf_event_attr *attr, int cpu,
 	init_waitqueue_head(&event->waitq);
 	init_irq_work(&event->pending_irq, perf_pending_irq);
 	init_task_work(&event->pending_task, perf_pending_task);
+	rcuwait_init(&event->pending_work_wait);
 
 	mutex_init(&event->mmap_mutex);
 	raw_spin_lock_init(&event->addr_filters.lock);
diff --git a/kernel/events/internal.h b/kernel/events/internal.h
index 5150d5f84c03..386d21c7edfa 100644
--- a/kernel/events/internal.h
+++ b/kernel/events/internal.h
@@ -128,7 +128,7 @@ static inline unsigned long perf_data_size(struct perf_buffer *rb)
 
 static inline unsigned long perf_aux_size(struct perf_buffer *rb)
 {
-	return rb->aux_nr_pages << PAGE_SHIFT;
+	return (unsigned long)rb->aux_nr_pages << PAGE_SHIFT;
 }
 
 #define __DEFINE_OUTPUT_COPY_BODY(advance_buf, memcpy_func, ...)	\
diff --git a/kernel/events/ring_buffer.c b/kernel/events/ring_buffer.c
index 45965f13757e..f3a3c294ff2b 100644
--- a/kernel/events/ring_buffer.c
+++ b/kernel/events/ring_buffer.c
@@ -683,7 +683,9 @@ int rb_alloc_aux(struct perf_buffer *rb, struct perf_event *event,
 		 * max_order, to aid PMU drivers in double buffering.
 		 */
 		if (!watermark)
-			watermark = nr_pages << (PAGE_SHIFT - 1);
+			watermark = min_t(unsigned long,
+					  U32_MAX,
+					  (unsigned long)nr_pages << (PAGE_SHIFT - 1));
 
 		/*
 		 * Use aux_watermark as the basis for chunking to
diff --git a/kernel/irq/manage.c b/kernel/irq/manage.c
index 40fe7806cc8c..a5843563d015 100644
--- a/kernel/irq/manage.c
+++ b/kernel/irq/manage.c
@@ -1324,7 +1324,7 @@ static int irq_thread(void *data)
 	 * synchronize_hardirq(). So neither IRQTF_RUNTHREAD nor the
 	 * oneshot mask bit can be set.
 	 */
-	task_work_cancel(current, irq_thread_dtor);
+	task_work_cancel_func(current, irq_thread_dtor);
 	return 0;
 }
 
diff --git a/kernel/jump_label.c b/kernel/jump_label.c
index 714ac4c3b556..eec802175ccc 100644
--- a/kernel/jump_label.c
+++ b/kernel/jump_label.c
@@ -113,30 +113,51 @@ int static_key_count(struct static_key *key)
 }
 EXPORT_SYMBOL_GPL(static_key_count);
 
-void static_key_slow_inc_cpuslocked(struct static_key *key)
+/*
+ * static_key_fast_inc_not_disabled - adds a user for a static key
+ * @key: static key that must be already enabled
+ *
+ * The caller must make sure that the static key can't get disabled while
+ * in this function. It doesn't patch jump labels, only adds a user to
+ * an already enabled static key.
+ *
+ * Returns true if the increment was done. Unlike refcount_t the ref counter
+ * is not saturated, but will fail to increment on overflow.
+ */
+bool static_key_fast_inc_not_disabled(struct static_key *key)
 {
-	int v, v1;
+	int v;
 
 	STATIC_KEY_CHECK_USE(key);
+	/*
+	 * Negative key->enabled has a special meaning: it sends
+	 * static_key_slow_inc/dec() down the slow path, and it is non-zero
+	 * so it counts as "enabled" in jump_label_update().  Note that
+	 * atomic_inc_unless_negative() checks >= 0, so roll our own.
+	 */
+	v = atomic_read(&key->enabled);
+	do {
+		if (v <= 0 || (v + 1) < 0)
+			return false;
+	} while (!likely(atomic_try_cmpxchg(&key->enabled, &v, v + 1)));
+
+	return true;
+}
+EXPORT_SYMBOL_GPL(static_key_fast_inc_not_disabled);
+
+bool static_key_slow_inc_cpuslocked(struct static_key *key)
+{
 	lockdep_assert_cpus_held();
 
 	/*
-	 * Careful if we get concurrent static_key_slow_inc() calls;
+	 * Careful if we get concurrent static_key_slow_inc/dec() calls;
 	 * later calls must wait for the first one to _finish_ the
 	 * jump_label_update() process.  At the same time, however,
 	 * the jump_label_update() call below wants to see
 	 * static_key_enabled(&key) for jumps to be updated properly.
-	 *
-	 * So give a special meaning to negative key->enabled: it sends
-	 * static_key_slow_inc() down the slow path, and it is non-zero
-	 * so it counts as "enabled" in jump_label_update().  Note that
-	 * atomic_inc_unless_negative() checks >= 0, so roll our own.
 	 */
-	for (v = atomic_read(&key->enabled); v > 0; v = v1) {
-		v1 = atomic_cmpxchg(&key->enabled, v, v + 1);
-		if (likely(v1 == v))
-			return;
-	}
+	if (static_key_fast_inc_not_disabled(key))
+		return true;
 
 	jump_label_lock();
 	if (atomic_read(&key->enabled) == 0) {
@@ -148,16 +169,23 @@ void static_key_slow_inc_cpuslocked(struct static_key *key)
 		 */
 		atomic_set_release(&key->enabled, 1);
 	} else {
-		atomic_inc(&key->enabled);
+		if (WARN_ON_ONCE(!static_key_fast_inc_not_disabled(key))) {
+			jump_label_unlock();
+			return false;
+		}
 	}
 	jump_label_unlock();
+	return true;
 }
 
-void static_key_slow_inc(struct static_key *key)
+bool static_key_slow_inc(struct static_key *key)
 {
+	bool ret;
+
 	cpus_read_lock();
-	static_key_slow_inc_cpuslocked(key);
+	ret = static_key_slow_inc_cpuslocked(key);
 	cpus_read_unlock();
+	return ret;
 }
 EXPORT_SYMBOL_GPL(static_key_slow_inc);
 
@@ -219,20 +247,32 @@ EXPORT_SYMBOL_GPL(static_key_disable);
 
 static bool static_key_slow_try_dec(struct static_key *key)
 {
-	int val;
-
-	val = atomic_fetch_add_unless(&key->enabled, -1, 1);
-	if (val == 1)
-		return false;
+	int v;
 
 	/*
-	 * The negative count check is valid even when a negative
-	 * key->enabled is in use by static_key_slow_inc(); a
-	 * __static_key_slow_dec() before the first static_key_slow_inc()
-	 * returns is unbalanced, because all other static_key_slow_inc()
-	 * instances block while the update is in progress.
+	 * Go into the slow path if key::enabled is less than or equal than
+	 * one. One is valid to shut down the key, anything less than one
+	 * is an imbalance, which is handled at the call site.
+	 *
+	 * That includes the special case of '-1' which is set in
+	 * static_key_slow_inc_cpuslocked(), but that's harmless as it is
+	 * fully serialized in the slow path below. By the time this task
+	 * acquires the jump label lock the value is back to one and the
+	 * retry under the lock must succeed.
 	 */
-	WARN(val < 0, "jump label: negative count!\n");
+	v = atomic_read(&key->enabled);
+	do {
+		/*
+		 * Warn about the '-1' case though; since that means a
+		 * decrement is concurrent with a first (0->1) increment. IOW
+		 * people are trying to disable something that wasn't yet fully
+		 * enabled. This suggests an ordering problem on the user side.
+		 */
+		WARN_ON_ONCE(v < 0);
+		if (v <= 1)
+			return false;
+	} while (!likely(atomic_try_cmpxchg(&key->enabled, &v, v - 1)));
+
 	return true;
 }
 
@@ -243,10 +283,11 @@ static void __static_key_slow_dec_cpuslocked(struct static_key *key)
 	if (static_key_slow_try_dec(key))
 		return;
 
-	jump_label_lock();
-	if (atomic_dec_and_test(&key->enabled))
+	guard(mutex)(&jump_label_mutex);
+	if (atomic_cmpxchg(&key->enabled, 1, 0))
 		jump_label_update(key);
-	jump_label_unlock();
+	else
+		WARN_ON_ONCE(!static_key_slow_try_dec(key));
 }
 
 static void __static_key_slow_dec(struct static_key *key)
diff --git a/kernel/locking/rwsem.c b/kernel/locking/rwsem.c
index 92d8e2c4edda..ffc2bbe39187 100644
--- a/kernel/locking/rwsem.c
+++ b/kernel/locking/rwsem.c
@@ -1308,7 +1308,7 @@ static inline int __down_read_trylock(struct rw_semaphore *sem)
 /*
  * lock for writing
  */
-static inline int __down_write_common(struct rw_semaphore *sem, int state)
+static __always_inline int __down_write_common(struct rw_semaphore *sem, int state)
 {
 	if (unlikely(!rwsem_write_trylock(sem))) {
 		if (IS_ERR(rwsem_down_write_slowpath(sem, state)))
@@ -1318,12 +1318,12 @@ static inline int __down_write_common(struct rw_semaphore *sem, int state)
 	return 0;
 }
 
-static inline void __down_write(struct rw_semaphore *sem)
+static __always_inline void __down_write(struct rw_semaphore *sem)
 {
 	__down_write_common(sem, TASK_UNINTERRUPTIBLE);
 }
 
-static inline int __down_write_killable(struct rw_semaphore *sem)
+static __always_inline int __down_write_killable(struct rw_semaphore *sem)
 {
 	return __down_write_common(sem, TASK_KILLABLE);
 }
diff --git a/kernel/rcu/tasks.h b/kernel/rcu/tasks.h
index 6f48f565e3ac..456c956f481e 100644
--- a/kernel/rcu/tasks.h
+++ b/kernel/rcu/tasks.h
@@ -1531,6 +1531,16 @@ static void rcu_tasks_trace_pregp_step(struct list_head *hop)
 	// allow safe access to the hop list.
 	for_each_online_cpu(cpu) {
 		rcu_read_lock();
+		// Note that cpu_curr_snapshot() picks up the target
+		// CPU's current task while its runqueue is locked with
+		// an smp_mb__after_spinlock().  This ensures that either
+		// the grace-period kthread will see that task's read-side
+		// critical section or the task will see the updater's pre-GP
+		// accesses.  The trailing smp_mb() in cpu_curr_snapshot()
+		// does not currently play a role other than simplify
+		// that function's ordering semantics.  If these simplified
+		// ordering semantics continue to be redundant, that smp_mb()
+		// might be removed.
 		t = cpu_curr_snapshot(cpu);
 		if (rcu_tasks_trace_pertask_prep(t, true))
 			trc_add_holdout(t, hop);
diff --git a/kernel/sched/core.c b/kernel/sched/core.c
index cac41c49bd2f..4a96bf1d2f37 100644
--- a/kernel/sched/core.c
+++ b/kernel/sched/core.c
@@ -1259,27 +1259,24 @@ int tg_nop(struct task_group *tg, void *data)
 static void set_load_weight(struct task_struct *p, bool update_load)
 {
 	int prio = p->static_prio - MAX_RT_PRIO;
-	struct load_weight *load = &p->se.load;
+	struct load_weight lw;
 
-	/*
-	 * SCHED_IDLE tasks get minimal weight:
-	 */
 	if (task_has_idle_policy(p)) {
-		load->weight = scale_load(WEIGHT_IDLEPRIO);
-		load->inv_weight = WMULT_IDLEPRIO;
-		return;
+		lw.weight = scale_load(WEIGHT_IDLEPRIO);
+		lw.inv_weight = WMULT_IDLEPRIO;
+	} else {
+		lw.weight = scale_load(sched_prio_to_weight[prio]);
+		lw.inv_weight = sched_prio_to_wmult[prio];
 	}
 
 	/*
 	 * SCHED_OTHER tasks have to update their load when changing their
 	 * weight
 	 */
-	if (update_load && p->sched_class == &fair_sched_class) {
-		reweight_task(p, prio);
-	} else {
-		load->weight = scale_load(sched_prio_to_weight[prio]);
-		load->inv_weight = sched_prio_to_wmult[prio];
-	}
+	if (update_load && p->sched_class == &fair_sched_class)
+		reweight_task(p, &lw);
+	else
+		p->se.load = lw;
 }
 
 #ifdef CONFIG_UCLAMP_TASK
@@ -4318,12 +4315,7 @@ int task_call_func(struct task_struct *p, task_call_f func, void *arg)
  * @cpu: The CPU on which to snapshot the task.
  *
  * Returns the task_struct pointer of the task "currently" running on
- * the specified CPU.  If the same task is running on that CPU throughout,
- * the return value will be a pointer to that task's task_struct structure.
- * If the CPU did any context switches even vaguely concurrently with the
- * execution of this function, the return value will be a pointer to the
- * task_struct structure of a randomly chosen task that was running on
- * that CPU somewhere around the time that this function was executing.
+ * the specified CPU.
  *
  * If the specified CPU was offline, the return value is whatever it
  * is, perhaps a pointer to the task_struct structure of that CPU's idle
@@ -4337,11 +4329,16 @@ int task_call_func(struct task_struct *p, task_call_f func, void *arg)
  */
 struct task_struct *cpu_curr_snapshot(int cpu)
 {
+	struct rq *rq = cpu_rq(cpu);
 	struct task_struct *t;
+	struct rq_flags rf;
 
-	smp_mb(); /* Pairing determined by caller's synchronization design. */
+	rq_lock_irqsave(rq, &rf);
+	smp_mb__after_spinlock(); /* Pairing determined by caller's synchronization design. */
 	t = rcu_dereference(cpu_curr(cpu));
+	rq_unlock_irqrestore(rq, &rf);
 	smp_mb(); /* Pairing determined by caller's synchronization design. */
+
 	return t;
 }
 
diff --git a/kernel/sched/fair.c b/kernel/sched/fair.c
index d0851610cf46..1e12f731a033 100644
--- a/kernel/sched/fair.c
+++ b/kernel/sched/fair.c
@@ -3330,15 +3330,14 @@ static void reweight_entity(struct cfs_rq *cfs_rq, struct sched_entity *se,
 
 }
 
-void reweight_task(struct task_struct *p, int prio)
+void reweight_task(struct task_struct *p, const struct load_weight *lw)
 {
 	struct sched_entity *se = &p->se;
 	struct cfs_rq *cfs_rq = cfs_rq_of(se);
 	struct load_weight *load = &se->load;
-	unsigned long weight = scale_load(sched_prio_to_weight[prio]);
 
-	reweight_entity(cfs_rq, se, weight);
-	load->inv_weight = sched_prio_to_wmult[prio];
+	reweight_entity(cfs_rq, se, lw->weight);
+	load->inv_weight = lw->inv_weight;
 }
 
 static inline int throttled_hierarchy(struct cfs_rq *cfs_rq);
@@ -8525,7 +8524,7 @@ static int detach_tasks(struct lb_env *env)
 		case migrate_util:
 			util = task_util_est(p);
 
-			if (util > env->imbalance)
+			if (shr_bound(util, env->sd->nr_balance_failed) > env->imbalance)
 				goto next;
 
 			env->imbalance -= util;
diff --git a/kernel/sched/sched.h b/kernel/sched/sched.h
index 81d9698f0a1e..f0c3d0d4a0dd 100644
--- a/kernel/sched/sched.h
+++ b/kernel/sched/sched.h
@@ -2346,7 +2346,7 @@ extern void init_sched_dl_class(void);
 extern void init_sched_rt_class(void);
 extern void init_sched_fair_class(void);
 
-extern void reweight_task(struct task_struct *p, int prio);
+extern void reweight_task(struct task_struct *p, const struct load_weight *lw);
 
 extern void resched_curr(struct rq *rq);
 extern void resched_cpu(int cpu);
diff --git a/kernel/signal.c b/kernel/signal.c
index 5d45f5da2b36..4bebd2443cc3 100644
--- a/kernel/signal.c
+++ b/kernel/signal.c
@@ -2558,6 +2558,14 @@ static void do_freezer_trap(void)
 	spin_unlock_irq(&current->sighand->siglock);
 	cgroup_enter_frozen();
 	schedule();
+
+	/*
+	 * We could've been woken by task_work, run it to clear
+	 * TIF_NOTIFY_SIGNAL. The caller will retry if necessary.
+	 */
+	clear_notify_signal();
+	if (unlikely(task_work_pending(current)))
+		task_work_run();
 }
 
 static int ptrace_signal(int signr, kernel_siginfo_t *info, enum pid_type type)
diff --git a/kernel/task_work.c b/kernel/task_work.c
index 065e1ef8fc8d..ffba54734cdb 100644
--- a/kernel/task_work.c
+++ b/kernel/task_work.c
@@ -119,9 +119,9 @@ static bool task_work_func_match(struct callback_head *cb, void *data)
 }
 
 /**
- * task_work_cancel - cancel a pending work added by task_work_add()
- * @task: the task which should execute the work
- * @func: identifies the work to remove
+ * task_work_cancel_func - cancel a pending work matching a function added by task_work_add()
+ * @task: the task which should execute the func's work
+ * @func: identifies the func to match with a work to remove
  *
  * Find the last queued pending work with ->func == @func and remove
  * it from queue.
@@ -130,11 +130,35 @@ static bool task_work_func_match(struct callback_head *cb, void *data)
  * The found work or NULL if not found.
  */
 struct callback_head *
-task_work_cancel(struct task_struct *task, task_work_func_t func)
+task_work_cancel_func(struct task_struct *task, task_work_func_t func)
 {
 	return task_work_cancel_match(task, task_work_func_match, func);
 }
 
+static bool task_work_match(struct callback_head *cb, void *data)
+{
+	return cb == data;
+}
+
+/**
+ * task_work_cancel - cancel a pending work added by task_work_add()
+ * @task: the task which should execute the work
+ * @cb: the callback to remove if queued
+ *
+ * Remove a callback from a task's queue if queued.
+ *
+ * RETURNS:
+ * True if the callback was queued and got cancelled, false otherwise.
+ */
+bool task_work_cancel(struct task_struct *task, struct callback_head *cb)
+{
+	struct callback_head *ret;
+
+	ret = task_work_cancel_match(task, task_work_match, cb);
+
+	return ret == cb;
+}
+
 /**
  * task_work_run - execute the works added by task_work_add()
  *
@@ -167,7 +191,7 @@ void task_work_run(void)
 		if (!work)
 			break;
 		/*
-		 * Synchronize with task_work_cancel(). It can not remove
+		 * Synchronize with task_work_cancel_match(). It can not remove
 		 * the first entry == work, cmpxchg(task_works) must fail.
 		 * But it can remove another entry from the ->next list.
 		 */
diff --git a/kernel/time/tick-broadcast.c b/kernel/time/tick-broadcast.c
index 0916cc9adb82..ba551ec546f5 100644
--- a/kernel/time/tick-broadcast.c
+++ b/kernel/time/tick-broadcast.c
@@ -1137,6 +1137,7 @@ void tick_broadcast_switch_to_oneshot(void)
 #ifdef CONFIG_HOTPLUG_CPU
 void hotplug_cpu__broadcast_tick_pull(int deadcpu)
 {
+	struct tick_device *td = this_cpu_ptr(&tick_cpu_device);
 	struct clock_event_device *bc;
 	unsigned long flags;
 
@@ -1144,6 +1145,28 @@ void hotplug_cpu__broadcast_tick_pull(int deadcpu)
 	bc = tick_broadcast_device.evtdev;
 
 	if (bc && broadcast_needs_cpu(bc, deadcpu)) {
+		/*
+		 * If the broadcast force bit of the current CPU is set,
+		 * then the current CPU has not yet reprogrammed the local
+		 * timer device to avoid a ping-pong race. See
+		 * ___tick_broadcast_oneshot_control().
+		 *
+		 * If the broadcast device is hrtimer based then
+		 * programming the broadcast event below does not have any
+		 * effect because the local clockevent device is not
+		 * running and not programmed because the broadcast event
+		 * is not earlier than the pending event of the local clock
+		 * event device. As a consequence all CPUs waiting for a
+		 * broadcast event are stuck forever.
+		 *
+		 * Detect this condition and reprogram the cpu local timer
+		 * device to avoid the starvation.
+		 */
+		if (tick_check_broadcast_expired()) {
+			cpumask_clear_cpu(smp_processor_id(), tick_broadcast_force_mask);
+			tick_program_event(td->evtdev->next_event, 1);
+		}
+
 		/* This moves the broadcast assignment to this CPU: */
 		clockevents_program_event(bc, bc->next_event, 1);
 	}
diff --git a/kernel/trace/pid_list.c b/kernel/trace/pid_list.c
index 95106d02b32d..85de221c0b6f 100644
--- a/kernel/trace/pid_list.c
+++ b/kernel/trace/pid_list.c
@@ -354,7 +354,7 @@ static void pid_list_refill_irq(struct irq_work *iwork)
 	while (upper_count-- > 0) {
 		union upper_chunk *chunk;
 
-		chunk = kzalloc(sizeof(*chunk), GFP_KERNEL);
+		chunk = kzalloc(sizeof(*chunk), GFP_NOWAIT);
 		if (!chunk)
 			break;
 		*upper_next = chunk;
@@ -365,7 +365,7 @@ static void pid_list_refill_irq(struct irq_work *iwork)
 	while (lower_count-- > 0) {
 		union lower_chunk *chunk;
 
-		chunk = kzalloc(sizeof(*chunk), GFP_KERNEL);
+		chunk = kzalloc(sizeof(*chunk), GFP_NOWAIT);
 		if (!chunk)
 			break;
 		*lower_next = chunk;
diff --git a/kernel/watchdog_hld.c b/kernel/watchdog_hld.c
index 1e8a49dc956e..8ba4b269ab89 100644
--- a/kernel/watchdog_hld.c
+++ b/kernel/watchdog_hld.c
@@ -91,11 +91,15 @@ static bool watchdog_check_timestamp(void)
 	__this_cpu_write(last_timestamp, now);
 	return true;
 }
-#else
-static inline bool watchdog_check_timestamp(void)
+
+static void watchdog_init_timestamp(void)
 {
-	return true;
+	__this_cpu_write(nmi_rearmed, 0);
+	__this_cpu_write(last_timestamp, ktime_get_mono_fast_ns());
 }
+#else
+static inline bool watchdog_check_timestamp(void) { return true; }
+static inline void watchdog_init_timestamp(void) { }
 #endif
 
 static struct perf_event_attr wd_hw_attr = {
@@ -196,6 +200,7 @@ void hardlockup_detector_perf_enable(void)
 	if (!atomic_fetch_inc(&watchdog_cpus))
 		pr_info("Enabled. Permanently consumes one hw-PMU counter.\n");
 
+	watchdog_init_timestamp();
 	perf_event_enable(this_cpu_read(watchdog_ev));
 }
 
diff --git a/lib/decompress_bunzip2.c b/lib/decompress_bunzip2.c
index 3518e7394eca..ca736166f100 100644
--- a/lib/decompress_bunzip2.c
+++ b/lib/decompress_bunzip2.c
@@ -232,7 +232,8 @@ static int INIT get_next_block(struct bunzip_data *bd)
 	   RUNB) */
 	symCount = symTotal+2;
 	for (j = 0; j < groupCount; j++) {
-		unsigned char length[MAX_SYMBOLS], temp[MAX_HUFCODE_BITS+1];
+		unsigned char length[MAX_SYMBOLS];
+		unsigned short temp[MAX_HUFCODE_BITS+1];
 		int	minLen,	maxLen, pp;
 		/* Read Huffman code lengths for each symbol.  They're
 		   stored in a way similar to mtf; record a starting
diff --git a/lib/kobject_uevent.c b/lib/kobject_uevent.c
index 7c44b7ae4c5c..d397b1ad5ccf 100644
--- a/lib/kobject_uevent.c
+++ b/lib/kobject_uevent.c
@@ -432,8 +432,23 @@ static void zap_modalias_env(struct kobj_uevent_env *env)
 		len = strlen(env->envp[i]) + 1;
 
 		if (i != env->envp_idx - 1) {
+			/* @env->envp[] contains pointers to @env->buf[]
+			 * with @env->buflen chars, and we are removing
+			 * variable MODALIAS here pointed by @env->envp[i]
+			 * with length @len as shown below:
+			 *
+			 * 0               @env->buf[]      @env->buflen
+			 * ---------------------------------------------
+			 * ^             ^              ^              ^
+			 * |             |->   @len   <-| target block |
+			 * @env->envp[0] @env->envp[i]  @env->envp[i + 1]
+			 *
+			 * so the "target block" indicated above is moved
+			 * backward by @len, and its right size is
+			 * @env->buflen - (@env->envp[i + 1] - @env->envp[0]).
+			 */
 			memmove(env->envp[i], env->envp[i + 1],
-				env->buflen - len);
+				env->buflen - (env->envp[i + 1] - env->envp[0]));
 
 			for (j = i; j < env->envp_idx - 1; j++)
 				env->envp[j] = env->envp[j + 1] - len;
diff --git a/lib/objagg.c b/lib/objagg.c
index 1e248629ed64..1608895b009c 100644
--- a/lib/objagg.c
+++ b/lib/objagg.c
@@ -167,6 +167,9 @@ static int objagg_obj_parent_assign(struct objagg *objagg,
 {
 	void *delta_priv;
 
+	if (WARN_ON(!objagg_obj_is_root(parent)))
+		return -EINVAL;
+
 	delta_priv = objagg->ops->delta_create(objagg->priv, parent->obj,
 					       objagg_obj->obj);
 	if (IS_ERR(delta_priv))
@@ -903,20 +906,6 @@ static const struct objagg_opt_algo *objagg_opt_algos[] = {
 	[OBJAGG_OPT_ALGO_SIMPLE_GREEDY] = &objagg_opt_simple_greedy,
 };
 
-static int objagg_hints_obj_cmp(struct rhashtable_compare_arg *arg,
-				const void *obj)
-{
-	struct rhashtable *ht = arg->ht;
-	struct objagg_hints *objagg_hints =
-			container_of(ht, struct objagg_hints, node_ht);
-	const struct objagg_ops *ops = objagg_hints->ops;
-	const char *ptr = obj;
-
-	ptr += ht->p.key_offset;
-	return ops->hints_obj_cmp ? ops->hints_obj_cmp(ptr, arg->key) :
-				    memcmp(ptr, arg->key, ht->p.key_len);
-}
-
 /**
  * objagg_hints_get - obtains hints instance
  * @objagg:		objagg instance
@@ -955,7 +944,6 @@ struct objagg_hints *objagg_hints_get(struct objagg *objagg,
 				offsetof(struct objagg_hints_node, obj);
 	objagg_hints->ht_params.head_offset =
 				offsetof(struct objagg_hints_node, ht_node);
-	objagg_hints->ht_params.obj_cmpfn = objagg_hints_obj_cmp;
 
 	err = rhashtable_init(&objagg_hints->node_ht, &objagg_hints->ht_params);
 	if (err)
diff --git a/lib/sbitmap.c b/lib/sbitmap.c
index c515072eca29..61075535a807 100644
--- a/lib/sbitmap.c
+++ b/lib/sbitmap.c
@@ -60,12 +60,30 @@ static inline void update_alloc_hint_after_get(struct sbitmap *sb,
 /*
  * See if we have deferred clears that we can batch move
  */
-static inline bool sbitmap_deferred_clear(struct sbitmap_word *map)
+static inline bool sbitmap_deferred_clear(struct sbitmap_word *map,
+		unsigned int depth, unsigned int alloc_hint, bool wrap)
 {
-	unsigned long mask;
+	unsigned long mask, word_mask;
 
-	if (!READ_ONCE(map->cleared))
-		return false;
+	guard(spinlock_irqsave)(&map->swap_lock);
+
+	if (!map->cleared) {
+		if (depth == 0)
+			return false;
+
+		word_mask = (~0UL) >> (BITS_PER_LONG - depth);
+		/*
+		 * The current behavior is to always retry after moving
+		 * ->cleared to word, and we change it to retry in case
+		 * of any free bits. To avoid an infinite loop, we need
+		 * to take wrap & alloc_hint into account, otherwise a
+		 * soft lockup may occur.
+		 */
+		if (!wrap && alloc_hint)
+			word_mask &= ~((1UL << alloc_hint) - 1);
+
+		return (READ_ONCE(map->word) & word_mask) != word_mask;
+	}
 
 	/*
 	 * First get a stable cleared mask, setting the old mask to 0.
@@ -85,6 +103,7 @@ int sbitmap_init_node(struct sbitmap *sb, unsigned int depth, int shift,
 		      bool alloc_hint)
 {
 	unsigned int bits_per_word;
+	int i;
 
 	if (shift < 0)
 		shift = sbitmap_calculate_shift(depth);
@@ -116,6 +135,9 @@ int sbitmap_init_node(struct sbitmap *sb, unsigned int depth, int shift,
 		return -ENOMEM;
 	}
 
+	for (i = 0; i < sb->map_nr; i++)
+		spin_lock_init(&sb->map[i].swap_lock);
+
 	return 0;
 }
 EXPORT_SYMBOL_GPL(sbitmap_init_node);
@@ -126,7 +148,7 @@ void sbitmap_resize(struct sbitmap *sb, unsigned int depth)
 	unsigned int i;
 
 	for (i = 0; i < sb->map_nr; i++)
-		sbitmap_deferred_clear(&sb->map[i]);
+		sbitmap_deferred_clear(&sb->map[i], 0, 0, 0);
 
 	sb->depth = depth;
 	sb->map_nr = DIV_ROUND_UP(sb->depth, bits_per_word);
@@ -167,18 +189,19 @@ static int __sbitmap_get_word(unsigned long *word, unsigned long depth,
 	return nr;
 }
 
-static int sbitmap_find_bit_in_index(struct sbitmap *sb, int index,
-				     unsigned int alloc_hint)
+static int sbitmap_find_bit_in_word(struct sbitmap_word *map,
+				    unsigned int depth,
+				    unsigned int alloc_hint,
+				    bool wrap)
 {
-	struct sbitmap_word *map = &sb->map[index];
 	int nr;
 
 	do {
-		nr = __sbitmap_get_word(&map->word, __map_depth(sb, index),
-					alloc_hint, !sb->round_robin);
+		nr = __sbitmap_get_word(&map->word, depth,
+					alloc_hint, wrap);
 		if (nr != -1)
 			break;
-		if (!sbitmap_deferred_clear(map))
+		if (!sbitmap_deferred_clear(map, depth, alloc_hint, wrap))
 			break;
 	} while (1);
 
@@ -203,7 +226,9 @@ static int __sbitmap_get(struct sbitmap *sb, unsigned int alloc_hint)
 		alloc_hint = 0;
 
 	for (i = 0; i < sb->map_nr; i++) {
-		nr = sbitmap_find_bit_in_index(sb, index, alloc_hint);
+		nr = sbitmap_find_bit_in_word(&sb->map[index],
+					      __map_depth(sb, index),
+					      alloc_hint, !sb->round_robin);
 		if (nr != -1) {
 			nr += index << sb->shift;
 			break;
@@ -243,30 +268,24 @@ static int __sbitmap_get_shallow(struct sbitmap *sb,
 	int nr = -1;
 
 	index = SB_NR_TO_INDEX(sb, alloc_hint);
+	alloc_hint = SB_NR_TO_BIT(sb, alloc_hint);
 
 	for (i = 0; i < sb->map_nr; i++) {
-again:
-		nr = __sbitmap_get_word(&sb->map[index].word,
-					min_t(unsigned int,
-					      __map_depth(sb, index),
-					      shallow_depth),
-					SB_NR_TO_BIT(sb, alloc_hint), true);
+		nr = sbitmap_find_bit_in_word(&sb->map[index],
+					      min_t(unsigned int,
+						    __map_depth(sb, index),
+						    shallow_depth),
+					      alloc_hint, true);
+
 		if (nr != -1) {
 			nr += index << sb->shift;
 			break;
 		}
 
-		if (sbitmap_deferred_clear(&sb->map[index]))
-			goto again;
-
 		/* Jump to next index. */
-		index++;
-		alloc_hint = index << sb->shift;
-
-		if (index >= sb->map_nr) {
+		alloc_hint = 0;
+		if (++index >= sb->map_nr)
 			index = 0;
-			alloc_hint = 0;
-		}
 	}
 
 	return nr;
@@ -506,18 +525,18 @@ unsigned long __sbitmap_queue_get_batch(struct sbitmap_queue *sbq, int nr_tags,
 		struct sbitmap_word *map = &sb->map[index];
 		unsigned long get_mask;
 		unsigned int map_depth = __map_depth(sb, index);
+		unsigned long val;
 
-		sbitmap_deferred_clear(map);
-		if (map->word == (1UL << (map_depth - 1)) - 1)
+		sbitmap_deferred_clear(map, 0, 0, 0);
+		val = READ_ONCE(map->word);
+		if (val == (1UL << (map_depth - 1)) - 1)
 			goto next;
 
-		nr = find_first_zero_bit(&map->word, map_depth);
+		nr = find_first_zero_bit(&val, map_depth);
 		if (nr + nr_tags <= map_depth) {
 			atomic_long_t *ptr = (atomic_long_t *) &map->word;
-			unsigned long val;
 
 			get_mask = ((1UL << nr_tags) - 1) << nr;
-			val = READ_ONCE(map->word);
 			while (!atomic_long_try_cmpxchg(ptr, &val,
 							  get_mask | val))
 				;
diff --git a/mm/hugetlb.c b/mm/hugetlb.c
index 87a14638fad0..05b8797163b2 100644
--- a/mm/hugetlb.c
+++ b/mm/hugetlb.c
@@ -4353,7 +4353,7 @@ void __init hugetlb_add_hstate(unsigned int order)
 	BUG_ON(hugetlb_max_hstate >= HUGE_MAX_HSTATE);
 	BUG_ON(order == 0);
 	h = &hstates[hugetlb_max_hstate++];
-	mutex_init(&h->resize_lock);
+	__mutex_init(&h->resize_lock, "resize mutex", &h->resize_key);
 	h->order = order;
 	h->mask = ~(huge_page_size(h) - 1);
 	for (i = 0; i < MAX_NUMNODES; ++i)
diff --git a/mm/mempolicy.c b/mm/mempolicy.c
index 84e11c2caae4..399d8cb48813 100644
--- a/mm/mempolicy.c
+++ b/mm/mempolicy.c
@@ -3112,8 +3112,9 @@ int mpol_parse_str(char *str, struct mempolicy **mpol)
  * @pol:  pointer to mempolicy to be formatted
  *
  * Convert @pol into a string.  If @buffer is too short, truncate the string.
- * Recommend a @maxlen of at least 32 for the longest mode, "interleave", the
- * longest flag, "relative", and to display at least a few node ids.
+ * Recommend a @maxlen of at least 51 for the longest mode, "weighted
+ * interleave", plus the longest flag flags, "relative|balancing", and to
+ * display at least a few node ids.
  */
 void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
 {
@@ -3122,7 +3123,10 @@ void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
 	unsigned short mode = MPOL_DEFAULT;
 	unsigned short flags = 0;
 
-	if (pol && pol != &default_policy && !(pol->flags & MPOL_F_MORON)) {
+	if (pol &&
+	    pol != &default_policy &&
+	    !(pol >= &preferred_node_policy[0] &&
+	      pol <= &preferred_node_policy[ARRAY_SIZE(preferred_node_policy) - 1])) {
 		mode = pol->mode;
 		flags = pol->flags;
 	}
@@ -3149,12 +3153,18 @@ void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
 		p += snprintf(p, buffer + maxlen - p, "=");
 
 		/*
-		 * Currently, the only defined flags are mutually exclusive
+		 * Static and relative are mutually exclusive.
 		 */
 		if (flags & MPOL_F_STATIC_NODES)
 			p += snprintf(p, buffer + maxlen - p, "static");
 		else if (flags & MPOL_F_RELATIVE_NODES)
 			p += snprintf(p, buffer + maxlen - p, "relative");
+
+		if (flags & MPOL_F_NUMA_BALANCING) {
+			if (!is_power_of_2(flags & MPOL_MODE_FLAGS))
+				p += snprintf(p, buffer + maxlen - p, "|");
+			p += snprintf(p, buffer + maxlen - p, "balancing");
+		}
 	}
 
 	if (!nodes_empty(nodes))
diff --git a/mm/mmap_lock.c b/mm/mmap_lock.c
index 1854850b4b89..368b840e7508 100644
--- a/mm/mmap_lock.c
+++ b/mm/mmap_lock.c
@@ -19,14 +19,7 @@ EXPORT_TRACEPOINT_SYMBOL(mmap_lock_released);
 
 #ifdef CONFIG_MEMCG
 
-/*
- * Our various events all share the same buffer (because we don't want or need
- * to allocate a set of buffers *per event type*), so we need to protect against
- * concurrent _reg() and _unreg() calls, and count how many _reg() calls have
- * been made.
- */
-static DEFINE_MUTEX(reg_lock);
-static int reg_refcount; /* Protected by reg_lock. */
+static atomic_t reg_refcount;
 
 /*
  * Size of the buffer for memcg path names. Ignoring stack trace support,
@@ -34,136 +27,22 @@ static int reg_refcount; /* Protected by reg_lock. */
  */
 #define MEMCG_PATH_BUF_SIZE MAX_FILTER_STR_VAL
 
-/*
- * How many contexts our trace events might be called in: normal, softirq, irq,
- * and NMI.
- */
-#define CONTEXT_COUNT 4
-
-struct memcg_path {
-	local_lock_t lock;
-	char __rcu *buf;
-	local_t buf_idx;
-};
-static DEFINE_PER_CPU(struct memcg_path, memcg_paths) = {
-	.lock = INIT_LOCAL_LOCK(lock),
-	.buf_idx = LOCAL_INIT(0),
-};
-
-static char **tmp_bufs;
-
-/* Called with reg_lock held. */
-static void free_memcg_path_bufs(void)
-{
-	struct memcg_path *memcg_path;
-	int cpu;
-	char **old = tmp_bufs;
-
-	for_each_possible_cpu(cpu) {
-		memcg_path = per_cpu_ptr(&memcg_paths, cpu);
-		*(old++) = rcu_dereference_protected(memcg_path->buf,
-			lockdep_is_held(&reg_lock));
-		rcu_assign_pointer(memcg_path->buf, NULL);
-	}
-
-	/* Wait for inflight memcg_path_buf users to finish. */
-	synchronize_rcu();
-
-	old = tmp_bufs;
-	for_each_possible_cpu(cpu) {
-		kfree(*(old++));
-	}
-
-	kfree(tmp_bufs);
-	tmp_bufs = NULL;
-}
-
 int trace_mmap_lock_reg(void)
 {
-	int cpu;
-	char *new;
-
-	mutex_lock(&reg_lock);
-
-	/* If the refcount is going 0->1, proceed with allocating buffers. */
-	if (reg_refcount++)
-		goto out;
-
-	tmp_bufs = kmalloc_array(num_possible_cpus(), sizeof(*tmp_bufs),
-				 GFP_KERNEL);
-	if (tmp_bufs == NULL)
-		goto out_fail;
-
-	for_each_possible_cpu(cpu) {
-		new = kmalloc(MEMCG_PATH_BUF_SIZE * CONTEXT_COUNT, GFP_KERNEL);
-		if (new == NULL)
-			goto out_fail_free;
-		rcu_assign_pointer(per_cpu_ptr(&memcg_paths, cpu)->buf, new);
-		/* Don't need to wait for inflights, they'd have gotten NULL. */
-	}
-
-out:
-	mutex_unlock(&reg_lock);
+	atomic_inc(&reg_refcount);
 	return 0;
-
-out_fail_free:
-	free_memcg_path_bufs();
-out_fail:
-	/* Since we failed, undo the earlier ref increment. */
-	--reg_refcount;
-
-	mutex_unlock(&reg_lock);
-	return -ENOMEM;
 }
 
 void trace_mmap_lock_unreg(void)
 {
-	mutex_lock(&reg_lock);
-
-	/* If the refcount is going 1->0, proceed with freeing buffers. */
-	if (--reg_refcount)
-		goto out;
-
-	free_memcg_path_bufs();
-
-out:
-	mutex_unlock(&reg_lock);
-}
-
-static inline char *get_memcg_path_buf(void)
-{
-	struct memcg_path *memcg_path = this_cpu_ptr(&memcg_paths);
-	char *buf;
-	int idx;
-
-	rcu_read_lock();
-	buf = rcu_dereference(memcg_path->buf);
-	if (buf == NULL) {
-		rcu_read_unlock();
-		return NULL;
-	}
-	idx = local_add_return(MEMCG_PATH_BUF_SIZE, &memcg_path->buf_idx) -
-	      MEMCG_PATH_BUF_SIZE;
-	return &buf[idx];
+	atomic_dec(&reg_refcount);
 }
 
-static inline void put_memcg_path_buf(void)
-{
-	local_sub(MEMCG_PATH_BUF_SIZE, &this_cpu_ptr(&memcg_paths)->buf_idx);
-	rcu_read_unlock();
-}
-
-#define TRACE_MMAP_LOCK_EVENT(type, mm, ...)                                   \
-	do {                                                                   \
-		const char *memcg_path;                                        \
-		local_lock(&memcg_paths.lock);                                 \
-		memcg_path = get_mm_memcg_path(mm);                            \
-		trace_mmap_lock_##type(mm,                                     \
-				       memcg_path != NULL ? memcg_path : "",   \
-				       ##__VA_ARGS__);                         \
-		if (likely(memcg_path != NULL))                                \
-			put_memcg_path_buf();                                  \
-		local_unlock(&memcg_paths.lock);                               \
+#define TRACE_MMAP_LOCK_EVENT(type, mm, ...)                    \
+	do {                                                    \
+		char buf[MEMCG_PATH_BUF_SIZE];                  \
+		get_mm_memcg_path(mm, buf, sizeof(buf));        \
+		trace_mmap_lock_##type(mm, buf, ##__VA_ARGS__); \
 	} while (0)
 
 #else /* !CONFIG_MEMCG */
@@ -185,37 +64,23 @@ void trace_mmap_lock_unreg(void)
 #ifdef CONFIG_TRACING
 #ifdef CONFIG_MEMCG
 /*
- * Write the given mm_struct's memcg path to a percpu buffer, and return a
- * pointer to it. If the path cannot be determined, or no buffer was available
- * (because the trace event is being unregistered), NULL is returned.
- *
- * Note: buffers are allocated per-cpu to avoid locking, so preemption must be
- * disabled by the caller before calling us, and re-enabled only after the
- * caller is done with the pointer.
- *
- * The caller must call put_memcg_path_buf() once the buffer is no longer
- * needed. This must be done while preemption is still disabled.
+ * Write the given mm_struct's memcg path to a buffer. If the path cannot be
+ * determined or the trace event is being unregistered, empty string is written.
  */
-static const char *get_mm_memcg_path(struct mm_struct *mm)
+static void get_mm_memcg_path(struct mm_struct *mm, char *buf, size_t buflen)
 {
-	char *buf = NULL;
-	struct mem_cgroup *memcg = get_mem_cgroup_from_mm(mm);
+	struct mem_cgroup *memcg;
 
+	buf[0] = '\0';
+	/* No need to get path if no trace event is registered. */
+	if (!atomic_read(&reg_refcount))
+		return;
+	memcg = get_mem_cgroup_from_mm(mm);
 	if (memcg == NULL)
-		goto out;
-	if (unlikely(memcg->css.cgroup == NULL))
-		goto out_put;
-
-	buf = get_memcg_path_buf();
-	if (buf == NULL)
-		goto out_put;
-
-	cgroup_path(memcg->css.cgroup, buf, MEMCG_PATH_BUF_SIZE);
-
-out_put:
+		return;
+	if (memcg->css.cgroup)
+		cgroup_path(memcg->css.cgroup, buf, buflen);
 	css_put(&memcg->css);
-out:
-	return buf;
 }
 
 #endif /* CONFIG_MEMCG */
diff --git a/mm/vmscan.c b/mm/vmscan.c
index a3b1d8e5dbb3..4cd0cbf9c121 100644
--- a/mm/vmscan.c
+++ b/mm/vmscan.c
@@ -5065,7 +5065,6 @@ static int evict_folios(struct lruvec *lruvec, struct scan_control *sc, int swap
 
 		/* retry folios that may have missed folio_rotate_reclaimable() */
 		list_move(&folio->lru, &clean);
-		sc->nr_scanned -= folio_nr_pages(folio);
 	}
 
 	spin_lock_irq(&lruvec->lru_lock);
diff --git a/net/bridge/br_forward.c b/net/bridge/br_forward.c
index 9661698e86e4..a32d73f38155 100644
--- a/net/bridge/br_forward.c
+++ b/net/bridge/br_forward.c
@@ -25,8 +25,8 @@ static inline int should_deliver(const struct net_bridge_port *p,
 
 	vg = nbp_vlan_group_rcu(p);
 	return ((p->flags & BR_HAIRPIN_MODE) || skb->dev != p->dev) &&
-		p->state == BR_STATE_FORWARDING && br_allowed_egress(vg, skb) &&
-		nbp_switchdev_allowed_egress(p, skb) &&
+		(br_mst_is_enabled(p->br) || p->state == BR_STATE_FORWARDING) &&
+		br_allowed_egress(vg, skb) && nbp_switchdev_allowed_egress(p, skb) &&
 		!br_skb_isolated(p, skb);
 }
 
diff --git a/net/core/filter.c b/net/core/filter.c
index dc89c3424718..210b881cb50b 100644
--- a/net/core/filter.c
+++ b/net/core/filter.c
@@ -3518,13 +3518,20 @@ static int bpf_skb_net_grow(struct sk_buff *skb, u32 off, u32 len_diff,
 	if (skb_is_gso(skb)) {
 		struct skb_shared_info *shinfo = skb_shinfo(skb);
 
-		/* Due to header grow, MSS needs to be downgraded. */
-		if (!(flags & BPF_F_ADJ_ROOM_FIXED_GSO))
-			skb_decrease_gso_size(shinfo, len_diff);
-
 		/* Header must be checked, and gso_segs recomputed. */
 		shinfo->gso_type |= gso_type;
 		shinfo->gso_segs = 0;
+
+		/* Due to header growth, MSS needs to be downgraded.
+		 * There is a BUG_ON() when segmenting the frag_list with
+		 * head_frag true, so linearize the skb after downgrading
+		 * the MSS.
+		 */
+		if (!(flags & BPF_F_ADJ_ROOM_FIXED_GSO)) {
+			skb_decrease_gso_size(shinfo, len_diff);
+			if (shinfo->frag_list)
+				return skb_linearize(skb);
+		}
 	}
 
 	return 0;
diff --git a/net/core/flow_dissector.c b/net/core/flow_dissector.c
index 0c85c8a9e752..fba8eb1bb281 100644
--- a/net/core/flow_dissector.c
+++ b/net/core/flow_dissector.c
@@ -1013,7 +1013,7 @@ bool __skb_flow_dissect(const struct net *net,
 		}
 	}
 
-	WARN_ON_ONCE(!net);
+	DEBUG_NET_WARN_ON_ONCE(!net);
 	if (net) {
 		enum netns_bpf_attach_type type = NETNS_BPF_FLOW_DISSECTOR;
 		struct bpf_prog_array *run_array;
diff --git a/net/core/xdp.c b/net/core/xdp.c
index c3f6653b4274..90de33b7c9ce 100644
--- a/net/core/xdp.c
+++ b/net/core/xdp.c
@@ -124,10 +124,8 @@ void xdp_unreg_mem_model(struct xdp_mem_info *mem)
 		return;
 
 	if (type == MEM_TYPE_PAGE_POOL) {
-		rcu_read_lock();
-		xa = rhashtable_lookup(mem_id_ht, &id, mem_id_rht_params);
+		xa = rhashtable_lookup_fast(mem_id_ht, &id, mem_id_rht_params);
 		page_pool_destroy(xa->page_pool);
-		rcu_read_unlock();
 	}
 }
 EXPORT_SYMBOL_GPL(xdp_unreg_mem_model);
diff --git a/net/ipv4/esp4.c b/net/ipv4/esp4.c
index e2546961add3..419969b26822 100644
--- a/net/ipv4/esp4.c
+++ b/net/ipv4/esp4.c
@@ -238,8 +238,7 @@ static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
 #else
 static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
 {
-	kfree_skb(skb);
-
+	WARN_ON(1);
 	return -EOPNOTSUPP;
 }
 #endif
diff --git a/net/ipv4/fib_semantics.c b/net/ipv4/fib_semantics.c
index 5eb1b8d302bb..e3268615a65a 100644
--- a/net/ipv4/fib_semantics.c
+++ b/net/ipv4/fib_semantics.c
@@ -2270,6 +2270,15 @@ void fib_select_path(struct net *net, struct fib_result *res,
 		fib_select_default(fl4, res);
 
 check_saddr:
-	if (!fl4->saddr)
-		fl4->saddr = fib_result_prefsrc(net, res);
+	if (!fl4->saddr) {
+		struct net_device *l3mdev;
+
+		l3mdev = dev_get_by_index_rcu(net, fl4->flowi4_l3mdev);
+
+		if (!l3mdev ||
+		    l3mdev_master_dev_rcu(FIB_RES_DEV(*res)) == l3mdev)
+			fl4->saddr = fib_result_prefsrc(net, res);
+		else
+			fl4->saddr = inet_select_addr(l3mdev, 0, RT_SCOPE_LINK);
+	}
 }
diff --git a/net/ipv4/fib_trie.c b/net/ipv4/fib_trie.c
index 9bdfdab906fe..77b97c48da5e 100644
--- a/net/ipv4/fib_trie.c
+++ b/net/ipv4/fib_trie.c
@@ -1628,6 +1628,7 @@ int fib_table_lookup(struct fib_table *tb, const struct flowi4 *flp,
 			res->nhc = nhc;
 			res->type = fa->fa_type;
 			res->scope = fi->fib_scope;
+			res->dscp = fa->fa_dscp;
 			res->fi = fi;
 			res->table = tb;
 			res->fa_head = &n->leaf;
diff --git a/net/ipv4/nexthop.c b/net/ipv4/nexthop.c
index be5498f5dd31..bba955d82f72 100644
--- a/net/ipv4/nexthop.c
+++ b/net/ipv4/nexthop.c
@@ -676,9 +676,10 @@ static int nla_put_nh_group(struct sk_buff *skb, struct nh_group *nhg)
 
 	p = nla_data(nla);
 	for (i = 0; i < nhg->num_nh; ++i) {
-		p->id = nhg->nh_entries[i].nh->id;
-		p->weight = nhg->nh_entries[i].weight - 1;
-		p += 1;
+		*p++ = (struct nexthop_grp) {
+			.id = nhg->nh_entries[i].nh->id,
+			.weight = nhg->nh_entries[i].weight - 1,
+		};
 	}
 
 	if (nhg->resilient && nla_put_nh_group_res(skb, nhg))
diff --git a/net/ipv4/route.c b/net/ipv4/route.c
index fcbacd39febe..fda88894d020 100644
--- a/net/ipv4/route.c
+++ b/net/ipv4/route.c
@@ -1275,7 +1275,7 @@ void ip_rt_get_source(u8 *addr, struct sk_buff *skb, struct rtable *rt)
 		struct flowi4 fl4 = {
 			.daddr = iph->daddr,
 			.saddr = iph->saddr,
-			.flowi4_tos = RT_TOS(iph->tos),
+			.flowi4_tos = iph->tos & IPTOS_RT_MASK,
 			.flowi4_oif = rt->dst.dev->ifindex,
 			.flowi4_iif = skb->dev->ifindex,
 			.flowi4_mark = skb->mark,
@@ -2934,9 +2934,9 @@ EXPORT_SYMBOL_GPL(ip_route_output_tunnel);
 
 /* called with rcu_read_lock held */
 static int rt_fill_info(struct net *net, __be32 dst, __be32 src,
-			struct rtable *rt, u32 table_id, struct flowi4 *fl4,
-			struct sk_buff *skb, u32 portid, u32 seq,
-			unsigned int flags)
+			struct rtable *rt, u32 table_id, dscp_t dscp,
+			struct flowi4 *fl4, struct sk_buff *skb, u32 portid,
+			u32 seq, unsigned int flags)
 {
 	struct rtmsg *r;
 	struct nlmsghdr *nlh;
@@ -2952,7 +2952,7 @@ static int rt_fill_info(struct net *net, __be32 dst, __be32 src,
 	r->rtm_family	 = AF_INET;
 	r->rtm_dst_len	= 32;
 	r->rtm_src_len	= 0;
-	r->rtm_tos	= fl4 ? fl4->flowi4_tos : 0;
+	r->rtm_tos	= inet_dscp_to_dsfield(dscp);
 	r->rtm_table	= table_id < 256 ? table_id : RT_TABLE_COMPAT;
 	if (nla_put_u32(skb, RTA_TABLE, table_id))
 		goto nla_put_failure;
@@ -3102,7 +3102,7 @@ static int fnhe_dump_bucket(struct net *net, struct sk_buff *skb,
 				goto next;
 
 			err = rt_fill_info(net, fnhe->fnhe_daddr, 0, rt,
-					   table_id, NULL, skb,
+					   table_id, 0, NULL, skb,
 					   NETLINK_CB(cb->skb).portid,
 					   cb->nlh->nlmsg_seq, flags);
 			if (err)
@@ -3398,7 +3398,7 @@ static int inet_rtm_getroute(struct sk_buff *in_skb, struct nlmsghdr *nlh,
 		fri.tb_id = table_id;
 		fri.dst = res.prefix;
 		fri.dst_len = res.prefixlen;
-		fri.dscp = inet_dsfield_to_dscp(fl4.flowi4_tos);
+		fri.dscp = res.dscp;
 		fri.type = rt->rt_type;
 		fri.offload = 0;
 		fri.trap = 0;
@@ -3425,8 +3425,8 @@ static int inet_rtm_getroute(struct sk_buff *in_skb, struct nlmsghdr *nlh,
 		err = fib_dump_info(skb, NETLINK_CB(in_skb).portid,
 				    nlh->nlmsg_seq, RTM_NEWROUTE, &fri, 0);
 	} else {
-		err = rt_fill_info(net, dst, src, rt, table_id, &fl4, skb,
-				   NETLINK_CB(in_skb).portid,
+		err = rt_fill_info(net, dst, src, rt, table_id, res.dscp, &fl4,
+				   skb, NETLINK_CB(in_skb).portid,
 				   nlh->nlmsg_seq, 0);
 	}
 	if (err < 0)
diff --git a/net/ipv4/tcp.c b/net/ipv4/tcp.c
index 2d4f697d338f..cb79919323a6 100644
--- a/net/ipv4/tcp.c
+++ b/net/ipv4/tcp.c
@@ -589,9 +589,10 @@ __poll_t tcp_poll(struct file *file, struct socket *sock, poll_table *wait)
 		 */
 		mask |= EPOLLOUT | EPOLLWRNORM;
 	}
-	/* This barrier is coupled with smp_wmb() in tcp_reset() */
+	/* This barrier is coupled with smp_wmb() in tcp_done_with_error() */
 	smp_rmb();
-	if (sk->sk_err || !skb_queue_empty_lockless(&sk->sk_error_queue))
+	if (READ_ONCE(sk->sk_err) ||
+	    !skb_queue_empty_lockless(&sk->sk_error_queue))
 		mask |= EPOLLERR;
 
 	return mask;
@@ -3119,7 +3120,7 @@ int tcp_disconnect(struct sock *sk, int flags)
 	if (old_state == TCP_LISTEN) {
 		inet_csk_listen_stop(sk);
 	} else if (unlikely(tp->repair)) {
-		sk->sk_err = ECONNABORTED;
+		WRITE_ONCE(sk->sk_err, ECONNABORTED);
 	} else if (tcp_need_reset(old_state) ||
 		   (tp->snd_nxt != tp->write_seq &&
 		    (1 << old_state) & (TCPF_CLOSING | TCPF_LAST_ACK))) {
@@ -3127,9 +3128,9 @@ int tcp_disconnect(struct sock *sk, int flags)
 		 * states
 		 */
 		tcp_send_active_reset(sk, gfp_any());
-		sk->sk_err = ECONNRESET;
+		WRITE_ONCE(sk->sk_err, ECONNRESET);
 	} else if (old_state == TCP_SYN_SENT)
-		sk->sk_err = ECONNRESET;
+		WRITE_ONCE(sk->sk_err, ECONNRESET);
 
 	tcp_clear_xmit_timers(sk);
 	__skb_queue_purge(&sk->sk_receive_queue);
@@ -4735,7 +4736,7 @@ int tcp_abort(struct sock *sk, int err)
 	bh_lock_sock(sk);
 
 	if (!sock_flag(sk, SOCK_DEAD)) {
-		sk->sk_err = err;
+		WRITE_ONCE(sk->sk_err, err);
 		/* This barrier is coupled with smp_rmb() in tcp_poll() */
 		smp_wmb();
 		sk_error_report(sk);
diff --git a/net/ipv4/tcp_input.c b/net/ipv4/tcp_input.c
index 359ffda9b736..b1b4f44d2137 100644
--- a/net/ipv4/tcp_input.c
+++ b/net/ipv4/tcp_input.c
@@ -3922,7 +3922,7 @@ static int tcp_ack(struct sock *sk, const struct sk_buff *skb, int flag)
 	/* We passed data and got it acked, remove any soft error
 	 * log. Something worked...
 	 */
-	sk->sk_err_soft = 0;
+	WRITE_ONCE(sk->sk_err_soft, 0);
 	icsk->icsk_probes_out = 0;
 	tp->rcv_tstamp = tcp_jiffies32;
 	if (!prior_packets)
@@ -4356,9 +4356,26 @@ static inline bool tcp_sequence(const struct tcp_sock *tp, u32 seq, u32 end_seq)
 		!after(seq, tp->rcv_nxt + tcp_receive_window(tp));
 }
 
+
+void tcp_done_with_error(struct sock *sk, int err)
+{
+	/* This barrier is coupled with smp_rmb() in tcp_poll() */
+	WRITE_ONCE(sk->sk_err, err);
+	smp_wmb();
+
+	tcp_write_queue_purge(sk);
+	tcp_done(sk);
+
+	if (!sock_flag(sk, SOCK_DEAD))
+		sk_error_report(sk);
+}
+EXPORT_SYMBOL(tcp_done_with_error);
+
 /* When we get a reset we do this. */
 void tcp_reset(struct sock *sk, struct sk_buff *skb)
 {
+	int err;
+
 	trace_tcp_receive_reset(sk);
 
 	/* mptcp can't tell us to ignore reset pkts,
@@ -4370,24 +4387,17 @@ void tcp_reset(struct sock *sk, struct sk_buff *skb)
 	/* We want the right error as BSD sees it (and indeed as we do). */
 	switch (sk->sk_state) {
 	case TCP_SYN_SENT:
-		sk->sk_err = ECONNREFUSED;
+		err = ECONNREFUSED;
 		break;
 	case TCP_CLOSE_WAIT:
-		sk->sk_err = EPIPE;
+		err = EPIPE;
 		break;
 	case TCP_CLOSE:
 		return;
 	default:
-		sk->sk_err = ECONNRESET;
+		err = ECONNRESET;
 	}
-	/* This barrier is coupled with smp_rmb() in tcp_poll() */
-	smp_wmb();
-
-	tcp_write_queue_purge(sk);
-	tcp_done(sk);
-
-	if (!sock_flag(sk, SOCK_DEAD))
-		sk_error_report(sk);
+	tcp_done_with_error(sk, err);
 }
 
 /*
diff --git a/net/ipv4/tcp_ipv4.c b/net/ipv4/tcp_ipv4.c
index befa848fb820..c64ba4f8ddaa 100644
--- a/net/ipv4/tcp_ipv4.c
+++ b/net/ipv4/tcp_ipv4.c
@@ -368,7 +368,7 @@ void tcp_v4_mtu_reduced(struct sock *sk)
 	 * for the case, if this connection will not able to recover.
 	 */
 	if (mtu < dst_mtu(dst) && ip_dont_fragment(sk, dst))
-		sk->sk_err_soft = EMSGSIZE;
+		WRITE_ONCE(sk->sk_err_soft, EMSGSIZE);
 
 	mtu = dst_mtu(dst);
 
@@ -602,15 +602,10 @@ int tcp_v4_err(struct sk_buff *skb, u32 info)
 
 		ip_icmp_error(sk, skb, err, th->dest, info, (u8 *)th);
 
-		if (!sock_owned_by_user(sk)) {
-			sk->sk_err = err;
-
-			sk_error_report(sk);
-
-			tcp_done(sk);
-		} else {
-			sk->sk_err_soft = err;
-		}
+		if (!sock_owned_by_user(sk))
+			tcp_done_with_error(sk, err);
+		else
+			WRITE_ONCE(sk->sk_err_soft, err);
 		goto out;
 	}
 
@@ -632,10 +627,10 @@ int tcp_v4_err(struct sk_buff *skb, u32 info)
 
 	inet = inet_sk(sk);
 	if (!sock_owned_by_user(sk) && inet->recverr) {
-		sk->sk_err = err;
+		WRITE_ONCE(sk->sk_err, err);
 		sk_error_report(sk);
 	} else	{ /* Only an error on timeout */
-		sk->sk_err_soft = err;
+		WRITE_ONCE(sk->sk_err_soft, err);
 	}
 
 out:
diff --git a/net/ipv4/tcp_output.c b/net/ipv4/tcp_output.c
index 15f814c1e169..19b5a6179c06 100644
--- a/net/ipv4/tcp_output.c
+++ b/net/ipv4/tcp_output.c
@@ -3764,7 +3764,7 @@ static void tcp_connect_init(struct sock *sk)
 	tp->rx_opt.rcv_wscale = rcv_wscale;
 	tp->rcv_ssthresh = tp->rcv_wnd;
 
-	sk->sk_err = 0;
+	WRITE_ONCE(sk->sk_err, 0);
 	sock_reset_flag(sk, SOCK_DONE);
 	tp->snd_wnd = 0;
 	tcp_init_wl(tp, 0);
diff --git a/net/ipv4/tcp_timer.c b/net/ipv4/tcp_timer.c
index 016f9eff49b4..3662b49ce71a 100644
--- a/net/ipv4/tcp_timer.c
+++ b/net/ipv4/tcp_timer.c
@@ -67,11 +67,7 @@ u32 tcp_clamp_probe0_to_user_timeout(const struct sock *sk, u32 when)
 
 static void tcp_write_err(struct sock *sk)
 {
-	sk->sk_err = sk->sk_err_soft ? : ETIMEDOUT;
-	sk_error_report(sk);
-
-	tcp_write_queue_purge(sk);
-	tcp_done(sk);
+	tcp_done_with_error(sk, READ_ONCE(sk->sk_err_soft) ? : ETIMEDOUT);
 	__NET_INC_STATS(sock_net(sk), LINUX_MIB_TCPABORTONTIMEOUT);
 }
 
@@ -110,7 +106,7 @@ static int tcp_out_of_resources(struct sock *sk, bool do_reset)
 		shift++;
 
 	/* If some dubious ICMP arrived, penalize even more. */
-	if (sk->sk_err_soft)
+	if (READ_ONCE(sk->sk_err_soft))
 		shift++;
 
 	if (tcp_check_oom(sk, shift)) {
@@ -146,7 +142,7 @@ static int tcp_orphan_retries(struct sock *sk, bool alive)
 	int retries = READ_ONCE(sock_net(sk)->ipv4.sysctl_tcp_orphan_retries); /* May be zero. */
 
 	/* We know from an ICMP that something is wrong. */
-	if (sk->sk_err_soft && !alive)
+	if (READ_ONCE(sk->sk_err_soft) && !alive)
 		retries = 0;
 
 	/* However, if socket sent something recently, select some safe
diff --git a/net/ipv6/addrconf.c b/net/ipv6/addrconf.c
index 22e246ff910e..4e1e6ef72464 100644
--- a/net/ipv6/addrconf.c
+++ b/net/ipv6/addrconf.c
@@ -1831,7 +1831,8 @@ int ipv6_dev_get_saddr(struct net *net, const struct net_device *dst_dev,
 							    master, &dst,
 							    scores, hiscore_idx);
 
-			if (scores[hiscore_idx].ifa)
+			if (scores[hiscore_idx].ifa &&
+			    scores[hiscore_idx].scopedist >= 0)
 				goto out;
 		}
 
diff --git a/net/ipv6/esp6.c b/net/ipv6/esp6.c
index c2dcb5c613b6..a021c88d3d9b 100644
--- a/net/ipv6/esp6.c
+++ b/net/ipv6/esp6.c
@@ -255,8 +255,7 @@ static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
 #else
 static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
 {
-	kfree_skb(skb);
-
+	WARN_ON(1);
 	return -EOPNOTSUPP;
 }
 #endif
diff --git a/net/ipv6/tcp_ipv6.c b/net/ipv6/tcp_ipv6.c
index 4b0e05349862..eb6fc0e2a453 100644
--- a/net/ipv6/tcp_ipv6.c
+++ b/net/ipv6/tcp_ipv6.c
@@ -492,13 +492,10 @@ static int tcp_v6_err(struct sk_buff *skb, struct inet6_skb_parm *opt,
 
 		ipv6_icmp_error(sk, skb, err, th->dest, ntohl(info), (u8 *)th);
 
-		if (!sock_owned_by_user(sk)) {
-			sk->sk_err = err;
-			sk_error_report(sk);		/* Wake people up to see the error (see connect in sock.c) */
-
-			tcp_done(sk);
-		} else
-			sk->sk_err_soft = err;
+		if (!sock_owned_by_user(sk))
+			tcp_done_with_error(sk, err);
+		else
+			WRITE_ONCE(sk->sk_err_soft, err);
 		goto out;
 	case TCP_LISTEN:
 		break;
@@ -512,11 +509,11 @@ static int tcp_v6_err(struct sk_buff *skb, struct inet6_skb_parm *opt,
 	}
 
 	if (!sock_owned_by_user(sk) && np->recverr) {
-		sk->sk_err = err;
+		WRITE_ONCE(sk->sk_err, err);
 		sk_error_report(sk);
-	} else
-		sk->sk_err_soft = err;
-
+	} else {
+		WRITE_ONCE(sk->sk_err_soft, err);
+	}
 out:
 	bh_unlock_sock(sk);
 	sock_put(sk);
diff --git a/net/mac80211/cfg.c b/net/mac80211/cfg.c
index 2c60fc165801..1ce8fefd7f0d 100644
--- a/net/mac80211/cfg.c
+++ b/net/mac80211/cfg.c
@@ -1775,7 +1775,7 @@ static int sta_link_apply_parameters(struct ieee80211_local *local,
 					      sband->band);
 	}
 
-	ieee80211_sta_set_rx_nss(link_sta);
+	ieee80211_sta_init_nss(link_sta);
 
 	return ret;
 }
@@ -2577,6 +2577,17 @@ static int ieee80211_change_bss(struct wiphy *wiphy,
 	if (!sband)
 		return -EINVAL;
 
+	if (params->basic_rates) {
+		if (!ieee80211_parse_bitrates(sdata->vif.bss_conf.chandef.width,
+					      wiphy->bands[sband->band],
+					      params->basic_rates,
+					      params->basic_rates_len,
+					      &sdata->vif.bss_conf.basic_rates))
+			return -EINVAL;
+		changed |= BSS_CHANGED_BASIC_RATES;
+		ieee80211_check_rate_mask(&sdata->deflink);
+	}
+
 	if (params->use_cts_prot >= 0) {
 		sdata->vif.bss_conf.use_cts_prot = params->use_cts_prot;
 		changed |= BSS_CHANGED_ERP_CTS_PROT;
@@ -2600,16 +2611,6 @@ static int ieee80211_change_bss(struct wiphy *wiphy,
 		changed |= BSS_CHANGED_ERP_SLOT;
 	}
 
-	if (params->basic_rates) {
-		ieee80211_parse_bitrates(sdata->vif.bss_conf.chandef.width,
-					 wiphy->bands[sband->band],
-					 params->basic_rates,
-					 params->basic_rates_len,
-					 &sdata->vif.bss_conf.basic_rates);
-		changed |= BSS_CHANGED_BASIC_RATES;
-		ieee80211_check_rate_mask(&sdata->deflink);
-	}
-
 	if (params->ap_isolate >= 0) {
 		if (params->ap_isolate)
 			sdata->flags |= IEEE80211_SDATA_DONT_BRIDGE_PACKETS;
diff --git a/net/mac80211/ieee80211_i.h b/net/mac80211/ieee80211_i.h
index 0d8a9bb92538..709eb7bfcf19 100644
--- a/net/mac80211/ieee80211_i.h
+++ b/net/mac80211/ieee80211_i.h
@@ -2071,7 +2071,7 @@ enum ieee80211_sta_rx_bandwidth
 ieee80211_sta_cap_rx_bw(struct link_sta_info *link_sta);
 enum ieee80211_sta_rx_bandwidth
 ieee80211_sta_cur_vht_bw(struct link_sta_info *link_sta);
-void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta);
+void ieee80211_sta_init_nss(struct link_sta_info *link_sta);
 enum ieee80211_sta_rx_bandwidth
 ieee80211_chan_width_to_rx_bw(enum nl80211_chan_width width);
 enum nl80211_chan_width
diff --git a/net/mac80211/rate.c b/net/mac80211/rate.c
index a2bc9c5d92b8..3cf252418bd3 100644
--- a/net/mac80211/rate.c
+++ b/net/mac80211/rate.c
@@ -37,7 +37,7 @@ void rate_control_rate_init(struct sta_info *sta)
 	struct ieee80211_supported_band *sband;
 	struct ieee80211_chanctx_conf *chanctx_conf;
 
-	ieee80211_sta_set_rx_nss(&sta->deflink);
+	ieee80211_sta_init_nss(&sta->deflink);
 
 	if (!ref)
 		return;
diff --git a/net/mac80211/sta_info.h b/net/mac80211/sta_info.h
index 2517ea714dc4..4809756a43dd 100644
--- a/net/mac80211/sta_info.h
+++ b/net/mac80211/sta_info.h
@@ -3,7 +3,7 @@
  * Copyright 2002-2005, Devicescape Software, Inc.
  * Copyright 2013-2014  Intel Mobile Communications GmbH
  * Copyright(c) 2015-2017 Intel Deutschland GmbH
- * Copyright(c) 2020-2022 Intel Corporation
+ * Copyright(c) 2020-2024 Intel Corporation
  */
 
 #ifndef STA_INFO_H
@@ -485,6 +485,8 @@ struct ieee80211_fragment_cache {
  *	same for non-MLD STA. This is used as key for searching link STA
  * @link_id: Link ID uniquely identifying the link STA. This is 0 for non-MLD
  *	and set to the corresponding vif LinkId for MLD STA
+ * @op_mode_nss: NSS limit as set by operating mode notification, or 0
+ * @capa_nss: NSS limit as determined by local and peer capabilities
  * @link_hash_node: hash node for rhashtable
  * @sta: Points to the STA info
  * @gtk: group keys negotiated with this station, if any
@@ -520,6 +522,8 @@ struct link_sta_info {
 	u8 addr[ETH_ALEN];
 	u8 link_id;
 
+	u8 op_mode_nss, capa_nss;
+
 	struct rhlist_head link_hash_node;
 
 	struct sta_info *sta;
diff --git a/net/mac80211/vht.c b/net/mac80211/vht.c
index f7526be8a1c7..bc13b1419981 100644
--- a/net/mac80211/vht.c
+++ b/net/mac80211/vht.c
@@ -4,7 +4,7 @@
  *
  * Portions of this file
  * Copyright(c) 2015 - 2016 Intel Deutschland GmbH
- * Copyright (C) 2018 - 2023 Intel Corporation
+ * Copyright (C) 2018 - 2024 Intel Corporation
  */
 
 #include <linux/ieee80211.h>
@@ -541,15 +541,11 @@ ieee80211_sta_cur_vht_bw(struct link_sta_info *link_sta)
 	return bw;
 }
 
-void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta)
+void ieee80211_sta_init_nss(struct link_sta_info *link_sta)
 {
 	u8 ht_rx_nss = 0, vht_rx_nss = 0, he_rx_nss = 0, eht_rx_nss = 0, rx_nss;
 	bool support_160;
 
-	/* if we received a notification already don't overwrite it */
-	if (link_sta->pub->rx_nss)
-		return;
-
 	if (link_sta->pub->eht_cap.has_eht) {
 		int i;
 		const u8 *rx_nss_mcs = (void *)&link_sta->pub->eht_cap.eht_mcs_nss_supp;
@@ -627,7 +623,15 @@ void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta)
 	rx_nss = max(vht_rx_nss, ht_rx_nss);
 	rx_nss = max(he_rx_nss, rx_nss);
 	rx_nss = max(eht_rx_nss, rx_nss);
-	link_sta->pub->rx_nss = max_t(u8, 1, rx_nss);
+	rx_nss = max_t(u8, 1, rx_nss);
+	link_sta->capa_nss = rx_nss;
+
+	/* that shouldn't be set yet, but we can handle it anyway */
+	if (link_sta->op_mode_nss)
+		link_sta->pub->rx_nss =
+			min_t(u8, rx_nss, link_sta->op_mode_nss);
+	else
+		link_sta->pub->rx_nss = rx_nss;
 }
 
 u32 __ieee80211_vht_handle_opmode(struct ieee80211_sub_if_data *sdata,
@@ -647,11 +651,20 @@ u32 __ieee80211_vht_handle_opmode(struct ieee80211_sub_if_data *sdata,
 	nss >>= IEEE80211_OPMODE_NOTIF_RX_NSS_SHIFT;
 	nss += 1;
 
-	if (link_sta->pub->rx_nss != nss) {
-		link_sta->pub->rx_nss = nss;
-		sta_opmode.rx_nss = nss;
-		changed |= IEEE80211_RC_NSS_CHANGED;
-		sta_opmode.changed |= STA_OPMODE_N_SS_CHANGED;
+	if (link_sta->op_mode_nss != nss) {
+		if (nss <= link_sta->capa_nss) {
+			link_sta->op_mode_nss = nss;
+
+			if (nss != link_sta->pub->rx_nss) {
+				link_sta->pub->rx_nss = nss;
+				changed |= IEEE80211_RC_NSS_CHANGED;
+				sta_opmode.rx_nss = link_sta->pub->rx_nss;
+				sta_opmode.changed |= STA_OPMODE_N_SS_CHANGED;
+			}
+		} else {
+			pr_warn_ratelimited("Ignoring NSS change in VHT Operating Mode Notification from %pM with invalid nss %d",
+					    link_sta->pub->addr, nss);
+		}
 	}
 
 	switch (opmode & IEEE80211_OPMODE_NOTIF_CHANWIDTH_MASK) {
diff --git a/net/netfilter/ipvs/ip_vs_proto_sctp.c b/net/netfilter/ipvs/ip_vs_proto_sctp.c
index 1e689c714127..83e452916403 100644
--- a/net/netfilter/ipvs/ip_vs_proto_sctp.c
+++ b/net/netfilter/ipvs/ip_vs_proto_sctp.c
@@ -126,7 +126,7 @@ sctp_snat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp,
 	if (sctph->source != cp->vport || payload_csum ||
 	    skb->ip_summed == CHECKSUM_PARTIAL) {
 		sctph->source = cp->vport;
-		if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb))
+		if (!skb_is_gso(skb))
 			sctp_nat_csum(skb, sctph, sctphoff);
 	} else {
 		skb->ip_summed = CHECKSUM_UNNECESSARY;
@@ -175,7 +175,7 @@ sctp_dnat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp,
 	    (skb->ip_summed == CHECKSUM_PARTIAL &&
 	     !(skb_dst(skb)->dev->features & NETIF_F_SCTP_CRC))) {
 		sctph->dest = cp->dport;
-		if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb))
+		if (!skb_is_gso(skb))
 			sctp_nat_csum(skb, sctph, sctphoff);
 	} else if (skb->ip_summed != CHECKSUM_PARTIAL) {
 		skb->ip_summed = CHECKSUM_UNNECESSARY;
diff --git a/net/netfilter/nf_conntrack_netlink.c b/net/netfilter/nf_conntrack_netlink.c
index 9ee8abd3e4b1..9672b0e00d6b 100644
--- a/net/netfilter/nf_conntrack_netlink.c
+++ b/net/netfilter/nf_conntrack_netlink.c
@@ -3415,7 +3415,8 @@ static int ctnetlink_del_expect(struct sk_buff *skb,
 
 		if (cda[CTA_EXPECT_ID]) {
 			__be32 id = nla_get_be32(cda[CTA_EXPECT_ID]);
-			if (ntohl(id) != (u32)(unsigned long)exp) {
+
+			if (id != nf_expect_get_id(exp)) {
 				nf_ct_expect_put(exp);
 				return -ENOENT;
 			}
diff --git a/net/netfilter/nft_set_pipapo.c b/net/netfilter/nft_set_pipapo.c
index a56ed216c223..d9c1c467ea68 100644
--- a/net/netfilter/nft_set_pipapo.c
+++ b/net/netfilter/nft_set_pipapo.c
@@ -360,7 +360,7 @@
  * Return: -1 on no match, bit position on 'match_only', 0 otherwise.
  */
 int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
-		  union nft_pipapo_map_bucket *mt, bool match_only)
+		  const union nft_pipapo_map_bucket *mt, bool match_only)
 {
 	unsigned long bitset;
 	int k, ret = -1;
@@ -412,9 +412,9 @@ bool nft_pipapo_lookup(const struct net *net, const struct nft_set *set,
 	struct nft_pipapo_scratch *scratch;
 	unsigned long *res_map, *fill_map;
 	u8 genmask = nft_genmask_cur(net);
+	const struct nft_pipapo_match *m;
+	const struct nft_pipapo_field *f;
 	const u8 *rp = (const u8 *)key;
-	struct nft_pipapo_match *m;
-	struct nft_pipapo_field *f;
 	bool map_index;
 	int i;
 
@@ -432,7 +432,7 @@ bool nft_pipapo_lookup(const struct net *net, const struct nft_set *set,
 	res_map  = scratch->map + (map_index ? m->bsize_max : 0);
 	fill_map = scratch->map + (map_index ? 0 : m->bsize_max);
 
-	memset(res_map, 0xff, m->bsize_max * sizeof(*res_map));
+	pipapo_resmap_init(m, res_map);
 
 	nft_pipapo_for_each_field(f, i, m) {
 		bool last = i == m->field_count - 1;
@@ -519,11 +519,13 @@ static struct nft_pipapo_elem *pipapo_get(const struct net *net,
 {
 	struct nft_pipapo_elem *ret = ERR_PTR(-ENOENT);
 	struct nft_pipapo *priv = nft_set_priv(set);
-	struct nft_pipapo_match *m = priv->clone;
 	unsigned long *res_map, *fill_map = NULL;
-	struct nft_pipapo_field *f;
+	const struct nft_pipapo_match *m;
+	const struct nft_pipapo_field *f;
 	int i;
 
+	m = priv->clone;
+
 	res_map = kmalloc_array(m->bsize_max, sizeof(*res_map), GFP_ATOMIC);
 	if (!res_map) {
 		ret = ERR_PTR(-ENOMEM);
@@ -536,7 +538,7 @@ static struct nft_pipapo_elem *pipapo_get(const struct net *net,
 		goto out;
 	}
 
-	memset(res_map, 0xff, m->bsize_max * sizeof(*res_map));
+	pipapo_resmap_init(m, res_map);
 
 	nft_pipapo_for_each_field(f, i, m) {
 		bool last = i == m->field_count - 1;
@@ -1595,7 +1597,7 @@ static void pipapo_gc(const struct nft_set *_set, struct nft_pipapo_match *m)
 
 	while ((rules_f0 = pipapo_rules_same_key(m->f, first_rule))) {
 		union nft_pipapo_map_bucket rulemap[NFT_PIPAPO_MAX_FIELDS];
-		struct nft_pipapo_field *f;
+		const struct nft_pipapo_field *f;
 		int i, start, rules_fx;
 
 		start = first_rule;
@@ -2041,8 +2043,8 @@ static void nft_pipapo_walk(const struct nft_ctx *ctx, struct nft_set *set,
 {
 	struct nft_pipapo *priv = nft_set_priv(set);
 	struct net *net = read_pnet(&set->net);
-	struct nft_pipapo_match *m;
-	struct nft_pipapo_field *f;
+	const struct nft_pipapo_match *m;
+	const struct nft_pipapo_field *f;
 	int i, r;
 
 	rcu_read_lock();
diff --git a/net/netfilter/nft_set_pipapo.h b/net/netfilter/nft_set_pipapo.h
index 30a3d092cd84..519a2e6dc206 100644
--- a/net/netfilter/nft_set_pipapo.h
+++ b/net/netfilter/nft_set_pipapo.h
@@ -185,7 +185,7 @@ struct nft_pipapo_elem {
 };
 
 int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
-		  union nft_pipapo_map_bucket *mt, bool match_only);
+		  const union nft_pipapo_map_bucket *mt, bool match_only);
 
 /**
  * pipapo_and_field_buckets_4bit() - Intersect 4-bit buckets
@@ -193,7 +193,7 @@ int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
  * @dst:	Area to store result
  * @data:	Input data selecting table buckets
  */
-static inline void pipapo_and_field_buckets_4bit(struct nft_pipapo_field *f,
+static inline void pipapo_and_field_buckets_4bit(const struct nft_pipapo_field *f,
 						 unsigned long *dst,
 						 const u8 *data)
 {
@@ -221,7 +221,7 @@ static inline void pipapo_and_field_buckets_4bit(struct nft_pipapo_field *f,
  * @dst:	Area to store result
  * @data:	Input data selecting table buckets
  */
-static inline void pipapo_and_field_buckets_8bit(struct nft_pipapo_field *f,
+static inline void pipapo_and_field_buckets_8bit(const struct nft_pipapo_field *f,
 						 unsigned long *dst,
 						 const u8 *data)
 {
@@ -285,4 +285,25 @@ static u64 pipapo_estimate_size(const struct nft_set_desc *desc)
 	return size;
 }
 
+/**
+ * pipapo_resmap_init() - Initialise result map before first use
+ * @m:		Matching data, including mapping table
+ * @res_map:	Result map
+ *
+ * Initialize all bits covered by the first field to one, so that after
+ * the first step, only the matching bits of the first bit group remain.
+ *
+ * If other fields have a large bitmap, set remainder of res_map to 0.
+ */
+static inline void pipapo_resmap_init(const struct nft_pipapo_match *m, unsigned long *res_map)
+{
+	const struct nft_pipapo_field *f = m->f;
+	int i;
+
+	for (i = 0; i < f->bsize; i++)
+		res_map[i] = ULONG_MAX;
+
+	for (i = f->bsize; i < m->bsize_max; i++)
+		res_map[i] = 0ul;
+}
 #endif /* _NFT_SET_PIPAPO_H */
diff --git a/net/netfilter/nft_set_pipapo_avx2.c b/net/netfilter/nft_set_pipapo_avx2.c
index a3a8ddca9918..b8d3c3213efe 100644
--- a/net/netfilter/nft_set_pipapo_avx2.c
+++ b/net/netfilter/nft_set_pipapo_avx2.c
@@ -212,8 +212,9 @@ static int nft_pipapo_avx2_refill(int offset, unsigned long *map,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_2(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	u8 pg[2] = { pkt[0] >> 4, pkt[0] & 0xf };
@@ -274,8 +275,9 @@ static int nft_pipapo_avx2_lookup_4b_2(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_4(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	u8 pg[4] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf };
@@ -350,8 +352,9 @@ static int nft_pipapo_avx2_lookup_4b_4(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_8(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	u8 pg[8] = {  pkt[0] >> 4,  pkt[0] & 0xf,  pkt[1] >> 4,  pkt[1] & 0xf,
 		      pkt[2] >> 4,  pkt[2] & 0xf,  pkt[3] >> 4,  pkt[3] & 0xf,
@@ -445,8 +448,9 @@ static int nft_pipapo_avx2_lookup_4b_8(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_12(unsigned long *map, unsigned long *fill,
-				        struct nft_pipapo_field *f, int offset,
-				        const u8 *pkt, bool first, bool last)
+					const struct nft_pipapo_field *f,
+					int offset, const u8 *pkt,
+					bool first, bool last)
 {
 	u8 pg[12] = {  pkt[0] >> 4,  pkt[0] & 0xf,  pkt[1] >> 4,  pkt[1] & 0xf,
 		       pkt[2] >> 4,  pkt[2] & 0xf,  pkt[3] >> 4,  pkt[3] & 0xf,
@@ -534,8 +538,9 @@ static int nft_pipapo_avx2_lookup_4b_12(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_32(unsigned long *map, unsigned long *fill,
-					struct nft_pipapo_field *f, int offset,
-					const u8 *pkt, bool first, bool last)
+					const struct nft_pipapo_field *f,
+					int offset, const u8 *pkt,
+					bool first, bool last)
 {
 	u8 pg[32] = {  pkt[0] >> 4,  pkt[0] & 0xf,  pkt[1] >> 4,  pkt[1] & 0xf,
 		       pkt[2] >> 4,  pkt[2] & 0xf,  pkt[3] >> 4,  pkt[3] & 0xf,
@@ -669,8 +674,9 @@ static int nft_pipapo_avx2_lookup_4b_32(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_1(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -726,8 +732,9 @@ static int nft_pipapo_avx2_lookup_8b_1(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_2(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -790,8 +797,9 @@ static int nft_pipapo_avx2_lookup_8b_2(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_4(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -865,8 +873,9 @@ static int nft_pipapo_avx2_lookup_8b_4(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_6(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -950,8 +959,9 @@ static int nft_pipapo_avx2_lookup_8b_6(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
-					struct nft_pipapo_field *f, int offset,
-					const u8 *pkt, bool first, bool last)
+					const struct nft_pipapo_field *f,
+					int offset, const u8 *pkt,
+					bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -1026,6 +1036,7 @@ static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
 
 /**
  * nft_pipapo_avx2_lookup_slow() - Fallback function for uncommon field sizes
+ * @mdata:	Matching data, including mapping table
  * @map:	Previous match result, used as initial bitmap
  * @fill:	Destination bitmap to be filled with current match result
  * @f:		Field, containing lookup and mapping tables
@@ -1041,15 +1052,17 @@ static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
  * Return: -1 on no match, rule index of match if @last, otherwise first long
  * word index to be checked next (i.e. first filled word).
  */
-static int nft_pipapo_avx2_lookup_slow(unsigned long *map, unsigned long *fill,
-					struct nft_pipapo_field *f, int offset,
-					const u8 *pkt, bool first, bool last)
+static int nft_pipapo_avx2_lookup_slow(const struct nft_pipapo_match *mdata,
+					unsigned long *map, unsigned long *fill,
+					const struct nft_pipapo_field *f,
+					int offset, const u8 *pkt,
+					bool first, bool last)
 {
 	unsigned long bsize = f->bsize;
 	int i, ret = -1, b;
 
 	if (first)
-		memset(map, 0xff, bsize * sizeof(*map));
+		pipapo_resmap_init(mdata, map);
 
 	for (i = offset; i < bsize; i++) {
 		if (f->bb == 8)
@@ -1119,15 +1132,21 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 	struct nft_pipapo *priv = nft_set_priv(set);
 	struct nft_pipapo_scratch *scratch;
 	u8 genmask = nft_genmask_cur(net);
+	const struct nft_pipapo_match *m;
+	const struct nft_pipapo_field *f;
 	const u8 *rp = (const u8 *)key;
-	struct nft_pipapo_match *m;
-	struct nft_pipapo_field *f;
 	unsigned long *res, *fill;
 	bool map_index;
 	int i, ret = 0;
 
-	if (unlikely(!irq_fpu_usable()))
-		return nft_pipapo_lookup(net, set, key, ext);
+	local_bh_disable();
+
+	if (unlikely(!irq_fpu_usable())) {
+		bool fallback_res = nft_pipapo_lookup(net, set, key, ext);
+
+		local_bh_enable();
+		return fallback_res;
+	}
 
 	m = rcu_dereference(priv->match);
 
@@ -1142,6 +1161,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 	scratch = *raw_cpu_ptr(m->scratch);
 	if (unlikely(!scratch)) {
 		kernel_fpu_end();
+		local_bh_enable();
 		return false;
 	}
 
@@ -1175,7 +1195,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 			} else if (f->groups == 16) {
 				NFT_SET_PIPAPO_AVX2_LOOKUP(8, 16);
 			} else {
-				ret = nft_pipapo_avx2_lookup_slow(res, fill, f,
+				ret = nft_pipapo_avx2_lookup_slow(m, res, fill, f,
 								  ret, rp,
 								  first, last);
 			}
@@ -1191,7 +1211,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 			} else if (f->groups == 32) {
 				NFT_SET_PIPAPO_AVX2_LOOKUP(4, 32);
 			} else {
-				ret = nft_pipapo_avx2_lookup_slow(res, fill, f,
+				ret = nft_pipapo_avx2_lookup_slow(m, res, fill, f,
 								  ret, rp,
 								  first, last);
 			}
@@ -1222,6 +1242,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 	if (i % 2)
 		scratch->map_index = !map_index;
 	kernel_fpu_end();
+	local_bh_enable();
 
 	return ret >= 0;
 }
diff --git a/net/packet/af_packet.c b/net/packet/af_packet.c
index c48cb7664c55..c9c813f731c6 100644
--- a/net/packet/af_packet.c
+++ b/net/packet/af_packet.c
@@ -541,6 +541,61 @@ static void *packet_current_frame(struct packet_sock *po,
 	return packet_lookup_frame(po, rb, rb->head, status);
 }
 
+static u16 vlan_get_tci(struct sk_buff *skb, struct net_device *dev)
+{
+	u8 *skb_orig_data = skb->data;
+	int skb_orig_len = skb->len;
+	struct vlan_hdr vhdr, *vh;
+	unsigned int header_len;
+
+	if (!dev)
+		return 0;
+
+	/* In the SOCK_DGRAM scenario, skb data starts at the network
+	 * protocol, which is after the VLAN headers. The outer VLAN
+	 * header is at the hard_header_len offset in non-variable
+	 * length link layer headers. If it's a VLAN device, the
+	 * min_header_len should be used to exclude the VLAN header
+	 * size.
+	 */
+	if (dev->min_header_len == dev->hard_header_len)
+		header_len = dev->hard_header_len;
+	else if (is_vlan_dev(dev))
+		header_len = dev->min_header_len;
+	else
+		return 0;
+
+	skb_push(skb, skb->data - skb_mac_header(skb));
+	vh = skb_header_pointer(skb, header_len, sizeof(vhdr), &vhdr);
+	if (skb_orig_data != skb->data) {
+		skb->data = skb_orig_data;
+		skb->len = skb_orig_len;
+	}
+	if (unlikely(!vh))
+		return 0;
+
+	return ntohs(vh->h_vlan_TCI);
+}
+
+static __be16 vlan_get_protocol_dgram(struct sk_buff *skb)
+{
+	__be16 proto = skb->protocol;
+
+	if (unlikely(eth_type_vlan(proto))) {
+		u8 *skb_orig_data = skb->data;
+		int skb_orig_len = skb->len;
+
+		skb_push(skb, skb->data - skb_mac_header(skb));
+		proto = __vlan_get_protocol(skb, proto, NULL);
+		if (skb_orig_data != skb->data) {
+			skb->data = skb_orig_data;
+			skb->len = skb_orig_len;
+		}
+	}
+
+	return proto;
+}
+
 static void prb_del_retire_blk_timer(struct tpacket_kbdq_core *pkc)
 {
 	del_timer_sync(&pkc->retire_blk_timer);
@@ -1010,10 +1065,16 @@ static void prb_clear_rxhash(struct tpacket_kbdq_core *pkc,
 static void prb_fill_vlan_info(struct tpacket_kbdq_core *pkc,
 			struct tpacket3_hdr *ppd)
 {
+	struct packet_sock *po = container_of(pkc, struct packet_sock, rx_ring.prb_bdqc);
+
 	if (skb_vlan_tag_present(pkc->skb)) {
 		ppd->hv1.tp_vlan_tci = skb_vlan_tag_get(pkc->skb);
 		ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->vlan_proto);
 		ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+	} else if (unlikely(po->sk.sk_type == SOCK_DGRAM && eth_type_vlan(pkc->skb->protocol))) {
+		ppd->hv1.tp_vlan_tci = vlan_get_tci(pkc->skb, pkc->skb->dev);
+		ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->protocol);
+		ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
 	} else {
 		ppd->hv1.tp_vlan_tci = 0;
 		ppd->hv1.tp_vlan_tpid = 0;
@@ -2431,6 +2492,10 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev,
 			h.h2->tp_vlan_tci = skb_vlan_tag_get(skb);
 			h.h2->tp_vlan_tpid = ntohs(skb->vlan_proto);
 			status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+		} else if (unlikely(sk->sk_type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) {
+			h.h2->tp_vlan_tci = vlan_get_tci(skb, skb->dev);
+			h.h2->tp_vlan_tpid = ntohs(skb->protocol);
+			status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
 		} else {
 			h.h2->tp_vlan_tci = 0;
 			h.h2->tp_vlan_tpid = 0;
@@ -2460,7 +2525,8 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev,
 	sll->sll_halen = dev_parse_header(skb, sll->sll_addr);
 	sll->sll_family = AF_PACKET;
 	sll->sll_hatype = dev->type;
-	sll->sll_protocol = skb->protocol;
+	sll->sll_protocol = (sk->sk_type == SOCK_DGRAM) ?
+		vlan_get_protocol_dgram(skb) : skb->protocol;
 	sll->sll_pkttype = skb->pkt_type;
 	if (unlikely(packet_sock_flag(po, PACKET_SOCK_ORIGDEV)))
 		sll->sll_ifindex = orig_dev->ifindex;
@@ -3481,7 +3547,8 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len,
 		/* Original length was stored in sockaddr_ll fields */
 		origlen = PACKET_SKB_CB(skb)->sa.origlen;
 		sll->sll_family = AF_PACKET;
-		sll->sll_protocol = skb->protocol;
+		sll->sll_protocol = (sock->type == SOCK_DGRAM) ?
+			vlan_get_protocol_dgram(skb) : skb->protocol;
 	}
 
 	sock_recv_cmsgs(msg, sk, skb);
@@ -3536,6 +3603,21 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len,
 			aux.tp_vlan_tci = skb_vlan_tag_get(skb);
 			aux.tp_vlan_tpid = ntohs(skb->vlan_proto);
 			aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+		} else if (unlikely(sock->type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) {
+			struct sockaddr_ll *sll = &PACKET_SKB_CB(skb)->sa.ll;
+			struct net_device *dev;
+
+			rcu_read_lock();
+			dev = dev_get_by_index_rcu(sock_net(sk), sll->sll_ifindex);
+			if (dev) {
+				aux.tp_vlan_tci = vlan_get_tci(skb, dev);
+				aux.tp_vlan_tpid = ntohs(skb->protocol);
+				aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+			} else {
+				aux.tp_vlan_tci = 0;
+				aux.tp_vlan_tpid = 0;
+			}
+			rcu_read_unlock();
 		} else {
 			aux.tp_vlan_tci = 0;
 			aux.tp_vlan_tpid = 0;
diff --git a/net/smc/smc_core.c b/net/smc/smc_core.c
index 64b6dd439938..10d79cb55528 100644
--- a/net/smc/smc_core.c
+++ b/net/smc/smc_core.c
@@ -1959,7 +1959,6 @@ int smc_conn_create(struct smc_sock *smc, struct smc_init_info *ini)
  */
 static u8 smc_compress_bufsize(int size, bool is_smcd, bool is_rmb)
 {
-	const unsigned int max_scat = SG_MAX_SINGLE_ALLOC * PAGE_SIZE;
 	u8 compressed;
 
 	if (size <= SMC_BUF_MIN_SIZE)
@@ -1969,9 +1968,11 @@ static u8 smc_compress_bufsize(int size, bool is_smcd, bool is_rmb)
 	compressed = min_t(u8, ilog2(size) + 1,
 			   is_smcd ? SMCD_DMBE_SIZES : SMCR_RMBE_SIZES);
 
+#ifdef CONFIG_ARCH_NO_SG_CHAIN
 	if (!is_smcd && is_rmb)
 		/* RMBs are backed by & limited to max size of scatterlists */
-		compressed = min_t(u8, compressed, ilog2(max_scat >> 14));
+		compressed = min_t(u8, compressed, ilog2((SG_MAX_SINGLE_ALLOC * PAGE_SIZE) >> 14));
+#endif
 
 	return compressed;
 }
diff --git a/net/sunrpc/auth_gss/gss_krb5_keys.c b/net/sunrpc/auth_gss/gss_krb5_keys.c
index 726c076950c0..fc4639687c0f 100644
--- a/net/sunrpc/auth_gss/gss_krb5_keys.c
+++ b/net/sunrpc/auth_gss/gss_krb5_keys.c
@@ -161,7 +161,7 @@ u32 krb5_derive_key(const struct gss_krb5_enctype *gk5e,
 	if (IS_ERR(cipher))
 		goto err_return;
 	if (crypto_sync_skcipher_setkey(cipher, inkey->data, inkey->len))
-		goto err_return;
+		goto err_free_cipher;
 
 	/* allocate and set up buffers */
 
diff --git a/net/sunrpc/clnt.c b/net/sunrpc/clnt.c
index 1dbad41c4614..b6529a9d37d3 100644
--- a/net/sunrpc/clnt.c
+++ b/net/sunrpc/clnt.c
@@ -2296,12 +2296,13 @@ call_transmit_status(struct rpc_task *task)
 		task->tk_action = call_transmit;
 		task->tk_status = 0;
 		break;
-	case -ECONNREFUSED:
 	case -EHOSTDOWN:
 	case -ENETDOWN:
 	case -EHOSTUNREACH:
 	case -ENETUNREACH:
 	case -EPERM:
+		break;
+	case -ECONNREFUSED:
 		if (RPC_IS_SOFTCONN(task)) {
 			if (!task->tk_msg.rpc_proc->p_proc)
 				trace_xprt_ping(task->tk_xprt,
diff --git a/net/sunrpc/xprtrdma/frwr_ops.c b/net/sunrpc/xprtrdma/frwr_ops.c
index ffbf99894970..47f33bb7bff8 100644
--- a/net/sunrpc/xprtrdma/frwr_ops.c
+++ b/net/sunrpc/xprtrdma/frwr_ops.c
@@ -92,7 +92,8 @@ static void frwr_mr_put(struct rpcrdma_mr *mr)
 	rpcrdma_mr_push(mr, &mr->mr_req->rl_free_mrs);
 }
 
-/* frwr_reset - Place MRs back on the free list
+/**
+ * frwr_reset - Place MRs back on @req's free list
  * @req: request to reset
  *
  * Used after a failed marshal. For FRWR, this means the MRs
diff --git a/net/sunrpc/xprtrdma/verbs.c b/net/sunrpc/xprtrdma/verbs.c
index 4f71627ba39c..cb909329a503 100644
--- a/net/sunrpc/xprtrdma/verbs.c
+++ b/net/sunrpc/xprtrdma/verbs.c
@@ -897,6 +897,8 @@ static int rpcrdma_reqs_setup(struct rpcrdma_xprt *r_xprt)
 
 static void rpcrdma_req_reset(struct rpcrdma_req *req)
 {
+	struct rpcrdma_mr *mr;
+
 	/* Credits are valid for only one connection */
 	req->rl_slot.rq_cong = 0;
 
@@ -906,7 +908,19 @@ static void rpcrdma_req_reset(struct rpcrdma_req *req)
 	rpcrdma_regbuf_dma_unmap(req->rl_sendbuf);
 	rpcrdma_regbuf_dma_unmap(req->rl_recvbuf);
 
-	frwr_reset(req);
+	/* The verbs consumer can't know the state of an MR on the
+	 * req->rl_registered list unless a successful completion
+	 * has occurred, so they cannot be re-used.
+	 */
+	while ((mr = rpcrdma_mr_pop(&req->rl_registered))) {
+		struct rpcrdma_buffer *buf = &mr->mr_xprt->rx_buf;
+
+		spin_lock(&buf->rb_lock);
+		list_del(&mr->mr_all);
+		spin_unlock(&buf->rb_lock);
+
+		frwr_mr_release(mr);
+	}
 }
 
 /* ASSUMPTION: the rb_allreqs list is stable for the duration,
diff --git a/net/tipc/udp_media.c b/net/tipc/udp_media.c
index 0a85244fd618..73e461dc12d7 100644
--- a/net/tipc/udp_media.c
+++ b/net/tipc/udp_media.c
@@ -135,8 +135,11 @@ static int tipc_udp_addr2str(struct tipc_media_addr *a, char *buf, int size)
 		snprintf(buf, size, "%pI4:%u", &ua->ipv4, ntohs(ua->port));
 	else if (ntohs(ua->proto) == ETH_P_IPV6)
 		snprintf(buf, size, "%pI6:%u", &ua->ipv6, ntohs(ua->port));
-	else
+	else {
 		pr_err("Invalid UDP media address\n");
+		return 1;
+	}
+
 	return 0;
 }
 
diff --git a/net/unix/af_unix.c b/net/unix/af_unix.c
index 3905cdcaa518..db71f35b67b8 100644
--- a/net/unix/af_unix.c
+++ b/net/unix/af_unix.c
@@ -2710,10 +2710,49 @@ static struct sk_buff *manage_oob(struct sk_buff *skb, struct sock *sk,
 
 static int unix_stream_read_skb(struct sock *sk, skb_read_actor_t recv_actor)
 {
+	struct unix_sock *u = unix_sk(sk);
+	struct sk_buff *skb;
+	int err;
+
 	if (unlikely(READ_ONCE(sk->sk_state) != TCP_ESTABLISHED))
 		return -ENOTCONN;
 
-	return unix_read_skb(sk, recv_actor);
+	mutex_lock(&u->iolock);
+	skb = skb_recv_datagram(sk, MSG_DONTWAIT, &err);
+	mutex_unlock(&u->iolock);
+	if (!skb)
+		return err;
+
+#if IS_ENABLED(CONFIG_AF_UNIX_OOB)
+	if (unlikely(skb == READ_ONCE(u->oob_skb))) {
+		bool drop = false;
+
+		unix_state_lock(sk);
+
+		if (sock_flag(sk, SOCK_DEAD)) {
+			unix_state_unlock(sk);
+			kfree_skb(skb);
+			return -ECONNRESET;
+		}
+
+		spin_lock(&sk->sk_receive_queue.lock);
+		if (likely(skb == u->oob_skb)) {
+			WRITE_ONCE(u->oob_skb, NULL);
+			drop = true;
+		}
+		spin_unlock(&sk->sk_receive_queue.lock);
+
+		unix_state_unlock(sk);
+
+		if (drop) {
+			WARN_ON_ONCE(skb_unref(skb));
+			kfree_skb(skb);
+			return -EAGAIN;
+		}
+	}
+#endif
+
+	return recv_actor(sk, skb);
 }
 
 static int unix_stream_read_generic(struct unix_stream_read_state *state,
diff --git a/net/unix/unix_bpf.c b/net/unix/unix_bpf.c
index bd84785bf8d6..bca2d86ba97d 100644
--- a/net/unix/unix_bpf.c
+++ b/net/unix/unix_bpf.c
@@ -54,6 +54,9 @@ static int unix_bpf_recvmsg(struct sock *sk, struct msghdr *msg,
 	struct sk_psock *psock;
 	int copied;
 
+	if (flags & MSG_OOB)
+		return -EOPNOTSUPP;
+
 	if (!len)
 		return 0;
 
diff --git a/net/wireless/util.c b/net/wireless/util.c
index 73b3648e1b4c..1665320d2214 100644
--- a/net/wireless/util.c
+++ b/net/wireless/util.c
@@ -1373,7 +1373,7 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate)
 		  5120, /*  0.833333... */
 	};
 	u32 rates_160M[3] = { 960777777, 907400000, 816666666 };
-	u32 rates_969[3] =  { 480388888, 453700000, 408333333 };
+	u32 rates_996[3] =  { 480388888, 453700000, 408333333 };
 	u32 rates_484[3] =  { 229411111, 216666666, 195000000 };
 	u32 rates_242[3] =  { 114711111, 108333333,  97500000 };
 	u32 rates_106[3] =  {  40000000,  37777777,  34000000 };
@@ -1393,12 +1393,14 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate)
 	if (WARN_ON_ONCE(rate->nss < 1 || rate->nss > 8))
 		return 0;
 
-	if (rate->bw == RATE_INFO_BW_160)
+	if (rate->bw == RATE_INFO_BW_160 ||
+	    (rate->bw == RATE_INFO_BW_HE_RU &&
+	     rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_2x996))
 		result = rates_160M[rate->he_gi];
 	else if (rate->bw == RATE_INFO_BW_80 ||
 		 (rate->bw == RATE_INFO_BW_HE_RU &&
 		  rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_996))
-		result = rates_969[rate->he_gi];
+		result = rates_996[rate->he_gi];
 	else if (rate->bw == RATE_INFO_BW_40 ||
 		 (rate->bw == RATE_INFO_BW_HE_RU &&
 		  rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_484))
diff --git a/scripts/Makefile.lib b/scripts/Makefile.lib
index 3aa384cec76b..d236e5658f9b 100644
--- a/scripts/Makefile.lib
+++ b/scripts/Makefile.lib
@@ -382,8 +382,12 @@ cmd_dtc = $(HOSTCC) -E $(dtc_cpp_flags) -x assembler-with-cpp -o $(dtc-tmp) $< ;
 		-d $(depfile).dtc.tmp $(dtc-tmp) ; \
 	cat $(depfile).pre.tmp $(depfile).dtc.tmp > $(depfile)
 
+# NOTE:
+# Do not replace $(filter %.dtb %.dtbo, $^) with $(real-prereqs). When a single
+# DTB is turned into a multi-blob DTB, $^ will contain header file dependencies
+# recorded in the .*.cmd file.
 quiet_cmd_fdtoverlay = DTOVL   $@
-      cmd_fdtoverlay = $(objtree)/scripts/dtc/fdtoverlay -o $@ -i $(real-prereqs)
+      cmd_fdtoverlay = $(objtree)/scripts/dtc/fdtoverlay -o $@ -i $(filter %.dtb %.dtbo, $^)
 
 $(multi-dtb-y): FORCE
 	$(call if_changed,fdtoverlay)
diff --git a/scripts/gcc-x86_32-has-stack-protector.sh b/scripts/gcc-x86_32-has-stack-protector.sh
index 825c75c5b715..9459ca4f0f11 100755
--- a/scripts/gcc-x86_32-has-stack-protector.sh
+++ b/scripts/gcc-x86_32-has-stack-protector.sh
@@ -5,4 +5,4 @@
 # -mstack-protector-guard-reg, added by
 # https://gcc.gnu.org/bugzilla/show_bug.cgi?id=81708
 
-echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m32 -O0 -fstack-protector -mstack-protector-guard-reg=fs -mstack-protector-guard-symbol=__stack_chk_guard - -o - 2> /dev/null | grep -q "%fs"
+echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m32 -O0 -fstack-protector -mstack-protector-guard-reg=fs -mstack-protector-guard-symbol=__stack_chk_guard - -o - 2> /dev/null | grep -q "%fs"
diff --git a/scripts/gcc-x86_64-has-stack-protector.sh b/scripts/gcc-x86_64-has-stack-protector.sh
index 75e4e22b986a..f680bb01aeeb 100755
--- a/scripts/gcc-x86_64-has-stack-protector.sh
+++ b/scripts/gcc-x86_64-has-stack-protector.sh
@@ -1,4 +1,4 @@
 #!/bin/sh
 # SPDX-License-Identifier: GPL-2.0
 
-echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs"
+echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs"
diff --git a/security/apparmor/lsm.c b/security/apparmor/lsm.c
index 1e2f40db15c5..97389b9c4129 100644
--- a/security/apparmor/lsm.c
+++ b/security/apparmor/lsm.c
@@ -1081,6 +1081,13 @@ static int apparmor_socket_sock_rcv_skb(struct sock *sk, struct sk_buff *skb)
 	if (!skb->secmark)
 		return 0;
 
+	/*
+	 * If reach here before socket_post_create hook is called, in which
+	 * case label is null, drop the packet.
+	 */
+	if (!ctx->label)
+		return -EACCES;
+
 	return apparmor_secmark_check(ctx->label, OP_RECVMSG, AA_MAY_RECEIVE,
 				      skb->secmark, sk);
 }
diff --git a/security/apparmor/policy.c b/security/apparmor/policy.c
index c7b84fb56841..4ee5a450d118 100644
--- a/security/apparmor/policy.c
+++ b/security/apparmor/policy.c
@@ -187,7 +187,7 @@ static void aa_free_data(void *ptr, void *arg)
 {
 	struct aa_data *data = ptr;
 
-	kfree_sensitive(data->data);
+	kvfree_sensitive(data->data, data->size);
 	kfree_sensitive(data->key);
 	kfree_sensitive(data);
 }
diff --git a/security/apparmor/policy_unpack.c b/security/apparmor/policy_unpack.c
index 633e778ec369..17601235ff98 100644
--- a/security/apparmor/policy_unpack.c
+++ b/security/apparmor/policy_unpack.c
@@ -898,6 +898,7 @@ static struct aa_profile *unpack_profile(struct aa_ext *e, char **ns_name)
 
 			if (rhashtable_insert_fast(profile->data, &data->head,
 						   profile->data->p)) {
+				kvfree_sensitive(data->data, data->size);
 				kfree_sensitive(data->key);
 				kfree_sensitive(data);
 				info = "failed to insert data to table";
diff --git a/security/keys/keyctl.c b/security/keys/keyctl.c
index 19be69fa4d05..aa1dc43b16dd 100644
--- a/security/keys/keyctl.c
+++ b/security/keys/keyctl.c
@@ -1694,7 +1694,7 @@ long keyctl_session_to_parent(void)
 		goto unlock;
 
 	/* cancel an already pending keyring replacement */
-	oldwork = task_work_cancel(parent, key_change_session_keyring);
+	oldwork = task_work_cancel_func(parent, key_change_session_keyring);
 
 	/* the replacement session keyring is applied just prior to userspace
 	 * restarting */
diff --git a/security/landlock/cred.c b/security/landlock/cred.c
index ec6c37f04a19..e215607fd46c 100644
--- a/security/landlock/cred.c
+++ b/security/landlock/cred.c
@@ -14,8 +14,8 @@
 #include "ruleset.h"
 #include "setup.h"
 
-static int hook_cred_prepare(struct cred *const new,
-			     const struct cred *const old, const gfp_t gfp)
+static void hook_cred_transfer(struct cred *const new,
+			       const struct cred *const old)
 {
 	struct landlock_ruleset *const old_dom = landlock_cred(old)->domain;
 
@@ -23,6 +23,12 @@ static int hook_cred_prepare(struct cred *const new,
 		landlock_get_ruleset(old_dom);
 		landlock_cred(new)->domain = old_dom;
 	}
+}
+
+static int hook_cred_prepare(struct cred *const new,
+			     const struct cred *const old, const gfp_t gfp)
+{
+	hook_cred_transfer(new, old);
 	return 0;
 }
 
@@ -36,6 +42,7 @@ static void hook_cred_free(struct cred *const cred)
 
 static struct security_hook_list landlock_hooks[] __lsm_ro_after_init = {
 	LSM_HOOK_INIT(cred_prepare, hook_cred_prepare),
+	LSM_HOOK_INIT(cred_transfer, hook_cred_transfer),
 	LSM_HOOK_INIT(cred_free, hook_cred_free),
 };
 
diff --git a/sound/soc/amd/acp-es8336.c b/sound/soc/amd/acp-es8336.c
index 89499542c803..f91a3c13ac23 100644
--- a/sound/soc/amd/acp-es8336.c
+++ b/sound/soc/amd/acp-es8336.c
@@ -203,8 +203,10 @@ static int st_es8336_late_probe(struct snd_soc_card *card)
 
 	codec_dev = acpi_get_first_physical_node(adev);
 	acpi_dev_put(adev);
-	if (!codec_dev)
+	if (!codec_dev) {
 		dev_err(card->dev, "can not find codec dev\n");
+		return -ENODEV;
+	}
 
 	ret = devm_acpi_dev_add_driver_gpios(codec_dev, acpi_es8336_gpios);
 	if (ret)
diff --git a/sound/soc/amd/yc/acp6x-mach.c b/sound/soc/amd/yc/acp6x-mach.c
index 8e3eccb4faa7..c438fccac8e9 100644
--- a/sound/soc/amd/yc/acp6x-mach.c
+++ b/sound/soc/amd/yc/acp6x-mach.c
@@ -220,6 +220,13 @@ static const struct dmi_system_id yc_acp_quirk_table[] = {
 			DMI_MATCH(DMI_PRODUCT_NAME, "21J6"),
 		}
 	},
+	{
+		.driver_data = &acp6x_card,
+		.matches = {
+			DMI_MATCH(DMI_BOARD_VENDOR, "LENOVO"),
+			DMI_MATCH(DMI_PRODUCT_NAME, "21M5"),
+		}
+	},
 	{
 		.driver_data = &acp6x_card,
 		.matches = {
diff --git a/sound/soc/codecs/max98088.c b/sound/soc/codecs/max98088.c
index 405ec16be2b6..eaabfe2cfd70 100644
--- a/sound/soc/codecs/max98088.c
+++ b/sound/soc/codecs/max98088.c
@@ -1318,6 +1318,7 @@ static int max98088_set_bias_level(struct snd_soc_component *component,
                                   enum snd_soc_bias_level level)
 {
 	struct max98088_priv *max98088 = snd_soc_component_get_drvdata(component);
+	int ret;
 
 	switch (level) {
 	case SND_SOC_BIAS_ON:
@@ -1333,10 +1334,13 @@ static int max98088_set_bias_level(struct snd_soc_component *component,
 		 */
 		if (!IS_ERR(max98088->mclk)) {
 			if (snd_soc_component_get_bias_level(component) ==
-			    SND_SOC_BIAS_ON)
+			    SND_SOC_BIAS_ON) {
 				clk_disable_unprepare(max98088->mclk);
-			else
-				clk_prepare_enable(max98088->mclk);
+			} else {
+				ret = clk_prepare_enable(max98088->mclk);
+				if (ret)
+					return ret;
+			}
 		}
 		break;
 
diff --git a/sound/soc/intel/common/soc-intel-quirks.h b/sound/soc/intel/common/soc-intel-quirks.h
index de4e550c5b34..42bd51456b94 100644
--- a/sound/soc/intel/common/soc-intel-quirks.h
+++ b/sound/soc/intel/common/soc-intel-quirks.h
@@ -11,7 +11,7 @@
 
 #include <linux/platform_data/x86/soc.h>
 
-#if IS_ENABLED(CONFIG_X86)
+#if IS_REACHABLE(CONFIG_IOSF_MBI)
 
 #include <linux/dmi.h>
 #include <asm/iosf_mbi.h>
diff --git a/sound/soc/qcom/lpass-cpu.c b/sound/soc/qcom/lpass-cpu.c
index dbdaaa85ce48..4387cca893c5 100644
--- a/sound/soc/qcom/lpass-cpu.c
+++ b/sound/soc/qcom/lpass-cpu.c
@@ -1160,9 +1160,13 @@ int asoc_qcom_lpass_cpu_platform_probe(struct platform_device *pdev)
 		}
 
 		res = platform_get_resource_byname(pdev, IORESOURCE_MEM, "lpass-rxtx-cdc-dma-lpm");
+		if (!res)
+			return -EINVAL;
 		drvdata->rxtx_cdc_dma_lpm_buf = res->start;
 
 		res = platform_get_resource_byname(pdev, IORESOURCE_MEM, "lpass-va-cdc-dma-lpm");
+		if (!res)
+			return -EINVAL;
 		drvdata->va_cdc_dma_lpm_buf = res->start;
 	}
 
diff --git a/sound/soc/sof/imx/imx8m.c b/sound/soc/sof/imx/imx8m.c
index 1243f8a6141e..186ba4bbb5b2 100644
--- a/sound/soc/sof/imx/imx8m.c
+++ b/sound/soc/sof/imx/imx8m.c
@@ -243,7 +243,7 @@ static int imx8m_probe(struct snd_sof_dev *sdev)
 	/* set default mailbox offset for FW ready message */
 	sdev->dsp_box.offset = MBOX_OFFSET;
 
-	priv->regmap = syscon_regmap_lookup_by_compatible("fsl,dsp-ctrl");
+	priv->regmap = syscon_regmap_lookup_by_phandle(np, "fsl,dsp-ctrl");
 	if (IS_ERR(priv->regmap)) {
 		dev_err(sdev->dev, "cannot find dsp-ctrl registers");
 		ret = PTR_ERR(priv->regmap);
diff --git a/sound/usb/mixer.c b/sound/usb/mixer.c
index 783a2493707e..5699a62d1767 100644
--- a/sound/usb/mixer.c
+++ b/sound/usb/mixer.c
@@ -1211,6 +1211,13 @@ static void volume_control_quirks(struct usb_mixer_elem_info *cval,
 			cval->res = 16;
 		}
 		break;
+	case USB_ID(0x1bcf, 0x2281): /* HD Webcam */
+		if (!strcmp(kctl->id.name, "Mic Capture Volume")) {
+			usb_audio_info(chip,
+				"set resolution quirk: cval->res = 16\n");
+			cval->res = 16;
+		}
+		break;
 	}
 }
 
diff --git a/sound/usb/quirks.c b/sound/usb/quirks.c
index b8a474a2e4d5..733a25275fe9 100644
--- a/sound/usb/quirks.c
+++ b/sound/usb/quirks.c
@@ -2083,6 +2083,8 @@ static const struct usb_audio_quirk_flags_table quirk_flags_table[] = {
 		   QUIRK_FLAG_CTL_MSG_DELAY_1M),
 	DEVICE_FLG(0x0b0e, 0x0349, /* Jabra 550a */
 		   QUIRK_FLAG_CTL_MSG_DELAY_1M),
+	DEVICE_FLG(0x0c45, 0x6340, /* Sonix HD USB Camera */
+		   QUIRK_FLAG_GET_SAMPLE_RATE),
 	DEVICE_FLG(0x0ecb, 0x205c, /* JBL Quantum610 Wireless */
 		   QUIRK_FLAG_FIXED_RATE),
 	DEVICE_FLG(0x0ecb, 0x2069, /* JBL Quantum810 Wireless */
@@ -2125,6 +2127,8 @@ static const struct usb_audio_quirk_flags_table quirk_flags_table[] = {
 		   QUIRK_FLAG_GET_SAMPLE_RATE),
 	DEVICE_FLG(0x19f7, 0x0035, /* RODE NT-USB+ */
 		   QUIRK_FLAG_GET_SAMPLE_RATE),
+	DEVICE_FLG(0x1bcf, 0x2281, /* HD Webcam */
+		   QUIRK_FLAG_GET_SAMPLE_RATE),
 	DEVICE_FLG(0x1bcf, 0x2283, /* NexiGo N930AF FHD Webcam */
 		   QUIRK_FLAG_GET_SAMPLE_RATE),
 	DEVICE_FLG(0x2040, 0x7200, /* Hauppauge HVR-950Q */
diff --git a/tools/bpf/bpftool/common.c b/tools/bpf/bpftool/common.c
index e7a11cff7245..db02b000fbeb 100644
--- a/tools/bpf/bpftool/common.c
+++ b/tools/bpf/bpftool/common.c
@@ -333,7 +333,7 @@ void get_prog_full_name(const struct bpf_prog_info *prog_info, int prog_fd,
 {
 	const char *prog_name = prog_info->name;
 	const struct btf_type *func_type;
-	const struct bpf_func_info finfo = {};
+	struct bpf_func_info finfo = {};
 	struct bpf_prog_info info = {};
 	__u32 info_len = sizeof(info);
 	struct btf *prog_btf = NULL;
diff --git a/tools/bpf/bpftool/prog.c b/tools/bpf/bpftool/prog.c
index 7e0b846e17ee..21817eb51039 100644
--- a/tools/bpf/bpftool/prog.c
+++ b/tools/bpf/bpftool/prog.c
@@ -1707,6 +1707,10 @@ static int load_with_options(int argc, char **argv, bool first_prog_only)
 	}
 
 	if (pinmaps) {
+		err = create_and_mount_bpffs_dir(pinmaps);
+		if (err)
+			goto err_unpin;
+
 		err = bpf_object__pin_maps(obj, pinmaps);
 		if (err) {
 			p_err("failed to pin all maps");
diff --git a/tools/bpf/resolve_btfids/main.c b/tools/bpf/resolve_btfids/main.c
index 82bffa7cf865..7775040182e3 100644
--- a/tools/bpf/resolve_btfids/main.c
+++ b/tools/bpf/resolve_btfids/main.c
@@ -696,7 +696,7 @@ static int sets_patch(struct object *obj)
 			 * Make sure id is at the beginning of the pairs
 			 * struct, otherwise the below qsort would not work.
 			 */
-			BUILD_BUG_ON(set8->pairs != &set8->pairs[0].id);
+			BUILD_BUG_ON((u32 *)set8->pairs != &set8->pairs[0].id);
 			qsort(set8->pairs, set8->cnt, sizeof(set8->pairs[0]), cmp_id);
 
 			/*
diff --git a/tools/lib/bpf/btf_dump.c b/tools/lib/bpf/btf_dump.c
index 713264899250..cfdee656789b 100644
--- a/tools/lib/bpf/btf_dump.c
+++ b/tools/lib/bpf/btf_dump.c
@@ -1521,10 +1521,12 @@ static void btf_dump_emit_type_chain(struct btf_dump *d,
 			 * Clang for BPF target generates func_proto with no
 			 * args as a func_proto with a single void arg (e.g.,
 			 * `int (*f)(void)` vs just `int (*f)()`). We are
-			 * going to pretend there are no args for such case.
+			 * going to emit valid empty args (void) syntax for
+			 * such case. Similarly and conveniently, valid
+			 * no args case can be special-cased here as well.
 			 */
-			if (vlen == 1 && p->type == 0) {
-				btf_dump_printf(d, ")");
+			if (vlen == 0 || (vlen == 1 && p->type == 0)) {
+				btf_dump_printf(d, "void)");
 				return;
 			}
 
diff --git a/tools/lib/bpf/linker.c b/tools/lib/bpf/linker.c
index 4ac02c28e152..8a7cb830bff1 100644
--- a/tools/lib/bpf/linker.c
+++ b/tools/lib/bpf/linker.c
@@ -2189,10 +2189,17 @@ static int linker_fixup_btf(struct src_obj *obj)
 		vi = btf_var_secinfos(t);
 		for (j = 0, m = btf_vlen(t); j < m; j++, vi++) {
 			const struct btf_type *vt = btf__type_by_id(obj->btf, vi->type);
-			const char *var_name = btf__str_by_offset(obj->btf, vt->name_off);
-			int var_linkage = btf_var(vt)->linkage;
+			const char *var_name;
+			int var_linkage;
 			Elf64_Sym *sym;
 
+			/* could be a variable or function */
+			if (!btf_is_var(vt))
+				continue;
+
+			var_name = btf__str_by_offset(obj->btf, vt->name_off);
+			var_linkage = btf_var(vt)->linkage;
+
 			/* no need to patch up static or extern vars */
 			if (var_linkage != BTF_VAR_GLOBAL_ALLOCATED)
 				continue;
diff --git a/tools/memory-model/lock.cat b/tools/memory-model/lock.cat
index 6b52f365d73a..9f3b5b38221b 100644
--- a/tools/memory-model/lock.cat
+++ b/tools/memory-model/lock.cat
@@ -102,19 +102,19 @@ let rf-lf = rfe-lf | rfi-lf
  * within one of the lock's critical sections returns False.
  *)
 
-(* rfi for RU events: an RU may read from the last po-previous UL *)
-let rfi-ru = ([UL] ; po-loc ; [RU]) \ ([UL] ; po-loc ; [LKW] ; po-loc)
-
-(* rfe for RU events: an RU may read from an external UL or the initial write *)
-let all-possible-rfe-ru =
-	let possible-rfe-ru r =
+(*
+ * rf for RU events: an RU may read from an external UL or the initial write,
+ * or from the last po-previous UL
+ *)
+let all-possible-rf-ru =
+	let possible-rf-ru r =
 		let pair-to-relation p = p ++ 0
-		in map pair-to-relation (((UL | IW) * {r}) & loc & ext)
-	in map possible-rfe-ru RU
+		in map pair-to-relation ((((UL | IW) * {r}) & loc & ext) |
+			(((UL * {r}) & po-loc) \ ([UL] ; po-loc ; [LKW] ; po-loc)))
+	in map possible-rf-ru RU
 
 (* Generate all rf relations for RU events *)
-with rfe-ru from cross(all-possible-rfe-ru)
-let rf-ru = rfe-ru | rfi-ru
+with rf-ru from cross(all-possible-rf-ru)
 
 (* Final rf relation *)
 let rf = rf | rf-lf | rf-ru
diff --git a/tools/perf/arch/x86/util/intel-pt.c b/tools/perf/arch/x86/util/intel-pt.c
index af102f471e9f..9daec588103b 100644
--- a/tools/perf/arch/x86/util/intel-pt.c
+++ b/tools/perf/arch/x86/util/intel-pt.c
@@ -32,6 +32,7 @@
 #include "../../../util/tsc.h"
 #include <internal/lib.h> // page_size
 #include "../../../util/intel-pt.h"
+#include <api/fs/fs.h>
 
 #define KiB(x) ((x) * 1024)
 #define MiB(x) ((x) * 1024 * 1024)
@@ -440,6 +441,16 @@ static int intel_pt_track_switches(struct evlist *evlist)
 	return 0;
 }
 
+static bool intel_pt_exclude_guest(void)
+{
+	int pt_mode;
+
+	if (sysfs__read_int("module/kvm_intel/parameters/pt_mode", &pt_mode))
+		pt_mode = 0;
+
+	return pt_mode == 1;
+}
+
 static void intel_pt_valid_str(char *str, size_t len, u64 valid)
 {
 	unsigned int val, last = 0, state = 1;
@@ -643,6 +654,7 @@ static int intel_pt_recording_options(struct auxtrace_record *itr,
 			}
 			evsel->core.attr.freq = 0;
 			evsel->core.attr.sample_period = 1;
+			evsel->core.attr.exclude_guest = intel_pt_exclude_guest();
 			evsel->no_aux_samples = true;
 			evsel->needs_auxtrace_mmap = true;
 			intel_pt_evsel = evsel;
@@ -780,7 +792,8 @@ static int intel_pt_recording_options(struct auxtrace_record *itr,
 	}
 
 	if (!opts->auxtrace_snapshot_mode && !opts->auxtrace_sample_mode) {
-		u32 aux_watermark = opts->auxtrace_mmap_pages * page_size / 4;
+		size_t aw = opts->auxtrace_mmap_pages * (size_t)page_size / 4;
+		u32 aux_watermark = aw > UINT_MAX ? UINT_MAX : aw;
 
 		intel_pt_evsel->core.attr.aux_watermark = aux_watermark;
 	}
diff --git a/tools/perf/tests/shell/test_arm_callgraph_fp.sh b/tools/perf/tests/shell/test_arm_callgraph_fp.sh
index ec108d45d3c6..60cd35c73e47 100755
--- a/tools/perf/tests/shell/test_arm_callgraph_fp.sh
+++ b/tools/perf/tests/shell/test_arm_callgraph_fp.sh
@@ -4,65 +4,31 @@
 
 lscpu | grep -q "aarch64" || exit 2
 
-if ! [ -x "$(command -v cc)" ]; then
-	echo "failed: no compiler, install gcc"
-	exit 2
-fi
-
 PERF_DATA=$(mktemp /tmp/__perf_test.perf.data.XXXXX)
-TEST_PROGRAM_SOURCE=$(mktemp /tmp/test_program.XXXXX.c)
-TEST_PROGRAM=$(mktemp /tmp/test_program.XXXXX)
+TEST_PROGRAM="perf test -w leafloop"
 
 cleanup_files()
 {
-	rm -f $PERF_DATA
-	rm -f $TEST_PROGRAM_SOURCE
-	rm -f $TEST_PROGRAM
-}
-
-trap cleanup_files exit term int
-
-cat << EOF > $TEST_PROGRAM_SOURCE
-int a = 0;
-void leaf(void) {
-  for (;;)
-    a += a;
+	rm -f "$PERF_DATA"
 }
-void parent(void) {
-  leaf();
-}
-int main(void) {
-  parent();
-  return 0;
-}
-EOF
-
-echo " + Compiling test program ($TEST_PROGRAM)..."
-
-CFLAGS="-g -O0 -fno-inline -fno-omit-frame-pointer"
-cc $CFLAGS $TEST_PROGRAM_SOURCE -o $TEST_PROGRAM || exit 1
 
-# Add a 1 second delay to skip samples that are not in the leaf() function
-perf record -o $PERF_DATA --call-graph fp -e cycles//u -D 1000 --user-callchains -- $TEST_PROGRAM 2> /dev/null &
-PID=$!
+trap cleanup_files EXIT TERM INT
 
-echo " + Recording (PID=$PID)..."
-sleep 2
-echo " + Stopping perf-record..."
+# shellcheck disable=SC2086
+perf record -o "$PERF_DATA" --call-graph fp -e cycles//u --user-callchains -- $TEST_PROGRAM
 
-kill $PID
-wait $PID
+# Try opening the file so any immediate errors are visible in the log
+perf script -i "$PERF_DATA" -F comm,ip,sym | head -n4
 
-# expected perf-script output:
+# expected perf-script output if 'leaf' has been inserted correctly:
 #
-# program
+# perf
 # 	728 leaf
 # 	753 parent
-# 	76c main
-# ...
+# 	76c leafloop
+# ... remaining stack to main() ...
 
-perf script -i $PERF_DATA -F comm,ip,sym | head -n4
-perf script -i $PERF_DATA -F comm,ip,sym | head -n4 | \
-	awk '{ if ($2 != "") sym[i++] = $2 } END { if (sym[0] != "leaf" ||
-						       sym[1] != "parent" ||
-						       sym[2] != "main") exit 1 }'
+# Each frame is separated by a tab, some spaces and an address
+SEP="[[:space:]]+ [[:xdigit:]]+"
+perf script -i "$PERF_DATA" -F comm,ip,sym | tr '\n' ' ' | \
+	grep -E -q "perf $SEP leaf $SEP parent $SEP leafloop"
diff --git a/tools/perf/tests/workloads/leafloop.c b/tools/perf/tests/workloads/leafloop.c
index 1bf5cc97649b..f7561767e32c 100644
--- a/tools/perf/tests/workloads/leafloop.c
+++ b/tools/perf/tests/workloads/leafloop.c
@@ -1,6 +1,8 @@
 /* SPDX-License-Identifier: GPL-2.0 */
+#include <signal.h>
 #include <stdlib.h>
 #include <linux/compiler.h>
+#include <unistd.h>
 #include "../tests.h"
 
 /* We want to check these symbols in perf script */
@@ -8,10 +10,16 @@ noinline void leaf(volatile int b);
 noinline void parent(volatile int b);
 
 static volatile int a;
+static volatile sig_atomic_t done;
+
+static void sighandler(int sig __maybe_unused)
+{
+	done = 1;
+}
 
 noinline void leaf(volatile int b)
 {
-	for (;;)
+	while (!done)
 		a += b;
 }
 
@@ -22,12 +30,16 @@ noinline void parent(volatile int b)
 
 static int leafloop(int argc, const char **argv)
 {
-	int c = 1;
+	int sec = 1;
 
 	if (argc > 0)
-		c = atoi(argv[0]);
+		sec = atoi(argv[0]);
+
+	signal(SIGINT, sighandler);
+	signal(SIGALRM, sighandler);
+	alarm(sec);
 
-	parent(c);
+	parent(sec);
 	return 0;
 }
 
diff --git a/tools/perf/util/sort.c b/tools/perf/util/sort.c
index 6882b1714499..1821c81892df 100644
--- a/tools/perf/util/sort.c
+++ b/tools/perf/util/sort.c
@@ -275,7 +275,7 @@ sort__sym_cmp(struct hist_entry *left, struct hist_entry *right)
 	 * comparing symbol address alone is not enough since it's a
 	 * relative address within a dso.
 	 */
-	if (!hists__has(left->hists, dso) || hists__has(right->hists, dso)) {
+	if (!hists__has(left->hists, dso)) {
 		ret = sort__dso_cmp(left, right);
 		if (ret != 0)
 			return ret;
diff --git a/tools/testing/selftests/bpf/prog_tests/sk_lookup.c b/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
index 597d0467a926..de2466547efe 100644
--- a/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
+++ b/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
@@ -994,7 +994,7 @@ static void drop_on_reuseport(const struct test *t)
 
 	err = update_lookup_map(t->sock_map, SERVER_A, server1);
 	if (err)
-		goto detach;
+		goto close_srv1;
 
 	/* second server on destination address we should never reach */
 	server2 = make_server(t->sotype, t->connect_to.ip, t->connect_to.port,
diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
index 39973ea1ce43..89366913a251 100644
--- a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
+++ b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
@@ -217,7 +217,7 @@ static void test_xdp_adjust_frags_tail_grow(void)
 
 	prog = bpf_object__next_program(obj, NULL);
 	if (bpf_object__load(obj))
-		return;
+		goto out;
 
 	prog_fd = bpf_program__fd(prog);
 
diff --git a/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c b/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
index ba97165bdb28..a657651eba52 100644
--- a/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
+++ b/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
@@ -14,9 +14,9 @@ typedef int *ptr_arr_t[6];
 
 typedef int *ptr_multiarr_t[7][8][9][10];
 
-typedef int * (*fn_ptr_arr_t[11])();
+typedef int * (*fn_ptr_arr_t[11])(void);
 
-typedef int * (*fn_ptr_multiarr_t[12][13])();
+typedef int * (*fn_ptr_multiarr_t[12][13])(void);
 
 struct root_struct {
 	arr_t _1;
diff --git a/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c b/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
index 4ee4748133fe..9355e323d40c 100644
--- a/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
+++ b/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
@@ -67,7 +67,7 @@ typedef void (*printf_fn_t)(const char *, ...);
  *   `int -> char *` function and returns pointer to a char. Equivalent:
  *   typedef char * (*fn_input_t)(int);
  *   typedef char * (*fn_output_outer_t)(fn_input_t);
- *   typedef const fn_output_outer_t (* fn_output_inner_t)();
+ *   typedef const fn_output_outer_t (* fn_output_inner_t)(void);
  *   typedef const fn_output_inner_t fn_ptr_arr2_t[5];
  */
 /* ----- START-EXPECTED-OUTPUT ----- */
@@ -94,7 +94,7 @@ typedef void (* (*signal_t)(int, void (*)(int)))(int);
 
 typedef char * (*fn_ptr_arr1_t[10])(int **);
 
-typedef char * (* (* const fn_ptr_arr2_t[5])())(char * (*)(int));
+typedef char * (* (* const fn_ptr_arr2_t[5])(void))(char * (*)(int));
 
 struct struct_w_typedefs {
 	int_t a;
diff --git a/tools/testing/selftests/bpf/test_sockmap.c b/tools/testing/selftests/bpf/test_sockmap.c
index d56f521b8aaa..25da05cad8f6 100644
--- a/tools/testing/selftests/bpf/test_sockmap.c
+++ b/tools/testing/selftests/bpf/test_sockmap.c
@@ -63,7 +63,7 @@ int passed;
 int failed;
 int map_fd[9];
 struct bpf_map *maps[9];
-int prog_fd[11];
+int prog_fd[9];
 
 int txmsg_pass;
 int txmsg_redir;
@@ -680,7 +680,8 @@ static int msg_loop(int fd, int iov_count, int iov_length, int cnt,
 				}
 			}
 
-			s->bytes_recvd += recv;
+			if (recv > 0)
+				s->bytes_recvd += recv;
 
 			if (opt->check_recved_len && s->bytes_recvd > total_bytes) {
 				errno = EMSGSIZE;
@@ -1775,8 +1776,6 @@ int prog_attach_type[] = {
 	BPF_SK_MSG_VERDICT,
 	BPF_SK_MSG_VERDICT,
 	BPF_SK_MSG_VERDICT,
-	BPF_SK_MSG_VERDICT,
-	BPF_SK_MSG_VERDICT,
 };
 
 int prog_type[] = {
@@ -1789,8 +1788,6 @@ int prog_type[] = {
 	BPF_PROG_TYPE_SK_MSG,
 	BPF_PROG_TYPE_SK_MSG,
 	BPF_PROG_TYPE_SK_MSG,
-	BPF_PROG_TYPE_SK_MSG,
-	BPF_PROG_TYPE_SK_MSG,
 };
 
 static int populate_progs(char *bpf_file)
diff --git a/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh b/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
index 616d3581419c..21d0f419cc6d 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
@@ -11,7 +11,7 @@ ALL_TESTS="single_mask_test identical_filters_test two_masks_test \
 	multiple_masks_test ctcam_edge_cases_test delta_simple_test \
 	delta_two_masks_one_key_test delta_simple_rehash_test \
 	bloom_simple_test bloom_complex_test bloom_delta_test \
-	max_erp_entries_test max_group_size_test"
+	max_erp_entries_test max_group_size_test collision_test"
 NUM_NETIFS=2
 source $lib_dir/lib.sh
 source $lib_dir/tc_common.sh
@@ -457,7 +457,7 @@ delta_two_masks_one_key_test()
 {
 	# If 2 keys are the same and only differ in mask in a way that
 	# they belong under the same ERP (second is delta of the first),
-	# there should be no C-TCAM spill.
+	# there should be C-TCAM spill.
 
 	RET=0
 
@@ -474,8 +474,8 @@ delta_two_masks_one_key_test()
 	tp_record "mlxsw:*" "tc filter add dev $h2 ingress protocol ip \
 		   pref 2 handle 102 flower $tcflags dst_ip 192.0.2.2 \
 		   action drop"
-	tp_check_hits "mlxsw:mlxsw_sp_acl_atcam_entry_add_ctcam_spill" 0
-	check_err $? "incorrect C-TCAM spill while inserting the second rule"
+	tp_check_hits "mlxsw:mlxsw_sp_acl_atcam_entry_add_ctcam_spill" 1
+	check_err $? "C-TCAM spill did not happen while inserting the second rule"
 
 	$MZ $h1 -c 1 -p 64 -a $h1mac -b $h2mac -A 192.0.2.1 -B 192.0.2.2 \
 		-t ip -q
@@ -1087,6 +1087,53 @@ max_group_size_test()
 	log_test "max ACL group size test ($tcflags). max size $max_size"
 }
 
+collision_test()
+{
+	# Filters cannot share an eRP if in the common unmasked part (i.e.,
+	# without the delta bits) they have the same values. If the driver does
+	# not prevent such configuration (by spilling into the C-TCAM), then
+	# multiple entries will be present in the device with the same key,
+	# leading to collisions and a reduced scale.
+	#
+	# Create such a scenario and make sure all the filters are successfully
+	# added.
+
+	RET=0
+
+	local ret
+
+	if [[ "$tcflags" != "skip_sw" ]]; then
+		return 0;
+	fi
+
+	# Add a single dst_ip/24 filter and multiple dst_ip/32 filters that all
+	# have the same values in the common unmasked part (dst_ip/24).
+
+	tc filter add dev $h2 ingress pref 1 proto ipv4 handle 101 \
+		flower $tcflags dst_ip 198.51.100.0/24 \
+		action drop
+
+	for i in {0..255}; do
+		tc filter add dev $h2 ingress pref 2 proto ipv4 \
+			handle $((102 + i)) \
+			flower $tcflags dst_ip 198.51.100.${i}/32 \
+			action drop
+		ret=$?
+		[[ $ret -ne 0 ]] && break
+	done
+
+	check_err $ret "failed to add all the filters"
+
+	for i in {255..0}; do
+		tc filter del dev $h2 ingress pref 2 proto ipv4 \
+			handle $((102 + i)) flower
+	done
+
+	tc filter del dev $h2 ingress pref 1 proto ipv4 handle 101 flower
+
+	log_test "collision test ($tcflags)"
+}
+
 setup_prepare()
 {
 	h1=${NETIFS[p1]}
diff --git a/tools/testing/selftests/landlock/base_test.c b/tools/testing/selftests/landlock/base_test.c
index da9290817866..e43831746146 100644
--- a/tools/testing/selftests/landlock/base_test.c
+++ b/tools/testing/selftests/landlock/base_test.c
@@ -9,6 +9,7 @@
 #define _GNU_SOURCE
 #include <errno.h>
 #include <fcntl.h>
+#include <linux/keyctl.h>
 #include <linux/landlock.h>
 #include <string.h>
 #include <sys/prctl.h>
@@ -356,4 +357,77 @@ TEST(ruleset_fd_transfer)
 	ASSERT_EQ(EXIT_SUCCESS, WEXITSTATUS(status));
 }
 
+TEST(cred_transfer)
+{
+	struct landlock_ruleset_attr ruleset_attr = {
+		.handled_access_fs = LANDLOCK_ACCESS_FS_READ_DIR,
+	};
+	int ruleset_fd, dir_fd;
+	pid_t child;
+	int status;
+
+	drop_caps(_metadata);
+
+	dir_fd = open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC);
+	EXPECT_LE(0, dir_fd);
+	EXPECT_EQ(0, close(dir_fd));
+
+	/* Denies opening directories. */
+	ruleset_fd =
+		landlock_create_ruleset(&ruleset_attr, sizeof(ruleset_attr), 0);
+	ASSERT_LE(0, ruleset_fd);
+	EXPECT_EQ(0, prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0));
+	ASSERT_EQ(0, landlock_restrict_self(ruleset_fd, 0));
+	EXPECT_EQ(0, close(ruleset_fd));
+
+	/* Checks ruleset enforcement. */
+	EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+	EXPECT_EQ(EACCES, errno);
+
+	/* Needed for KEYCTL_SESSION_TO_PARENT permission checks */
+	EXPECT_NE(-1, syscall(__NR_keyctl, KEYCTL_JOIN_SESSION_KEYRING, NULL, 0,
+			      0, 0))
+	{
+		TH_LOG("Failed to join session keyring: %s", strerror(errno));
+	}
+
+	child = fork();
+	ASSERT_LE(0, child);
+	if (child == 0) {
+		/* Checks ruleset enforcement. */
+		EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+		EXPECT_EQ(EACCES, errno);
+
+		/*
+		 * KEYCTL_SESSION_TO_PARENT is a no-op unless we have a
+		 * different session keyring in the child, so make that happen.
+		 */
+		EXPECT_NE(-1, syscall(__NR_keyctl, KEYCTL_JOIN_SESSION_KEYRING,
+				      NULL, 0, 0, 0));
+
+		/*
+		 * KEYCTL_SESSION_TO_PARENT installs credentials on the parent
+		 * that never go through the cred_prepare hook, this path uses
+		 * cred_transfer instead.
+		 */
+		EXPECT_EQ(0, syscall(__NR_keyctl, KEYCTL_SESSION_TO_PARENT, 0,
+				     0, 0, 0));
+
+		/* Re-checks ruleset enforcement. */
+		EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+		EXPECT_EQ(EACCES, errno);
+
+		_exit(_metadata->passed ? EXIT_SUCCESS : EXIT_FAILURE);
+		return;
+	}
+
+	EXPECT_EQ(child, waitpid(child, &status, 0));
+	EXPECT_EQ(1, WIFEXITED(status));
+	EXPECT_EQ(EXIT_SUCCESS, WEXITSTATUS(status));
+
+	/* Re-checks ruleset enforcement. */
+	EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+	EXPECT_EQ(EACCES, errno);
+}
+
 TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/landlock/config b/tools/testing/selftests/landlock/config
index 0f0a65287bac..177f4878bdf3 100644
--- a/tools/testing/selftests/landlock/config
+++ b/tools/testing/selftests/landlock/config
@@ -1,7 +1,8 @@
+CONFIG_KEYS=y
 CONFIG_OVERLAY_FS=y
+CONFIG_SECURITY=y
 CONFIG_SECURITY_LANDLOCK=y
 CONFIG_SECURITY_PATH=y
-CONFIG_SECURITY=y
 CONFIG_SHMEM=y
-CONFIG_TMPFS_XATTR=y
 CONFIG_TMPFS=y
+CONFIG_TMPFS_XATTR=y
diff --git a/tools/testing/selftests/net/fib_tests.sh b/tools/testing/selftests/net/fib_tests.sh
index e5db2a2a67df..26f30c6fa0f2 100755
--- a/tools/testing/selftests/net/fib_tests.sh
+++ b/tools/testing/selftests/net/fib_tests.sh
@@ -1485,53 +1485,53 @@ ipv4_rt_dsfield()
 
 	# DSCP 0x10 should match the specific route, no matter the ECN bits
 	$IP route get fibmatch 172.16.102.1 dsfield 0x10 | \
-		grep -q "via 172.16.103.2"
+		grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
 	log_test $? 0 "IPv4 route with DSCP and ECN:Not-ECT"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x11 | \
-		grep -q "via 172.16.103.2"
+		grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
 	log_test $? 0 "IPv4 route with DSCP and ECN:ECT(1)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x12 | \
-		grep -q "via 172.16.103.2"
+		grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
 	log_test $? 0 "IPv4 route with DSCP and ECN:ECT(0)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x13 | \
-		grep -q "via 172.16.103.2"
+		grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
 	log_test $? 0 "IPv4 route with DSCP and ECN:CE"
 
 	# Unknown DSCP should match the generic route, no matter the ECN bits
 	$IP route get fibmatch 172.16.102.1 dsfield 0x14 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with unknown DSCP and ECN:Not-ECT"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x15 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with unknown DSCP and ECN:ECT(1)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x16 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with unknown DSCP and ECN:ECT(0)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x17 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with unknown DSCP and ECN:CE"
 
 	# Null DSCP should match the generic route, no matter the ECN bits
 	$IP route get fibmatch 172.16.102.1 dsfield 0x00 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with no DSCP and ECN:Not-ECT"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x01 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with no DSCP and ECN:ECT(1)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x02 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with no DSCP and ECN:ECT(0)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x03 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with no DSCP and ECN:CE"
 }
 
diff --git a/tools/testing/selftests/net/forwarding/devlink_lib.sh b/tools/testing/selftests/net/forwarding/devlink_lib.sh
index 601990c6881b..4c555fab9e75 100644
--- a/tools/testing/selftests/net/forwarding/devlink_lib.sh
+++ b/tools/testing/selftests/net/forwarding/devlink_lib.sh
@@ -122,6 +122,8 @@ devlink_reload()
 	still_pending=$(devlink resource show "$DEVLINK_DEV" | \
 			grep -c "size_new")
 	check_err $still_pending "Failed reload - There are still unset sizes"
+
+	udevadm settle
 }
 
 declare -A DEVLINK_ORIG
diff --git a/tools/testing/selftests/sigaltstack/current_stack_pointer.h b/tools/testing/selftests/sigaltstack/current_stack_pointer.h
index ea9bdf3a90b1..09da8f1011ce 100644
--- a/tools/testing/selftests/sigaltstack/current_stack_pointer.h
+++ b/tools/testing/selftests/sigaltstack/current_stack_pointer.h
@@ -8,7 +8,7 @@ register unsigned long sp asm("sp");
 register unsigned long sp asm("esp");
 #elif __loongarch64
 register unsigned long sp asm("$sp");
-#elif __ppc__
+#elif __powerpc__
 register unsigned long sp asm("r1");
 #elif __s390x__
 register unsigned long sp asm("%15");

^ permalink raw reply	[flat|nested] 2+ messages in thread

end of thread, other threads:[~2024-08-03  7:06 UTC | newest]

Thread overview: 2+ messages (download: mbox.gz / follow: Atom feed)
-- links below jump to the message on this page --
2024-08-03  7:05 Linux 6.1.103 Greg Kroah-Hartman
2024-08-03  7:05 ` Greg Kroah-Hartman

This is a public inbox, see mirroring instructions
for how to clone and mirror all data and code used for this inbox

all inboxes | Powered by JetHome®